Fix clippy warning

Helpful in scenarios where you want to disambiguate people based on
their user id at a glance.

.github/workflows/build.yml

@@ -0,0 +1,75 @@
+# What software is installed by default:
+# https://docs.github.com/en/actions/using-github-hosted-runners/using-github-hosted-runners/about-github-hosted-runners#supported-runners-and-hardware-resources
+
+name: build
+
+on:
+  push:
+  pull_request:
+
+defaults:
+  run:
+    shell: bash
+
+jobs:
+  build:
+    strategy:
+      matrix:
+        os:
+          - ubuntu-22.04
+          - windows-latest
+          - macos-latest
+          - macos-13
+    runs-on: ${{ matrix.os }}
+    steps:
+      - name: Check out repo
+        uses: actions/checkout@v4
+
+      - name: Set up rust
+        run: rustup update
+
+      - name: Build
+        run: cargo build --release
+
+      - name: Test
+        run: cargo test --release
+
+      - name: Record target triple
+        run: rustc -vV | awk '/^host/ { print $2 }' > target/release/host
+
+      - name: Upload
+        uses: actions/upload-artifact@v4
+        with:
+          name: cove-${{ matrix.os }}
+          path: |
+            target/release/cove
+            target/release/cove.exe
+            target/release/host
+
+  release:
+    runs-on: ubuntu-latest
+    if: ${{ startsWith(github.ref, 'refs/tags/v') }}
+    needs:
+      - build
+    permissions:
+      contents: write
+    steps:
+      - name: Download artifacts
+        uses: actions/download-artifact@v4
+
+      - name: Zip artifacts
+        run: |
+          chmod +x cove-ubuntu-22.04/cove
+          chmod +x cove-windows-latest/cove.exe
+          chmod +x cove-macos-latest/cove
+          chmod +x cove-macos-13/cove
+          zip -jr "cove-$(cat cove-ubuntu-22.04/host).zip"  cove-ubuntu-22.04/cove
+          zip -jr "cove-$(cat cove-windows-latest/host).zip" cove-windows-latest/cove.exe
+          zip -jr "cove-$(cat cove-macos-latest/host).zip"   cove-macos-latest/cove
+          zip -jr "cove-$(cat cove-macos-13/host).zip"       cove-macos-13/cove
+
+      - name: Create new release
+        uses: softprops/action-gh-release@v2
+        with:
+          body: Automated release, see [CHANGELOG.md](CHANGELOG.md) for more details.
+          files: "*.zip"

.vscode/settings.json

@@ -2,7 +2,7 @@
     "files.insertFinalNewline": true,
     "rust-analyzer.cargo.features": "all",
     "rust-analyzer.imports.granularity.enforce": true,
-    "rust-analyzer.imports.granularity.group": "module",
+    "rust-analyzer.imports.granularity.group": "crate",
     "rust-analyzer.imports.group.enable": true,
     "evenBetterToml.formatter.columnWidth": 100,
 }

CHANGELOG.md

@@ -4,28 +4,168 @@ All notable changes to this project will be documented in this file.
 The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/).
 
 Procedure when bumping the version number:
+
 1. Update dependencies in a separate commit
 2. Set version number in `Cargo.toml`
 3. Add new section in this changelog
-4. Commit with message `Bump version to X.Y.Z`
-5. Create tag named `vX.Y.Z`
-6. Fast-forward branch `latest`
-7. Push `master`, `latest` and the new tag
+4. Run `cargo run help-config > CONFIG.md`
+5. Commit with message `Bump version to X.Y.Z`
+6. Create tag named `vX.Y.Z`
+7. Push `master` and the new tag
 
 ## Unreleased
 
+### Changed
+
+- Display emoji user id hashes in the nick list
+- Compile linux binary with older glibc version
+
+## v0.9.3 - 2025-05-31
+
+### Added
+
+- Key bindings for emoji-based user id hashing
+
+### Fixed
+
+- `keys.rooms.action.connect_autojoin` connecting to non-autojoin rooms
+
+## v0.9.2 - 2025-03-14
+
+### Added
+
+- `bell_on_mention` config option
+
+## v0.9.1 - 2025-03-01
+
+### Fixed
+
+- Rendering glitches with unicode-based width estimation
+
+## v0.9.0 - 2025-02-23
+
+### Added
+
+- Unicode-based grapheme width estimation method
+  - `width_estimation_method` config option
+  - `--width-estimation-method` option
+- Room links are now included in the `I` message links list
+
+### Changed
+
+- Updated documentation for `time_zone` config option
+- When connecting to a room using `n` in the room list, the cursor now moves to that room
+- Updated list of emoji names
+
+### Removed
+
+- Special handling of &rl2dev
+
+### Fixed
+
+- Nick color in rare edge cases
+- Message link list rendering bug
+
+## v0.8.3 - 2024-05-20
+
+### Changed
+
+- Updated list of emoji names
+
+## v0.8.2 - 2024-04-25
+
+### Changed
+
+- Renamed `json-stream` export format to `json-lines` (see <https://jsonlines.org/>)
+- Changed `json-lines` file extension from `.json` to `.jsonl`
+
+### Fixed
+
+- Crash when window is too small while empty message editor is visible
+- Mistakes in output and docs
+- Cove not cleaning up terminal state properly
+
+## v0.8.1 - 2024-01-11
+
+### Added
+
+- Support for setting window title
+- More information to room list heading
+- Key bindings for live caesar cipher de- and encoding
+
+### Removed
+
+- Key binding to open present page
+
+## v0.8.0 - 2024-01-04
+
+### Added
+
+- Support for multiple euph server domains
+- Support for `TZ` environment variable
+- `time_zone` config option
+- `--domain` option to `cove export` command
+- `--domain` option to `cove clear-cookies` command
+- Domain field to "connect to new room" popup
+- Welcome info box next to room list
+
+### Changed
+
+- The default euph domain is now https://euphoria.leet.nu/ everywhere
+- The config file format was changed to support multiple euph servers with different domains.
+  Options previously located at `euph.rooms.*` should be reviewed and moved to `euph.servers."euphoria.leet.nu".rooms.*`.
+- Tweaked F1 popup
+- Tweaked chat message editor when nick list is foused
+- Reduced connection timeout from 30 seconds to 10 seconds
+
+### Fixed
+
+- Room deletion popup accepting any room name
+- Duplicated key presses on Windows
+
+## v0.7.1 - 2023-08-31
+
+### Changed
+
+- Updated dependencies
+
+## v0.7.0 - 2023-05-14
+
+### Added
+
+- Auto-generated config documentation
+  - in [CONFIG.md](CONFIG.md)
+  - via `help-config` CLI command
+- `keys.*` config options
+- `measure_widths` config option
+
+### Changed
+
+- Overhauled widget system and extracted generic widgets to [toss](https://github.com/Garmelon/toss)
+- Overhauled config system to support auto-generating documentation
+- Overhauled key binding system to make key bindings configurable
+- Redesigned F1 popup. It can now be toggled with F1 like the F12 log
+- The F12 log can now be closed with escape
+- Some more small UI fixes and adjustments to the new key binding system
+- Reduced tearing when redrawing screen
+- Split up project into sub-crates
+- Simplified flake dependencies
+
 ## v0.6.1 - 2023-04-10
 
 ### Changed
+
 - Improved JSON export performance
 - Always show rooms from config file in room list
 
 ### Fixed
+
 - Rooms reconnecting instead of showing error popups
 
 ## v0.6.0 - 2023-04-04
 
 ### Added
+
 - Emoji support
 - `flake.nix`, making cove available as a nix flake
 - `json-stream` room export format
@@ -33,31 +173,37 @@ Procedure when bumping the version number:
 - `--verbose` flag
 
 ### Changed
+
 - Non-export info is now printed to stderr instead of stdout
-- Recognizes links without scheme (e. g. `euphoria.io` instead of `https://euphoria.io`)
+- Recognizes links without scheme (e.g. `euphoria.io` instead of `https://euphoria.io`)
 - Rooms waiting for reconnect are no longer sorted to bottom in default sort order
 
 ### Fixed
+
 - Mentions not being stopped by `>`
 
 ## v0.5.2 - 2023-01-14
 
 ### Added
+
 - Key binding to open present page
 
 ### Changed
+
 - Always connect to &rl2dev in ephemeral mode
 - Reduce amount of messages per &rl2dev log request
 
 ## v0.5.1 - 2022-11-27
 
 ### Changed
+
 - Increase reconnect delay to one minute
 - Print errors that occurred while cove was running more compactly
 
 ## v0.5.0 - 2022-09-26
 
 ### Added
+
 - Key bindings to navigate nick list
 - Room deletion confirmation popup
 - Message inspection popup
@@ -66,10 +212,12 @@ Procedure when bumping the version number:
 - `rooms_sort_order` config option
 
 ### Changed
+
 - Use nick changes to detect sessions for nick list
 - Support Unicode 15
 
 ### Fixed
+
 - Cursor being visible through popups
 - Cursor in lists when highlighted item moves off-screen
 - User disappearing from nick list when only one of their sessions disconnects
@@ -77,6 +225,7 @@ Procedure when bumping the version number:
 ## v0.4.0 - 2022-09-01
 
 ### Added
+
 - Config file and `--config` cli option
 - `data_dir` config option
 - `ephemeral` config option
@@ -92,14 +241,17 @@ Procedure when bumping the version number:
 - Key bindings to view and open links in a message
 
 ### Changed
+
 - Some key bindings in the rooms list
 
 ### Fixed
+
 - Rooms being stuck in "Connecting" state
 
 ## v0.3.0 - 2022-08-22
 
 ### Added
+
 - Account login and logout
 - Authentication dialog for password-protected rooms
 - Error popups in rooms when something goes wrong
@@ -107,10 +259,12 @@ Procedure when bumping the version number:
 - Key binding to download more logs
 
 ### Changed
+
 - Reduced amount of unnecessary redraws
 - Description of `export` CLI command
 
 ### Fixed
+
 - Crash when connecting to nonexistent rooms
 - Crash when connecting to rooms that require authentication
 - Pasting multi-line strings into the editor
@@ -118,15 +272,18 @@ Procedure when bumping the version number:
 ## v0.2.1 - 2022-08-11
 
 ### Added
+
 - Support for modifiers on special keys via the [kitty keyboard protocol](https://sw.kovidgoyal.net/kitty/keyboard-protocol/)
 
 ### Fixed
+
 - Joining new rooms no longer crashes cove
 - Scrolling when exiting message editor
 
 ## v0.2.0 - 2022-08-10
 
 ### Added
+
 - New messages are now marked as unseen
 - Sub-trees can now be folded
 - Support for pasting text into editors
@@ -139,10 +296,12 @@ Procedure when bumping the version number:
 - Support for exporting multiple/all rooms at once
 
 ### Changed
+
 - Reorganized export command
 - Slowed down room history download speed
 
 ### Fixed
+
 - Chat rendering when deleting and re-joining a room
 - Spacing in some popups
 

CONFIG.md

@@ -0,0 +1,711 @@
+# Config file format
+
+Cove's config file uses the [TOML](https://toml.io/) format.
+
+Here is an example config that changes a few different options:
+
+```toml
+measure_widths = true
+rooms_sort_order = "importance"
+
+[euph.servers."euphoria.leet.nu".rooms]
+welcome.autojoin = true
+test.username = "badingle"
+test.force_username = true
+private.password = "foobar"
+
+[keys]
+general.abort = ["esc", "ctrl+c"]
+general.exit = "ctrl+q"
+tree.action.fold_tree = "f"
+```
+
+## Key bindings
+
+Key bindings are specified as strings or lists of strings. Each string specifies
+a main key and zero or more modifier keys. The modifier keys (if any) are listed
+first, followed by the main key. They are separated by the `+` character and
+**no** whitespace.
+
+Examples of key bindings:
+- `"ctrl+c"`
+- `"X"` (not `"shift+x"`)
+- `"space"` or `" "` (both space bar)
+- `["g", "home"]`
+- `["K", "ctrl+up"]`
+- `["f1", "?"]`
+- `"ctrl+alt+f3"`
+- `["enter", "any+enter"]` (matches `enter` regardless of modifiers)
+
+Available main keys:
+- Any single character that can be typed
+- `esc`, `enter`, `space`, `tab`, `backtab`
+- `backspace`, `delete`, `insert`
+- `left`, `right`, `up`, `down`
+- `home`, `end`, `pageup`, `pagedown`
+- `f1`, `f2`, ...
+
+Available modifiers:
+- `shift` (must not be used with single characters)
+- `ctrl`
+- `alt`
+- `any` (matches as long as at least one modifier is pressed)
+
+## Available options
+
+### `bell_on_mention`
+
+**Required:** yes  
+**Type:** boolean  
+**Default:** `false`
+
+Ring the bell (character 0x07) when you are mentioned in a room.
+
+### `data_dir`
+
+**Required:** no  
+**Type:** path  
+**Default:** platform-dependent
+
+The directory that cove stores its data in when not running in ephemeral
+mode.
+
+Relative paths are interpreted relative to the user's home directory.
+
+See also the `--data-dir` command line option.
+
+### `ephemeral`
+
+**Required:** yes  
+**Type:** boolean  
+**Default:** `false`
+
+Whether to start in ephemeral mode.
+
+In ephemeral mode, cove doesn't store any data. It completely ignores
+any options related to the data dir.
+
+See also the `--ephemeral` command line option.
+
+### `euph.servers.<domain>.rooms.<room>.autojoin`
+
+**Required:** yes  
+**Type:** boolean  
+**Default:** `false`
+
+Whether to automatically join this room on startup.
+
+### `euph.servers.<domain>.rooms.<room>.force_username`
+
+**Required:** yes  
+**Type:** boolean  
+**Default:** `false`
+
+If `euph.servers.<domain>.rooms.<room>.username` is set, this will force
+cove to set the username even if there is already a different username
+associated with the current session.
+
+### `euph.servers.<domain>.rooms.<room>.password`
+
+**Required:** no  
+**Type:** string
+
+If set, cove will try once to use this password to authenticate, should
+the room be password-protected.
+
+### `euph.servers.<domain>.rooms.<room>.username`
+
+**Required:** no  
+**Type:** string
+
+If set, cove will set this username upon joining if there is no username
+associated with the current session.
+
+### `keys.cursor.down`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["j", "down"]`
+
+Move down.
+
+### `keys.cursor.to_bottom`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["G", "end"]`
+
+Move to bottom.
+
+### `keys.cursor.to_top`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["g", "home"]`
+
+Move to top.
+
+### `keys.cursor.up`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["k", "up"]`
+
+Move up.
+
+### `keys.editor.action.backspace`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+h", "backspace"]`
+
+Delete before cursor.
+
+### `keys.editor.action.clear`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+l"`
+
+Clear editor contents.
+
+### `keys.editor.action.delete`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+d", "delete"]`
+
+Delete after cursor.
+
+### `keys.editor.action.external`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+x", "alt+e"]`
+
+Edit in external editor.
+
+### `keys.editor.cursor.down`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"down"`
+
+Move down.
+
+### `keys.editor.cursor.end`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+e", "end"]`
+
+Move to end of line.
+
+### `keys.editor.cursor.left`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+b", "left"]`
+
+Move left.
+
+### `keys.editor.cursor.left_word`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["alt+b", "ctrl+left"]`
+
+Move left a word.
+
+### `keys.editor.cursor.right`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+f", "right"]`
+
+Move right.
+
+### `keys.editor.cursor.right_word`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["alt+f", "ctrl+right"]`
+
+Move right a word.
+
+### `keys.editor.cursor.start`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+a", "home"]`
+
+Move to start of line.
+
+### `keys.editor.cursor.up`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"up"`
+
+Move up.
+
+### `keys.general.abort`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"esc"`
+
+Abort/close.
+
+### `keys.general.confirm`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"enter"`
+
+Confirm.
+
+### `keys.general.exit`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+c"`
+
+Quit cove.
+
+### `keys.general.focus`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"tab"`
+
+Advance focus.
+
+### `keys.general.help`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"f1"`
+
+Show this help.
+
+### `keys.general.log`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"f12"`
+
+Show log.
+
+### `keys.room.action.account`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"A"`
+
+Manage account.
+
+### `keys.room.action.authenticate`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"a"`
+
+Authenticate.
+
+### `keys.room.action.more_messages`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"m"`
+
+Download more messages.
+
+### `keys.room.action.nick`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"n"`
+
+Change nick.
+
+### `keys.rooms.action.change_sort_order`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"s"`
+
+Change sort order.
+
+### `keys.rooms.action.connect`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"c"`
+
+Connect to selected room.
+
+### `keys.rooms.action.connect_all`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"C"`
+
+Connect to all rooms.
+
+### `keys.rooms.action.connect_autojoin`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"a"`
+
+Connect to all autojoin rooms.
+
+### `keys.rooms.action.delete`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"X"`
+
+Delete room.
+
+### `keys.rooms.action.disconnect`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"d"`
+
+Disconnect from selected room.
+
+### `keys.rooms.action.disconnect_all`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"D"`
+
+Disconnect from all rooms.
+
+### `keys.rooms.action.disconnect_non_autojoin`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"A"`
+
+Disconnect from all non-autojoin rooms.
+
+### `keys.rooms.action.new`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"n"`
+
+Connect to new room.
+
+### `keys.scroll.center_cursor`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"z"`
+
+Center cursor.
+
+### `keys.scroll.down_full`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+f", "pagedown"]`
+
+Scroll down a full screen.
+
+### `keys.scroll.down_half`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+d"`
+
+Scroll down half a screen.
+
+### `keys.scroll.down_line`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+e"`
+
+Scroll down one line.
+
+### `keys.scroll.up_full`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["ctrl+b", "pageup"]`
+
+Scroll up a full screen.
+
+### `keys.scroll.up_half`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+u"`
+
+Scroll up half a screen.
+
+### `keys.scroll.up_line`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+y"`
+
+Scroll up one line.
+
+### `keys.tree.action.decrease_caesar`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"C"`
+
+Decrease caesar cipher rotation.
+
+### `keys.tree.action.fold_tree`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"space"`
+
+Fold current message's subtree.
+
+### `keys.tree.action.increase_caesar`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"c"`
+
+Increase caesar cipher rotation.
+
+### `keys.tree.action.inspect`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"i"`
+
+Inspect selected element.
+
+### `keys.tree.action.links`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"I"`
+
+List links found in message.
+
+### `keys.tree.action.mark_older_seen`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"ctrl+s"`
+
+Mark all older messages as seen.
+
+### `keys.tree.action.mark_visible_seen`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"S"`
+
+Mark all visible messages as seen.
+
+### `keys.tree.action.new_thread`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"t"`
+
+Start a new thread.
+
+### `keys.tree.action.reply`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"r"`
+
+Reply to message, inline if possible.
+
+### `keys.tree.action.reply_alternate`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"R"`
+
+Reply opposite to normal reply.
+
+### `keys.tree.action.toggle_nick_emoji`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"e"`
+
+Toggle agent id based nick emoji.
+
+### `keys.tree.action.toggle_seen`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"s"`
+
+Toggle current message's seen status.
+
+### `keys.tree.cursor.to_above_sibling`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["K", "ctrl+up"]`
+
+Move to above sibling.
+
+### `keys.tree.cursor.to_below_sibling`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["J", "ctrl+down"]`
+
+Move to below sibling.
+
+### `keys.tree.cursor.to_newer_message`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["l", "right"]`
+
+Move to newer message.
+
+### `keys.tree.cursor.to_newer_unseen_message`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["L", "ctrl+right"]`
+
+Move to newer unseen message.
+
+### `keys.tree.cursor.to_older_message`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["h", "left"]`
+
+Move to older message.
+
+### `keys.tree.cursor.to_older_unseen_message`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `["H", "ctrl+left"]`
+
+Move to older unseen message.
+
+### `keys.tree.cursor.to_parent`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"p"`
+
+Move to parent.
+
+### `keys.tree.cursor.to_root`
+
+**Required:** yes  
+**Type:** key binding  
+**Default:** `"P"`
+
+Move to root.
+
+### `measure_widths`
+
+**Required:** yes  
+**Type:** boolean  
+**Default:** `false`
+
+Whether to measure the width of graphemes (i.e. characters) as displayed
+by the terminal emulator instead of estimating the width.
+
+Enabling this makes rendering a bit slower but more accurate. The screen
+might also flash when encountering new graphemes.
+
+See also the `--measure-widths` command line option.
+
+### `offline`
+
+**Required:** yes  
+**Type:** boolean  
+**Default:** `false`
+
+Whether to start in offline mode.
+
+In offline mode, cove won't automatically join rooms marked via the
+`autojoin` option on startup. You can still join those rooms manually by
+pressing `a` in the rooms list.
+
+See also the `--offline` command line option.
+
+### `rooms_sort_order`
+
+**Required:** yes  
+**Type:** string  
+**Values:** `"alphabet"`, `"importance"`  
+**Default:** `"alphabet"`
+
+Initial sort order of rooms list.
+
+`"alphabet"` sorts rooms in alphabetic order.
+
+`"importance"` sorts rooms by the following criteria (in descending
+order of priority):
+
+1. connected rooms before unconnected rooms
+2. rooms with unread messages before rooms without
+3. alphabetic order
+
+### `time_zone`
+
+**Required:** no  
+**Type:** string  
+**Default:** `$TZ` or local system time zone
+
+Time zone that chat timestamps should be displayed in.
+
+This option can either be the string `"localtime"`, a [POSIX TZ string],
+or a [tz identifier] from the [tz database].
+
+When not set or when set to `"localtime"`, cove attempts to use your
+system's configured time zone, falling back to UTC.
+
+When the string begins with a colon or doesn't match the a POSIX TZ
+string format, it is interpreted as a tz identifier and looked up in
+your system's tz database (or a bundled tz database on Windows).
+
+If the `TZ` environment variable exists, it overrides this option.
+
+[POSIX TZ string]: https://pubs.opengroup.org/onlinepubs/9699919799/basedefs/V1_chap08.html#tag_08_03
+[tz identifier]: https://en.wikipedia.org/wiki/List_of_tz_database_time_zones
+[tz database]: https://en.wikipedia.org/wiki/Tz_database
+
+### `width_estimation_method`
+
+**Required:** yes  
+**Type:** string  
+**Values:** `"legacy"`, `"unicode"`  
+**Default:** `"legacy"`
+
+How to estimate the width of graphemes (i.e. characters) as displayed by
+the terminal emulator.
+
+`"legacy"`: Use a legacy method that should mostly work on most terminal
+emulators. This method will never be correct in all cases since every
+terminal emulator handles grapheme widths slightly differently. However,
+those cases are usually rare (unless you view a lot of emoji).
+
+`"unicode"`: Use the unicode standard in a best-effort manner to
+determine grapheme widths. Some terminals (e.g. ghostty) can make use of
+this.
+
+This method is used when `measure_widths` is set to `false`.
+
+See also the `--width-estimation-method` command line option.

Cargo.toml

@@ -1,57 +1,72 @@
-[package]
-name = "cove"
-version = "0.6.1"
-edition = "2021"
+[workspace]
+resolver = "3"
+members = ["cove", "cove-*"]
 
-[dependencies]
-anyhow = "1.0.70"
-async-trait = "0.1.68"
-clap = { version = "4.2.1", features = ["derive", "deprecated"] }
-cookie = "0.17.0"
-crossterm = "0.26.1"
-directories = "5.0.0"
-edit = "0.1.4"
-linkify = "0.9.0"
-log = { version = "0.4.17", features = ["std"] }
-once_cell = "1.17.1"
-open = "4.0.1"
-parking_lot = "0.12.1"
-rusqlite = { version = "0.28.0", features = ["bundled", "time"] }
-serde = { version = "1.0.159", features = ["derive"] }
-serde_json = "1.0.95"
-thiserror = "1.0.40"
-tokio = { version = "1.27.0", features = ["full"] }
-toml = "0.7.3"
-unicode-segmentation = "1.10.1"
-unicode-width = "0.1.10"
+[workspace.package]
+version = "0.9.3"
+edition = "2024"
 
-[dependencies.time]
-version = "0.3.20"
-features = ["macros", "formatting", "parsing", "serde"]
+[workspace.dependencies]
+anyhow = "1.0.97"
+async-trait = "0.1.87"
+clap = { version = "4.5.32", features = ["derive", "deprecated"] }
+cookie = "0.18.1"
+crossterm = "0.28.1"
+directories = "6.0.0"
+edit = "0.1.5"
+jiff = "0.2.4"
+linkify = "0.10.0"
+log = { version = "0.4.26", features = ["std"] }
+open = "5.3.2"
+parking_lot = "0.12.3"
+proc-macro2 = "1.0.94"
+quote = "1.0.40"
+rusqlite = { version = "0.31.0", features = ["bundled", "time"] }
+rustls = "0.23.23"
+serde = { version = "1.0.219", features = ["derive"] }
+serde_either = "0.2.1"
+serde_json = "1.0.140"
+syn = "2.0.100"
+thiserror = "2.0.12"
+tokio = { version = "1.44.1", features = ["full"] }
+toml = "0.8.20"
+unicode-width = "0.2.0"
 
-[dependencies.tokio-tungstenite]
-version = "0.18.0"
-features = ["rustls-tls-native-roots"]
-
-[dependencies.euphoxide]
+[workspace.dependencies.euphoxide]
 git = "https://github.com/Garmelon/euphoxide.git"
-rev = "0f217a6279181b0731216760219e8ff0fa01e449"
+tag = "v0.6.1"
 features = ["bot"]
 
-# [patch."https://github.com/Garmelon/euphoxide.git"]
-# euphoxide = { path = "../euphoxide/" }
-
-[dependencies.toss]
+[workspace.dependencies.toss]
 git = "https://github.com/Garmelon/toss.git"
-rev = "0d59116012a51516a821991e2969b1cf4779770f"
+tag = "v0.3.4"
 
-# [patch."https://github.com/Garmelon/toss.git"]
-# toss = { path = "../toss/" }
-
-[dependencies.vault]
+[workspace.dependencies.vault]
 git = "https://github.com/Garmelon/vault.git"
-tag = "v0.1.0"
+tag = "v0.4.0"
 features = ["tokio"]
 
-# [patch."https://github.com/Garmelon/vault.git"]
-# vault = { path = "../vault/" }
+[workspace.lints]
+rust.unsafe_code = { level = "forbid", priority = 1 }
+# Lint groups
+rust.deprecated_safe = "warn"
+rust.future_incompatible = "warn"
+rust.keyword_idents = "warn"
+rust.rust_2018_idioms = "warn"
+rust.unused = "warn"
+# Individual lints
+rust.non_local_definitions = "warn"
+rust.redundant_imports = "warn"
+rust.redundant_lifetimes = "warn"
+rust.single_use_lifetimes = "warn"
+rust.unit_bindings = "warn"
+rust.unnameable_types = "warn"
+rust.unused_crate_dependencies = "warn"
+rust.unused_import_braces = "warn"
+rust.unused_lifetimes = "warn"
+rust.unused_qualifications = "warn"
+# Clippy
+clippy.use_self = "warn"
+
+[profile.dev.package."*"]
+opt-level = 3

README.md

@@ -1,11 +1,16 @@
 # cove
 
-Cove is a TUI client for [euphoria.io](https://euphoria.io/), a threaded
+Cove is a TUI client for [euphoria.leet.nu](https://euphoria.leet.nu/), a threaded
 real-time chat platform.
 
 ![A very meta screenshot](screenshot.png)
 
-It runs on Linux, Windows and macOS.
+It runs on Linux, Windows, and macOS.
+
+## Installing cove
+
+Download a binary of your choice from the
+[latest release on GitHub](https://github.com/Garmelon/cove/releases/latest).
 
 ## Using cove
 
@@ -18,156 +23,11 @@ things in) won't automatically shrink. If it takes up too much space, try
 running `cove gc` and waiting for it to finish. This isn't done automatically
 because it can take quite a while.
 
-## Installation
+## Configuring cove
 
-At this point, cove is not available via any package manager.
-
-Cove is available as a Nix Flake. To try it out, you can use
-```bash
-$ nix run --override-input nixpkgs nixpkgs github:Garmelon/cove/latest
-```
-
-## Manual installation
-
-This section contains instructions on how to install cove by compiling it yourself.
-It doesn't assume you know how to program, but it does assume basic familiarity with the command line on your platform of choice.
-Cove runs in the terminal, after all.
-
-### Installing rustup
-
-Cove is written in Rust, so the first step is to install rustup. Either install
-it from your package manager of choice (if you have one) or use the
-[installer](https://rustup.rs/).
-
-Test your installation by running `rustup --version` and `cargo --version`. If
-rustup is installed correctly, both of these should show a version number.
-
-Cove is designed on the current version of the stable toolchain. If cove doesn't
-compile, you can try switching to the stable toolchain and updating it using the
-following commands:
-```bash
-$ rustup default stable
-$ rustup update
-```
-
-### Installing cove
-
-To install or update to the latest release of cove, run the following command:
-
-```bash
-$ cargo install --force --git https://github.com/Garmelon/cove --branch latest
-```
-
-If you like to live dangerously and want to install or update to the latest,
-bleeding-edge, possibly-broken commit from the repo's main branch, run the
-following command.
-
-**Warning:** This could corrupt your vault. Make sure to make a backup before
-running the command.
-
-```bash
-$ cargo install --force --git https://github.com/Garmelon/cove
-```
-
-To install a specific version of cove, run the following command and substitute
-in the full version you want to install:
-
-```bash
-$ cargo install --force --git https://github.com/Garmelon/cove --tag v0.1.0
-```
-
-## Config file
-
-Cove's config file uses the [TOML](https://toml.io/) format.
+A complete list of config options is available in the [CONFIG.md](CONFIG.md)
+file or via `cove help-config`.
 
 When launched, cove prints the location it is loading its config file from. To
 configure cove, create a config file at that location. This location can be
 changed via the `--config` command line option.
-
-The following is a complete list of available options. If a command line option
-with the same purpose exists, it takes precedence over the option specified in
-the config file.
-
-### `data_dir`
-
-**Type:** String (representing path)  
-**Default:** Platform dependent
-
-The directory that cove stores its data in when not running in ephemeral mode.
-
-Relative paths are interpreted relative to the user's home directory.
-
-See also the `--data-dir` command line option.
-
-### `ephemeral`
-
-**Type:** Boolean  
-**Default:** `false`
-
-Whether to start in ephemeral mode.
-
-In ephemeral mode, cove doesn't store any data. It completely ignores any
-options related to the data dir.
-
-See also the `--ephemeral` command line option.
-
-### `offline`
-
-**Type:** Boolean  
-**Default:** `false`
-
-Whether to start in offline mode.
-
-In offline mode, cove won't automatically join rooms marked via the `autojoin`
-option on startup. You can still join those rooms manually by pressing `a` in
-the rooms list.
-
-See also the `--offline` command line option.
-
-### `rooms_sort_order`
-
-**Type:** String, one of `alphabetic`, `importance`  
-**Default:** `alphabetic`
-
-Initial sort order of rooms list.
-
-`alphabetic` sorts rooms in alphabetic order.
-
-`importance` sorts rooms by the following criteria (in descending order of
-priority):
-
-1. connected rooms before unconnected rooms
-2. rooms with unread messages before rooms without
-3. alphabetic order
-
-### `euph.rooms.<room>.autojoin`
-
-**Type:** Boolean  
-**Default:** `false`
-
-Whether to automatically join this room on startup.
-
-### `euph.rooms.<room>.username`
-
-**Type:** String  
-**Default:** Not set
-
-If set, cove will set this username upon joining if there is no username
-associated with the current session.
-
-### `euph.rooms.<room>.force_username`
-
-**Type:** Boolean  
-**Default:** `false`
-
-If `euph.rooms.<room>.username` is set, this will force cove to set the username
-even if there is already a different username associated with the current
-session.
-
-### `euph.rooms.<room>.password`
-
-**Type:** String  
-**Default:** Not set
-
-If set, cove will try once to use this password to authenticate, should the room
-be password-protected.

cove-config/Cargo.toml

@@ -0,0 +1,15 @@
+[package]
+name = "cove-config"
+version.workspace = true
+edition.workspace = true
+
+[dependencies]
+cove-input = { path = "../cove-input" }
+cove-macro = { path = "../cove-macro" }
+
+serde.workspace = true
+thiserror.workspace = true
+toml.workspace = true
+
+[lints]
+workspace = true

cove-config/src/doc.rs

@@ -0,0 +1,267 @@
+//! Auto-generate markdown documentation.
+
+use std::{collections::HashMap, path::PathBuf};
+
+use cove_input::KeyBinding;
+pub use cove_macro::Document;
+use serde::Serialize;
+
+const MARKDOWN_INTRODUCTION: &str = r#"# Config file format
+
+Cove's config file uses the [TOML](https://toml.io/) format.
+
+Here is an example config that changes a few different options:
+
+```toml
+measure_widths = true
+rooms_sort_order = "importance"
+
+[euph.servers."euphoria.leet.nu".rooms]
+welcome.autojoin = true
+test.username = "badingle"
+test.force_username = true
+private.password = "foobar"
+
+[keys]
+general.abort = ["esc", "ctrl+c"]
+general.exit = "ctrl+q"
+tree.action.fold_tree = "f"
+```
+
+## Key bindings
+
+Key bindings are specified as strings or lists of strings. Each string specifies
+a main key and zero or more modifier keys. The modifier keys (if any) are listed
+first, followed by the main key. They are separated by the `+` character and
+**no** whitespace.
+
+Examples of key bindings:
+- `"ctrl+c"`
+- `"X"` (not `"shift+x"`)
+- `"space"` or `" "` (both space bar)
+- `["g", "home"]`
+- `["K", "ctrl+up"]`
+- `["f1", "?"]`
+- `"ctrl+alt+f3"`
+- `["enter", "any+enter"]` (matches `enter` regardless of modifiers)
+
+Available main keys:
+- Any single character that can be typed
+- `esc`, `enter`, `space`, `tab`, `backtab`
+- `backspace`, `delete`, `insert`
+- `left`, `right`, `up`, `down`
+- `home`, `end`, `pageup`, `pagedown`
+- `f1`, `f2`, ...
+
+Available modifiers:
+- `shift` (must not be used with single characters)
+- `ctrl`
+- `alt`
+- `any` (matches as long as at least one modifier is pressed)
+
+## Available options
+"#;
+
+pub fn toml_value_as_markdown<T: Serialize>(value: &T) -> String {
+    let mut result = String::new();
+    value
+        .serialize(toml::ser::ValueSerializer::new(&mut result))
+        .expect("not a valid toml value");
+    format!("`{result}`")
+}
+
+#[derive(Clone, Default)]
+pub struct ValueInfo {
+    pub required: Option<bool>,
+    pub r#type: Option<String>,
+    pub values: Option<Vec<String>>,
+    pub default: Option<String>,
+}
+
+impl ValueInfo {
+    fn as_markdown(&self) -> String {
+        let mut lines = vec![];
+
+        if let Some(required) = self.required {
+            let yesno = if required { "yes" } else { "no" };
+            lines.push(format!("**Required:** {yesno}"));
+        }
+
+        if let Some(r#type) = &self.r#type {
+            lines.push(format!("**Type:** {type}"));
+        }
+
+        if let Some(values) = &self.values {
+            let values = values.join(", ");
+            lines.push(format!("**Values:** {values}"));
+        }
+
+        if let Some(default) = &self.default {
+            lines.push(format!("**Default:** {default}"));
+        }
+
+        lines.join("  \n")
+    }
+}
+
+#[derive(Clone, Default)]
+pub struct StructInfo {
+    pub fields: HashMap<String, Box<Doc>>,
+}
+
+#[derive(Clone, Default)]
+pub struct WrapInfo {
+    pub inner: Option<Box<Doc>>,
+    pub metavar: Option<String>,
+}
+
+#[derive(Clone, Default)]
+pub struct Doc {
+    pub description: Option<String>,
+
+    pub value_info: ValueInfo,
+    pub struct_info: StructInfo,
+    pub wrap_info: WrapInfo,
+}
+
+struct Entry {
+    path: String,
+    description: String,
+    value_info: ValueInfo,
+}
+
+impl Entry {
+    fn new(description: String, value_info: ValueInfo) -> Self {
+        Self {
+            path: String::new(),
+            description,
+            value_info,
+        }
+    }
+
+    fn with_parent(mut self, segment: String) -> Self {
+        if self.path.is_empty() {
+            self.path = segment;
+        } else {
+            self.path = format!("{segment}.{}", self.path);
+        }
+        self
+    }
+}
+
+impl Doc {
+    fn entries(&self) -> Vec<Entry> {
+        let mut entries = vec![];
+
+        if let Some(description) = &self.description {
+            entries.push(Entry::new(description.clone(), self.value_info.clone()));
+        }
+
+        for (segment, field) in &self.struct_info.fields {
+            entries.extend(
+                field
+                    .entries()
+                    .into_iter()
+                    .map(|entry| entry.with_parent(segment.clone())),
+            );
+        }
+
+        if let Some(inner) = &self.wrap_info.inner {
+            let segment = match &self.wrap_info.metavar {
+                Some(metavar) => format!("<{metavar}>"),
+                None => "<...>".to_string(),
+            };
+            entries.extend(
+                inner
+                    .entries()
+                    .into_iter()
+                    .map(|entry| entry.with_parent(segment.clone())),
+            );
+        }
+
+        entries
+    }
+
+    pub fn as_markdown(&self) -> String {
+        // Print entries in alphabetical order to make generated documentation
+        // format more stable.
+        let mut entries = self.entries();
+        entries.sort_unstable_by(|a, b| a.path.cmp(&b.path));
+
+        let mut result = String::new();
+
+        result.push_str(MARKDOWN_INTRODUCTION);
+
+        for entry in entries {
+            result.push_str(&format!("\n### `{}`\n", entry.path));
+
+            let value_info = entry.value_info.as_markdown();
+            if !value_info.is_empty() {
+                result.push_str(&format!("\n{value_info}\n"));
+            }
+
+            if !entry.description.is_empty() {
+                result.push_str(&format!("\n{}\n", entry.description));
+            }
+        }
+
+        result
+    }
+}
+
+pub trait Document {
+    fn doc() -> Doc;
+}
+
+impl Document for String {
+    fn doc() -> Doc {
+        let mut doc = Doc::default();
+        doc.value_info.required = Some(true);
+        doc.value_info.r#type = Some("string".to_string());
+        doc
+    }
+}
+
+impl Document for bool {
+    fn doc() -> Doc {
+        let mut doc = Doc::default();
+        doc.value_info.required = Some(true);
+        doc.value_info.r#type = Some("boolean".to_string());
+        doc
+    }
+}
+
+impl Document for PathBuf {
+    fn doc() -> Doc {
+        let mut doc = Doc::default();
+        doc.value_info.required = Some(true);
+        doc.value_info.r#type = Some("path".to_string());
+        doc
+    }
+}
+
+impl<I: Document> Document for Option<I> {
+    fn doc() -> Doc {
+        let mut doc = I::doc();
+        assert_eq!(doc.value_info.required, Some(true));
+        doc.value_info.required = Some(false);
+        doc
+    }
+}
+
+impl<I: Document> Document for HashMap<String, I> {
+    fn doc() -> Doc {
+        let mut doc = Doc::default();
+        doc.wrap_info.inner = Some(Box::new(I::doc()));
+        doc
+    }
+}
+
+impl Document for KeyBinding {
+    fn doc() -> Doc {
+        let mut doc = Doc::default();
+        doc.value_info.required = Some(true);
+        doc.value_info.r#type = Some("key binding".to_string());
+        doc
+    }
+}

cove-config/src/euph.rs

@@ -0,0 +1,47 @@
+use std::collections::HashMap;
+
+use serde::{Deserialize, Serialize};
+
+use crate::doc::Document;
+
+#[derive(Debug, Clone, Copy, Default, Serialize, Deserialize, Document)]
+#[serde(rename_all = "snake_case")]
+pub enum RoomsSortOrder {
+    #[default]
+    Alphabet,
+    Importance,
+}
+
+// TODO Mark favourite rooms via printable ascii characters
+#[derive(Debug, Clone, Default, Deserialize, Document)]
+pub struct EuphRoom {
+    /// Whether to automatically join this room on startup.
+    #[serde(default)]
+    pub autojoin: bool,
+
+    /// If set, cove will set this username upon joining if there is no username
+    /// associated with the current session.
+    pub username: Option<String>,
+
+    /// If `euph.servers.<domain>.rooms.<room>.username` is set, this will force
+    /// cove to set the username even if there is already a different username
+    /// associated with the current session.
+    #[serde(default)]
+    pub force_username: bool,
+
+    /// If set, cove will try once to use this password to authenticate, should
+    /// the room be password-protected.
+    pub password: Option<String>,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct EuphServer {
+    #[document(metavar = "room")]
+    pub rooms: HashMap<String, EuphRoom>,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Euph {
+    #[document(metavar = "domain")]
+    pub servers: HashMap<String, EuphServer>,
+}

cove-config/src/keys.rs

@@ -0,0 +1,427 @@
+use cove_input::{KeyBinding, KeyGroup, KeyGroupInfo};
+use serde::Deserialize;
+
+use crate::doc::Document;
+
+macro_rules! default_bindings {
+    ( $(
+        pub mod $mod:ident { $(
+            pub fn $name:ident => [ $($key:expr),* ];
+        )* }
+    )*) => {
+        mod default { $(
+            pub mod $mod { $(
+                pub fn $name() -> ::cove_input::KeyBinding {
+                    ::cove_input::KeyBinding::new().with_keys([ $($key),* ]).unwrap()
+                }
+            )* }
+        )* }
+    };
+}
+
+default_bindings! {
+    pub mod general {
+        pub fn exit => ["ctrl+c"];
+        pub fn abort => ["esc"];
+        pub fn confirm => ["enter"];
+        pub fn focus => ["tab"];
+        pub fn help => ["f1"];
+        pub fn log => ["f12"];
+    }
+
+    pub mod scroll {
+        pub fn up_line => ["ctrl+y"];
+        pub fn down_line => ["ctrl+e"];
+        pub fn up_half => ["ctrl+u"];
+        pub fn down_half => ["ctrl+d"];
+        pub fn up_full => ["ctrl+b", "pageup"];
+        pub fn down_full => ["ctrl+f", "pagedown"];
+        pub fn center_cursor => ["z"];
+    }
+
+    pub mod cursor {
+        pub fn up => ["k", "up"];
+        pub fn down => ["j", "down"];
+        pub fn to_top => ["g", "home"];
+        pub fn to_bottom => ["G", "end"];
+    }
+
+    pub mod editor_cursor {
+        pub fn left => ["ctrl+b","left"];
+        pub fn right => ["ctrl+f", "right"];
+        pub fn left_word => ["alt+b", "ctrl+left"];
+        pub fn right_word => ["alt+f", "ctrl+right"];
+        pub fn start => ["ctrl+a", "home"];
+        pub fn end => ["ctrl+e", "end"];
+        pub fn up => ["up"];
+        pub fn down => ["down"];
+    }
+
+    pub mod editor_action {
+        pub fn backspace => ["ctrl+h", "backspace"];
+        pub fn delete => ["ctrl+d", "delete"];
+        pub fn clear => ["ctrl+l"];
+        pub fn external => ["ctrl+x", "alt+e"];
+    }
+
+    pub mod rooms_action {
+        pub fn connect => ["c"];
+        pub fn connect_all => ["C"];
+        pub fn disconnect => ["d"];
+        pub fn disconnect_all => ["D"];
+        pub fn connect_autojoin => ["a"];
+        pub fn disconnect_non_autojoin => ["A"];
+        pub fn new => ["n"];
+        pub fn delete => ["X"];
+        pub fn change_sort_order => ["s"];
+    }
+
+    pub mod room_action {
+        pub fn authenticate => ["a"];
+        pub fn nick => ["n"];
+        pub fn more_messages => ["m"];
+        pub fn account => ["A"];
+    }
+
+    pub mod tree_cursor {
+        pub fn to_above_sibling => ["K", "ctrl+up"];
+        pub fn to_below_sibling => ["J", "ctrl+down"];
+        pub fn to_parent => ["p"];
+        pub fn to_root => ["P"];
+        pub fn to_older_message => ["h", "left"];
+        pub fn to_newer_message => ["l", "right"];
+        pub fn to_older_unseen_message => ["H", "ctrl+left"];
+        pub fn to_newer_unseen_message => ["L", "ctrl+right"];
+    }
+
+    pub mod tree_action {
+        pub fn reply => ["r"];
+        pub fn reply_alternate => ["R"];
+        pub fn new_thread => ["t"];
+        pub fn fold_tree => [" "];
+        pub fn toggle_seen => ["s"];
+        pub fn mark_visible_seen => ["S"];
+        pub fn mark_older_seen => ["ctrl+s"];
+        pub fn info => ["i"];
+        pub fn links => ["I"];
+        pub fn toggle_nick_emoji => ["e"];
+        pub fn increase_caesar => ["c"];
+        pub fn decrease_caesar => ["C"];
+    }
+
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// General.
+pub struct General {
+    /// Quit cove.
+    #[serde(default = "default::general::exit")]
+    pub exit: KeyBinding,
+    /// Abort/close.
+    #[serde(default = "default::general::abort")]
+    pub abort: KeyBinding,
+    /// Confirm.
+    #[serde(default = "default::general::confirm")]
+    pub confirm: KeyBinding,
+    /// Advance focus.
+    #[serde(default = "default::general::focus")]
+    pub focus: KeyBinding,
+    /// Show this help.
+    #[serde(default = "default::general::help")]
+    pub help: KeyBinding,
+    /// Show log.
+    #[serde(default = "default::general::log")]
+    pub log: KeyBinding,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Scrolling.
+pub struct Scroll {
+    /// Scroll up one line.
+    #[serde(default = "default::scroll::up_line")]
+    pub up_line: KeyBinding,
+    /// Scroll down one line.
+    #[serde(default = "default::scroll::down_line")]
+    pub down_line: KeyBinding,
+    /// Scroll up half a screen.
+    #[serde(default = "default::scroll::up_half")]
+    pub up_half: KeyBinding,
+    /// Scroll down half a screen.
+    #[serde(default = "default::scroll::down_half")]
+    pub down_half: KeyBinding,
+    /// Scroll up a full screen.
+    #[serde(default = "default::scroll::up_full")]
+    pub up_full: KeyBinding,
+    /// Scroll down a full screen.
+    #[serde(default = "default::scroll::down_full")]
+    pub down_full: KeyBinding,
+    /// Center cursor.
+    #[serde(default = "default::scroll::center_cursor")]
+    pub center_cursor: KeyBinding,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Cursor movement.
+pub struct Cursor {
+    /// Move up.
+    #[serde(default = "default::cursor::up")]
+    pub up: KeyBinding,
+    /// Move down.
+    #[serde(default = "default::cursor::down")]
+    pub down: KeyBinding,
+    /// Move to top.
+    #[serde(default = "default::cursor::to_top")]
+    pub to_top: KeyBinding,
+    /// Move to bottom.
+    #[serde(default = "default::cursor::to_bottom")]
+    pub to_bottom: KeyBinding,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Editor cursor movement.
+pub struct EditorCursor {
+    /// Move left.
+    #[serde(default = "default::editor_cursor::left")]
+    pub left: KeyBinding,
+    /// Move right.
+    #[serde(default = "default::editor_cursor::right")]
+    pub right: KeyBinding,
+    /// Move left a word.
+    #[serde(default = "default::editor_cursor::left_word")]
+    pub left_word: KeyBinding,
+    /// Move right a word.
+    #[serde(default = "default::editor_cursor::right_word")]
+    pub right_word: KeyBinding,
+    /// Move to start of line.
+    #[serde(default = "default::editor_cursor::start")]
+    pub start: KeyBinding,
+    /// Move to end of line.
+    #[serde(default = "default::editor_cursor::end")]
+    pub end: KeyBinding,
+    /// Move up.
+    #[serde(default = "default::editor_cursor::up")]
+    pub up: KeyBinding,
+    /// Move down.
+    #[serde(default = "default::editor_cursor::down")]
+    pub down: KeyBinding,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Editor actions.
+pub struct EditorAction {
+    /// Delete before cursor.
+    #[serde(default = "default::editor_action::backspace")]
+    pub backspace: KeyBinding,
+    /// Delete after cursor.
+    #[serde(default = "default::editor_action::delete")]
+    pub delete: KeyBinding,
+    /// Clear editor contents.
+    #[serde(default = "default::editor_action::clear")]
+    pub clear: KeyBinding,
+    /// Edit in external editor.
+    #[serde(default = "default::editor_action::external")]
+    pub external: KeyBinding,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Editor {
+    #[serde(default)]
+    #[document(no_default)]
+    pub cursor: EditorCursor,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub action: EditorAction,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Room list actions.
+pub struct RoomsAction {
+    /// Connect to selected room.
+    #[serde(default = "default::rooms_action::connect")]
+    pub connect: KeyBinding,
+    /// Connect to all rooms.
+    #[serde(default = "default::rooms_action::connect_all")]
+    pub connect_all: KeyBinding,
+    /// Disconnect from selected room.
+    #[serde(default = "default::rooms_action::disconnect")]
+    pub disconnect: KeyBinding,
+    /// Disconnect from all rooms.
+    #[serde(default = "default::rooms_action::disconnect_all")]
+    pub disconnect_all: KeyBinding,
+    /// Connect to all autojoin rooms.
+    #[serde(default = "default::rooms_action::connect_autojoin")]
+    pub connect_autojoin: KeyBinding,
+    /// Disconnect from all non-autojoin rooms.
+    #[serde(default = "default::rooms_action::disconnect_non_autojoin")]
+    pub disconnect_non_autojoin: KeyBinding,
+    /// Connect to new room.
+    #[serde(default = "default::rooms_action::new")]
+    pub new: KeyBinding,
+    /// Delete room.
+    #[serde(default = "default::rooms_action::delete")]
+    pub delete: KeyBinding,
+    /// Change sort order.
+    #[serde(default = "default::rooms_action::change_sort_order")]
+    pub change_sort_order: KeyBinding,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Rooms {
+    #[serde(default)]
+    #[document(no_default)]
+    pub action: RoomsAction,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Room actions.
+pub struct RoomAction {
+    /// Authenticate.
+    #[serde(default = "default::room_action::authenticate")]
+    pub authenticate: KeyBinding,
+    /// Change nick.
+    #[serde(default = "default::room_action::nick")]
+    pub nick: KeyBinding,
+    /// Download more messages.
+    #[serde(default = "default::room_action::more_messages")]
+    pub more_messages: KeyBinding,
+    /// Manage account.
+    #[serde(default = "default::room_action::account")]
+    pub account: KeyBinding,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Room {
+    #[serde(default)]
+    #[document(no_default)]
+    pub action: RoomAction,
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Tree cursor movement.
+pub struct TreeCursor {
+    /// Move to above sibling.
+    #[serde(default = "default::tree_cursor::to_above_sibling")]
+    pub to_above_sibling: KeyBinding,
+    /// Move to below sibling.
+    #[serde(default = "default::tree_cursor::to_below_sibling")]
+    pub to_below_sibling: KeyBinding,
+    /// Move to parent.
+    #[serde(default = "default::tree_cursor::to_parent")]
+    pub to_parent: KeyBinding,
+    /// Move to root.
+    #[serde(default = "default::tree_cursor::to_root")]
+    pub to_root: KeyBinding,
+    /// Move to older message.
+    #[serde(default = "default::tree_cursor::to_older_message")]
+    pub to_older_message: KeyBinding,
+    /// Move to newer message.
+    #[serde(default = "default::tree_cursor::to_newer_message")]
+    pub to_newer_message: KeyBinding,
+    /// Move to older unseen message.
+    #[serde(default = "default::tree_cursor::to_older_unseen_message")]
+    pub to_older_unseen_message: KeyBinding,
+    /// Move to newer unseen message.
+    #[serde(default = "default::tree_cursor::to_newer_unseen_message")]
+    pub to_newer_unseen_message: KeyBinding,
+    // TODO Bindings inspired by vim's ()/[]/{} bindings?
+}
+
+#[derive(Debug, Deserialize, Document, KeyGroup)]
+/// Tree actions.
+pub struct TreeAction {
+    /// Reply to message, inline if possible.
+    #[serde(default = "default::tree_action::reply")]
+    pub reply: KeyBinding,
+    /// Reply opposite to normal reply.
+    #[serde(default = "default::tree_action::reply_alternate")]
+    pub reply_alternate: KeyBinding,
+    /// Start a new thread.
+    #[serde(default = "default::tree_action::new_thread")]
+    pub new_thread: KeyBinding,
+    /// Fold current message's subtree.
+    #[serde(default = "default::tree_action::fold_tree")]
+    pub fold_tree: KeyBinding,
+    /// Toggle current message's seen status.
+    #[serde(default = "default::tree_action::toggle_seen")]
+    pub toggle_seen: KeyBinding,
+    /// Mark all visible messages as seen.
+    #[serde(default = "default::tree_action::mark_visible_seen")]
+    pub mark_visible_seen: KeyBinding,
+    /// Mark all older messages as seen.
+    #[serde(default = "default::tree_action::mark_older_seen")]
+    pub mark_older_seen: KeyBinding,
+    /// Inspect selected element.
+    #[serde(default = "default::tree_action::info")]
+    pub inspect: KeyBinding,
+    /// List links found in message.
+    #[serde(default = "default::tree_action::links")]
+    pub links: KeyBinding,
+    /// Toggle agent id based nick emoji.
+    #[serde(default = "default::tree_action::toggle_nick_emoji")]
+    pub toggle_nick_emoji: KeyBinding,
+    /// Increase caesar cipher rotation.
+    #[serde(default = "default::tree_action::increase_caesar")]
+    pub increase_caesar: KeyBinding,
+    /// Decrease caesar cipher rotation.
+    #[serde(default = "default::tree_action::decrease_caesar")]
+    pub decrease_caesar: KeyBinding,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Tree {
+    #[serde(default)]
+    #[document(no_default)]
+    pub cursor: TreeCursor,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub action: TreeAction,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Keys {
+    #[serde(default)]
+    #[document(no_default)]
+    pub general: General,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub scroll: Scroll,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub cursor: Cursor,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub editor: Editor,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub rooms: Rooms,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub room: Room,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub tree: Tree,
+}
+
+impl Keys {
+    pub fn groups(&self) -> Vec<KeyGroupInfo<'_>> {
+        vec![
+            KeyGroupInfo::new("general", &self.general),
+            KeyGroupInfo::new("scroll", &self.scroll),
+            KeyGroupInfo::new("cursor", &self.cursor),
+            KeyGroupInfo::new("editor.cursor", &self.editor.cursor),
+            KeyGroupInfo::new("editor.action", &self.editor.action),
+            KeyGroupInfo::new("rooms.action", &self.rooms.action),
+            KeyGroupInfo::new("room.action", &self.room.action),
+            KeyGroupInfo::new("tree.cursor", &self.tree.cursor),
+            KeyGroupInfo::new("tree.action", &self.tree.action),
+        ]
+    }
+}

cove-config/src/lib.rs

@@ -0,0 +1,158 @@
+use std::{
+    fs,
+    io::{self, ErrorKind},
+    path::{Path, PathBuf},
+};
+
+use doc::Document;
+use serde::{Deserialize, Serialize};
+
+pub use crate::{euph::*, keys::*};
+
+pub mod doc;
+mod euph;
+mod keys;
+
+#[derive(Debug, thiserror::Error)]
+pub enum Error {
+    #[error("failed to read config file")]
+    Io(#[from] io::Error),
+    #[error("failed to parse config file")]
+    Toml(#[from] toml::de::Error),
+}
+
+#[derive(Debug, Clone, Copy, Default, Serialize, Deserialize, Document)]
+#[serde(rename_all = "snake_case")]
+pub enum WidthEstimationMethod {
+    #[default]
+    Legacy,
+    Unicode,
+}
+
+#[derive(Debug, Default, Deserialize, Document)]
+pub struct Config {
+    /// The directory that cove stores its data in when not running in ephemeral
+    /// mode.
+    ///
+    /// Relative paths are interpreted relative to the user's home directory.
+    ///
+    /// See also the `--data-dir` command line option.
+    #[document(default = "platform-dependent")]
+    pub data_dir: Option<PathBuf>,
+
+    /// Whether to start in ephemeral mode.
+    ///
+    /// In ephemeral mode, cove doesn't store any data. It completely ignores
+    /// any options related to the data dir.
+    ///
+    /// See also the `--ephemeral` command line option.
+    #[serde(default)]
+    pub ephemeral: bool,
+
+    /// How to estimate the width of graphemes (i.e. characters) as displayed by
+    /// the terminal emulator.
+    ///
+    /// `"legacy"`: Use a legacy method that should mostly work on most terminal
+    /// emulators. This method will never be correct in all cases since every
+    /// terminal emulator handles grapheme widths slightly differently. However,
+    /// those cases are usually rare (unless you view a lot of emoji).
+    ///
+    /// `"unicode"`: Use the unicode standard in a best-effort manner to
+    /// determine grapheme widths. Some terminals (e.g. ghostty) can make use of
+    /// this.
+    ///
+    /// This method is used when `measure_widths` is set to `false`.
+    ///
+    /// See also the `--width-estimation-method` command line option.
+    #[serde(default)]
+    pub width_estimation_method: WidthEstimationMethod,
+
+    /// Whether to measure the width of graphemes (i.e. characters) as displayed
+    /// by the terminal emulator instead of estimating the width.
+    ///
+    /// Enabling this makes rendering a bit slower but more accurate. The screen
+    /// might also flash when encountering new graphemes.
+    ///
+    /// See also the `--measure-widths` command line option.
+    #[serde(default)]
+    pub measure_widths: bool,
+
+    /// Whether to start in offline mode.
+    ///
+    /// In offline mode, cove won't automatically join rooms marked via the
+    /// `autojoin` option on startup. You can still join those rooms manually by
+    /// pressing `a` in the rooms list.
+    ///
+    /// See also the `--offline` command line option.
+    #[serde(default)]
+    pub offline: bool,
+
+    /// Initial sort order of rooms list.
+    ///
+    /// `"alphabet"` sorts rooms in alphabetic order.
+    ///
+    /// `"importance"` sorts rooms by the following criteria (in descending
+    /// order of priority):
+    ///
+    /// 1. connected rooms before unconnected rooms
+    /// 2. rooms with unread messages before rooms without
+    /// 3. alphabetic order
+    #[serde(default)]
+    pub rooms_sort_order: RoomsSortOrder,
+
+    /// Ring the bell (character 0x07) when you are mentioned in a room.
+    #[serde(default)]
+    pub bell_on_mention: bool,
+
+    /// Time zone that chat timestamps should be displayed in.
+    ///
+    /// This option can either be the string `"localtime"`, a [POSIX TZ string],
+    /// or a [tz identifier] from the [tz database].
+    ///
+    /// When not set or when set to `"localtime"`, cove attempts to use your
+    /// system's configured time zone, falling back to UTC.
+    ///
+    /// When the string begins with a colon or doesn't match the a POSIX TZ
+    /// string format, it is interpreted as a tz identifier and looked up in
+    /// your system's tz database (or a bundled tz database on Windows).
+    ///
+    /// If the `TZ` environment variable exists, it overrides this option.
+    ///
+    /// [POSIX TZ string]: https://pubs.opengroup.org/onlinepubs/9699919799/basedefs/V1_chap08.html#tag_08_03
+    /// [tz identifier]: https://en.wikipedia.org/wiki/List_of_tz_database_time_zones
+    /// [tz database]: https://en.wikipedia.org/wiki/Tz_database
+    #[serde(default)]
+    #[document(default = "`$TZ` or local system time zone")]
+    pub time_zone: Option<String>,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub euph: Euph,
+
+    #[serde(default)]
+    #[document(no_default)]
+    pub keys: Keys,
+}
+
+impl Config {
+    pub fn load(path: &Path) -> Result<Self, Error> {
+        Ok(match fs::read_to_string(path) {
+            Ok(content) => toml::from_str(&content)?,
+            Err(err) if err.kind() == ErrorKind::NotFound => Self::default(),
+            Err(err) => Err(err)?,
+        })
+    }
+
+    pub fn euph_room(&self, domain: &str, name: &str) -> EuphRoom {
+        if let Some(server) = self.euph.servers.get(domain) {
+            if let Some(room) = server.rooms.get(name) {
+                return room.clone();
+            }
+        }
+        EuphRoom::default()
+    }
+
+    pub fn time_zone_ref(&self) -> Option<&str> {
+        self.time_zone.as_ref().map(|s| s as &str)
+    }
+}

cove-input/Cargo.toml

@@ -0,0 +1,18 @@
+[package]
+name = "cove-input"
+version.workspace = true
+edition.workspace = true
+
+[dependencies]
+cove-macro = { path = "../cove-macro" }
+
+crossterm.workspace = true
+edit.workspace = true
+parking_lot.workspace = true
+serde.workspace = true
+serde_either.workspace = true
+thiserror.workspace = true
+toss.workspace = true
+
+[lints]
+workspace = true

cove-input/src/keys.rs

@@ -0,0 +1,252 @@
+use std::{fmt, num::ParseIntError, str::FromStr};
+
+use crossterm::event::{KeyCode, KeyEvent, KeyModifiers};
+use serde::{Deserialize, Deserializer, Serialize, Serializer, de::Error};
+use serde_either::SingleOrVec;
+
+#[derive(Debug, thiserror::Error)]
+pub enum ParseKeysError {
+    #[error("no key code specified")]
+    NoKeyCode,
+    #[error("unknown key code: {0:?}")]
+    UnknownKeyCode(String),
+    #[error("invalid function key number: {0}")]
+    InvalidFNumber(#[from] ParseIntError),
+    #[error("unknown modifier: {0:?}")]
+    UnknownModifier(String),
+    #[error("modifier {0} conflicts with previous modifier")]
+    ConflictingModifier(String),
+}
+
+fn conflicts_with_shift(code: KeyCode) -> bool {
+    match code {
+        KeyCode::Char(' ') => false,
+        KeyCode::Char(_) => true,
+        _ => false,
+    }
+}
+
+#[derive(Debug, Clone, Copy, PartialEq, Eq)]
+pub struct KeyPress {
+    pub code: KeyCode,
+    pub shift: bool,
+    pub ctrl: bool,
+    pub alt: bool,
+    pub any: bool,
+}
+
+impl KeyPress {
+    fn parse_key_code(code: &str) -> Result<Self, ParseKeysError> {
+        let code = match code {
+            "esc" => KeyCode::Esc,
+            "enter" => KeyCode::Enter,
+            "space" => KeyCode::Char(' '),
+            "tab" => KeyCode::Tab,
+            "backtab" => KeyCode::BackTab,
+
+            "backspace" => KeyCode::Backspace,
+            "delete" => KeyCode::Delete,
+            "insert" => KeyCode::Insert,
+
+            "left" => KeyCode::Left,
+            "right" => KeyCode::Right,
+            "up" => KeyCode::Up,
+            "down" => KeyCode::Down,
+
+            "home" => KeyCode::Home,
+            "end" => KeyCode::End,
+            "pageup" => KeyCode::PageUp,
+            "pagedown" => KeyCode::PageDown,
+
+            c if c.chars().count() == 1 => KeyCode::Char(c.chars().next().unwrap()),
+            c if c.starts_with('f') => KeyCode::F(c.strip_prefix('f').unwrap().parse()?),
+
+            "" => return Err(ParseKeysError::NoKeyCode),
+            c => return Err(ParseKeysError::UnknownKeyCode(c.to_string())),
+        };
+        Ok(Self {
+            code,
+            shift: false,
+            ctrl: false,
+            alt: false,
+            any: false,
+        })
+    }
+
+    fn display_key_code(code: KeyCode) -> String {
+        match code {
+            KeyCode::Esc => "esc".to_string(),
+            KeyCode::Enter => "enter".to_string(),
+            KeyCode::Char(' ') => "space".to_string(),
+            KeyCode::Tab => "tab".to_string(),
+            KeyCode::BackTab => "backtab".to_string(),
+
+            KeyCode::Backspace => "backspace".to_string(),
+            KeyCode::Delete => "delete".to_string(),
+            KeyCode::Insert => "insert".to_string(),
+
+            KeyCode::Left => "left".to_string(),
+            KeyCode::Right => "right".to_string(),
+            KeyCode::Up => "up".to_string(),
+            KeyCode::Down => "down".to_string(),
+
+            KeyCode::Home => "home".to_string(),
+            KeyCode::End => "end".to_string(),
+            KeyCode::PageUp => "pageup".to_string(),
+            KeyCode::PageDown => "pagedown".to_string(),
+
+            KeyCode::Char(c) => c.to_string(),
+            KeyCode::F(n) => format!("f{n}"),
+
+            _ => "unknown".to_string(),
+        }
+    }
+
+    fn parse_modifier(
+        &mut self,
+        modifier: &str,
+        shift_allowed: bool,
+    ) -> Result<(), ParseKeysError> {
+        match modifier {
+            m if self.any => return Err(ParseKeysError::ConflictingModifier(m.to_string())),
+            "shift" if shift_allowed && !self.shift => self.shift = true,
+            "ctrl" if !self.ctrl => self.ctrl = true,
+            "alt" if !self.alt => self.alt = true,
+            "any" if !self.shift && !self.ctrl && !self.alt => self.any = true,
+            m @ ("shift" | "ctrl" | "alt" | "any") => {
+                return Err(ParseKeysError::ConflictingModifier(m.to_string()));
+            }
+            m => return Err(ParseKeysError::UnknownModifier(m.to_string())),
+        }
+        Ok(())
+    }
+
+    pub fn matches(&self, event: KeyEvent) -> bool {
+        if event.code != self.code {
+            return false;
+        }
+
+        if self.any && !event.modifiers.is_empty() {
+            return true;
+        }
+
+        let ctrl = event.modifiers.contains(KeyModifiers::CONTROL) == self.ctrl;
+        let alt = event.modifiers.contains(KeyModifiers::ALT) == self.alt;
+        if conflicts_with_shift(self.code) {
+            ctrl && alt
+        } else {
+            let shift = event.modifiers.contains(KeyModifiers::SHIFT) == self.shift;
+            shift && ctrl && alt
+        }
+    }
+}
+
+impl FromStr for KeyPress {
+    type Err = ParseKeysError;
+
+    fn from_str(s: &str) -> Result<Self, Self::Err> {
+        let mut parts = s.split('+');
+        let code = parts.next_back().ok_or(ParseKeysError::NoKeyCode)?;
+
+        let mut keys = Self::parse_key_code(code)?;
+        let shift_allowed = !conflicts_with_shift(keys.code);
+        for modifier in parts {
+            keys.parse_modifier(modifier, shift_allowed)?;
+        }
+
+        Ok(keys)
+    }
+}
+
+impl fmt::Display for KeyPress {
+    fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
+        let code = Self::display_key_code(self.code);
+
+        let mut segments = vec![];
+        if self.shift {
+            segments.push("shift");
+        }
+        if self.ctrl {
+            segments.push("ctrl");
+        }
+        if self.alt {
+            segments.push("alt");
+        }
+        if self.any {
+            segments.push("any");
+        }
+        segments.push(&code);
+
+        segments.join("+").fmt(f)
+    }
+}
+
+impl Serialize for KeyPress {
+    fn serialize<S: Serializer>(&self, serializer: S) -> Result<S::Ok, S::Error> {
+        format!("{self}").serialize(serializer)
+    }
+}
+
+impl<'de> Deserialize<'de> for KeyPress {
+    fn deserialize<D: Deserializer<'de>>(deserializer: D) -> Result<Self, D::Error> {
+        String::deserialize(deserializer)?
+            .parse()
+            .map_err(|e| D::Error::custom(format!("{e}")))
+    }
+}
+
+#[derive(Debug, Clone)]
+pub struct KeyBinding(Vec<KeyPress>);
+
+impl KeyBinding {
+    pub fn new() -> Self {
+        Self(vec![])
+    }
+
+    pub fn keys(&self) -> &[KeyPress] {
+        &self.0
+    }
+
+    pub fn with_key(self, key: &str) -> Result<Self, ParseKeysError> {
+        self.with_keys([key])
+    }
+
+    pub fn with_keys<'a, I>(mut self, keys: I) -> Result<Self, ParseKeysError>
+    where
+        I: IntoIterator<Item = &'a str>,
+    {
+        for key in keys {
+            self.0.push(key.parse()?);
+        }
+        Ok(self)
+    }
+
+    pub fn matches(&self, event: KeyEvent) -> bool {
+        self.0.iter().any(|kp| kp.matches(event))
+    }
+}
+
+impl Default for KeyBinding {
+    fn default() -> Self {
+        Self::new()
+    }
+}
+
+impl Serialize for KeyBinding {
+    fn serialize<S: Serializer>(&self, serializer: S) -> Result<S::Ok, S::Error> {
+        if self.0.len() == 1 {
+            self.0[0].serialize(serializer)
+        } else {
+            self.0.serialize(serializer)
+        }
+    }
+}
+
+impl<'de> Deserialize<'de> for KeyBinding {
+    fn deserialize<D: Deserializer<'de>>(deserializer: D) -> Result<Self, D::Error> {
+        Ok(match SingleOrVec::<KeyPress>::deserialize(deserializer)? {
+            SingleOrVec::Single(key) => Self(vec![key]),
+            SingleOrVec::Vec(keys) => Self(keys),
+        })
+    }
+}

cove-input/src/lib.rs

@@ -0,0 +1,102 @@
+use std::{io, sync::Arc};
+
+pub use cove_macro::KeyGroup;
+use crossterm::event::{Event, KeyEvent, KeyEventKind};
+use parking_lot::FairMutex;
+use toss::{Frame, Terminal, WidthDb};
+
+pub use crate::keys::*;
+
+mod keys;
+
+pub struct KeyBindingInfo<'a> {
+    pub name: &'static str,
+    pub binding: &'a KeyBinding,
+    pub description: &'static str,
+}
+
+/// A group of related key bindings.
+pub trait KeyGroup {
+    const DESCRIPTION: &'static str;
+
+    fn bindings(&self) -> Vec<KeyBindingInfo<'_>>;
+}
+
+pub struct KeyGroupInfo<'a> {
+    pub name: &'static str,
+    pub description: &'static str,
+    pub bindings: Vec<KeyBindingInfo<'a>>,
+}
+
+impl<'a> KeyGroupInfo<'a> {
+    pub fn new<G: KeyGroup>(name: &'static str, group: &'a G) -> Self {
+        Self {
+            name,
+            description: G::DESCRIPTION,
+            bindings: group.bindings(),
+        }
+    }
+}
+
+pub struct InputEvent<'a> {
+    event: Event,
+    terminal: &'a mut Terminal,
+    crossterm_lock: Arc<FairMutex<()>>,
+}
+
+impl<'a> InputEvent<'a> {
+    pub fn new(
+        event: Event,
+        terminal: &'a mut Terminal,
+        crossterm_lock: Arc<FairMutex<()>>,
+    ) -> Self {
+        Self {
+            event,
+            terminal,
+            crossterm_lock,
+        }
+    }
+
+    /// If the current event represents a key press, returns the [`KeyEvent`]
+    /// associated with that key press.
+    pub fn key_event(&self) -> Option<KeyEvent> {
+        if let Event::Key(event) = &self.event {
+            if matches!(event.kind, KeyEventKind::Press | KeyEventKind::Repeat) {
+                return Some(*event);
+            }
+        }
+        None
+    }
+
+    pub fn paste_event(&self) -> Option<&str> {
+        match &self.event {
+            Event::Paste(string) => Some(string),
+            _ => None,
+        }
+    }
+
+    pub fn matches(&self, binding: &KeyBinding) -> bool {
+        match self.key_event() {
+            Some(event) => binding.matches(event),
+            None => false,
+        }
+    }
+
+    pub fn frame(&mut self) -> &mut Frame {
+        self.terminal.frame()
+    }
+
+    pub fn widthdb(&mut self) -> &mut WidthDb {
+        self.terminal.widthdb()
+    }
+
+    pub fn prompt(&mut self, initial_text: &str) -> io::Result<String> {
+        let guard = self.crossterm_lock.lock();
+        self.terminal.suspend().expect("failed to suspend");
+        let content = edit::edit(initial_text);
+        self.terminal.unsuspend().expect("fauled to unsuspend");
+        drop(guard);
+
+        content
+    }
+}

cove-macro/Cargo.toml

@@ -0,0 +1,15 @@
+[package]
+name = "cove-macro"
+version.workspace = true
+edition.workspace = true
+
+[dependencies]
+proc-macro2.workspace = true
+quote.workspace = true
+syn.workspace = true
+
+[lib]
+proc-macro = true
+
+[lints]
+workspace = true

cove-macro/src/document.rs

@@ -0,0 +1,152 @@
+use proc_macro2::TokenStream;
+use quote::quote;
+use syn::{Data, DataEnum, DataStruct, DeriveInput, Field, Ident, LitStr, spanned::Spanned};
+
+use crate::util::{self, SerdeDefault};
+
+#[derive(Default)]
+struct FieldInfo {
+    description: Option<String>,
+    metavar: Option<LitStr>,
+    default: Option<LitStr>,
+    serde_default: Option<SerdeDefault>,
+    no_default: bool,
+}
+
+impl FieldInfo {
+    fn initialize_from_field(&mut self, field: &Field) -> syn::Result<()> {
+        let docstring = util::docstring(&field.attrs)?;
+        if !docstring.is_empty() {
+            self.description = Some(docstring);
+        }
+
+        for arg in util::attribute_arguments(&field.attrs, "document")? {
+            if arg.path.is_ident("metavar") {
+                // Parse `#[document(metavar = "bla")]`
+                if let Some(metavar) = arg.value.and_then(util::into_litstr) {
+                    self.metavar = Some(metavar);
+                } else {
+                    util::bail(arg.path.span(), "must be of the form `key = \"value\"`")?;
+                }
+            } else if arg.path.is_ident("default") {
+                // Parse `#[document(default = "bla")]`
+                if let Some(value) = arg.value.and_then(util::into_litstr) {
+                    self.default = Some(value);
+                } else {
+                    util::bail(arg.path.span(), "must be of the form `key = \"value\"`")?;
+                }
+            } else if arg.path.is_ident("no_default") {
+                // Parse #[document(no_default)]
+                if arg.value.is_some() {
+                    util::bail(arg.path.span(), "must not have a value")?;
+                }
+                self.no_default = true;
+            } else {
+                util::bail(arg.path.span(), "unknown argument name")?;
+            }
+        }
+
+        // Find `#[serde(default)]` or `#[serde(default = "bla")]`.
+        self.serde_default = util::serde_default(field)?;
+
+        Ok(())
+    }
+
+    fn from_field(field: &Field) -> syn::Result<Self> {
+        let mut result = Self::default();
+        result.initialize_from_field(field)?;
+        Ok(result)
+    }
+}
+
+fn from_struct(ident: Ident, data: DataStruct) -> syn::Result<TokenStream> {
+    let mut fields = vec![];
+    for field in data.fields {
+        let Some(ident) = field.ident.as_ref() else {
+            return util::bail(field.span(), "must not be a tuple struct");
+        };
+        let ident = ident.to_string();
+
+        let info = FieldInfo::from_field(&field)?;
+
+        let mut setters = vec![];
+        if let Some(description) = info.description {
+            setters.push(quote! {
+                doc.description = Some(#description.to_string());
+            });
+        }
+        if let Some(metavar) = info.metavar {
+            setters.push(quote! {
+                doc.wrap_info.metavar = Some(#metavar.to_string());
+            });
+        }
+        if info.no_default {
+        } else if let Some(default) = info.default {
+            setters.push(quote! {
+                doc.value_info.default = Some(#default.to_string());
+            });
+        } else if let Some(serde_default) = info.serde_default {
+            let value = serde_default.value();
+            setters.push(quote! {
+                doc.value_info.default = Some(crate::doc::toml_value_as_markdown(&#value));
+            });
+        }
+
+        let ty = field.ty;
+        fields.push(quote! {
+            fields.insert(
+                #ident.to_string(),
+                {
+                    let mut doc = <#ty as crate::doc::Document>::doc();
+                    #( #setters )*
+                    ::std::boxed::Box::new(doc)
+                }
+            );
+        });
+    }
+
+    let tokens = quote!(
+        impl crate::doc::Document for #ident {
+            fn doc() -> crate::doc::Doc {
+                let mut fields = ::std::collections::HashMap::new();
+                #( #fields )*
+
+                let mut doc = crate::doc::Doc::default();
+                doc.struct_info.fields = fields;
+                doc
+            }
+        }
+    );
+
+    Ok(tokens)
+}
+
+fn from_enum(ident: Ident, data: DataEnum) -> syn::Result<TokenStream> {
+    let mut values = vec![];
+    for variant in data.variants {
+        let ident = variant.ident;
+        values.push(quote! {
+            crate::doc::toml_value_as_markdown(&Self::#ident)
+        });
+    }
+
+    let tokens = quote!(
+        impl crate::doc::Document for #ident {
+            fn doc() -> crate::doc::Doc {
+                let mut doc = <String as crate::doc::Document>::doc();
+                doc.value_info.values = Some(vec![ #( #values ),* ]);
+                doc
+            }
+        }
+    );
+
+    Ok(tokens)
+}
+
+pub fn derive_impl(input: DeriveInput) -> syn::Result<TokenStream> {
+    match input.data {
+        Data::Struct(data) => from_struct(input.ident, data),
+        Data::Enum(data) => from_enum(input.ident, data),
+        Data::Union(_) => util::bail(input.span(), "must be an enum or a struct"),
+    }
+}

cove-macro/src/key_group.rs

@@ -0,0 +1,74 @@
+use proc_macro2::TokenStream;
+use quote::quote;
+use syn::{Data, DeriveInput, spanned::Spanned};
+
+use crate::util;
+
+fn decapitalize(s: &str) -> String {
+    let mut chars = s.chars();
+    if let Some(char) = chars.next() {
+        char.to_lowercase().chain(chars).collect()
+    } else {
+        String::new()
+    }
+}
+
+pub fn derive_impl(input: DeriveInput) -> syn::Result<TokenStream> {
+    let Data::Struct(data) = input.data else {
+        return util::bail(input.span(), "must be a struct");
+    };
+
+    let docstring = util::docstring(&input.attrs)?;
+    let description = docstring.strip_suffix('.').unwrap_or(&docstring);
+
+    let mut bindings = vec![];
+    let mut defaults = vec![];
+    for field in &data.fields {
+        if let Some(field_ident) = &field.ident {
+            let field_name = field_ident.to_string();
+
+            let docstring = util::docstring(&field.attrs)?;
+            let description = decapitalize(&docstring);
+            let description = description.strip_suffix('.').unwrap_or(&description);
+
+            let default = util::serde_default(field)?;
+            let Some(default) = default else {
+                return util::bail(field_ident.span(), "must have serde default");
+            };
+            let default_value = default.value();
+
+            bindings.push(quote! {
+                ::cove_input::KeyBindingInfo {
+                    name: #field_name,
+                    binding: &self.#field_ident,
+                    description: #description
+                }
+            });
+
+            defaults.push(quote! {
+                #field_ident: #default_value,
+            });
+        }
+    }
+
+    let ident = input.ident;
+    Ok(quote! {
+        impl ::cove_input::KeyGroup for #ident {
+            const DESCRIPTION: &'static str = #description;
+
+            fn bindings(&self) -> Vec<::cove_input::KeyBindingInfo<'_>> {
+                vec![
+                    #( #bindings, )*
+                ]
+            }
+        }
+
+        impl Default for #ident {
+            fn default() -> Self {
+                Self {
+                    #( #defaults )*
+                }
+            }
+        }
+    })
+}

cove-macro/src/lib.rs

@@ -0,0 +1,23 @@
+use syn::{DeriveInput, parse_macro_input};
+
+mod document;
+mod key_group;
+mod util;
+
+#[proc_macro_derive(Document, attributes(document))]
+pub fn derive_document(input: proc_macro::TokenStream) -> proc_macro::TokenStream {
+    let input = parse_macro_input!(input as DeriveInput);
+    match document::derive_impl(input) {
+        Ok(tokens) => tokens.into(),
+        Err(err) => err.into_compile_error().into(),
+    }
+}
+
+#[proc_macro_derive(KeyGroup)]
+pub fn derive_group(input: proc_macro::TokenStream) -> proc_macro::TokenStream {
+    let input = parse_macro_input!(input as DeriveInput);
+    match key_group::derive_impl(input) {
+        Ok(tokens) => tokens.into(),
+        Err(err) => err.into_compile_error().into(),
+    }
+}

cove-macro/src/util.rs

@@ -0,0 +1,117 @@
+use proc_macro2::{Span, TokenStream};
+use quote::quote;
+use syn::{
+    Attribute, Expr, ExprLit, ExprPath, Field, Lit, LitStr, Path, Token, Type, parse::Parse,
+    punctuated::Punctuated,
+};
+
+pub fn bail<T>(span: Span, message: &str) -> syn::Result<T> {
+    Err(syn::Error::new(span, message))
+}
+
+pub fn litstr(expr: &Expr) -> Option<&LitStr> {
+    match expr {
+        Expr::Lit(ExprLit {
+            lit: Lit::Str(lit), ..
+        }) => Some(lit),
+        _ => None,
+    }
+}
+
+pub fn into_litstr(expr: Expr) -> Option<LitStr> {
+    match expr {
+        Expr::Lit(ExprLit {
+            lit: Lit::Str(lit), ..
+        }) => Some(lit),
+        _ => None,
+    }
+}
+
+/// Given a struct field, this finds all attributes like `#[doc = "bla"]`,
+/// unindents, concatenates and returns them.
+pub fn docstring(attributes: &[Attribute]) -> syn::Result<String> {
+    let mut lines = vec![];
+
+    for attr in attributes.iter().filter(|attr| attr.path().is_ident("doc")) {
+        if let Some(lit) = litstr(&attr.meta.require_name_value()?.value) {
+            let value = lit.value();
+            let value = value
+                .strip_prefix(' ')
+                .map(|value| value.to_string())
+                .unwrap_or(value);
+            lines.push(value);
+        }
+    }
+
+    Ok(lines.join("\n"))
+}
+
+pub struct AttributeArgument {
+    pub path: Path,
+    pub value: Option<Expr>,
+}
+
+impl Parse for AttributeArgument {
+    fn parse(input: syn::parse::ParseStream<'_>) -> syn::Result<Self> {
+        let path = Path::parse(input)?;
+        let value = if input.peek(Token![=]) {
+            input.parse::<Token![=]>()?;
+            Some(Expr::parse(input)?)
+        } else {
+            None
+        };
+        Ok(Self { path, value })
+    }
+}
+
+/// Given a struct field, this finds all arguments of the form `#[path(key)]`
+/// and `#[path(key = value)]`. Multiple arguments may be specified in a single
+/// annotation, e.g. `#[foo(bar, baz = true)]`.
+pub fn attribute_arguments(
+    attributes: &[Attribute],
+    path: &str,
+) -> syn::Result<Vec<AttributeArgument>> {
+    let mut attr_args = vec![];
+
+    for attr in attributes.iter().filter(|attr| attr.path().is_ident(path)) {
+        let args =
+            attr.parse_args_with(Punctuated::<AttributeArgument, Token![,]>::parse_terminated)?;
+        attr_args.extend(args);
+    }
+
+    Ok(attr_args)
+}
+
+pub enum SerdeDefault {
+    Default(Type),
+    Path(ExprPath),
+}
+
+impl SerdeDefault {
+    pub fn value(&self) -> TokenStream {
+        match self {
+            Self::Default(ty) => quote! {
+                <#ty as Default>::default()
+            },
+            Self::Path(path) => quote! {
+                #path()
+            },
+        }
+    }
+}
+
+/// Find `#[serde(default)]` or `#[serde(default = "bla")]`.
+pub fn serde_default(field: &Field) -> syn::Result<Option<SerdeDefault>> {
+    for arg in attribute_arguments(&field.attrs, "serde")? {
+        if arg.path.is_ident("default") {
+            if let Some(value) = arg.value {
+                if let Some(path) = into_litstr(value) {
+                    return Ok(Some(SerdeDefault::Path(path.parse()?)));
+                }
+            } else {
+                return Ok(Some(SerdeDefault::Default(field.ty.clone())));
+            }
+        }
+    }
+    Ok(None)
+}

cove/Cargo.toml

@@ -0,0 +1,32 @@
+[package]
+name = "cove"
+version.workspace = true
+edition.workspace = true
+
+[dependencies]
+cove-config = { path = "../cove-config" }
+cove-input = { path = "../cove-input" }
+
+anyhow.workspace = true
+async-trait.workspace = true
+clap.workspace = true
+cookie.workspace = true
+crossterm.workspace = true
+directories.workspace = true
+euphoxide.workspace = true
+jiff.workspace = true
+linkify.workspace = true
+log.workspace = true
+open.workspace = true
+parking_lot.workspace = true
+rusqlite.workspace = true
+serde_json.workspace = true
+thiserror.workspace = true
+tokio.workspace = true
+toss.workspace = true
+unicode-width.workspace = true
+vault.workspace = true
+rustls.workspace = true
+
+[lints]
+workspace = true

cove/src/euph.rs

@@ -1,7 +1,9 @@
-mod room;
-mod small_message;
-mod util;
-
+pub use highlight::*;
 pub use room::*;
 pub use small_message::*;
 pub use util::*;
+
+mod highlight;
+mod room;
+mod small_message;
+mod util;

cove/src/euph/highlight.rs

@@ -0,0 +1,211 @@
+use std::ops::Range;
+
+use crossterm::style::Stylize;
+use toss::{Style, Styled};
+
+use crate::euph::util;
+
+#[derive(Debug, Clone, Copy, PartialEq, Eq)]
+pub enum SpanType {
+    Mention,
+    Room,
+    Emoji,
+}
+
+fn nick_char(ch: char) -> bool {
+    // Closely following the heim mention regex:
+    // https://github.com/euphoria-io/heim/blob/978c921063e6b06012fc8d16d9fbf1b3a0be1191/client/lib/stores/chat.js#L14-L15
+    // `>` has been experimentally confirmed to delimit mentions as well.
+    match ch {
+        ',' | '.' | '!' | '?' | ';' | '&' | '<' | '>' | '\'' | '"' => false,
+        _ => !ch.is_whitespace(),
+    }
+}
+
+fn room_char(ch: char) -> bool {
+    // Basically just \w, see also
+    // https://github.com/euphoria-io/heim/blob/978c921063e6b06012fc8d16d9fbf1b3a0be1191/client/lib/ui/MessageText.js#L66
+    ch.is_ascii_alphanumeric() || ch == '_'
+}
+
+struct SpanFinder<'a> {
+    content: &'a str,
+
+    span: Option<(SpanType, usize)>,
+    room_or_mention_possible: bool,
+
+    result: Vec<(SpanType, Range<usize>)>,
+}
+
+impl<'a> SpanFinder<'a> {
+    fn is_valid_span(&self, span: SpanType, range: Range<usize>) -> bool {
+        let text = &self.content[range.start..range.end];
+        match span {
+            SpanType::Mention => range.len() > 1 && text.starts_with('@'),
+            SpanType::Room => range.len() > 1 && text.starts_with('&'),
+            SpanType::Emoji => {
+                if range.len() <= 2 {
+                    return false;
+                }
+
+                let Some(name) = Some(text)
+                    .and_then(|it| it.strip_prefix(':'))
+                    .and_then(|it| it.strip_suffix(':'))
+                else {
+                    return false;
+                };
+
+                util::EMOJI.get(name).is_some()
+            }
+        }
+    }
+
+    fn close_span(&mut self, end: usize) {
+        let Some((span, start)) = self.span else {
+            return;
+        };
+        if self.is_valid_span(span, start..end) {
+            self.result.push((span, start..end));
+        }
+        self.span = None;
+    }
+
+    fn open_span(&mut self, span: SpanType, start: usize) {
+        self.close_span(start);
+        self.span = Some((span, start))
+    }
+
+    fn step(&mut self, idx: usize, char: char) {
+        match (char, self.span) {
+            ('@', Some((SpanType::Mention, _))) => {} // Continue the mention
+            ('@', _) if self.room_or_mention_possible => self.open_span(SpanType::Mention, idx),
+            ('&', _) if self.room_or_mention_possible => self.open_span(SpanType::Room, idx),
+            (':', None) => self.open_span(SpanType::Emoji, idx),
+            (':', Some((SpanType::Emoji, _))) => self.close_span(idx + 1),
+            (c, Some((SpanType::Mention, _))) if !nick_char(c) => self.close_span(idx),
+            (c, Some((SpanType::Room, _))) if !room_char(c) => self.close_span(idx),
+            _ => {}
+        }
+
+        // More permissive than the heim web client
+        self.room_or_mention_possible = !char.is_alphanumeric();
+    }
+
+    fn find(content: &'a str) -> Vec<(SpanType, Range<usize>)> {
+        let mut this = Self {
+            content,
+            span: None,
+            room_or_mention_possible: true,
+            result: vec![],
+        };
+
+        for (idx, char) in content.char_indices() {
+            this.step(idx, char);
+        }
+
+        this.close_span(content.len());
+
+        this.result
+    }
+}
+
+pub fn find_spans(content: &str) -> Vec<(SpanType, Range<usize>)> {
+    SpanFinder::find(content)
+}
+
+/// Highlight spans in a string.
+///
+/// The list of spans must be non-overlapping and in ascending order.
+///
+/// If `exact` is specified, colon-delimited emoji are not replaced with their
+/// unicode counterparts.
+pub fn apply_spans(
+    content: &str,
+    spans: &[(SpanType, Range<usize>)],
+    base: Style,
+    exact: bool,
+) -> Styled {
+    let mut result = Styled::default();
+    let mut i = 0;
+
+    for (span, range) in spans {
+        assert!(i <= range.start);
+        assert!(range.end <= content.len());
+
+        if i < range.start {
+            result = result.then(&content[i..range.start], base);
+        }
+
+        let text = &content[range.start..range.end];
+        result = match span {
+            SpanType::Mention if exact => result.and_then(util::style_mention_exact(text, base)),
+            SpanType::Mention => result.and_then(util::style_mention(text, base)),
+            SpanType::Room => result.then(text, base.blue().bold()),
+            SpanType::Emoji if exact => result.then(text, base.magenta()),
+            SpanType::Emoji => {
+                let name = text.strip_prefix(':').unwrap_or(text);
+                let name = name.strip_suffix(':').unwrap_or(name);
+                if let Some(Some(replacement)) = util::EMOJI.get(name) {
+                    result.then(replacement, base)
+                } else {
+                    result.then(text, base.magenta())
+                }
+            }
+        };
+
+        i = range.end;
+    }
+
+    if i < content.len() {
+        result = result.then(&content[i..], base);
+    }
+
+    result
+}
+
+/// Highlight an euphoria message's content.
+///
+/// If `exact` is specified, colon-delimited emoji are not replaced with their
+/// unicode counterparts.
+pub fn highlight(content: &str, base: Style, exact: bool) -> Styled {
+    apply_spans(content, &find_spans(content), base, exact)
+}
+
+#[cfg(test)]
+mod tests {
+
+    use crate::euph::SpanType;
+
+    use super::find_spans;
+
+    #[test]
+    fn mentions() {
+        assert_eq!(find_spans("@foo"), vec![(SpanType::Mention, 0..4)]);
+        assert_eq!(find_spans("&@foo"), vec![(SpanType::Mention, 1..5)]);
+        assert_eq!(find_spans("a @foo b"), vec![(SpanType::Mention, 2..6)]);
+        assert_eq!(find_spans("@@foo@@"), vec![(SpanType::Mention, 0..7)]);
+        assert_eq!(find_spans("a @b@c d"), vec![(SpanType::Mention, 2..6)]);
+        assert_eq!(
+            find_spans("a @b @c d"),
+            vec![(SpanType::Mention, 2..4), (SpanType::Mention, 5..7)]
+        );
+    }
+
+    #[test]
+    fn rooms() {
+        assert_eq!(find_spans("&foo"), vec![(SpanType::Room, 0..4)]);
+        assert_eq!(find_spans("@&foo"), vec![(SpanType::Room, 1..5)]);
+        assert_eq!(find_spans("a &foo b"), vec![(SpanType::Room, 2..6)]);
+        assert_eq!(find_spans("&&foo&&"), vec![(SpanType::Room, 1..5)]);
+        assert_eq!(find_spans("a &b&c d"), vec![(SpanType::Room, 2..4)]);
+        assert_eq!(
+            find_spans("a &b &c d"),
+            vec![(SpanType::Room, 2..4), (SpanType::Room, 5..7)]
+        );
+    }
+
+    #[test]
+    fn emoji_in_mentions() {
+        assert_eq!(find_spans(" @a:b:c "), vec![(SpanType::Mention, 1..7)]);
+    }
+}

cove/src/euph/room.rs

@@ -1,24 +1,21 @@
-// TODO Stop if room does not exist (e. g. 404)
+use std::{convert::Infallible, time::Duration};
 
-use std::convert::Infallible;
-use std::time::Duration;
-
-use euphoxide::api::packet::ParsedPacket;
-use euphoxide::api::{
-    Auth, AuthOption, Data, Log, Login, Logout, MessageId, Nick, Send, SendEvent, SendReply, Time,
-    UserId,
+use euphoxide::{
+    api::{
+        Auth, AuthOption, Data, Log, Login, Logout, MessageId, Nick, Send, SendEvent, SendReply,
+        Time, UserId, packet::ParsedPacket,
+    },
+    bot::instance::{ConnSnapshot, Event, Instance, InstanceConfig},
+    conn::{self, ConnTx, Joined},
 };
-use euphoxide::bot::instance::{Event, Instance, InstanceConfig, Snapshot};
-use euphoxide::conn::{self, ConnTx};
-use log::{debug, error, info, warn};
-use tokio::select;
-use tokio::sync::oneshot;
+use log::{debug, info, warn};
+use tokio::{select, sync::oneshot};
 
-use crate::macros::{logging_unwrap, ok_or_return};
-use crate::vault::EuphRoomVault;
+use crate::{macros::logging_unwrap, vault::EuphRoomVault};
 
 const LOG_INTERVAL: Duration = Duration::from_secs(10);
 
+#[allow(clippy::large_enum_variant)]
 #[derive(Debug)]
 pub enum State {
     Disconnected,
@@ -35,6 +32,13 @@ impl State {
             None
         }
     }
+
+    pub fn joined(&self) -> Option<&Joined> {
+        match self {
+            Self::Connected(_, conn::State::Joined(joined)) => Some(joined),
+            _ => None,
+        }
+    }
 }
 
 #[derive(Debug, thiserror::Error)]
@@ -65,19 +69,13 @@ impl Room {
     where
         F: Fn(Event) + std::marker::Send + Sync + 'static,
     {
-        // &rl2dev's message history is broken and requesting old messages past
-        // a certain point results in errors. Cove should not keep retrying log
-        // requests when hitting that limit, so &rl2dev is always opened in
-        // ephemeral mode.
-        let ephemeral = vault.vault().vault().ephemeral() || vault.room() == "rl2dev";
-
         Self {
-            vault,
-            ephemeral,
+            ephemeral: vault.vault().vault().ephemeral(),
             instance: instance_config.build(on_event),
             state: State::Disconnected,
             last_msg_id: None,
             log_request_canary: None,
+            vault,
         }
     }
 
@@ -106,7 +104,7 @@ impl Room {
                 self.last_msg_id = None;
                 self.log_request_canary = None;
             }
-            Event::Connected(_, Snapshot { conn_tx, state }) => {
+            Event::Connected(_, ConnSnapshot { conn_tx, state }) => {
                 if !self.ephemeral {
                     let (tx, rx) = oneshot::channel();
                     self.log_request_canary = Some(tx);
@@ -125,9 +123,10 @@ impl Room {
 
                 let cookies = &*self.instance.config().server.cookies;
                 let cookies = cookies.lock().unwrap().clone();
-                logging_unwrap!(self.vault.vault().set_cookies(cookies).await);
+                let domain = self.vault.room().domain.clone();
+                logging_unwrap!(self.vault.vault().set_cookies(domain, cookies).await);
             }
-            Event::Packet(_, packet, Snapshot { conn_tx, state }) => {
+            Event::Packet(_, packet, ConnSnapshot { conn_tx, state }) => {
                 self.state = State::Connected(conn_tx, state);
                 self.on_packet(packet).await;
             }
@@ -137,7 +136,6 @@ impl Room {
                 self.log_request_canary = None;
             }
             Event::Stopped(_) => {
-                // TODO Remove room somewhere if this happens? If it doesn't already happen during stabilization
                 self.state = State::Stopped;
             }
         }
@@ -183,15 +181,9 @@ impl Room {
             None => None,
         };
 
-        debug!("{}: requesting logs", vault.room());
+        debug!("{:?}: requesting logs", vault.room());
 
-        // &rl2dev's message history is broken and requesting old messages past
-        // a certain point results in errors. By reducing the amount of messages
-        // in each log request, we can get closer to this point. Since &rl2dev
-        // is fairly low in activity, this should be fine.
-        let n = if vault.room() == "rl2dev" { 50 } else { 1000 };
-
-        let _ = conn_tx.send(Log { n, before }).await;
+        let _ = conn_tx.send(Log { n: 1000, before }).await;
         // The code handling incoming events and replies also handles
         // `LogReply`s, so we don't need to do anything special here.
     }
@@ -209,7 +201,9 @@ impl Room {
 
     async fn on_packet(&mut self, packet: ParsedPacket) {
         let room_name = &self.instance.config().room;
-        let data = ok_or_return!(&packet.content);
+        let Ok(data) = &packet.content else {
+            return;
+        };
         match data {
             Data::BounceEvent(_) => {}
             Data::DisconnectEvent(_) => {}

cove/src/euph/small_message.rs

@@ -0,0 +1,102 @@
+use crossterm::style::Stylize;
+use euphoxide::api::{MessageId, Snowflake, Time, UserId};
+use jiff::Timestamp;
+use toss::{Style, Styled};
+
+use crate::{store::Msg, ui::ChatMsg};
+
+use super::util;
+
+#[derive(Debug, Clone)]
+pub struct SmallMessage {
+    pub id: MessageId,
+    pub parent: Option<MessageId>,
+    pub time: Time,
+    pub user_id: UserId,
+    pub nick: String,
+    pub content: String,
+    pub seen: bool,
+}
+
+fn as_me(content: &str) -> Option<&str> {
+    content.strip_prefix("/me")
+}
+
+fn style_me() -> Style {
+    Style::new().grey().italic()
+}
+
+fn styled_nick(nick: &str) -> Styled {
+    Styled::new_plain("[")
+        .and_then(super::style_nick(nick, Style::new()))
+        .then_plain("]")
+}
+
+fn styled_nick_me(nick: &str) -> Styled {
+    let style = style_me();
+    Styled::new("*", style).and_then(super::style_nick(nick, style))
+}
+
+fn styled_content(content: &str) -> Styled {
+    super::highlight(content.trim(), Style::new(), false)
+}
+
+fn styled_content_me(content: &str) -> Styled {
+    let style = style_me();
+    super::highlight(content.trim(), style, false).then("*", style)
+}
+
+fn styled_editor_content(content: &str) -> Styled {
+    let style = if as_me(content).is_some() {
+        style_me()
+    } else {
+        Style::new()
+    };
+    super::highlight(content, style, true)
+}
+
+impl Msg for SmallMessage {
+    type Id = MessageId;
+
+    fn id(&self) -> Self::Id {
+        self.id
+    }
+
+    fn parent(&self) -> Option<Self::Id> {
+        self.parent
+    }
+
+    fn seen(&self) -> bool {
+        self.seen
+    }
+
+    fn last_possible_id() -> Self::Id {
+        MessageId(Snowflake::MAX)
+    }
+
+    fn nick_emoji(&self) -> Option<String> {
+        Some(util::user_id_emoji(&self.user_id))
+    }
+}
+
+impl ChatMsg for SmallMessage {
+    fn time(&self) -> Option<Timestamp> {
+        Some(self.time.as_timestamp())
+    }
+
+    fn styled(&self) -> (Styled, Styled) {
+        Self::pseudo(&self.nick, &self.content)
+    }
+
+    fn edit(nick: &str, content: &str) -> (Styled, Styled) {
+        (styled_nick(nick), styled_editor_content(content))
+    }
+
+    fn pseudo(nick: &str, content: &str) -> (Styled, Styled) {
+        if let Some(content) = as_me(content) {
+            (styled_nick_me(nick), styled_content_me(content))
+        } else {
+            (styled_nick(nick), styled_content(content))
+        }
+    }
+}

cove/src/euph/util.rs

@@ -1,9 +1,27 @@
-use crossterm::style::{Color, ContentStyle, Stylize};
-use euphoxide::Emoji;
-use once_cell::sync::Lazy;
-use toss::styled::Styled;
+use std::{
+    collections::HashSet,
+    hash::{DefaultHasher, Hash, Hasher},
+    sync::LazyLock,
+};
 
-pub static EMOJI: Lazy<Emoji> = Lazy::new(Emoji::load);
+use crossterm::style::{Color, Stylize};
+use euphoxide::{Emoji, api::UserId};
+use toss::{Style, Styled};
+
+pub static EMOJI: LazyLock<Emoji> = LazyLock::new(Emoji::load);
+
+pub static EMOJI_LIST: LazyLock<Vec<String>> = LazyLock::new(|| {
+    let mut list = EMOJI
+        .0
+        .values()
+        .flatten()
+        .cloned()
+        .collect::<HashSet<_>>()
+        .into_iter()
+        .collect::<Vec<_>>();
+    list.sort_unstable();
+    list
+});
 
 /// Convert HSL to RGB following [this approach from wikipedia][1].
 ///
@@ -42,15 +60,37 @@ pub fn nick_color(nick: &str) -> (u8, u8, u8) {
     hsl_to_rgb(hue, 1.0, 0.72)
 }
 
-pub fn nick_style(nick: &str, base: ContentStyle) -> ContentStyle {
+pub fn nick_style(nick: &str, base: Style) -> Style {
     let (r, g, b) = nick_color(nick);
     base.bold().with(Color::Rgb { r, g, b })
 }
 
-pub fn style_nick(nick: &str, base: ContentStyle) -> Styled {
+pub fn style_nick(nick: &str, base: Style) -> Styled {
     Styled::new(EMOJI.replace(nick), nick_style(nick, base))
 }
 
-pub fn style_nick_exact(nick: &str, base: ContentStyle) -> Styled {
+pub fn style_nick_exact(nick: &str, base: Style) -> Styled {
     Styled::new(nick, nick_style(nick, base))
 }
+
+pub fn style_mention(mention: &str, base: Style) -> Styled {
+    let nick = mention
+        .strip_prefix('@')
+        .expect("mention must start with @");
+    Styled::new(EMOJI.replace(mention), nick_style(nick, base))
+}
+
+pub fn style_mention_exact(mention: &str, base: Style) -> Styled {
+    let nick = mention
+        .strip_prefix('@')
+        .expect("mention must start with @");
+    Styled::new(mention, nick_style(nick, base))
+}
+
+pub fn user_id_emoji(user_id: &UserId) -> String {
+    let mut hasher = DefaultHasher::new();
+    user_id.0.hash(&mut hasher);
+    let hash = hasher.finish();
+    let emoji = &EMOJI_LIST[hash as usize % EMOJI_LIST.len()];
+    emoji.clone()
+}

cove/src/export.rs

@@ -1,21 +1,24 @@
 //! Export logs from the vault to plain text files.
 
+use std::{
+    fs::File,
+    io::{self, BufWriter, Write},
+};
+
+use crate::vault::{EuphRoomVault, EuphVault, RoomIdentifier};
+
 mod json;
 mod text;
 
-use std::fs::File;
-use std::io::{self, BufWriter, Write};
-
-use crate::vault::{EuphRoomVault, EuphVault};
-
 #[derive(Debug, Clone, Copy, clap::ValueEnum)]
 pub enum Format {
     /// Human-readable tree-structured messages.
     Text,
     /// Array of message objects in the same format as the euphoria API uses.
     Json,
-    /// Message objects in the same format as the euphoria API uses, one per line.
-    JsonStream,
+    /// Message objects in the same format as the euphoria API uses, one per
+    /// line (https://jsonlines.org/).
+    JsonLines,
 }
 
 impl Format {
@@ -23,14 +26,15 @@ impl Format {
         match self {
             Self::Text => "text",
             Self::Json => "json",
-            Self::JsonStream => "json stream",
+            Self::JsonLines => "json lines",
         }
     }
 
     fn extension(&self) -> &'static str {
         match self {
             Self::Text => "txt",
-            Self::Json | Self::JsonStream => "json",
+            Self::Json => "json",
+            Self::JsonLines => "jsonl",
         }
     }
 }
@@ -43,6 +47,10 @@ pub struct Args {
     #[arg(long, short)]
     all: bool,
 
+    /// Domain to resolve the room names with.
+    #[arg(long, short, default_value = "euphoria.leet.nu")]
+    domain: String,
+
     /// Format of the output file.
     #[arg(long, short, value_enum, default_value_t = Format::Text)]
     format: Format,
@@ -74,7 +82,7 @@ async fn export_room<W: Write>(
     match format {
         Format::Text => text::export(vault, out).await?,
         Format::Json => json::export(vault, out).await?,
-        Format::JsonStream => json::export_stream(vault, out).await?,
+        Format::JsonLines => json::export_lines(vault, out).await?,
     }
     Ok(())
 }
@@ -85,7 +93,12 @@ pub async fn export(vault: &EuphVault, mut args: Args) -> anyhow::Result<()> {
     }
 
     let rooms = if args.all {
-        let mut rooms = vault.rooms().await?;
+        let mut rooms = vault
+            .rooms()
+            .await?
+            .into_iter()
+            .map(|id| id.name)
+            .collect::<Vec<_>>();
         rooms.sort_unstable();
         rooms
     } else {
@@ -101,14 +114,14 @@ pub async fn export(vault: &EuphVault, mut args: Args) -> anyhow::Result<()> {
     for room in rooms {
         if args.out == "-" {
             eprintln!("Exporting &{room} as {} to stdout", args.format.name());
-            let vault = vault.room(room);
+            let vault = vault.room(RoomIdentifier::new(args.domain.clone(), room));
             let mut stdout = BufWriter::new(io::stdout());
             export_room(&vault, &mut stdout, args.format).await?;
             stdout.flush()?;
         } else {
             let out = format_out(&args.out, &room, args.format);
             eprintln!("Exporting &{room} as {} to {out}", args.format.name());
-            let vault = vault.room(room);
+            let vault = vault.room(RoomIdentifier::new(args.domain.clone(), room));
             let mut file = BufWriter::new(File::create(out)?);
             export_room(&vault, &mut file, args.format).await?;
             file.flush()?;

cove/src/export/json.rs

@@ -37,7 +37,7 @@ pub async fn export<W: Write>(vault: &EuphRoomVault, file: &mut W) -> anyhow::Re
     Ok(())
 }
 
-pub async fn export_stream<W: Write>(vault: &EuphRoomVault, file: &mut W) -> anyhow::Result<()> {
+pub async fn export_lines<W: Write>(vault: &EuphRoomVault, file: &mut W) -> anyhow::Result<()> {
     let mut total = 0;
     let mut last_msg_id = None;
     loop {

cove/src/export/text.rs

@@ -1,16 +1,11 @@
 use std::io::Write;
 
 use euphoxide::api::MessageId;
-use time::format_description::FormatItem;
-use time::macros::format_description;
 use unicode_width::UnicodeWidthStr;
 
-use crate::euph::SmallMessage;
-use crate::store::Tree;
-use crate::vault::EuphRoomVault;
+use crate::{euph::SmallMessage, store::Tree, vault::EuphRoomVault};
 
-const TIME_FORMAT: &[FormatItem<'_>] =
-    format_description!("[year]-[month]-[day] [hour]:[minute]:[second]");
+const TIME_FORMAT: &str = "%Y-%m-%d %H:%M:%S";
 const TIME_EMPTY: &str = "                   ";
 
 pub async fn export<W: Write>(vault: &EuphRoomVault, out: &mut W) -> anyhow::Result<()> {
@@ -67,11 +62,7 @@ fn write_msg<W: Write>(
 
     for (i, line) in msg.content.lines().enumerate() {
         if i == 0 {
-            let time = msg
-                .time
-                .0
-                .format(TIME_FORMAT)
-                .expect("time can be formatted");
+            let time = msg.time.as_timestamp().strftime(TIME_FORMAT);
             writeln!(file, "{time} {indent_string}[{nick}] {line}")?;
         } else {
             writeln!(file, "{TIME_EMPTY} {indent_string}| {nick_empty} {line}")?;

cove/src/logger.rs

@@ -1,22 +1,22 @@
-use std::convert::Infallible;
-use std::sync::Arc;
-use std::vec;
+use std::{convert::Infallible, sync::Arc, vec};
 
 use async_trait::async_trait;
-use crossterm::style::{ContentStyle, Stylize};
+use crossterm::style::Stylize;
+use jiff::Timestamp;
 use log::{Level, LevelFilter, Log};
 use parking_lot::Mutex;
-use time::OffsetDateTime;
 use tokio::sync::mpsc;
-use toss::styled::Styled;
+use toss::{Style, Styled};
 
-use crate::store::{Msg, MsgStore, Path, Tree};
-use crate::ui::ChatMsg;
+use crate::{
+    store::{Msg, MsgStore, Path, Tree},
+    ui::ChatMsg,
+};
 
 #[derive(Debug, Clone)]
 pub struct LogMsg {
     id: usize,
-    time: OffsetDateTime,
+    time: Timestamp,
     level: Level,
     content: String,
 }
@@ -42,17 +42,17 @@ impl Msg for LogMsg {
 }
 
 impl ChatMsg for LogMsg {
-    fn time(&self) -> OffsetDateTime {
-        self.time
+    fn time(&self) -> Option<Timestamp> {
+        Some(self.time)
     }
 
     fn styled(&self) -> (Styled, Styled) {
         let nick_style = match self.level {
-            Level::Error => ContentStyle::default().bold().red(),
-            Level::Warn => ContentStyle::default().bold().yellow(),
-            Level::Info => ContentStyle::default().bold().green(),
-            Level::Debug => ContentStyle::default().bold().blue(),
-            Level::Trace => ContentStyle::default().bold().magenta(),
+            Level::Error => Style::new().bold().red(),
+            Level::Warn => Style::new().bold().yellow(),
+            Level::Info => Style::new().bold().green(),
+            Level::Debug => Style::new().bold().blue(),
+            Level::Trace => Style::new().bold().magenta(),
         };
         let nick = Styled::new(format!("{}", self.level), nick_style);
         let content = Styled::new_plain(&self.content);
@@ -209,7 +209,7 @@ impl Log for Logger {
         let mut guard = self.messages.lock();
         let msg = LogMsg {
             id: guard.len(),
-            time: OffsetDateTime::now_utc(),
+            time: Timestamp::now(),
             level: record.level(),
             content: format!("<{}> {}", record.target(), record.args()),
         };

cove/src/macros.rs

@@ -0,0 +1,12 @@
+macro_rules! logging_unwrap {
+    ($e:expr) => {
+        match $e {
+            Ok(value) => value,
+            Err(err) => {
+                log::error!("{err}");
+                panic!("{err}");
+            }
+        }
+    };
+}
+pub(crate) use logging_unwrap;

cove/src/main.rs

@@ -0,0 +1,253 @@
+// TODO Remove unnecessary Debug impls and compare compile times
+// TODO Invoke external notification command?
+
+use std::path::PathBuf;
+
+use anyhow::Context;
+use clap::Parser;
+use cove_config::{Config, doc::Document};
+use directories::{BaseDirs, ProjectDirs};
+use log::info;
+use tokio::sync::mpsc;
+use toss::Terminal;
+
+use crate::{
+    logger::Logger,
+    ui::Ui,
+    vault::Vault,
+    version::{NAME, VERSION},
+};
+
+mod euph;
+mod export;
+mod logger;
+mod macros;
+mod store;
+mod ui;
+mod util;
+mod vault;
+mod version;
+
+#[derive(Debug, clap::Parser)]
+enum Command {
+    /// Run the client interactively (default).
+    Run,
+    /// Export room logs as plain text files.
+    Export(export::Args),
+    /// Compact and clean up vault.
+    Gc,
+    /// Clear euphoria session cookies.
+    ClearCookies {
+        /// Clear cookies for a specific domain only.
+        #[arg(long, short)]
+        domain: Option<String>,
+    },
+    /// Print config documentation as markdown.
+    HelpConfig,
+}
+
+#[derive(Debug, Clone, Copy, clap::ValueEnum)]
+enum WidthEstimationMethod {
+    Legacy,
+    Unicode,
+}
+
+impl Default for Command {
+    fn default() -> Self {
+        Self::Run
+    }
+}
+
+#[derive(Debug, clap::Parser)]
+#[command(version)]
+struct Args {
+    /// Show more detailed log messages.
+    #[arg(long, short)]
+    verbose: bool,
+
+    /// Path to the config file.
+    ///
+    /// Relative paths are interpreted relative to the current directory.
+    #[arg(long, short)]
+    config: Option<PathBuf>,
+
+    /// Path to a directory for cove to store its data in.
+    ///
+    /// Relative paths are interpreted relative to the current directory.
+    #[arg(long, short)]
+    data_dir: Option<PathBuf>,
+
+    /// If set, cove won't store data permanently.
+    #[arg(long, short)]
+    ephemeral: bool,
+
+    /// If set, cove will ignore the autojoin config option.
+    #[arg(long, short)]
+    offline: bool,
+
+    /// Method for estimating the width of characters as displayed by the
+    /// terminal emulator.
+    #[arg(long, short)]
+    width_estimation_method: Option<WidthEstimationMethod>,
+
+    /// Measure the width of characters as displayed by the terminal emulator
+    /// instead of guessing the width.
+    #[arg(long, short)]
+    measure_widths: bool,
+
+    #[command(subcommand)]
+    command: Option<Command>,
+}
+
+fn config_path(args: &Args, dirs: &ProjectDirs) -> PathBuf {
+    args.config
+        .clone()
+        .unwrap_or_else(|| dirs.config_dir().join("config.toml"))
+}
+
+fn data_dir(config: &Config, dirs: &ProjectDirs) -> PathBuf {
+    config
+        .data_dir
+        .clone()
+        .unwrap_or_else(|| dirs.data_dir().to_path_buf())
+}
+
+fn update_config_with_args(config: &mut Config, args: &Args) {
+    if let Some(data_dir) = args.data_dir.clone() {
+        // The data dir specified via args_data_dir is relative to the current
+        // directory and needs no resolving.
+        config.data_dir = Some(data_dir);
+    } else if let Some(data_dir) = &config.data_dir {
+        // Resolve the data dir specified in the config file relative to the
+        // user's home directory, if possible.
+        let base_dirs = BaseDirs::new().expect("failed to find home directory");
+        config.data_dir = Some(base_dirs.home_dir().join(data_dir));
+    }
+
+    config.ephemeral |= args.ephemeral;
+    if let Some(method) = args.width_estimation_method {
+        config.width_estimation_method = match method {
+            WidthEstimationMethod::Legacy => cove_config::WidthEstimationMethod::Legacy,
+            WidthEstimationMethod::Unicode => cove_config::WidthEstimationMethod::Unicode,
+        }
+    }
+    config.measure_widths |= args.measure_widths;
+    config.offline |= args.offline;
+}
+
+fn open_vault(config: &Config, dirs: &ProjectDirs) -> anyhow::Result<Vault> {
+    let vault = if config.ephemeral {
+        vault::launch_in_memory()?
+    } else {
+        let data_dir = data_dir(config, dirs);
+        eprintln!("Data dir:    {}", data_dir.to_string_lossy());
+        vault::launch(&data_dir.join("vault.db"))?
+    };
+
+    Ok(vault)
+}
+
+#[tokio::main]
+async fn main() -> anyhow::Result<()> {
+    let args = Args::parse();
+
+    let (logger, logger_guard, logger_rx) = Logger::init(args.verbose);
+    let dirs = ProjectDirs::from("de", "plugh", "cove").expect("failed to find config directory");
+
+    // https://github.com/snapview/tokio-tungstenite/issues/353#issuecomment-2455247837
+    rustls::crypto::aws_lc_rs::default_provider()
+        .install_default()
+        .unwrap();
+
+    // Locate config
+    let config_path = config_path(&args, &dirs);
+    eprintln!("Config file: {}", config_path.to_string_lossy());
+
+    // Load config
+    let mut config = Config::load(&config_path)?;
+    update_config_with_args(&mut config, &args);
+    let config = Box::leak(Box::new(config));
+
+    match args.command.unwrap_or_default() {
+        Command::Run => run(logger, logger_rx, config, &dirs).await?,
+        Command::Export(args) => export(config, &dirs, args).await?,
+        Command::Gc => gc(config, &dirs).await?,
+        Command::ClearCookies { domain } => clear_cookies(config, &dirs, domain).await?,
+        Command::HelpConfig => help_config(),
+    }
+
+    // Print all logged errors. This should always happen, even if cove panics,
+    // because the errors may be key in diagnosing what happened. Because of
+    // this, it is not implemented via a normal function call.
+    drop(logger_guard);
+
+    eprintln!("Goodbye!");
+    Ok(())
+}
+
+async fn run(
+    logger: Logger,
+    logger_rx: mpsc::UnboundedReceiver<()>,
+    config: &'static Config,
+    dirs: &ProjectDirs,
+) -> anyhow::Result<()> {
+    info!("Welcome to {NAME} {VERSION}",);
+
+    let tz = util::load_time_zone(config.time_zone_ref()).context("failed to load time zone")?;
+
+    let vault = open_vault(config, dirs)?;
+
+    let mut terminal = Terminal::new()?;
+    terminal.set_measuring(config.measure_widths);
+    terminal.set_width_estimation_method(match config.width_estimation_method {
+        cove_config::WidthEstimationMethod::Legacy => toss::WidthEstimationMethod::Legacy,
+        cove_config::WidthEstimationMethod::Unicode => toss::WidthEstimationMethod::Unicode,
+    });
+    Ui::run(config, tz, &mut terminal, vault.clone(), logger, logger_rx).await?;
+    drop(terminal);
+
+    vault.close().await;
+    Ok(())
+}
+
+async fn export(
+    config: &'static Config,
+    dirs: &ProjectDirs,
+    args: export::Args,
+) -> anyhow::Result<()> {
+    let vault = open_vault(config, dirs)?;
+
+    export::export(&vault.euph(), args).await?;
+
+    vault.close().await;
+    Ok(())
+}
+
+async fn gc(config: &'static Config, dirs: &ProjectDirs) -> anyhow::Result<()> {
+    let vault = open_vault(config, dirs)?;
+
+    eprintln!("Cleaning up and compacting vault");
+    eprintln!("This may take a while...");
+    vault.gc().await?;
+
+    vault.close().await;
+    Ok(())
+}
+
+async fn clear_cookies(
+    config: &'static Config,
+    dirs: &ProjectDirs,
+    domain: Option<String>,
+) -> anyhow::Result<()> {
+    let vault = open_vault(config, dirs)?;
+
+    eprintln!("Clearing cookies");
+    vault.euph().clear_cookies(domain).await?;
+
+    vault.close().await;
+    Ok(())
+}
+
+fn help_config() {
+    print!("{}", Config::doc().as_markdown());
+}

cove/src/store.rs

@@ -1,7 +1,4 @@
-use std::collections::HashMap;
-use std::fmt::Debug;
-use std::hash::Hash;
-use std::vec;
+use std::{collections::HashMap, fmt::Debug, hash::Hash, vec};
 
 use async_trait::async_trait;
 
@@ -11,6 +8,10 @@ pub trait Msg {
     fn parent(&self) -> Option<Self::Id>;
     fn seen(&self) -> bool;
 
+    fn nick_emoji(&self) -> Option<String> {
+        None
+    }
+
     fn last_possible_id() -> Self::Id;
 }
 
@@ -27,12 +28,12 @@ impl<I> Path<I> {
         self.0.iter().take(self.0.len() - 1)
     }
 
-    pub fn push(&mut self, segment: I) {
-        self.0.push(segment)
+    pub fn first(&self) -> &I {
+        self.0.first().expect("path is empty")
     }
 
-    pub fn first(&self) -> &I {
-        self.0.first().expect("path is not empty")
+    pub fn into_first(self) -> I {
+        self.0.into_iter().next().expect("path is empty")
     }
 }
 
@@ -130,6 +131,7 @@ impl<M: Msg> Tree<M> {
     }
 }
 
+#[allow(dead_code)]
 #[async_trait]
 pub trait MsgStore<M: Msg> {
     type Error;

cove/src/ui.rs

@@ -1,37 +1,56 @@
+use std::{
+    convert::Infallible,
+    io,
+    sync::{Arc, Weak},
+    time::{Duration, Instant},
+};
+
+use cove_config::Config;
+use cove_input::InputEvent;
+use jiff::tz::TimeZone;
+use parking_lot::FairMutex;
+use tokio::{
+    sync::mpsc::{self, UnboundedReceiver, UnboundedSender, error::TryRecvError},
+    task,
+};
+use toss::{Terminal, WidgetExt, widgets::BoxedAsync};
+
+use crate::{
+    logger::{LogMsg, Logger},
+    macros::logging_unwrap,
+    util::InfallibleExt,
+    vault::Vault,
+};
+
+pub use self::chat::ChatMsg;
+use self::{chat::ChatState, rooms::Rooms, widgets::ListState};
+
 mod chat;
 mod euph;
-mod input;
+mod key_bindings;
 mod rooms;
 mod util;
 mod widgets;
 
-use std::convert::Infallible;
-use std::io;
-use std::sync::{Arc, Weak};
-use std::time::{Duration, Instant};
-
-use parking_lot::FairMutex;
-use tokio::sync::mpsc::error::TryRecvError;
-use tokio::sync::mpsc::{self, UnboundedReceiver, UnboundedSender};
-use tokio::task;
-use toss::terminal::Terminal;
-
-use crate::config::Config;
-use crate::logger::{LogMsg, Logger};
-use crate::macros::{logging_unwrap, ok_or_return, some_or_return};
-use crate::vault::Vault;
-
-pub use self::chat::ChatMsg;
-use self::chat::ChatState;
-use self::input::{key, InputEvent, KeyBindingsList};
-use self::rooms::Rooms;
-use self::widgets::layer::Layer;
-use self::widgets::list::ListState;
-use self::widgets::BoxedWidget;
-
 /// Time to spend batch processing events before redrawing the screen.
 const EVENT_PROCESSING_TIME: Duration = Duration::from_millis(1000 / 15); // 15 fps
 
+/// Error for anything that can go wrong while rendering.
+#[derive(Debug, thiserror::Error)]
+pub enum UiError {
+    #[error("{0}")]
+    Vault(#[from] vault::tokio::Error<rusqlite::Error>),
+    #[error("{0}")]
+    Io(#[from] io::Error),
+}
+
+impl From<Infallible> for UiError {
+    fn from(value: Infallible) -> Self {
+        Err(value).infallible()
+    }
+}
+
+#[expect(clippy::large_enum_variant)]
 pub enum UiEvent {
     GraphemeWidthsChanged,
     LogChanged,
@@ -51,16 +70,17 @@ enum Mode {
     Log,
 }
 
-// TODO Add Error for anything that can go wrong while rendering
-
 pub struct Ui {
+    config: &'static Config,
     event_tx: UnboundedSender<UiEvent>,
 
     mode: Mode,
 
     rooms: Rooms,
     log_chat: ChatState<LogMsg, Logger>,
-    key_bindings_list: Option<ListState<Infallible>>,
+
+    key_bindings_visible: bool,
+    key_bindings_list: ListState<Infallible>,
 }
 
 impl Ui {
@@ -68,6 +88,7 @@ impl Ui {
 
     pub async fn run(
         config: &'static Config,
+        tz: TimeZone,
         terminal: &mut Terminal,
         vault: Vault,
         logger: Logger,
@@ -93,11 +114,13 @@ impl Ui {
         // On the other hand, if the crossterm_event_task stops for any reason,
         // the rest of the UI is also shut down and the client stops.
         let mut ui = Self {
+            config,
             event_tx: event_tx.clone(),
             mode: Mode::Main,
-            rooms: Rooms::new(config, vault, event_tx.clone()).await,
-            log_chat: ChatState::new(logger),
-            key_bindings_list: None,
+            rooms: Rooms::new(config, tz.clone(), vault, event_tx.clone()).await,
+            log_chat: ChatState::new(logger, tz),
+            key_bindings_visible: false,
+            key_bindings_list: ListState::new(),
         };
         tokio::select! {
             e = ui.run_main(terminal, event_rx, crossterm_lock) => e?,
@@ -110,13 +133,17 @@ impl Ui {
     fn poll_crossterm_events(
         tx: UnboundedSender<UiEvent>,
         lock: Weak<FairMutex<()>>,
-    ) -> crossterm::Result<()> {
+    ) -> io::Result<()> {
         loop {
-            let lock = some_or_return!(lock.upgrade(), Ok(()));
+            let Some(lock) = lock.upgrade() else {
+                return Ok(());
+            };
             let _guard = lock.lock();
             if crossterm::event::poll(Self::POLL_DURATION)? {
                 let event = crossterm::event::read()?;
-                ok_or_return!(tx.send(UiEvent::Term(event)), Ok(()));
+                if tx.send(UiEvent::Term(event)).is_err() {
+                    return Ok(());
+                }
             }
         }
     }
@@ -126,8 +153,12 @@ impl Ui {
         event_tx: &UnboundedSender<UiEvent>,
     ) {
         loop {
-            some_or_return!(logger_rx.recv().await);
-            ok_or_return!(event_tx.send(UiEvent::LogChanged));
+            if logger_rx.recv().await.is_none() {
+                return;
+            }
+            if event_tx.send(UiEvent::LogChanged).is_err() {
+                return;
+            }
         }
     }
 
@@ -136,27 +167,28 @@ impl Ui {
         terminal: &mut Terminal,
         mut event_rx: UnboundedReceiver<UiEvent>,
         crossterm_lock: Arc<FairMutex<()>>,
-    ) -> io::Result<()> {
-        // Initial render so we don't show a blank screen until the first event
-        terminal.autoresize()?;
-        terminal.frame().reset();
-        self.widget().await.render(terminal.frame()).await;
-        terminal.present()?;
+    ) -> Result<(), UiError> {
+        let mut redraw = true;
 
         loop {
-            // 1. Measure grapheme widths if required
-            if terminal.measuring_required() {
-                let _guard = crossterm_lock.lock();
-                terminal.measure_widths()?;
-                ok_or_return!(self.event_tx.send(UiEvent::GraphemeWidthsChanged), Ok(()));
+            // Redraw if necessary
+            if redraw {
+                redraw = false;
+                terminal.present_async_widget(self.widget().await).await?;
+
+                if terminal.measuring_required() {
+                    let _guard = crossterm_lock.lock();
+                    terminal.measure_widths()?;
+                    if self.event_tx.send(UiEvent::GraphemeWidthsChanged).is_err() {
+                        return Ok(());
+                    }
+                }
             }
 
-            // 2. Handle events (in batches)
-            let mut event = match event_rx.recv().await {
-                Some(event) => event,
-                None => return Ok(()),
+            // Handle events (in batches)
+            let Some(mut event) = event_rx.recv().await else {
+                return Ok(());
             };
-            let mut redraw = false;
             let end_time = Instant::now() + EVENT_PROCESSING_TIME;
             loop {
                 match self.handle_event(terminal, &crossterm_lock, event).await {
@@ -173,49 +205,23 @@ impl Ui {
                     Err(TryRecvError::Disconnected) => return Ok(()),
                 };
             }
-
-            // 3. Render and present final state
-            if redraw {
-                terminal.autoresize()?;
-                terminal.frame().reset();
-                self.widget().await.render(terminal.frame()).await;
-                terminal.present()?;
-            }
         }
     }
 
-    async fn widget(&mut self) -> BoxedWidget {
+    async fn widget(&mut self) -> BoxedAsync<'_, UiError> {
         let widget = match self.mode {
             Mode::Main => self.rooms.widget().await,
-            Mode::Log => self.log_chat.widget(String::new(), true).into(),
+            Mode::Log => self.log_chat.widget(String::new(), true),
         };
 
-        if let Some(key_bindings_list) = &self.key_bindings_list {
-            let mut bindings = KeyBindingsList::new(key_bindings_list);
-            self.list_key_bindings(&mut bindings).await;
-            Layer::new(vec![widget, bindings.widget()]).into()
+        if self.key_bindings_visible {
+            let popup = key_bindings::widget(&mut self.key_bindings_list, self.config);
+            popup.desync().above(widget).boxed_async()
         } else {
             widget
         }
     }
 
-    fn show_key_bindings(&mut self) {
-        if self.key_bindings_list.is_none() {
-            self.key_bindings_list = Some(ListState::new())
-        }
-    }
-
-    async fn list_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("ctrl+c", "quit cove");
-        bindings.binding("F1, ?", "show this menu");
-        bindings.binding("F12", "toggle log");
-        bindings.empty();
-        match self.mode {
-            Mode::Main => self.rooms.list_key_bindings(bindings).await,
-            Mode::Log => self.log_chat.list_key_bindings(bindings, false).await,
-        }
-    }
-
     async fn handle_event(
         &mut self,
         terminal: &mut Terminal,
@@ -228,7 +234,7 @@ impl Ui {
             UiEvent::LogChanged => EventHandleResult::Continue,
             UiEvent::Term(crossterm::event::Event::Resize(_, _)) => EventHandleResult::Redraw,
             UiEvent::Term(event) => {
-                self.handle_term_event(terminal, crossterm_lock, event)
+                self.handle_term_event(terminal, crossterm_lock.clone(), event)
                     .await
             }
             UiEvent::Euph(event) => {
@@ -244,74 +250,62 @@ impl Ui {
     async fn handle_term_event(
         &mut self,
         terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
+        crossterm_lock: Arc<FairMutex<()>>,
         event: crossterm::event::Event,
     ) -> EventHandleResult {
-        let event = some_or_return!(InputEvent::from_event(event), EventHandleResult::Continue);
+        let mut event = InputEvent::new(event, terminal, crossterm_lock);
+        let keys = &self.config.keys;
 
-        if let key!(Ctrl + 'c') = event {
-            // Exit unconditionally on ctrl+c. Previously, shift+q would also
-            // unconditionally exit, but that interfered with typing text in
-            // inline editors.
+        if event.matches(&keys.general.exit) {
             return EventHandleResult::Stop;
         }
 
         // Key bindings list overrides any other bindings if visible
-        if let Some(key_bindings_list) = &mut self.key_bindings_list {
-            match event {
-                key!(Esc) | key!(F 1) | key!('?') => self.key_bindings_list = None,
-                key!('k') | key!(Up) => key_bindings_list.scroll_up(1),
-                key!('j') | key!(Down) => key_bindings_list.scroll_down(1),
-                _ => return EventHandleResult::Continue,
+        if self.key_bindings_visible {
+            if event.matches(&keys.general.abort) || event.matches(&keys.general.help) {
+                self.key_bindings_visible = false;
+                return EventHandleResult::Redraw;
             }
+            if key_bindings::handle_input_event(&mut self.key_bindings_list, &mut event, keys) {
+                return EventHandleResult::Redraw;
+            }
+            // ... and does not let anything below the popup receive events
+            return EventHandleResult::Continue;
+        }
+
+        if event.matches(&keys.general.help) {
+            self.key_bindings_visible = true;
             return EventHandleResult::Redraw;
         }
 
-        match event {
-            key!(F 1) => {
-                self.key_bindings_list = Some(ListState::new());
-                return EventHandleResult::Redraw;
-            }
-            key!(F 12) => {
-                self.mode = match self.mode {
-                    Mode::Main => Mode::Log,
-                    Mode::Log => Mode::Main,
-                };
-                return EventHandleResult::Redraw;
-            }
-            _ => {}
-        }
-
-        let mut handled = match self.mode {
+        match self.mode {
             Mode::Main => {
-                self.rooms
-                    .handle_input_event(terminal, crossterm_lock, &event)
-                    .await
+                if event.matches(&keys.general.log) {
+                    self.mode = Mode::Log;
+                    return EventHandleResult::Redraw;
+                }
+
+                if self.rooms.handle_input_event(&mut event, keys).await {
+                    return EventHandleResult::Redraw;
+                }
             }
             Mode::Log => {
+                if event.matches(&keys.general.abort) || event.matches(&keys.general.log) {
+                    self.mode = Mode::Main;
+                    return EventHandleResult::Redraw;
+                }
+
                 let reaction = self
                     .log_chat
-                    .handle_input_event(terminal, crossterm_lock, &event, false)
+                    .handle_input_event(&mut event, keys, false)
                     .await;
                 let reaction = logging_unwrap!(reaction);
-                reaction.handled()
-            }
-        };
-
-        // Pressing '?' should only open the key bindings list if it doesn't
-        // interfere with any part of the main UI, such as entering text in a
-        // text editor.
-        if !handled {
-            if let key!('?') = event {
-                self.show_key_bindings();
-                handled = true;
+                if reaction.handled() {
+                    return EventHandleResult::Redraw;
+                }
             }
         }
 
-        if handled {
-            EventHandleResult::Redraw
-        } else {
-            EventHandleResult::Continue
-        }
+        EventHandleResult::Continue
     }
 }

cove/src/ui/chat.rs

@@ -0,0 +1,186 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use jiff::{Timestamp, tz::TimeZone};
+use toss::{
+    Styled, WidgetExt,
+    widgets::{BoxedAsync, EditorState},
+};
+
+use crate::{
+    store::{Msg, MsgStore},
+    util,
+};
+
+use super::UiError;
+
+use self::{cursor::Cursor, tree::TreeViewState};
+
+mod blocks;
+mod cursor;
+mod renderer;
+mod tree;
+mod widgets;
+
+pub trait ChatMsg {
+    fn time(&self) -> Option<Timestamp>;
+    fn styled(&self) -> (Styled, Styled);
+    fn edit(nick: &str, content: &str) -> (Styled, Styled);
+    fn pseudo(nick: &str, content: &str) -> (Styled, Styled);
+}
+
+pub enum Mode {
+    Tree,
+}
+
+pub struct ChatState<M: Msg, S: MsgStore<M>> {
+    store: S,
+
+    cursor: Cursor<M::Id>,
+    editor: EditorState,
+    nick_emoji: bool,
+    caesar: i8,
+
+    mode: Mode,
+    tree: TreeViewState<M, S>,
+}
+
+impl<M: Msg, S: MsgStore<M> + Clone> ChatState<M, S> {
+    pub fn new(store: S, tz: TimeZone) -> Self {
+        Self {
+            cursor: Cursor::Bottom,
+            editor: EditorState::new(),
+            nick_emoji: false,
+            caesar: 0,
+
+            mode: Mode::Tree,
+            tree: TreeViewState::new(store.clone(), tz),
+
+            store,
+        }
+    }
+
+    pub fn nick_emoji(&self) -> bool {
+        self.nick_emoji
+    }
+}
+
+impl<M: Msg, S: MsgStore<M>> ChatState<M, S> {
+    pub fn store(&self) -> &S {
+        &self.store
+    }
+
+    pub fn widget(&mut self, nick: String, focused: bool) -> BoxedAsync<'_, UiError>
+    where
+        M: ChatMsg + Send + Sync,
+        M::Id: Send + Sync,
+        S: Send + Sync,
+        S::Error: Send,
+        UiError: From<S::Error>,
+    {
+        match self.mode {
+            Mode::Tree => self
+                .tree
+                .widget(
+                    &mut self.cursor,
+                    &mut self.editor,
+                    nick,
+                    focused,
+                    self.nick_emoji,
+                    self.caesar,
+                )
+                .boxed_async(),
+        }
+    }
+
+    pub async fn handle_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        can_compose: bool,
+    ) -> Result<Reaction<M>, S::Error>
+    where
+        M: ChatMsg + Send + Sync,
+        M::Id: Send + Sync,
+        S: Send + Sync,
+        S::Error: Send,
+    {
+        let reaction = match self.mode {
+            Mode::Tree => {
+                self.tree
+                    .handle_input_event(
+                        event,
+                        keys,
+                        &mut self.cursor,
+                        &mut self.editor,
+                        can_compose,
+                    )
+                    .await?
+            }
+        };
+
+        Ok(match reaction {
+            Reaction::Composed { parent, content } if self.caesar != 0 => {
+                let content = util::caesar(&content, self.caesar);
+                Reaction::Composed { parent, content }
+            }
+
+            Reaction::NotHandled if event.matches(&keys.tree.action.toggle_nick_emoji) => {
+                self.nick_emoji = !self.nick_emoji;
+                Reaction::Handled
+            }
+
+            Reaction::NotHandled if event.matches(&keys.tree.action.increase_caesar) => {
+                self.caesar = (self.caesar + 1).rem_euclid(26);
+                Reaction::Handled
+            }
+
+            Reaction::NotHandled if event.matches(&keys.tree.action.decrease_caesar) => {
+                self.caesar = (self.caesar - 1).rem_euclid(26);
+                Reaction::Handled
+            }
+
+            reaction => reaction,
+        })
+    }
+
+    pub fn cursor(&self) -> Option<&M::Id> {
+        match &self.cursor {
+            Cursor::Msg(id) => Some(id),
+            Cursor::Bottom | Cursor::Editor { .. } | Cursor::Pseudo { .. } => None,
+        }
+    }
+
+    /// A [`Reaction::Composed`] message was sent successfully.
+    pub fn send_successful(&mut self, id: M::Id) {
+        if let Cursor::Pseudo { .. } = &self.cursor {
+            self.tree.send_successful(&id);
+            self.cursor = Cursor::Msg(id);
+            self.editor.clear();
+        }
+    }
+
+    /// A [`Reaction::Composed`] message failed to be sent.
+    pub fn send_failed(&mut self) {
+        if let Cursor::Pseudo { coming_from, .. } = &self.cursor {
+            self.cursor = match coming_from {
+                Some(id) => Cursor::Msg(id.clone()),
+                None => Cursor::Bottom,
+            };
+        }
+    }
+}
+
+pub enum Reaction<M: Msg> {
+    NotHandled,
+    Handled,
+    Composed {
+        parent: Option<M::Id>,
+        content: String,
+    },
+}
+
+impl<M: Msg> Reaction<M> {
+    pub fn handled(&self) -> bool {
+        !matches!(self, Self::NotHandled)
+    }
+}

cove/src/ui/chat/blocks.rs

@@ -0,0 +1,214 @@
+//! Common rendering logic.
+
+use std::collections::{VecDeque, vec_deque};
+
+use toss::widgets::Predrawn;
+
+#[derive(Debug, Clone, Copy, PartialEq, Eq, PartialOrd, Ord)]
+pub struct Range<T> {
+    pub top: T,
+    pub bottom: T,
+}
+
+impl<T> Range<T> {
+    pub fn new(top: T, bottom: T) -> Self {
+        Self { top, bottom }
+    }
+}
+
+impl Range<i32> {
+    pub fn shifted(self, delta: i32) -> Self {
+        Self::new(self.top + delta, self.bottom + delta)
+    }
+
+    pub fn with_top(self, top: i32) -> Self {
+        self.shifted(top - self.top)
+    }
+
+    pub fn with_bottom(self, bottom: i32) -> Self {
+        self.shifted(bottom - self.bottom)
+    }
+}
+
+pub struct Block<Id> {
+    id: Id,
+    widget: Predrawn,
+    focus: Range<i32>,
+    can_be_cursor: bool,
+}
+
+impl<Id> Block<Id> {
+    pub fn new(id: Id, widget: Predrawn, can_be_cursor: bool) -> Self {
+        let height: i32 = widget.size().height.into();
+        Self {
+            id,
+            widget,
+            focus: Range::new(0, height),
+            can_be_cursor,
+        }
+    }
+
+    pub fn id(&self) -> &Id {
+        &self.id
+    }
+
+    pub fn into_widget(self) -> Predrawn {
+        self.widget
+    }
+
+    fn height(&self) -> i32 {
+        self.widget.size().height.into()
+    }
+
+    pub fn set_focus(&mut self, focus: Range<i32>) {
+        assert!(0 <= focus.top);
+        assert!(focus.top <= focus.bottom);
+        assert!(focus.bottom <= self.height());
+        self.focus = focus;
+    }
+
+    pub fn focus(&self, range: Range<i32>) -> Range<i32> {
+        Range::new(range.top + self.focus.top, range.top + self.focus.bottom)
+    }
+
+    pub fn can_be_cursor(&self) -> bool {
+        self.can_be_cursor
+    }
+}
+
+pub struct Blocks<Id> {
+    blocks: VecDeque<Block<Id>>,
+    range: Range<i32>,
+    end: Range<bool>,
+}
+
+impl<Id> Blocks<Id> {
+    pub fn new(at: i32) -> Self {
+        Self {
+            blocks: VecDeque::new(),
+            range: Range::new(at, at),
+            end: Range::new(false, false),
+        }
+    }
+
+    pub fn range(&self) -> Range<i32> {
+        self.range
+    }
+
+    pub fn end(&self) -> Range<bool> {
+        self.end
+    }
+
+    pub fn iter(&self) -> Iter<'_, Id> {
+        Iter {
+            iter: self.blocks.iter(),
+            range: self.range,
+        }
+    }
+
+    pub fn into_iter(self) -> IntoIter<Id> {
+        IntoIter {
+            iter: self.blocks.into_iter(),
+            range: self.range,
+        }
+    }
+
+    pub fn find_block(&self, id: &Id) -> Option<(Range<i32>, &Block<Id>)>
+    where
+        Id: Eq,
+    {
+        self.iter().find(|(_, block)| block.id == *id)
+    }
+
+    pub fn push_top(&mut self, block: Block<Id>) {
+        assert!(!self.end.top);
+        self.range.top -= block.height();
+        self.blocks.push_front(block);
+    }
+
+    pub fn push_bottom(&mut self, block: Block<Id>) {
+        assert!(!self.end.bottom);
+        self.range.bottom += block.height();
+        self.blocks.push_back(block);
+    }
+
+    pub fn append_top(&mut self, other: Self) {
+        assert!(!self.end.top);
+        assert!(!other.end.bottom);
+        for block in other.blocks.into_iter().rev() {
+            self.push_top(block);
+        }
+        self.end.top = other.end.top;
+    }
+
+    pub fn append_bottom(&mut self, other: Self) {
+        assert!(!self.end.bottom);
+        assert!(!other.end.top);
+        for block in other.blocks {
+            self.push_bottom(block);
+        }
+        self.end.bottom = other.end.bottom;
+    }
+
+    pub fn end_top(&mut self) {
+        self.end.top = true;
+    }
+
+    pub fn end_bottom(&mut self) {
+        self.end.bottom = true;
+    }
+
+    pub fn shift(&mut self, delta: i32) {
+        self.range = self.range.shifted(delta);
+    }
+}
+
+pub struct Iter<'a, Id> {
+    iter: vec_deque::Iter<'a, Block<Id>>,
+    range: Range<i32>,
+}
+
+impl<'a, Id> Iterator for Iter<'a, Id> {
+    type Item = (Range<i32>, &'a Block<Id>);
+
+    fn next(&mut self) -> Option<Self::Item> {
+        let block = self.iter.next()?;
+        let range = Range::new(self.range.top, self.range.top + block.height());
+        self.range.top = range.bottom;
+        Some((range, block))
+    }
+}
+
+impl<Id> DoubleEndedIterator for Iter<'_, Id> {
+    fn next_back(&mut self) -> Option<Self::Item> {
+        let block = self.iter.next_back()?;
+        let range = Range::new(self.range.bottom - block.height(), self.range.bottom);
+        self.range.bottom = range.top;
+        Some((range, block))
+    }
+}
+
+pub struct IntoIter<Id> {
+    iter: vec_deque::IntoIter<Block<Id>>,
+    range: Range<i32>,
+}
+
+impl<Id> Iterator for IntoIter<Id> {
+    type Item = (Range<i32>, Block<Id>);
+
+    fn next(&mut self) -> Option<Self::Item> {
+        let block = self.iter.next()?;
+        let range = Range::new(self.range.top, self.range.top + block.height());
+        self.range.top = range.bottom;
+        Some((range, block))
+    }
+}
+
+impl<Id> DoubleEndedIterator for IntoIter<Id> {
+    fn next_back(&mut self) -> Option<Self::Item> {
+        let block = self.iter.next_back()?;
+        let range = Range::new(self.range.bottom - block.height(), self.range.bottom);
+        self.range.bottom = range.top;
+        Some((range, block))
+    }
+}

cove/src/ui/chat/cursor.rs

@@ -0,0 +1,527 @@
+//! Common cursor movement logic.
+
+use std::{collections::HashSet, hash::Hash};
+
+use crate::store::{Msg, MsgStore, Tree};
+
+#[derive(Debug, Clone, Copy, PartialEq, Eq)]
+pub enum Cursor<Id> {
+    Bottom,
+    Msg(Id),
+    Editor {
+        coming_from: Option<Id>,
+        parent: Option<Id>,
+    },
+    Pseudo {
+        coming_from: Option<Id>,
+        parent: Option<Id>,
+    },
+}
+
+impl<Id: Clone + Eq + Hash> Cursor<Id> {
+    fn find_parent<M>(tree: &Tree<M>, id: &mut Id) -> bool
+    where
+        M: Msg<Id = Id>,
+    {
+        if let Some(parent) = tree.parent(id) {
+            *id = parent;
+            true
+        } else {
+            false
+        }
+    }
+
+    /// Move to the previous sibling, or don't move if this is not possible.
+    ///
+    /// Always stays at the same level of indentation.
+    async fn find_prev_sibling<M, S>(
+        store: &S,
+        tree: &mut Tree<M>,
+        id: &mut Id,
+    ) -> Result<bool, S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        let moved = if let Some(prev_sibling) = tree.prev_sibling(id) {
+            *id = prev_sibling;
+            true
+        } else if tree.parent(id).is_none() {
+            // We're at the root of our tree, so we need to move to the root of
+            // the previous tree.
+            if let Some(prev_root_id) = store.prev_root_id(tree.root()).await? {
+                *tree = store.tree(&prev_root_id).await?;
+                *id = prev_root_id;
+                true
+            } else {
+                false
+            }
+        } else {
+            false
+        };
+        Ok(moved)
+    }
+
+    /// Move to the next sibling, or don't move if this is not possible.
+    ///
+    /// Always stays at the same level of indentation.
+    async fn find_next_sibling<M, S>(
+        store: &S,
+        tree: &mut Tree<M>,
+        id: &mut Id,
+    ) -> Result<bool, S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        let moved = if let Some(next_sibling) = tree.next_sibling(id) {
+            *id = next_sibling;
+            true
+        } else if tree.parent(id).is_none() {
+            // We're at the root of our tree, so we need to move to the root of
+            // the next tree.
+            if let Some(next_root_id) = store.next_root_id(tree.root()).await? {
+                *tree = store.tree(&next_root_id).await?;
+                *id = next_root_id;
+                true
+            } else {
+                false
+            }
+        } else {
+            false
+        };
+        Ok(moved)
+    }
+
+    fn find_first_child_in_tree<M>(folded: &HashSet<Id>, tree: &Tree<M>, id: &mut Id) -> bool
+    where
+        M: Msg<Id = Id>,
+    {
+        if folded.contains(id) {
+            return false;
+        }
+
+        if let Some(child) = tree.children(id).and_then(|c| c.first()) {
+            *id = child.clone();
+            true
+        } else {
+            false
+        }
+    }
+
+    fn find_last_child_in_tree<M>(folded: &HashSet<Id>, tree: &Tree<M>, id: &mut Id) -> bool
+    where
+        M: Msg<Id = Id>,
+    {
+        if folded.contains(id) {
+            return false;
+        }
+
+        if let Some(child) = tree.children(id).and_then(|c| c.last()) {
+            *id = child.clone();
+            true
+        } else {
+            false
+        }
+    }
+
+    /// Move to the message above, or don't move if this is not possible.
+    async fn find_above_msg_in_tree<M, S>(
+        store: &S,
+        folded: &HashSet<Id>,
+        tree: &mut Tree<M>,
+        id: &mut Id,
+    ) -> Result<bool, S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        // Move to previous sibling, then to its last child
+        // If not possible, move to parent
+        let moved = if Self::find_prev_sibling(store, tree, id).await? {
+            while Self::find_last_child_in_tree(folded, tree, id) {}
+            true
+        } else {
+            Self::find_parent(tree, id)
+        };
+        Ok(moved)
+    }
+
+    /// Move to the next message, or don't move if this is not possible.
+    async fn find_below_msg_in_tree<M, S>(
+        store: &S,
+        folded: &HashSet<Id>,
+        tree: &mut Tree<M>,
+        id: &mut Id,
+    ) -> Result<bool, S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        if Self::find_first_child_in_tree(folded, tree, id) {
+            return Ok(true);
+        }
+
+        if Self::find_next_sibling(store, tree, id).await? {
+            return Ok(true);
+        }
+
+        // Temporary id to avoid modifying the original one if no parent-sibling
+        // can be found.
+        let mut tmp_id = id.clone();
+        while Self::find_parent(tree, &mut tmp_id) {
+            if Self::find_next_sibling(store, tree, &mut tmp_id).await? {
+                *id = tmp_id;
+                return Ok(true);
+            }
+        }
+
+        Ok(false)
+    }
+
+    pub async fn move_to_top<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        if let Some(first_root_id) = store.first_root_id().await? {
+            *self = Self::Msg(first_root_id);
+        }
+        Ok(())
+    }
+
+    pub fn move_to_bottom(&mut self) {
+        *self = Self::Bottom;
+    }
+
+    pub async fn move_to_older_msg<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Msg(id) => {
+                if let Some(prev_id) = store.older_msg_id(id).await? {
+                    *id = prev_id;
+                }
+            }
+            Self::Bottom | Self::Pseudo { .. } => {
+                if let Some(id) = store.newest_msg_id().await? {
+                    *self = Self::Msg(id);
+                }
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_newer_msg<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Msg(id) => {
+                if let Some(prev_id) = store.newer_msg_id(id).await? {
+                    *id = prev_id;
+                } else {
+                    *self = Self::Bottom;
+                }
+            }
+            Self::Pseudo { .. } => {
+                *self = Self::Bottom;
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_older_unseen_msg<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Msg(id) => {
+                if let Some(prev_id) = store.older_unseen_msg_id(id).await? {
+                    *id = prev_id;
+                }
+            }
+            Self::Bottom | Self::Pseudo { .. } => {
+                if let Some(id) = store.newest_unseen_msg_id().await? {
+                    *self = Self::Msg(id);
+                }
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_newer_unseen_msg<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Msg(id) => {
+                if let Some(prev_id) = store.newer_unseen_msg_id(id).await? {
+                    *id = prev_id;
+                } else {
+                    *self = Self::Bottom;
+                }
+            }
+            Self::Pseudo { .. } => {
+                *self = Self::Bottom;
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_parent<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Editor { parent, .. } | Self::Pseudo { parent, .. } => {
+                if let Some(parent_id) = parent {
+                    *self = Self::Msg(parent_id.clone())
+                }
+            }
+
+            Self::Msg(id) => {
+                let path = store.path(id).await?;
+                if let Some(parent_id) = path.parent_segments().last() {
+                    *id = parent_id.clone();
+                }
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_root<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Pseudo {
+                parent: Some(parent),
+                ..
+            } => {
+                let path = store.path(parent).await?;
+                *self = Self::Msg(path.first().clone());
+            }
+            Self::Msg(id) => {
+                let path = store.path(id).await?;
+                *id = path.first().clone();
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_prev_sibling<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Bottom | Self::Pseudo { parent: None, .. } => {
+                if let Some(last_root_id) = store.last_root_id().await? {
+                    *self = Self::Msg(last_root_id);
+                }
+            }
+            Self::Msg(msg) => {
+                let path = store.path(msg).await?;
+                let mut tree = store.tree(path.first()).await?;
+                Self::find_prev_sibling(store, &mut tree, msg).await?;
+            }
+            Self::Editor { .. } => {}
+            Self::Pseudo {
+                parent: Some(parent),
+                ..
+            } => {
+                let path = store.path(parent).await?;
+                let tree = store.tree(path.first()).await?;
+                if let Some(children) = tree.children(parent) {
+                    if let Some(last_child) = children.last() {
+                        *self = Self::Msg(last_child.clone());
+                    }
+                }
+            }
+        }
+        Ok(())
+    }
+
+    pub async fn move_to_next_sibling<M, S>(&mut self, store: &S) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Msg(msg) => {
+                let path = store.path(msg).await?;
+                let mut tree = store.tree(path.first()).await?;
+                if !Self::find_next_sibling(store, &mut tree, msg).await?
+                    && tree.parent(msg).is_none()
+                {
+                    *self = Self::Bottom;
+                }
+            }
+            Self::Pseudo { parent: None, .. } => {
+                *self = Self::Bottom;
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    pub async fn move_up_in_tree<M, S>(
+        &mut self,
+        store: &S,
+        folded: &HashSet<Id>,
+    ) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Bottom | Self::Pseudo { parent: None, .. } => {
+                if let Some(last_root_id) = store.last_root_id().await? {
+                    let tree = store.tree(&last_root_id).await?;
+                    let mut id = last_root_id;
+                    while Self::find_last_child_in_tree(folded, &tree, &mut id) {}
+                    *self = Self::Msg(id);
+                }
+            }
+            Self::Msg(msg) => {
+                let path = store.path(msg).await?;
+                let mut tree = store.tree(path.first()).await?;
+                Self::find_above_msg_in_tree(store, folded, &mut tree, msg).await?;
+            }
+            Self::Editor { .. } => {}
+            Self::Pseudo {
+                parent: Some(parent),
+                ..
+            } => {
+                let tree = store.tree(parent).await?;
+                let mut id = parent.clone();
+                while Self::find_last_child_in_tree(folded, &tree, &mut id) {}
+                *self = Self::Msg(id);
+            }
+        }
+        Ok(())
+    }
+
+    pub async fn move_down_in_tree<M, S>(
+        &mut self,
+        store: &S,
+        folded: &HashSet<Id>,
+    ) -> Result<(), S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        match self {
+            Self::Msg(msg) => {
+                let path = store.path(msg).await?;
+                let mut tree = store.tree(path.first()).await?;
+                if !Self::find_below_msg_in_tree(store, folded, &mut tree, msg).await? {
+                    *self = Self::Bottom;
+                }
+            }
+            Self::Pseudo { parent: None, .. } => {
+                *self = Self::Bottom;
+            }
+            Self::Pseudo {
+                parent: Some(parent),
+                ..
+            } => {
+                let mut tree = store.tree(parent).await?;
+                let mut id = parent.clone();
+                while Self::find_last_child_in_tree(folded, &tree, &mut id) {}
+                // Now we're at the previous message
+                if Self::find_below_msg_in_tree(store, folded, &mut tree, &mut id).await? {
+                    *self = Self::Msg(id);
+                } else {
+                    *self = Self::Bottom;
+                }
+            }
+            _ => {}
+        }
+        Ok(())
+    }
+
+    /// The outer `Option` shows whether a parent exists or not. The inner
+    /// `Option` shows if that parent has an id.
+    pub async fn parent_for_normal_tree_reply<M, S>(
+        &self,
+        store: &S,
+    ) -> Result<Option<Option<M::Id>>, S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        Ok(match self {
+            Self::Bottom => Some(None),
+            Self::Msg(id) => {
+                let path = store.path(id).await?;
+                let tree = store.tree(path.first()).await?;
+
+                Some(Some(if tree.next_sibling(id).is_some() {
+                    // A reply to a message that has further siblings should be
+                    // a direct reply. An indirect reply might end up a lot
+                    // further down in the current conversation.
+                    id.clone()
+                } else if let Some(parent) = tree.parent(id) {
+                    // A reply to a message without younger siblings should be
+                    // an indirect reply so as not to create unnecessarily deep
+                    // threads. In the case that our message has children, this
+                    // might get a bit confusing. I'm not sure yet how well this
+                    // "smart" reply actually works in practice.
+                    parent
+                } else {
+                    // When replying to a top-level message, it makes sense to
+                    // avoid creating unnecessary new threads.
+                    id.clone()
+                }))
+            }
+            _ => None,
+        })
+    }
+
+    /// The outer `Option` shows whether a parent exists or not. The inner
+    /// `Option` shows if that parent has an id.
+    pub async fn parent_for_alternate_tree_reply<M, S>(
+        &self,
+        store: &S,
+    ) -> Result<Option<Option<M::Id>>, S::Error>
+    where
+        M: Msg<Id = Id>,
+        S: MsgStore<M>,
+    {
+        Ok(match self {
+            Self::Bottom => Some(None),
+            Self::Msg(id) => {
+                let path = store.path(id).await?;
+                let tree = store.tree(path.first()).await?;
+
+                Some(Some(if tree.next_sibling(id).is_none() {
+                    // The opposite of replying normally
+                    id.clone()
+                } else if let Some(parent) = tree.parent(id) {
+                    // The opposite of replying normally
+                    parent
+                } else {
+                    // The same as replying normally, still to avoid creating
+                    // unnecessary new threads
+                    id.clone()
+                }))
+            }
+            _ => None,
+        })
+    }
+}

cove/src/ui/chat/renderer.rs

@@ -0,0 +1,328 @@
+use std::cmp::Ordering;
+
+use async_trait::async_trait;
+use toss::Size;
+
+use super::blocks::{Blocks, Range};
+
+#[async_trait]
+pub trait Renderer<Id> {
+    type Error;
+
+    fn size(&self) -> Size;
+    fn scrolloff(&self) -> i32;
+
+    fn blocks(&self) -> &Blocks<Id>;
+    fn blocks_mut(&mut self) -> &mut Blocks<Id>;
+
+    async fn expand_top(&mut self) -> Result<(), Self::Error>;
+    async fn expand_bottom(&mut self) -> Result<(), Self::Error>;
+}
+
+/// A range of all the lines that are visible given the renderer's size.
+pub fn visible_area<Id, R>(r: &R) -> Range<i32>
+where
+    R: Renderer<Id>,
+{
+    let height: i32 = r.size().height.into();
+    Range::new(0, height)
+}
+
+/// The renderer's visible area, reduced by its scrolloff at the top and bottom.
+fn scroll_area<Id, R>(r: &R) -> Range<i32>
+where
+    R: Renderer<Id>,
+{
+    let range = visible_area(r);
+    let scrolloff = r.scrolloff();
+    let top = range.top + scrolloff;
+    let bottom = top.max(range.bottom - scrolloff);
+    Range::new(top, bottom)
+}
+
+/// Compute a delta that makes the object partially or fully overlap the area
+/// when added to the object. This delta should be as close to zero as possible.
+///
+/// If the object has a height of zero, it must be within the area or exactly on
+/// its border to be considered overlapping.
+///
+/// If the object has a nonzero height, at least one line of the object must be
+/// within the area for the object to be considered overlapping.
+fn overlap_delta(area: Range<i32>, object: Range<i32>) -> i32 {
+    assert!(object.top <= object.bottom, "object range not well-formed");
+    assert!(area.top <= area.bottom, "area range not well-formed");
+
+    if object.top == object.bottom || area.top == area.bottom {
+        // Delta that moves the object.bottom to area.top. If this is positive,
+        // we need to move the object because it is too high.
+        let move_to_top = area.top - object.bottom;
+
+        // Delta that moves the object.top to area.bottom. If this is negative,
+        // we need to move the object because it is too low.
+        let move_to_bottom = area.bottom - object.top;
+
+        // move_to_top <= move_to_bottom because...
+        //
+        // Case 1: object.top == object.bottom
+        // Premise follows from rom area.top <= area.bottom
+        //
+        // Case 2: area.top == area.bottom
+        // Premise follows from object.top <= object.bottom
+        0.clamp(move_to_top, move_to_bottom)
+    } else {
+        // Delta that moves object.bottom one line below area.top. If this is
+        // positive, we need to move the object because it is too high.
+        let move_to_top = (area.top + 1) - object.bottom;
+
+        // Delta that moves object.top one line above area.bottom. If this is
+        // negative, we need to move the object because it is too low.
+        let move_to_bottom = (area.bottom - 1) - object.top;
+
+        // move_to_top <= move_to_bottom because...
+        //
+        // We know that area.top < area.bottom and object.top < object.bottom,
+        // otherwise we'd be in the previous `if` branch.
+        //
+        // We get the largest value for move_to_top if area.top is largest and
+        // object.bottom is smallest. We get the smallest value for
+        // move_to_bottom if area.bottom is smallest and object.top is largest.
+        //
+        // This means that the worst case scenario is when area.top and
+        // area.bottom as well as object.top and object.bottom are closest
+        // together. In other words:
+        //
+        // area.top + 1 == area.bottom
+        // object.top + 1 == object.bottom
+        //
+        // Inserting that into our formulas for move_to_top and move_to_bottom,
+        // we get:
+        //
+        // move_to_top = (area.top + 1) - (object.top + 1) = area.top + object.top
+        // move_to_bottom = (area.top + 1 - 1) - object.top = area.top + object.top
+        0.clamp(move_to_top, move_to_bottom)
+    }
+}
+
+pub fn overlaps(area: Range<i32>, object: Range<i32>) -> bool {
+    overlap_delta(area, object) == 0
+}
+
+/// Move the object such that it overlaps the area.
+fn overlap(area: Range<i32>, object: Range<i32>) -> Range<i32> {
+    object.shifted(overlap_delta(area, object))
+}
+
+/// Compute a delta that makes the object fully overlap the area when added to
+/// the object. This delta should be as close to zero as possible.
+///
+/// If the object is higher than the area, it should be moved such that
+/// object.top == area.top.
+fn full_overlap_delta(area: Range<i32>, object: Range<i32>) -> i32 {
+    assert!(object.top <= object.bottom, "object range not well-formed");
+    assert!(area.top <= area.bottom, "area range not well-formed");
+
+    // Delta that moves object.top to area.top. If this is positive, we need to
+    // move the object because it is too high.
+    let move_to_top = area.top - object.top;
+
+    // Delta that moves object.bottom to area.bottom. If this is negative, we
+    // need to move the object because it is too low.
+    let move_to_bottom = area.bottom - object.bottom;
+
+    // If the object is higher than the area, move_to_top becomes larger than
+    // move_to_bottom. In that case, this function should return move_to_top.
+    0.min(move_to_bottom).max(move_to_top)
+}
+
+async fn expand_upwards_until<Id, R>(r: &mut R, top: i32) -> Result<(), R::Error>
+where
+    R: Renderer<Id>,
+{
+    loop {
+        let blocks = r.blocks();
+        if blocks.end().top || blocks.range().top <= top {
+            break;
+        }
+
+        r.expand_top().await?;
+    }
+
+    Ok(())
+}
+
+async fn expand_downwards_until<Id, R>(r: &mut R, bottom: i32) -> Result<(), R::Error>
+where
+    R: Renderer<Id>,
+{
+    loop {
+        let blocks = r.blocks();
+        if blocks.end().bottom || blocks.range().bottom >= bottom {
+            break;
+        }
+
+        r.expand_bottom().await?;
+    }
+
+    Ok(())
+}
+
+pub async fn expand_to_fill_visible_area<Id, R>(r: &mut R) -> Result<(), R::Error>
+where
+    R: Renderer<Id>,
+{
+    let area = visible_area(r);
+    expand_upwards_until(r, area.top).await?;
+    expand_downwards_until(r, area.bottom).await?;
+    Ok(())
+}
+
+/// Expand blocks such that the screen is full for any offset where the
+/// specified block is visible. The block must exist.
+pub async fn expand_to_fill_screen_around_block<Id, R>(r: &mut R, id: &Id) -> Result<(), R::Error>
+where
+    Id: Eq,
+    R: Renderer<Id>,
+{
+    let screen = visible_area(r);
+    let (block, _) = r.blocks().find_block(id).expect("no block with that id");
+
+    let top = overlap(block, screen.with_bottom(block.top)).top;
+    let bottom = overlap(block, screen.with_top(block.bottom)).bottom;
+
+    expand_upwards_until(r, top).await?;
+    expand_downwards_until(r, bottom).await?;
+
+    Ok(())
+}
+
+/// Scroll so that the top of the block is at the specified value. Returns
+/// `true` if successful, or `false` if the block could not be found.
+pub fn scroll_to_set_block_top<Id, R>(r: &mut R, id: &Id, top: i32) -> bool
+where
+    Id: Eq,
+    R: Renderer<Id>,
+{
+    if let Some((range, _)) = r.blocks().find_block(id) {
+        let delta = top - range.top;
+        r.blocks_mut().shift(delta);
+        true
+    } else {
+        false
+    }
+}
+
+pub fn scroll_so_block_is_centered<Id, R>(r: &mut R, id: &Id)
+where
+    Id: Eq,
+    R: Renderer<Id>,
+{
+    let area = visible_area(r);
+    let (range, block) = r.blocks().find_block(id).expect("no block with that id");
+    let focus = block.focus(range);
+    let focus_height = focus.bottom - focus.top;
+    let top = (area.top + area.bottom - focus_height) / 2;
+    r.blocks_mut().shift(top - range.top);
+}
+
+pub fn scroll_blocks_fully_above_screen<Id, R>(r: &mut R)
+where
+    R: Renderer<Id>,
+{
+    let area = visible_area(r);
+    let blocks = r.blocks_mut();
+    let delta = area.top - blocks.range().bottom;
+    blocks.shift(delta);
+}
+
+pub fn scroll_blocks_fully_below_screen<Id, R>(r: &mut R)
+where
+    R: Renderer<Id>,
+{
+    let area = visible_area(r);
+    let blocks = r.blocks_mut();
+    let delta = area.bottom - blocks.range().top;
+    blocks.shift(delta);
+}
+
+pub fn scroll_so_block_focus_overlaps_scroll_area<Id, R>(r: &mut R, id: &Id) -> bool
+where
+    Id: Eq,
+    R: Renderer<Id>,
+{
+    if let Some((range, block)) = r.blocks().find_block(id) {
+        let area = scroll_area(r);
+        let delta = overlap_delta(area, block.focus(range));
+        r.blocks_mut().shift(delta);
+        true
+    } else {
+        false
+    }
+}
+
+pub fn scroll_so_block_focus_fully_overlaps_scroll_area<Id, R>(r: &mut R, id: &Id) -> bool
+where
+    Id: Eq,
+    R: Renderer<Id>,
+{
+    if let Some((range, block)) = r.blocks().find_block(id) {
+        let area = scroll_area(r);
+        let delta = full_overlap_delta(area, block.focus(range));
+        r.blocks_mut().shift(delta);
+        true
+    } else {
+        false
+    }
+}
+
+pub fn clamp_scroll_biased_downwards<Id, R>(r: &mut R)
+where
+    R: Renderer<Id>,
+{
+    let area = visible_area(r);
+    let blocks = r.blocks().range();
+
+    // Delta that moves blocks.top to the top of the screen. If this is
+    // negative, we need to move the blocks because they're too low.
+    let move_to_top = area.top - blocks.top;
+
+    // Delta that moves blocks.bottom to the bottom of the screen. If this is
+    // positive, we need to move the blocks because they're too high.
+    let move_to_bottom = area.bottom - blocks.bottom;
+
+    // If the screen is higher, the blocks should rather be moved to the bottom
+    // than the top because of the downwards bias.
+    let delta = 0.min(move_to_top).max(move_to_bottom);
+    r.blocks_mut().shift(delta);
+}
+
+pub fn find_cursor_starting_at<'a, Id, R>(r: &'a R, id: &Id) -> Option<&'a Id>
+where
+    Id: Eq,
+    R: Renderer<Id>,
+{
+    let area = scroll_area(r);
+    let (range, block) = r.blocks().find_block(id)?;
+    let delta = overlap_delta(area, block.focus(range));
+    match delta.cmp(&0) {
+        Ordering::Equal => Some(block.id()),
+
+        // Blocks must be scrolled downwards to become visible, meaning the
+        // cursor must be above the visible area.
+        Ordering::Greater => r
+            .blocks()
+            .iter()
+            .filter(|(_, block)| block.can_be_cursor())
+            .find(|(range, block)| overlaps(area, block.focus(*range)))
+            .map(|(_, block)| block.id()),
+
+        // Blocks must be scrolled upwards to become visible, meaning the cursor
+        // must be below the visible area.
+        Ordering::Less => r
+            .blocks()
+            .iter()
+            .rev()
+            .filter(|(_, block)| block.can_be_cursor())
+            .find(|(range, block)| overlaps(area, block.focus(*range)))
+            .map(|(_, block)| block.id()),
+    }
+}

cove/src/ui/chat/tree.rs

@@ -0,0 +1,480 @@
+//! Rendering messages as full trees.
+
+// TODO Focusing on sub-trees
+
+use std::collections::HashSet;
+
+use async_trait::async_trait;
+use cove_config::Keys;
+use cove_input::InputEvent;
+use jiff::tz::TimeZone;
+use toss::{AsyncWidget, Frame, Pos, Size, WidgetExt, WidthDb, widgets::EditorState};
+
+use crate::{
+    store::{Msg, MsgStore},
+    ui::{UiError, util},
+    util::InfallibleExt,
+};
+
+use super::{ChatMsg, Reaction, cursor::Cursor};
+
+use self::renderer::{TreeContext, TreeRenderer};
+
+mod renderer;
+mod scroll;
+mod widgets;
+
+pub struct TreeViewState<M: Msg, S: MsgStore<M>> {
+    store: S,
+    tz: TimeZone,
+
+    last_size: Size,
+    last_nick: String,
+    last_cursor: Cursor<M::Id>,
+    last_cursor_top: i32,
+    last_visible_msgs: Vec<M::Id>,
+
+    folded: HashSet<M::Id>,
+}
+
+impl<M: Msg, S: MsgStore<M>> TreeViewState<M, S> {
+    pub fn new(store: S, tz: TimeZone) -> Self {
+        Self {
+            store,
+            tz,
+            last_size: Size::ZERO,
+            last_nick: String::new(),
+            last_cursor: Cursor::Bottom,
+            last_cursor_top: 0,
+            last_visible_msgs: vec![],
+            folded: HashSet::new(),
+        }
+    }
+
+    async fn handle_movement_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        cursor: &mut Cursor<M::Id>,
+        editor: &mut EditorState,
+    ) -> Result<bool, S::Error>
+    where
+        M: ChatMsg + Send + Sync,
+        M::Id: Send + Sync,
+        S: Send + Sync,
+        S::Error: Send,
+    {
+        let chat_height: i32 = (event.frame().size().height - 3).into();
+
+        // Basic cursor movement
+        if event.matches(&keys.cursor.up) {
+            cursor.move_up_in_tree(&self.store, &self.folded).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.cursor.down) {
+            cursor.move_down_in_tree(&self.store, &self.folded).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.cursor.to_top) {
+            cursor.move_to_top(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.cursor.to_bottom) {
+            cursor.move_to_bottom();
+            return Ok(true);
+        }
+
+        // Tree cursor movement
+        if event.matches(&keys.tree.cursor.to_above_sibling) {
+            cursor.move_to_prev_sibling(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_below_sibling) {
+            cursor.move_to_next_sibling(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_parent) {
+            cursor.move_to_parent(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_root) {
+            cursor.move_to_root(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_older_message) {
+            cursor.move_to_older_msg(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_newer_message) {
+            cursor.move_to_newer_msg(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_older_unseen_message) {
+            cursor.move_to_older_unseen_msg(&self.store).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.tree.cursor.to_newer_unseen_message) {
+            cursor.move_to_newer_unseen_msg(&self.store).await?;
+            return Ok(true);
+        }
+
+        // Scrolling
+        if event.matches(&keys.scroll.up_line) {
+            self.scroll_by(cursor, editor, event.widthdb(), 1).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.scroll.down_line) {
+            self.scroll_by(cursor, editor, event.widthdb(), -1).await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.scroll.up_half) {
+            let delta = chat_height / 2;
+            self.scroll_by(cursor, editor, event.widthdb(), delta)
+                .await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.scroll.down_half) {
+            let delta = -(chat_height / 2);
+            self.scroll_by(cursor, editor, event.widthdb(), delta)
+                .await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.scroll.up_full) {
+            let delta = chat_height.saturating_sub(1);
+            self.scroll_by(cursor, editor, event.widthdb(), delta)
+                .await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.scroll.down_full) {
+            let delta = -chat_height.saturating_sub(1);
+            self.scroll_by(cursor, editor, event.widthdb(), delta)
+                .await?;
+            return Ok(true);
+        }
+        if event.matches(&keys.scroll.center_cursor) {
+            self.center_cursor(cursor, editor, event.widthdb()).await?;
+            return Ok(true);
+        }
+
+        Ok(false)
+    }
+
+    async fn handle_action_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        id: Option<&M::Id>,
+    ) -> Result<bool, S::Error> {
+        if event.matches(&keys.tree.action.fold_tree) {
+            if let Some(id) = id {
+                if !self.folded.remove(id) {
+                    self.folded.insert(id.clone());
+                }
+            }
+            return Ok(true);
+        }
+
+        if event.matches(&keys.tree.action.toggle_seen) {
+            if let Some(id) = id {
+                if let Some(msg) = self.store.tree(id).await?.msg(id) {
+                    self.store.set_seen(id, !msg.seen()).await?;
+                }
+            }
+            return Ok(true);
+        }
+
+        if event.matches(&keys.tree.action.mark_visible_seen) {
+            for id in &self.last_visible_msgs {
+                self.store.set_seen(id, true).await?;
+            }
+            return Ok(true);
+        }
+
+        if event.matches(&keys.tree.action.mark_older_seen) {
+            if let Some(id) = id {
+                self.store.set_older_seen(id, true).await?;
+            } else {
+                self.store
+                    .set_older_seen(&M::last_possible_id(), true)
+                    .await?;
+            }
+            return Ok(true);
+        }
+
+        Ok(false)
+    }
+
+    async fn handle_edit_initiating_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        cursor: &mut Cursor<M::Id>,
+        id: Option<M::Id>,
+    ) -> Result<bool, S::Error> {
+        if event.matches(&keys.tree.action.reply) {
+            if let Some(parent) = cursor.parent_for_normal_tree_reply(&self.store).await? {
+                *cursor = Cursor::Editor {
+                    coming_from: id,
+                    parent,
+                };
+            }
+            return Ok(true);
+        }
+
+        if event.matches(&keys.tree.action.reply_alternate) {
+            if let Some(parent) = cursor.parent_for_alternate_tree_reply(&self.store).await? {
+                *cursor = Cursor::Editor {
+                    coming_from: id,
+                    parent,
+                };
+            }
+            return Ok(true);
+        }
+
+        if event.matches(&keys.tree.action.new_thread) {
+            *cursor = Cursor::Editor {
+                coming_from: id,
+                parent: None,
+            };
+            return Ok(true);
+        }
+
+        Ok(false)
+    }
+
+    async fn handle_normal_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        cursor: &mut Cursor<M::Id>,
+        editor: &mut EditorState,
+        can_compose: bool,
+        id: Option<M::Id>,
+    ) -> Result<bool, S::Error>
+    where
+        M: ChatMsg + Send + Sync,
+        M::Id: Send + Sync,
+        S: Send + Sync,
+        S::Error: Send,
+    {
+        if self
+            .handle_movement_input_event(event, keys, cursor, editor)
+            .await?
+        {
+            return Ok(true);
+        }
+
+        if self
+            .handle_action_input_event(event, keys, id.as_ref())
+            .await?
+        {
+            return Ok(true);
+        }
+
+        if can_compose
+            && self
+                .handle_edit_initiating_input_event(event, keys, cursor, id)
+                .await?
+        {
+            return Ok(true);
+        }
+
+        Ok(false)
+    }
+
+    fn handle_editor_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        cursor: &mut Cursor<M::Id>,
+        editor: &mut EditorState,
+        coming_from: Option<M::Id>,
+        parent: Option<M::Id>,
+    ) -> Reaction<M> {
+        // Abort edit
+        if event.matches(&keys.general.abort) {
+            *cursor = coming_from.map(Cursor::Msg).unwrap_or(Cursor::Bottom);
+            return Reaction::Handled;
+        }
+
+        // Send message
+        if event.matches(&keys.general.confirm) {
+            let content = editor.text().to_string();
+            if content.trim().is_empty() {
+                return Reaction::Handled;
+            }
+            *cursor = Cursor::Pseudo {
+                coming_from,
+                parent: parent.clone(),
+            };
+            return Reaction::Composed { parent, content };
+        }
+
+        // TODO Tab-completion
+
+        // Editing
+        if util::handle_editor_input_event(editor, event, keys, |_| true) {
+            return Reaction::Handled;
+        }
+
+        Reaction::NotHandled
+    }
+
+    pub async fn handle_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        cursor: &mut Cursor<M::Id>,
+        editor: &mut EditorState,
+        can_compose: bool,
+    ) -> Result<Reaction<M>, S::Error>
+    where
+        M: ChatMsg + Send + Sync,
+        M::Id: Send + Sync,
+        S: Send + Sync,
+        S::Error: Send,
+    {
+        Ok(match cursor {
+            Cursor::Bottom => {
+                if self
+                    .handle_normal_input_event(event, keys, cursor, editor, can_compose, None)
+                    .await?
+                {
+                    Reaction::Handled
+                } else {
+                    Reaction::NotHandled
+                }
+            }
+            Cursor::Msg(id) => {
+                let id = id.clone();
+                if self
+                    .handle_normal_input_event(event, keys, cursor, editor, can_compose, Some(id))
+                    .await?
+                {
+                    Reaction::Handled
+                } else {
+                    Reaction::NotHandled
+                }
+            }
+            Cursor::Editor {
+                coming_from,
+                parent,
+            } => {
+                let coming_from = coming_from.clone();
+                let parent = parent.clone();
+                self.handle_editor_input_event(event, keys, cursor, editor, coming_from, parent)
+            }
+            Cursor::Pseudo { .. } => {
+                if self
+                    .handle_movement_input_event(event, keys, cursor, editor)
+                    .await?
+                {
+                    Reaction::Handled
+                } else {
+                    Reaction::NotHandled
+                }
+            }
+        })
+    }
+
+    pub fn send_successful(&mut self, id: &M::Id) {
+        if let Cursor::Pseudo { .. } = self.last_cursor {
+            self.last_cursor = Cursor::Msg(id.clone());
+        }
+    }
+
+    pub fn widget<'a>(
+        &'a mut self,
+        cursor: &'a mut Cursor<M::Id>,
+        editor: &'a mut EditorState,
+        nick: String,
+        focused: bool,
+        nick_emoji: bool,
+        caesar: i8,
+    ) -> TreeView<'a, M, S> {
+        TreeView {
+            state: self,
+            cursor,
+            editor,
+            nick,
+            focused,
+            nick_emoji,
+            caesar,
+        }
+    }
+}
+
+pub struct TreeView<'a, M: Msg, S: MsgStore<M>> {
+    state: &'a mut TreeViewState<M, S>,
+
+    cursor: &'a mut Cursor<M::Id>,
+    editor: &'a mut EditorState,
+
+    nick: String,
+    focused: bool,
+
+    nick_emoji: bool,
+    caesar: i8,
+}
+
+#[async_trait]
+impl<M, S> AsyncWidget<UiError> for TreeView<'_, M, S>
+where
+    M: Msg + ChatMsg + Send + Sync,
+    M::Id: Send + Sync,
+    S: MsgStore<M> + Send + Sync,
+    S::Error: Send,
+    UiError: From<S::Error>,
+{
+    async fn size(
+        &self,
+        _widthdb: &mut WidthDb,
+        _max_width: Option<u16>,
+        _max_height: Option<u16>,
+    ) -> Result<Size, UiError> {
+        Ok(Size::ZERO)
+    }
+
+    async fn draw(self, frame: &mut Frame) -> Result<(), UiError> {
+        let size = frame.size();
+
+        let context = TreeContext {
+            size,
+            nick: self.nick.clone(),
+            focused: self.focused,
+            nick_emoji: self.nick_emoji,
+            caesar: self.caesar,
+            last_cursor: self.state.last_cursor.clone(),
+            last_cursor_top: self.state.last_cursor_top,
+        };
+
+        let mut renderer = TreeRenderer::new(
+            context,
+            &self.state.store,
+            &self.state.tz,
+            &mut self.state.folded,
+            self.cursor,
+            self.editor,
+            frame.widthdb(),
+        );
+
+        renderer.prepare_blocks_for_drawing().await?;
+
+        self.state.last_size = size;
+        self.state.last_nick = self.nick;
+        renderer.update_render_info(
+            &mut self.state.last_cursor,
+            &mut self.state.last_cursor_top,
+            &mut self.state.last_visible_msgs,
+        );
+
+        for (range, block) in renderer.into_visible_blocks() {
+            let widget = block.into_widget();
+            frame.push(Pos::new(0, range.top), widget.size());
+            widget.desync().draw(frame).await.infallible();
+            frame.pop();
+        }
+
+        Ok(())
+    }
+}

cove/src/ui/chat/tree/renderer.rs

@@ -0,0 +1,523 @@
+//! A [`Renderer`] for message trees.
+
+use std::{collections::HashSet, convert::Infallible};
+
+use async_trait::async_trait;
+use jiff::tz::TimeZone;
+use toss::{
+    Size, Widget, WidthDb,
+    widgets::{EditorState, Empty, Predrawn, Resize},
+};
+
+use crate::{
+    store::{Msg, MsgStore, Tree},
+    ui::{
+        ChatMsg,
+        chat::{
+            blocks::{Block, Blocks, Range},
+            cursor::Cursor,
+            renderer::{self, Renderer, overlaps},
+        },
+    },
+    util::InfallibleExt,
+};
+
+use super::widgets;
+
+/// When rendering messages as full trees, special ids and zero-height messages
+/// are used for robust scrolling behaviour.
+#[derive(PartialEq, Eq)]
+pub enum TreeBlockId<Id> {
+    /// There is a zero-height block at the very bottom of the chat that has
+    /// this id. It is used for positioning [`Cursor::Bottom`].
+    Bottom,
+    /// Normal messages have this id. It is used for positioning
+    /// [`Cursor::Msg`].
+    Msg(Id),
+    /// After all children of a message, a zero-height block with this id is
+    /// rendered. It is used for positioning [`Cursor::Editor`] and
+    /// [`Cursor::Pseudo`].
+    After(Id),
+}
+
+impl<Id: Clone> TreeBlockId<Id> {
+    pub fn from_cursor(cursor: &Cursor<Id>) -> Self {
+        match cursor {
+            Cursor::Bottom
+            | Cursor::Editor { parent: None, .. }
+            | Cursor::Pseudo { parent: None, .. } => Self::Bottom,
+
+            Cursor::Msg(id) => Self::Msg(id.clone()),
+
+            Cursor::Editor {
+                parent: Some(id), ..
+            }
+            | Cursor::Pseudo {
+                parent: Some(id), ..
+            } => Self::After(id.clone()),
+        }
+    }
+
+    pub fn any_id(&self) -> Option<&Id> {
+        match self {
+            Self::Bottom => None,
+            Self::Msg(id) | Self::After(id) => Some(id),
+        }
+    }
+
+    pub fn msg_id(&self) -> Option<&Id> {
+        match self {
+            Self::Bottom | Self::After(_) => None,
+            Self::Msg(id) => Some(id),
+        }
+    }
+}
+
+type TreeBlock<Id> = Block<TreeBlockId<Id>>;
+type TreeBlocks<Id> = Blocks<TreeBlockId<Id>>;
+
+pub struct TreeContext<Id> {
+    pub size: Size,
+    pub nick: String,
+    pub focused: bool,
+    pub nick_emoji: bool,
+    pub caesar: i8,
+    pub last_cursor: Cursor<Id>,
+    pub last_cursor_top: i32,
+}
+
+pub struct TreeRenderer<'a, M: Msg, S: MsgStore<M>> {
+    context: TreeContext<M::Id>,
+
+    store: &'a S,
+    tz: &'a TimeZone,
+    folded: &'a mut HashSet<M::Id>,
+    cursor: &'a mut Cursor<M::Id>,
+    editor: &'a mut EditorState,
+    widthdb: &'a mut WidthDb,
+
+    /// Root id of the topmost tree in the blocks. When set to `None`, only the
+    /// bottom of the chat history has been rendered.
+    top_root_id: Option<M::Id>,
+    /// Root id of the bottommost tree in the blocks. When set to `None`, only
+    /// the bottom of the chat history has been rendered.
+    bottom_root_id: Option<M::Id>,
+
+    blocks: TreeBlocks<M::Id>,
+}
+
+impl<'a, M, S> TreeRenderer<'a, M, S>
+where
+    M: Msg + ChatMsg + Send + Sync,
+    M::Id: Send + Sync,
+    S: MsgStore<M> + Send + Sync,
+    S::Error: Send,
+{
+    /// You must call [`Self::prepare_blocks_for_drawing`] immediately after
+    /// calling this function.
+    pub fn new(
+        context: TreeContext<M::Id>,
+        store: &'a S,
+        tz: &'a TimeZone,
+        folded: &'a mut HashSet<M::Id>,
+        cursor: &'a mut Cursor<M::Id>,
+        editor: &'a mut EditorState,
+        widthdb: &'a mut WidthDb,
+    ) -> Self {
+        Self {
+            context,
+            store,
+            tz,
+            folded,
+            cursor,
+            editor,
+            widthdb,
+            top_root_id: None,
+            bottom_root_id: None,
+            blocks: Blocks::new(0),
+        }
+    }
+
+    fn predraw<W>(widget: W, size: Size, widthdb: &mut WidthDb) -> Predrawn
+    where
+        W: Widget<Infallible>,
+    {
+        Predrawn::new(Resize::new(widget).with_max_width(size.width), widthdb).infallible()
+    }
+
+    fn zero_height_block(&mut self, parent: Option<&M::Id>) -> TreeBlock<M::Id> {
+        let id = match parent {
+            Some(parent) => TreeBlockId::After(parent.clone()),
+            None => TreeBlockId::Bottom,
+        };
+
+        let widget = Self::predraw(Empty::new(), self.context.size, self.widthdb);
+        Block::new(id, widget, false)
+    }
+
+    fn editor_block(&mut self, indent: usize, parent: Option<&M::Id>) -> TreeBlock<M::Id> {
+        let id = match parent {
+            Some(parent) => TreeBlockId::After(parent.clone()),
+            None => TreeBlockId::Bottom,
+        };
+
+        let widget = widgets::editor::<M>(
+            indent,
+            &self.context.nick,
+            self.context.focused,
+            self.editor,
+        );
+        let widget = Self::predraw(widget, self.context.size, self.widthdb);
+        let mut block = Block::new(id, widget, false);
+
+        // Since the editor was rendered when the `Predrawn` was created, the
+        // last cursor pos is accurate now.
+        let cursor_line = self.editor.last_cursor_pos().y;
+        block.set_focus(Range::new(cursor_line, cursor_line + 1));
+
+        block
+    }
+
+    fn pseudo_block(&mut self, indent: usize, parent: Option<&M::Id>) -> TreeBlock<M::Id> {
+        let id = match parent {
+            Some(parent) => TreeBlockId::After(parent.clone()),
+            None => TreeBlockId::Bottom,
+        };
+
+        let widget = widgets::pseudo::<M>(indent, &self.context.nick, self.editor);
+        let widget = Self::predraw(widget, self.context.size, self.widthdb);
+        Block::new(id, widget, false)
+    }
+
+    fn message_block(
+        &mut self,
+        indent: usize,
+        msg: &M,
+        folded_info: Option<usize>,
+    ) -> TreeBlock<M::Id> {
+        let msg_id = msg.id();
+
+        let highlighted = match self.cursor {
+            Cursor::Msg(id) => *id == msg_id,
+            _ => false,
+        };
+        let highlighted = highlighted && self.context.focused;
+
+        let widget = widgets::msg(
+            highlighted,
+            self.tz.clone(),
+            indent,
+            msg,
+            self.context.nick_emoji,
+            self.context.caesar,
+            folded_info,
+        );
+        let widget = Self::predraw(widget, self.context.size, self.widthdb);
+        Block::new(TreeBlockId::Msg(msg_id), widget, true)
+    }
+
+    fn message_placeholder_block(
+        &mut self,
+        indent: usize,
+        msg_id: &M::Id,
+        folded_info: Option<usize>,
+    ) -> TreeBlock<M::Id> {
+        let highlighted = match self.cursor {
+            Cursor::Msg(id) => id == msg_id,
+            _ => false,
+        };
+        let highlighted = highlighted && self.context.focused;
+
+        let widget = widgets::msg_placeholder(highlighted, indent, folded_info);
+        let widget = Self::predraw(widget, self.context.size, self.widthdb);
+        Block::new(TreeBlockId::Msg(msg_id.clone()), widget, true)
+    }
+
+    fn layout_bottom(&mut self) -> TreeBlocks<M::Id> {
+        let mut blocks = Blocks::new(0);
+
+        match self.cursor {
+            Cursor::Editor { parent: None, .. } => blocks.push_bottom(self.editor_block(0, None)),
+            Cursor::Pseudo { parent: None, .. } => blocks.push_bottom(self.pseudo_block(0, None)),
+            _ => blocks.push_bottom(self.zero_height_block(None)),
+        }
+
+        blocks
+    }
+
+    fn layout_subtree(
+        &mut self,
+        tree: &Tree<M>,
+        indent: usize,
+        msg_id: &M::Id,
+        blocks: &mut TreeBlocks<M::Id>,
+    ) {
+        let folded = self.folded.contains(msg_id);
+        let folded_info = if folded {
+            Some(tree.subtree_size(msg_id)).filter(|s| *s > 0)
+        } else {
+            None
+        };
+
+        // Message itself
+        let block = if let Some(msg) = tree.msg(msg_id) {
+            self.message_block(indent, msg, folded_info)
+        } else {
+            self.message_placeholder_block(indent, msg_id, folded_info)
+        };
+        blocks.push_bottom(block);
+
+        // Children, recursively
+        if !folded {
+            if let Some(children) = tree.children(msg_id) {
+                for child in children {
+                    self.layout_subtree(tree, indent + 1, child, blocks);
+                }
+            }
+        }
+
+        // After message (zero-height block, editor, or placeholder)
+        let block = match self.cursor {
+            Cursor::Editor {
+                parent: Some(id), ..
+            } if id == msg_id => self.editor_block(indent + 1, Some(msg_id)),
+
+            Cursor::Pseudo {
+                parent: Some(id), ..
+            } if id == msg_id => self.pseudo_block(indent + 1, Some(msg_id)),
+
+            _ => self.zero_height_block(Some(msg_id)),
+        };
+        blocks.push_bottom(block);
+    }
+
+    fn layout_tree(&mut self, tree: Tree<M>) -> TreeBlocks<M::Id> {
+        let mut blocks = Blocks::new(0);
+        self.layout_subtree(&tree, 0, tree.root(), &mut blocks);
+        blocks
+    }
+
+    async fn root_id(&self, id: &TreeBlockId<M::Id>) -> Result<Option<M::Id>, S::Error> {
+        let Some(id) = id.any_id() else {
+            return Ok(None);
+        };
+        let path = self.store.path(id).await?;
+        Ok(Some(path.into_first()))
+    }
+
+    /// Render the tree containing the cursor to the blocks and set the top and
+    /// bottom root id accordingly. This function will always render a block
+    /// that has the cusor id.
+    async fn prepare_initial_tree(
+        &mut self,
+        cursor_id: &TreeBlockId<M::Id>,
+        root_id: &Option<M::Id>,
+    ) -> Result<(), S::Error> {
+        self.top_root_id = root_id.clone();
+        self.bottom_root_id = root_id.clone();
+
+        let blocks = if let Some(root_id) = root_id {
+            let tree = self.store.tree(root_id).await?;
+
+            // To ensure the cursor block will be rendered, all its parents must
+            // be unfolded.
+            if let TreeBlockId::Msg(id) | TreeBlockId::After(id) = cursor_id {
+                let mut id = id.clone();
+                while let Some(parent_id) = tree.parent(&id) {
+                    self.folded.remove(&parent_id);
+                    id = parent_id;
+                }
+            }
+
+            self.layout_tree(tree)
+        } else {
+            self.layout_bottom()
+        };
+        self.blocks.append_bottom(blocks);
+
+        Ok(())
+    }
+
+    fn make_cursor_visible(&mut self) {
+        let cursor_id = TreeBlockId::from_cursor(self.cursor);
+        if *self.cursor == self.context.last_cursor {
+            // Cursor did not move, so we just need to ensure it overlaps the
+            // scroll area
+            renderer::scroll_so_block_focus_overlaps_scroll_area(self, &cursor_id);
+        } else {
+            // Cursor moved, so it should fully overlap the scroll area
+            renderer::scroll_so_block_focus_fully_overlaps_scroll_area(self, &cursor_id);
+        }
+    }
+
+    fn root_id_is_above_root_id(first: Option<M::Id>, second: Option<M::Id>) -> bool {
+        match (first, second) {
+            (Some(_), None) => true,
+            (Some(a), Some(b)) => a < b,
+            _ => false,
+        }
+    }
+
+    pub async fn prepare_blocks_for_drawing(&mut self) -> Result<(), S::Error> {
+        let cursor_id = TreeBlockId::from_cursor(self.cursor);
+        let cursor_root_id = self.root_id(&cursor_id).await?;
+
+        // Render cursor and blocks around it so that the screen will always be
+        // filled as long as the cursor is visible, regardless of how the screen
+        // is scrolled.
+        self.prepare_initial_tree(&cursor_id, &cursor_root_id)
+            .await?;
+        renderer::expand_to_fill_screen_around_block(self, &cursor_id).await?;
+
+        // Scroll based on last cursor position
+        let last_cursor_id = TreeBlockId::from_cursor(&self.context.last_cursor);
+        if !renderer::scroll_to_set_block_top(self, &last_cursor_id, self.context.last_cursor_top) {
+            // Since the last cursor is not within scrolling distance of our
+            // current cursor, we need to estimate whether the last cursor was
+            // above or below the current cursor.
+            let last_cursor_root_id = self.root_id(&last_cursor_id).await?;
+            if Self::root_id_is_above_root_id(last_cursor_root_id, cursor_root_id) {
+                renderer::scroll_blocks_fully_below_screen(self);
+            } else {
+                renderer::scroll_blocks_fully_above_screen(self);
+            }
+        }
+
+        // Fulfill scroll constraints
+        self.make_cursor_visible();
+        renderer::clamp_scroll_biased_downwards(self);
+
+        Ok(())
+    }
+
+    fn move_cursor_so_it_is_visible(&mut self) {
+        let cursor_id = TreeBlockId::from_cursor(self.cursor);
+        if matches!(cursor_id, TreeBlockId::Bottom | TreeBlockId::Msg(_)) {
+            match renderer::find_cursor_starting_at(self, &cursor_id) {
+                Some(TreeBlockId::Bottom) => *self.cursor = Cursor::Bottom,
+                Some(TreeBlockId::Msg(id)) => *self.cursor = Cursor::Msg(id.clone()),
+                _ => {}
+            }
+        }
+    }
+
+    pub async fn scroll_by(&mut self, delta: i32) -> Result<(), S::Error> {
+        self.blocks.shift(delta);
+        renderer::expand_to_fill_visible_area(self).await?;
+        renderer::clamp_scroll_biased_downwards(self);
+
+        self.move_cursor_so_it_is_visible();
+
+        self.make_cursor_visible();
+        renderer::clamp_scroll_biased_downwards(self);
+
+        Ok(())
+    }
+
+    pub fn center_cursor(&mut self) {
+        let cursor_id = TreeBlockId::from_cursor(self.cursor);
+        renderer::scroll_so_block_is_centered(self, &cursor_id);
+
+        self.make_cursor_visible();
+        renderer::clamp_scroll_biased_downwards(self);
+    }
+
+    pub fn update_render_info(
+        &self,
+        last_cursor: &mut Cursor<M::Id>,
+        last_cursor_top: &mut i32,
+        last_visible_msgs: &mut Vec<M::Id>,
+    ) {
+        *last_cursor = self.cursor.clone();
+
+        let cursor_id = TreeBlockId::from_cursor(self.cursor);
+        let (range, _) = self.blocks.find_block(&cursor_id).unwrap();
+        *last_cursor_top = range.top;
+
+        let area = renderer::visible_area(self);
+        *last_visible_msgs = self
+            .blocks
+            .iter()
+            .filter(|(range, _)| overlaps(area, *range))
+            .filter_map(|(_, block)| block.id().msg_id())
+            .cloned()
+            .collect()
+    }
+
+    pub fn into_visible_blocks(
+        self,
+    ) -> impl Iterator<Item = (Range<i32>, Block<TreeBlockId<M::Id>>)> + use<M, S> {
+        let area = renderer::visible_area(&self);
+        self.blocks
+            .into_iter()
+            .filter(move |(range, block)| overlaps(area, block.focus(*range)))
+    }
+}
+
+#[async_trait]
+impl<M, S> Renderer<TreeBlockId<M::Id>> for TreeRenderer<'_, M, S>
+where
+    M: Msg + ChatMsg + Send + Sync,
+    M::Id: Send + Sync,
+    S: MsgStore<M> + Send + Sync,
+    S::Error: Send,
+{
+    type Error = S::Error;
+
+    fn size(&self) -> Size {
+        self.context.size
+    }
+
+    fn scrolloff(&self) -> i32 {
+        2 // TODO Make configurable
+    }
+
+    fn blocks(&self) -> &TreeBlocks<M::Id> {
+        &self.blocks
+    }
+
+    fn blocks_mut(&mut self) -> &mut TreeBlocks<M::Id> {
+        &mut self.blocks
+    }
+
+    async fn expand_top(&mut self) -> Result<(), Self::Error> {
+        let prev_root_id = if let Some(top_root_id) = &self.top_root_id {
+            self.store.prev_root_id(top_root_id).await?
+        } else {
+            self.store.last_root_id().await?
+        };
+
+        if let Some(prev_root_id) = prev_root_id {
+            let tree = self.store.tree(&prev_root_id).await?;
+            let blocks = self.layout_tree(tree);
+            self.blocks.append_top(blocks);
+            self.top_root_id = Some(prev_root_id);
+        } else {
+            self.blocks.end_top();
+        }
+
+        Ok(())
+    }
+
+    async fn expand_bottom(&mut self) -> Result<(), Self::Error> {
+        let Some(bottom_root_id) = &self.bottom_root_id else {
+            self.blocks.end_bottom();
+            return Ok(());
+        };
+
+        let next_root_id = self.store.next_root_id(bottom_root_id).await?;
+        if let Some(next_root_id) = next_root_id {
+            let tree = self.store.tree(&next_root_id).await?;
+            let blocks = self.layout_tree(tree);
+            self.blocks.append_bottom(blocks);
+            self.bottom_root_id = Some(next_root_id);
+        } else {
+            let blocks = self.layout_bottom();
+            self.blocks.append_bottom(blocks);
+            self.blocks.end_bottom();
+            self.bottom_root_id = None;
+        };
+
+        Ok(())
+    }
+}

cove/src/ui/chat/tree/scroll.rs

@@ -0,0 +1,88 @@
+use toss::{WidthDb, widgets::EditorState};
+
+use crate::{
+    store::{Msg, MsgStore},
+    ui::{ChatMsg, chat::cursor::Cursor},
+};
+
+use super::{
+    TreeViewState,
+    renderer::{TreeContext, TreeRenderer},
+};
+
+impl<M, S> TreeViewState<M, S>
+where
+    M: Msg + ChatMsg + Send + Sync,
+    M::Id: Send + Sync,
+    S: MsgStore<M> + Send + Sync,
+    S::Error: Send,
+{
+    fn last_context(&self) -> TreeContext<M::Id> {
+        TreeContext {
+            size: self.last_size,
+            nick: self.last_nick.clone(),
+            focused: true,
+            nick_emoji: false,
+            caesar: 0,
+            last_cursor: self.last_cursor.clone(),
+            last_cursor_top: self.last_cursor_top,
+        }
+    }
+
+    pub async fn scroll_by(
+        &mut self,
+        cursor: &mut Cursor<M::Id>,
+        editor: &mut EditorState,
+        widthdb: &mut WidthDb,
+        delta: i32,
+    ) -> Result<(), S::Error> {
+        let context = self.last_context();
+        let mut renderer = TreeRenderer::new(
+            context,
+            &self.store,
+            &self.tz,
+            &mut self.folded,
+            cursor,
+            editor,
+            widthdb,
+        );
+        renderer.prepare_blocks_for_drawing().await?;
+
+        renderer.scroll_by(delta).await?;
+
+        renderer.update_render_info(
+            &mut self.last_cursor,
+            &mut self.last_cursor_top,
+            &mut self.last_visible_msgs,
+        );
+        Ok(())
+    }
+
+    pub async fn center_cursor(
+        &mut self,
+        cursor: &mut Cursor<M::Id>,
+        editor: &mut EditorState,
+        widthdb: &mut WidthDb,
+    ) -> Result<(), S::Error> {
+        let context = self.last_context();
+        let mut renderer = TreeRenderer::new(
+            context,
+            &self.store,
+            &self.tz,
+            &mut self.folded,
+            cursor,
+            editor,
+            widthdb,
+        );
+        renderer.prepare_blocks_for_drawing().await?;
+
+        renderer.center_cursor();
+
+        renderer.update_render_info(
+            &mut self.last_cursor,
+            &mut self.last_cursor_top,
+            &mut self.last_visible_msgs,
+        );
+        Ok(())
+    }
+}

cove/src/ui/chat/tree/widgets.rs

@@ -0,0 +1,214 @@
+use std::convert::Infallible;
+
+use crossterm::style::Stylize;
+use jiff::tz::TimeZone;
+use toss::{
+    Style, Styled, WidgetExt,
+    widgets::{Boxed, EditorState, Join2, Join4, Join5, Text},
+};
+
+use crate::{
+    store::Msg,
+    ui::{
+        ChatMsg,
+        chat::widgets::{Indent, Seen, Time},
+    },
+    util,
+};
+
+pub const PLACEHOLDER: &str = "[...]";
+
+pub fn style_placeholder() -> Style {
+    Style::new().dark_grey()
+}
+
+fn style_time(highlighted: bool) -> Style {
+    if highlighted {
+        Style::new().black().on_white()
+    } else {
+        Style::new().grey()
+    }
+}
+
+fn style_indent(highlighted: bool) -> Style {
+    if highlighted {
+        Style::new().black().on_white()
+    } else {
+        Style::new().dark_grey()
+    }
+}
+
+fn style_caesar() -> Style {
+    Style::new().green()
+}
+
+fn style_info() -> Style {
+    Style::new().italic().dark_grey()
+}
+
+fn style_editor_highlight() -> Style {
+    Style::new().black().on_cyan()
+}
+
+fn style_pseudo_highlight() -> Style {
+    Style::new().black().on_yellow()
+}
+
+pub fn msg<M: Msg + ChatMsg>(
+    highlighted: bool,
+    tz: TimeZone,
+    indent: usize,
+    msg: &M,
+    nick_emoji: bool,
+    caesar: i8,
+    folded_info: Option<usize>,
+) -> Boxed<'static, Infallible> {
+    let (mut nick, mut content) = msg.styled();
+
+    if nick_emoji {
+        if let Some(emoji) = msg.nick_emoji() {
+            nick = nick.then_plain("(").then_plain(emoji).then_plain(")");
+        }
+    }
+
+    if caesar != 0 {
+        // Apply caesar in inverse because we're decoding
+        let rotated = util::caesar(content.text(), -caesar);
+        content = content
+            .then_plain("\n")
+            .then(format!("{rotated} [rot{caesar}]"), style_caesar());
+    }
+
+    if let Some(amount) = folded_info {
+        content = content
+            .then_plain("\n")
+            .then(format!("[{amount} more]"), style_info());
+    }
+
+    Join5::horizontal(
+        Seen::new(msg.seen()).segment().with_fixed(true),
+        Time::new(msg.time().map(|t| t.to_zoned(tz)), style_time(highlighted))
+            .padding()
+            .with_right(1)
+            .with_stretch(true)
+            .segment()
+            .with_fixed(true),
+        Indent::new(indent, style_indent(highlighted))
+            .segment()
+            .with_fixed(true),
+        Join2::vertical(
+            Text::new(nick)
+                .padding()
+                .with_right(1)
+                .segment()
+                .with_fixed(true),
+            Indent::new(1, style_indent(false)).segment(),
+        )
+        .segment()
+        .with_fixed(true),
+        // TODO Minimum content width
+        // TODO Minimizing and maximizing messages
+        Text::new(content).segment(),
+    )
+    .boxed()
+}
+
+pub fn msg_placeholder(
+    highlighted: bool,
+    indent: usize,
+    folded_info: Option<usize>,
+) -> Boxed<'static, Infallible> {
+    let mut content = Styled::new(PLACEHOLDER, style_placeholder());
+
+    if let Some(amount) = folded_info {
+        content = content
+            .then_plain("\n")
+            .then(format!("[{amount} more]"), style_info());
+    }
+
+    Join4::horizontal(
+        Seen::new(true).segment().with_fixed(true),
+        Time::new(None, style_time(highlighted))
+            .padding()
+            .with_right(1)
+            .with_stretch(true)
+            .segment()
+            .with_fixed(true),
+        Indent::new(indent, style_indent(highlighted))
+            .segment()
+            .with_fixed(true),
+        Text::new(content).segment(),
+    )
+    .boxed()
+}
+
+pub fn editor<'a, M: ChatMsg>(
+    indent: usize,
+    nick: &str,
+    focus: bool,
+    editor: &'a mut EditorState,
+) -> Boxed<'a, Infallible> {
+    let (nick, content) = M::edit(nick, editor.text());
+    let editor = editor
+        .widget()
+        .with_highlight(|_| content)
+        .with_focus(focus);
+
+    Join5::horizontal(
+        Seen::new(true).segment().with_fixed(true),
+        Time::new(None, style_editor_highlight())
+            .padding()
+            .with_right(1)
+            .with_stretch(true)
+            .segment()
+            .with_fixed(true),
+        Indent::new(indent, style_editor_highlight())
+            .segment()
+            .with_fixed(true),
+        Join2::vertical(
+            Text::new(nick)
+                .padding()
+                .with_right(1)
+                .segment()
+                .with_fixed(true),
+            Indent::new(1, style_indent(false)).segment(),
+        )
+        .segment()
+        .with_fixed(true),
+        editor.segment(),
+    )
+    .boxed()
+}
+
+pub fn pseudo<'a, M: ChatMsg>(
+    indent: usize,
+    nick: &str,
+    editor: &'a mut EditorState,
+) -> Boxed<'a, Infallible> {
+    let (nick, content) = M::edit(nick, editor.text());
+
+    Join5::horizontal(
+        Seen::new(true).segment().with_fixed(true),
+        Time::new(None, style_pseudo_highlight())
+            .padding()
+            .with_right(1)
+            .with_stretch(true)
+            .segment()
+            .with_fixed(true),
+        Indent::new(indent, style_pseudo_highlight())
+            .segment()
+            .with_fixed(true),
+        Join2::vertical(
+            Text::new(nick)
+                .padding()
+                .with_right(1)
+                .segment()
+                .with_fixed(true),
+            Indent::new(1, style_indent(false)).segment(),
+        )
+        .segment()
+        .with_fixed(true),
+        Text::new(content).segment(),
+    )
+    .boxed()
+}

cove/src/ui/chat/widgets.rs

@@ -0,0 +1,117 @@
+use std::convert::Infallible;
+
+use crossterm::style::Stylize;
+use jiff::Zoned;
+use toss::{
+    Frame, Pos, Size, Style, Widget, WidgetExt, WidthDb,
+    widgets::{Boxed, Empty, Text},
+};
+
+use crate::util::InfallibleExt;
+
+pub const INDENT_STR: &str = "│ ";
+pub const INDENT_WIDTH: usize = 2;
+
+pub struct Indent {
+    level: usize,
+    style: Style,
+}
+
+impl Indent {
+    pub fn new(level: usize, style: Style) -> Self {
+        Self { level, style }
+    }
+}
+
+impl<E> Widget<E> for Indent {
+    fn size(
+        &self,
+        _widthdb: &mut WidthDb,
+        _max_width: Option<u16>,
+        _max_height: Option<u16>,
+    ) -> Result<Size, E> {
+        let width = (INDENT_WIDTH * self.level).try_into().unwrap_or(u16::MAX);
+        Ok(Size::new(width, 0))
+    }
+
+    fn draw(self, frame: &mut Frame) -> Result<(), E> {
+        let size = frame.size();
+        let indent_string = INDENT_STR.repeat(self.level);
+
+        for y in 0..size.height {
+            frame.write(Pos::new(0, y.into()), (&indent_string, self.style))
+        }
+
+        Ok(())
+    }
+}
+
+const TIME_FORMAT: &str = "%Y-%m-%d %H:%M";
+const TIME_WIDTH: u16 = 16;
+
+pub struct Time(Boxed<'static, Infallible>);
+
+impl Time {
+    pub fn new(time: Option<Zoned>, style: Style) -> Self {
+        let widget = if let Some(time) = time {
+            let text = time.strftime(TIME_FORMAT).to_string();
+            Text::new((text, style))
+                .background()
+                .with_style(style)
+                .boxed()
+        } else {
+            Empty::new()
+                .with_width(TIME_WIDTH)
+                .background()
+                .with_style(style)
+                .boxed()
+        };
+        Self(widget)
+    }
+}
+
+impl<E> Widget<E> for Time {
+    fn size(
+        &self,
+        widthdb: &mut WidthDb,
+        max_width: Option<u16>,
+        max_height: Option<u16>,
+    ) -> Result<Size, E> {
+        Ok(self.0.size(widthdb, max_width, max_height).infallible())
+    }
+
+    fn draw(self, frame: &mut Frame) -> Result<(), E> {
+        self.0.draw(frame).infallible();
+        Ok(())
+    }
+}
+
+pub struct Seen(Boxed<'static, Infallible>);
+
+impl Seen {
+    pub fn new(seen: bool) -> Self {
+        let widget = if seen {
+            Empty::new().with_width(1).boxed()
+        } else {
+            let style = Style::new().black().on_green();
+            Text::new("*").background().with_style(style).boxed()
+        };
+        Self(widget)
+    }
+}
+
+impl<E> Widget<E> for Seen {
+    fn size(
+        &self,
+        widthdb: &mut WidthDb,
+        max_width: Option<u16>,
+        max_height: Option<u16>,
+    ) -> Result<Size, E> {
+        Ok(self.0.size(widthdb, max_width, max_height).infallible())
+    }
+
+    fn draw(self, frame: &mut Frame) -> Result<(), E> {
+        self.0.draw(frame).infallible();
+        Ok(())
+    }
+}

cove/src/ui/euph/account.rs

@@ -0,0 +1,195 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use crossterm::style::Stylize;
+use euphoxide::{api::PersonalAccountView, conn};
+use toss::{
+    Style, Widget, WidgetExt,
+    widgets::{EditorState, Empty, Join3, Join4, Join5, Text},
+};
+
+use crate::{
+    euph::{self, Room},
+    ui::{UiError, util, widgets::Popup},
+};
+
+use super::popup::PopupResult;
+
+#[derive(Debug, Clone, Copy, PartialEq, Eq)]
+enum Focus {
+    Email,
+    Password,
+}
+
+pub struct LoggedOut {
+    focus: Focus,
+    email: EditorState,
+    password: EditorState,
+}
+
+impl LoggedOut {
+    fn new() -> Self {
+        Self {
+            focus: Focus::Email,
+            email: EditorState::new(),
+            password: EditorState::new(),
+        }
+    }
+
+    fn widget(&mut self) -> impl Widget<UiError> {
+        let bold = Style::new().bold();
+        Join4::vertical(
+            Text::new(("Not logged in", bold.yellow())).segment(),
+            Empty::new().with_height(1).segment(),
+            Join3::horizontal(
+                Text::new(("Email address:", bold))
+                    .segment()
+                    .with_fixed(true),
+                Empty::new().with_width(1).segment().with_fixed(true),
+                self.email
+                    .widget()
+                    .with_focus(self.focus == Focus::Email)
+                    .segment(),
+            )
+            .segment(),
+            Join3::horizontal(
+                Text::new(("Password:", bold)).segment().with_fixed(true),
+                Empty::new().with_width(5 + 1).segment().with_fixed(true),
+                self.password
+                    .widget()
+                    .with_focus(self.focus == Focus::Password)
+                    .with_hidden_default_placeholder()
+                    .segment(),
+            )
+            .segment(),
+        )
+    }
+}
+
+pub struct LoggedIn(PersonalAccountView);
+
+impl LoggedIn {
+    fn widget(&self) -> impl Widget<UiError> + use<> {
+        let bold = Style::new().bold();
+        Join5::vertical(
+            Text::new(("Logged in", bold.green())).segment(),
+            Empty::new().with_height(1).segment(),
+            Join3::horizontal(
+                Text::new(("Email address:", bold))
+                    .segment()
+                    .with_fixed(true),
+                Empty::new().with_width(1).segment().with_fixed(true),
+                Text::new((&self.0.email,)).segment(),
+            )
+            .segment(),
+            Empty::new().with_height(1).segment(),
+            Text::new(("Log out", Style::new().black().on_white())).segment(),
+        )
+    }
+}
+
+pub enum AccountUiState {
+    LoggedOut(LoggedOut),
+    LoggedIn(LoggedIn),
+}
+
+impl AccountUiState {
+    pub fn new() -> Self {
+        Self::LoggedOut(LoggedOut::new())
+    }
+
+    /// Returns `false` if the account UI should not be displayed any longer.
+    pub fn stabilize(&mut self, state: Option<&euph::State>) -> bool {
+        if let Some(euph::State::Connected(_, conn::State::Joined(state))) = state {
+            match (&self, &state.account) {
+                (Self::LoggedOut(_), Some(view)) => *self = Self::LoggedIn(LoggedIn(view.clone())),
+                (Self::LoggedIn(_), None) => *self = Self::LoggedOut(LoggedOut::new()),
+                _ => {}
+            }
+            true
+        } else {
+            false
+        }
+    }
+
+    pub fn widget(&mut self) -> impl Widget<UiError> {
+        let inner = match self {
+            Self::LoggedOut(logged_out) => logged_out.widget().first2(),
+            Self::LoggedIn(logged_in) => logged_in.widget().second2(),
+        }
+        .resize()
+        .with_min_width(40);
+
+        Popup::new(inner, "Account")
+    }
+
+    pub fn handle_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+        room: &Option<Room>,
+    ) -> PopupResult {
+        if event.matches(&keys.general.abort) {
+            return PopupResult::Close;
+        }
+
+        match self {
+            Self::LoggedOut(logged_out) => {
+                if event.matches(&keys.general.focus) {
+                    logged_out.focus = match logged_out.focus {
+                        Focus::Email => Focus::Password,
+                        Focus::Password => Focus::Email,
+                    };
+                    return PopupResult::Handled;
+                }
+
+                match logged_out.focus {
+                    Focus::Email => {
+                        if event.matches(&keys.general.confirm) {
+                            logged_out.focus = Focus::Password;
+                            return PopupResult::Handled;
+                        }
+
+                        if util::handle_editor_input_event(
+                            &mut logged_out.email,
+                            event,
+                            keys,
+                            |c| c != '\n',
+                        ) {
+                            return PopupResult::Handled;
+                        }
+                    }
+                    Focus::Password => {
+                        if event.matches(&keys.general.confirm) {
+                            if let Some(room) = room {
+                                let _ = room.login(
+                                    logged_out.email.text().to_string(),
+                                    logged_out.password.text().to_string(),
+                                );
+                            }
+                            return PopupResult::Handled;
+                        }
+
+                        if util::handle_editor_input_event(
+                            &mut logged_out.password,
+                            event,
+                            keys,
+                            |c| c != '\n',
+                        ) {
+                            return PopupResult::Handled;
+                        }
+                    }
+                }
+            }
+            Self::LoggedIn(_) => {
+                if event.matches(&keys.general.confirm) {
+                    if let Some(room) = room {
+                        let _ = room.logout();
+                    }
+                    return PopupResult::Handled;
+                }
+            }
+        }
+
+        PopupResult::NotHandled
+    }
+}

cove/src/ui/euph/auth.rs

@@ -0,0 +1,45 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use toss::{Widget, widgets::EditorState};
+
+use crate::{
+    euph::Room,
+    ui::{UiError, util, widgets::Popup},
+};
+
+use super::popup::PopupResult;
+
+pub fn new() -> EditorState {
+    EditorState::new()
+}
+
+pub fn widget(editor: &mut EditorState) -> impl Widget<UiError> {
+    Popup::new(
+        editor.widget().with_hidden_default_placeholder(),
+        "Enter password",
+    )
+}
+
+pub fn handle_input_event(
+    event: &mut InputEvent<'_>,
+    keys: &Keys,
+    room: &Option<Room>,
+    editor: &mut EditorState,
+) -> PopupResult {
+    if event.matches(&keys.general.abort) {
+        return PopupResult::Close;
+    }
+
+    if event.matches(&keys.general.confirm) {
+        if let Some(room) = &room {
+            let _ = room.auth(editor.text().to_string());
+        }
+        return PopupResult::Close;
+    }
+
+    if util::handle_editor_input_event(editor, event, keys, |_| true) {
+        return PopupResult::Handled;
+    }
+
+    PopupResult::NotHandled
+}

cove/src/ui/euph/inspect.rs

@@ -1,41 +1,46 @@
-use crossterm::style::{ContentStyle, Stylize};
-use euphoxide::api::{Message, NickEvent, SessionView};
-use euphoxide::conn::SessionInfo;
-use toss::styled::Styled;
+use cove_config::Keys;
+use cove_input::InputEvent;
+use crossterm::style::Stylize;
+use euphoxide::{
+    api::{Message, NickEvent, SessionView},
+    conn::SessionInfo,
+};
+use toss::{Style, Styled, Widget, widgets::Text};
 
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::widgets::popup::Popup;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
+use crate::ui::{UiError, widgets::Popup};
+
+use super::popup::PopupResult;
 
 macro_rules! line {
     ( $text:ident, $name:expr, $val:expr ) => {
         $text = $text
-            .then($name, ContentStyle::default().cyan())
+            .then($name, Style::new().cyan())
             .then_plain(format!(" {}\n", $val));
     };
     ( $text:ident, $name:expr, $val:expr, debug ) => {
         $text = $text
-            .then($name, ContentStyle::default().cyan())
+            .then($name, Style::new().cyan())
             .then_plain(format!(" {:?}\n", $val));
     };
     ( $text:ident, $name:expr, $val:expr, optional ) => {
         if let Some(val) = $val {
             $text = $text
-                .then($name, ContentStyle::default().cyan())
+                .then($name, Style::new().cyan())
                 .then_plain(format!(" {val}\n"));
         } else {
             $text = $text
-                .then($name, ContentStyle::default().cyan())
+                .then($name, Style::new().cyan())
                 .then_plain(" ")
-                .then("none", ContentStyle::default().italic().grey())
+                .then("none", Style::new().italic().grey())
                 .then_plain("\n");
         }
     };
     ( $text:ident, $name:expr, $val:expr, yes or no ) => {
-        $text = $text
-            .then($name, ContentStyle::default().cyan())
-            .then_plain(if $val { " yes\n" } else { " no\n" });
+        $text = $text.then($name, Style::new().cyan()).then_plain(if $val {
+            " yes\n"
+        } else {
+            " no\n"
+        });
     };
 }
 
@@ -86,8 +91,8 @@ fn message_lines(mut text: Styled, msg: &Message) -> Styled {
     text
 }
 
-pub fn session_widget(session: &SessionInfo) -> BoxedWidget {
-    let heading_style = ContentStyle::default().bold();
+pub fn session_widget(session: &SessionInfo) -> impl Widget<UiError> + use<> {
+    let heading_style = Style::new().bold();
 
     let text = match session {
         SessionInfo::Full(session) => {
@@ -100,11 +105,11 @@ pub fn session_widget(session: &SessionInfo) -> BoxedWidget {
         }
     };
 
-    Popup::new(Text::new(text)).title("Inspect session").build()
+    Popup::new(Text::new(text), "Inspect session")
 }
 
-pub fn message_widget(msg: &Message) -> BoxedWidget {
-    let heading_style = ContentStyle::default().bold();
+pub fn message_widget(msg: &Message) -> impl Widget<UiError> + use<> {
+    let heading_style = Style::new().bold();
 
     let mut text = Styled::new("Message", heading_style).then_plain("\n");
 
@@ -117,21 +122,13 @@ pub fn message_widget(msg: &Message) -> BoxedWidget {
 
     text = session_view_lines(text, &msg.sender);
 
-    Popup::new(Text::new(text)).title("Inspect message").build()
+    Popup::new(Text::new(text), "Inspect message")
 }
 
-pub fn list_key_bindings(bindings: &mut KeyBindingsList) {
-    bindings.binding("esc", "close");
-}
-
-pub enum EventResult {
-    NotHandled,
-    Close,
-}
-
-pub fn handle_input_event(event: &InputEvent) -> EventResult {
-    match event {
-        key!(Esc) => EventResult::Close,
-        _ => EventResult::NotHandled,
+pub fn handle_input_event(event: &mut InputEvent<'_>, keys: &Keys) -> PopupResult {
+    if event.matches(&keys.general.abort) {
+        return PopupResult::Close;
     }
+
+    PopupResult::NotHandled
 }

cove/src/ui/euph/links.rs

@@ -0,0 +1,192 @@
+use cove_config::{Config, Keys};
+use cove_input::InputEvent;
+use crossterm::{event::KeyCode, style::Stylize};
+use linkify::{LinkFinder, LinkKind};
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{Join2, Text},
+};
+
+use crate::{
+    euph::{self, SpanType},
+    ui::{
+        UiError, key_bindings, util,
+        widgets::{ListBuilder, ListState, Popup},
+    },
+};
+
+use super::popup::PopupResult;
+
+#[derive(Clone, PartialEq, Eq, PartialOrd, Ord)]
+enum Link {
+    Url(String),
+    Room(String),
+}
+
+pub struct LinksState {
+    config: &'static Config,
+    links: Vec<Link>,
+    list: ListState<usize>,
+}
+
+const NUMBER_KEYS: [char; 10] = ['1', '2', '3', '4', '5', '6', '7', '8', '9', '0'];
+
+impl LinksState {
+    pub fn new(config: &'static Config, content: &str) -> Self {
+        let mut links = vec![];
+
+        // Collect URL-like links
+        for link in LinkFinder::new()
+            .url_must_have_scheme(false)
+            .kinds(&[LinkKind::Url])
+            .links(content)
+        {
+            links.push((
+                link.start(),
+                link.end(),
+                Link::Url(link.as_str().to_string()),
+            ));
+        }
+
+        // Collect room links
+        for (span, range) in euph::find_spans(content) {
+            if span == SpanType::Room {
+                let name = &content[range.start + 1..range.end];
+                links.push((range.start, range.end, Link::Room(name.to_string())));
+            }
+        }
+
+        links.sort();
+        let links = links
+            .into_iter()
+            .map(|(_, _, link)| link)
+            .collect::<Vec<_>>();
+
+        Self {
+            config,
+            links,
+            list: ListState::new(),
+        }
+    }
+
+    pub fn widget(&mut self) -> impl Widget<UiError> {
+        let style_selected = Style::new().black().on_white();
+
+        let mut list_builder = ListBuilder::new();
+
+        if self.links.is_empty() {
+            list_builder.add_unsel(Text::new(("No links found", Style::new().grey().italic())))
+        }
+
+        for (id, link) in self.links.iter().enumerate() {
+            let link = link.clone();
+            list_builder.add_sel(id, move |selected| {
+                let mut text = Styled::default();
+
+                // Number key indicator
+                text = match NUMBER_KEYS.get(id) {
+                    None if selected => text.then("    ", style_selected),
+                    None => text.then_plain("    "),
+                    Some(key) if selected => text.then(format!("[{key}] "), style_selected.bold()),
+                    Some(key) => text.then(format!("[{key}] "), Style::new().dark_grey().bold()),
+                };
+
+                // The link itself
+                text = match link {
+                    Link::Url(url) if selected => text.then(url, style_selected),
+                    Link::Url(url) => text.then_plain(url),
+                    Link::Room(name) if selected => {
+                        text.then(format!("&{name}"), style_selected.bold())
+                    }
+                    Link::Room(name) => text.then(format!("&{name}"), Style::new().blue().bold()),
+                };
+
+                Text::new(text).with_wrap(false)
+            });
+        }
+
+        let hint_style = Style::new().grey().italic();
+        let hint = Styled::new("Open links with ", hint_style)
+            .and_then(key_bindings::format_binding(
+                &self.config.keys.general.confirm,
+            ))
+            .then(" or the number keys.", hint_style);
+
+        Popup::new(
+            Join2::vertical(
+                list_builder.build(&mut self.list).segment(),
+                Text::new(hint)
+                    .padding()
+                    .with_top(1)
+                    .segment()
+                    .with_fixed(true),
+            ),
+            "Links",
+        )
+    }
+
+    fn open_link_by_id(&self, id: usize) -> PopupResult {
+        match self.links.get(id) {
+            Some(Link::Url(url)) => {
+                // The `http://` or `https://` schema is necessary for
+                // open::that to successfully open the link in the browser.
+                let link = if url.starts_with("http://") || url.starts_with("https://") {
+                    url.clone()
+                } else {
+                    format!("https://{url}")
+                };
+
+                if let Err(error) = open::that(&link) {
+                    return PopupResult::ErrorOpeningLink { link, error };
+                }
+            }
+
+            Some(Link::Room(name)) => return PopupResult::SwitchToRoom { name: name.clone() },
+
+            _ => {}
+        }
+        PopupResult::Handled
+    }
+
+    fn open_link(&self) -> PopupResult {
+        if let Some(id) = self.list.selected() {
+            self.open_link_by_id(*id)
+        } else {
+            PopupResult::Handled
+        }
+    }
+
+    pub fn handle_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> PopupResult {
+        if event.matches(&keys.general.abort) {
+            return PopupResult::Close;
+        }
+
+        if event.matches(&keys.general.confirm) {
+            return self.open_link();
+        }
+
+        if util::handle_list_input_event(&mut self.list, event, keys) {
+            return PopupResult::Handled;
+        }
+
+        if let Some(key_event) = event.key_event() {
+            if key_event.modifiers.is_empty() {
+                match key_event.code {
+                    KeyCode::Char('1') => return self.open_link_by_id(0),
+                    KeyCode::Char('2') => return self.open_link_by_id(1),
+                    KeyCode::Char('3') => return self.open_link_by_id(2),
+                    KeyCode::Char('4') => return self.open_link_by_id(3),
+                    KeyCode::Char('5') => return self.open_link_by_id(4),
+                    KeyCode::Char('6') => return self.open_link_by_id(5),
+                    KeyCode::Char('7') => return self.open_link_by_id(6),
+                    KeyCode::Char('8') => return self.open_link_by_id(7),
+                    KeyCode::Char('9') => return self.open_link_by_id(8),
+                    KeyCode::Char('0') => return self.open_link_by_id(9),
+                    _ => {}
+                }
+            }
+        }
+
+        PopupResult::NotHandled
+    }
+}

cove/src/ui/euph/nick.rs

@@ -0,0 +1,47 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use euphoxide::conn::Joined;
+use toss::{Style, Widget, widgets::EditorState};
+
+use crate::{
+    euph::{self, Room},
+    ui::{UiError, util, widgets::Popup},
+};
+
+use super::popup::PopupResult;
+
+pub fn new(joined: Joined) -> EditorState {
+    EditorState::with_initial_text(joined.session.name)
+}
+
+pub fn widget(editor: &mut EditorState) -> impl Widget<UiError> {
+    let inner = editor
+        .widget()
+        .with_highlight(|s| euph::style_nick_exact(s, Style::new()));
+
+    Popup::new(inner, "Choose nick")
+}
+
+pub fn handle_input_event(
+    event: &mut InputEvent<'_>,
+    keys: &Keys,
+    room: &Option<Room>,
+    editor: &mut EditorState,
+) -> PopupResult {
+    if event.matches(&keys.general.abort) {
+        return PopupResult::Close;
+    }
+
+    if event.matches(&keys.general.confirm) {
+        if let Some(room) = &room {
+            let _ = room.nick(editor.text().to_string());
+        }
+        return PopupResult::Close;
+    }
+
+    if util::handle_editor_input_event(editor, event, keys, |c| c != '\n') {
+        return PopupResult::Handled;
+    }
+
+    PopupResult::NotHandled
+}

cove/src/ui/euph/nick_list.rs

@@ -0,0 +1,222 @@
+use std::iter;
+
+use crossterm::style::{Color, Stylize};
+use euphoxide::{
+    api::{NickEvent, SessionId, SessionType, SessionView, UserId},
+    conn::{Joined, SessionInfo},
+};
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{Background, Text},
+};
+
+use crate::{
+    euph,
+    ui::{
+        UiError,
+        widgets::{ListBuilder, ListState},
+    },
+};
+
+pub fn widget<'a>(
+    list: &'a mut ListState<SessionId>,
+    joined: &Joined,
+    focused: bool,
+    nick_emoji: bool,
+) -> impl Widget<UiError> + use<'a> {
+    let mut list_builder = ListBuilder::new();
+    render_rows(&mut list_builder, joined, focused, nick_emoji);
+    list_builder.build(list)
+}
+
+#[derive(Debug, PartialEq, Eq, PartialOrd, Ord)]
+struct HalfSession {
+    name: String,
+    id: UserId,
+    session_id: SessionId,
+    is_staff: bool,
+    is_manager: bool,
+}
+
+impl HalfSession {
+    fn from_session_view(sess: &SessionView) -> Self {
+        Self {
+            name: sess.name.clone(),
+            id: sess.id.clone(),
+            session_id: sess.session_id.clone(),
+            is_staff: sess.is_staff,
+            is_manager: sess.is_manager,
+        }
+    }
+
+    fn from_nick_event(nick: &NickEvent) -> Self {
+        Self {
+            name: nick.to.clone(),
+            id: nick.id.clone(),
+            session_id: nick.session_id.clone(),
+            is_staff: false,
+            is_manager: false,
+        }
+    }
+
+    fn from_session_info(info: &SessionInfo) -> Self {
+        match info {
+            SessionInfo::Full(sess) => Self::from_session_view(sess),
+            SessionInfo::Partial(nick) => Self::from_nick_event(nick),
+        }
+    }
+}
+
+fn render_rows(
+    list_builder: &mut ListBuilder<'_, SessionId, Background<Text>>,
+    joined: &Joined,
+    focused: bool,
+    nick_emoji: bool,
+) {
+    let mut people = vec![];
+    let mut bots = vec![];
+    let mut lurkers = vec![];
+    let mut nurkers = vec![];
+
+    let sessions = joined
+        .listing
+        .values()
+        .map(HalfSession::from_session_info)
+        .chain(iter::once(HalfSession::from_session_view(&joined.session)));
+    for sess in sessions {
+        match sess.id.session_type() {
+            Some(SessionType::Bot) if sess.name.is_empty() => nurkers.push(sess),
+            Some(SessionType::Bot) => bots.push(sess),
+            _ if sess.name.is_empty() => lurkers.push(sess),
+            _ => people.push(sess),
+        }
+    }
+
+    people.sort_unstable();
+    bots.sort_unstable();
+    lurkers.sort_unstable();
+    nurkers.sort_unstable();
+
+    render_section(
+        list_builder,
+        "People",
+        &people,
+        &joined.session,
+        focused,
+        nick_emoji,
+    );
+    render_section(
+        list_builder,
+        "Bots",
+        &bots,
+        &joined.session,
+        focused,
+        nick_emoji,
+    );
+    render_section(
+        list_builder,
+        "Lurkers",
+        &lurkers,
+        &joined.session,
+        focused,
+        nick_emoji,
+    );
+    render_section(
+        list_builder,
+        "Nurkers",
+        &nurkers,
+        &joined.session,
+        focused,
+        nick_emoji,
+    );
+}
+
+fn render_section(
+    list_builder: &mut ListBuilder<'_, SessionId, Background<Text>>,
+    name: &str,
+    sessions: &[HalfSession],
+    own_session: &SessionView,
+    focused: bool,
+    nick_emoji: bool,
+) {
+    if sessions.is_empty() {
+        return;
+    }
+
+    let heading_style = Style::new().bold();
+
+    if !list_builder.is_empty() {
+        list_builder.add_unsel(Text::new("").background());
+    }
+
+    let row = Styled::new_plain(" ")
+        .then(name, heading_style)
+        .then_plain(format!(" ({})", sessions.len()));
+    list_builder.add_unsel(Text::new(row).background());
+
+    for session in sessions {
+        render_row(list_builder, session, own_session, focused, nick_emoji);
+    }
+}
+
+fn render_row(
+    list_builder: &mut ListBuilder<'_, SessionId, Background<Text>>,
+    session: &HalfSession,
+    own_session: &SessionView,
+    focused: bool,
+    nick_emoji: bool,
+) {
+    let (name, style, style_inv, perms_style_inv) = if session.name.is_empty() {
+        let name = "lurk".to_string();
+        let style = Style::new().grey();
+        let style_inv = Style::new().black().on_grey();
+        (name, style, style_inv, style_inv)
+    } else {
+        let name = &session.name as &str;
+        let (r, g, b) = euph::nick_color(name);
+        let name = euph::EMOJI.replace(name).to_string();
+        let color = Color::Rgb { r, g, b };
+        let style = Style::new().bold().with(color);
+        let style_inv = Style::new().bold().black().on(color);
+        let perms_style_inv = Style::new().black().on(color);
+        (name, style, style_inv, perms_style_inv)
+    };
+
+    let perms = if session.is_staff {
+        "!"
+    } else if session.is_manager {
+        "*"
+    } else if session.id.session_type() == Some(SessionType::Account) {
+        "~"
+    } else {
+        ""
+    };
+
+    let owner = if session.session_id == own_session.session_id {
+        ">"
+    } else {
+        " "
+    };
+
+    let emoji = if nick_emoji {
+        format!(" ({})", euph::user_id_emoji(&session.id))
+    } else {
+        "".to_string()
+    };
+
+    list_builder.add_sel(session.session_id.clone(), move |selected| {
+        if focused && selected {
+            let text = Styled::new_plain(owner)
+                .then(name, style_inv)
+                .then(perms, perms_style_inv)
+                .then(emoji, perms_style_inv);
+            Text::new(text).background().with_style(style_inv)
+        } else {
+            let text = Styled::new_plain(owner)
+                .then(&name, style)
+                .then_plain(perms)
+                .then_plain(emoji);
+            Text::new(text).background()
+        }
+    });
+}

cove/src/ui/euph/popup.rs

@@ -0,0 +1,40 @@
+use std::io;
+
+use crossterm::style::Stylize;
+use toss::{Style, Styled, Widget, widgets::Text};
+
+use crate::ui::{UiError, widgets::Popup};
+
+pub enum RoomPopup {
+    Error { description: String, reason: String },
+}
+
+impl RoomPopup {
+    fn server_error_widget(description: &str, reason: &str) -> impl Widget<UiError> + use<> {
+        let border_style = Style::new().red().bold();
+        let text = Styled::new_plain(description)
+            .then_plain("\n\n")
+            .then("Reason:", Style::new().bold())
+            .then_plain(" ")
+            .then_plain(reason);
+
+        Popup::new(Text::new(text), ("Error", border_style)).with_border_style(border_style)
+    }
+
+    pub fn widget(&self) -> impl Widget<UiError> + use<> {
+        match self {
+            Self::Error {
+                description,
+                reason,
+            } => Self::server_error_widget(description, reason),
+        }
+    }
+}
+
+pub enum PopupResult {
+    NotHandled,
+    Handled,
+    Close,
+    SwitchToRoom { name: String },
+    ErrorOpeningLink { link: String, error: io::Error },
+}

cove/src/ui/euph/room.rs

@@ -0,0 +1,708 @@
+use std::collections::VecDeque;
+
+use cove_config::{Config, Keys};
+use cove_input::InputEvent;
+use crossterm::style::Stylize;
+use euphoxide::{
+    api::{Data, Message, MessageId, PacketType, SessionId, packet::ParsedPacket},
+    bot::instance::{ConnSnapshot, Event, ServerConfig},
+    conn::{self, Joined, Joining, SessionInfo},
+};
+use jiff::tz::TimeZone;
+use tokio::sync::{
+    mpsc,
+    oneshot::{self, error::TryRecvError},
+};
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{BoxedAsync, EditorState, Join2, Layer, Text},
+};
+
+use crate::{
+    euph::{self, SpanType},
+    macros::logging_unwrap,
+    ui::{
+        UiError, UiEvent,
+        chat::{ChatState, Reaction},
+        util,
+        widgets::ListState,
+    },
+    vault::{EuphRoomVault, RoomIdentifier},
+};
+
+use super::{
+    account::AccountUiState,
+    auth, inspect,
+    links::LinksState,
+    nick, nick_list,
+    popup::{PopupResult, RoomPopup},
+};
+
+#[derive(Debug, Clone, Copy, PartialEq, Eq)]
+enum Focus {
+    Chat,
+    NickList,
+}
+
+#[allow(clippy::large_enum_variant)]
+enum State {
+    Normal,
+    Auth(EditorState),
+    Nick(EditorState),
+    Account(AccountUiState),
+    Links(LinksState),
+    InspectMessage(Message),
+    InspectSession(SessionInfo),
+}
+
+type EuphChatState = ChatState<euph::SmallMessage, EuphRoomVault>;
+
+pub struct EuphRoom {
+    config: &'static Config,
+    server_config: ServerConfig,
+    room_config: cove_config::EuphRoom,
+    ui_event_tx: mpsc::UnboundedSender<UiEvent>,
+
+    room: Option<euph::Room>,
+
+    focus: Focus,
+    state: State,
+    popups: VecDeque<RoomPopup>,
+
+    chat: EuphChatState,
+    last_msg_sent: Option<oneshot::Receiver<MessageId>>,
+
+    nick_list: ListState<SessionId>,
+
+    mentioned: bool,
+}
+
+impl EuphRoom {
+    pub fn new(
+        config: &'static Config,
+        server_config: ServerConfig,
+        room_config: cove_config::EuphRoom,
+        vault: EuphRoomVault,
+        tz: TimeZone,
+        ui_event_tx: mpsc::UnboundedSender<UiEvent>,
+    ) -> Self {
+        Self {
+            config,
+            server_config,
+            room_config,
+            ui_event_tx,
+            room: None,
+            focus: Focus::Chat,
+            state: State::Normal,
+            popups: VecDeque::new(),
+            chat: ChatState::new(vault, tz),
+            last_msg_sent: None,
+            nick_list: ListState::new(),
+            mentioned: false,
+        }
+    }
+
+    fn vault(&self) -> &EuphRoomVault {
+        self.chat.store()
+    }
+
+    fn domain(&self) -> &str {
+        &self.vault().room().domain
+    }
+
+    fn name(&self) -> &str {
+        &self.vault().room().name
+    }
+
+    pub fn connect(&mut self, next_instance_id: &mut usize) {
+        if self.room.is_none() {
+            let room = self.vault().room();
+            let instance_config = self
+                .server_config
+                .clone()
+                .room(self.vault().room().name.clone())
+                .name(format!("{room:?}-{next_instance_id}"))
+                .human(true)
+                .username(self.room_config.username.clone())
+                .force_username(self.room_config.force_username)
+                .password(self.room_config.password.clone());
+            *next_instance_id = next_instance_id.wrapping_add(1);
+
+            let tx = self.ui_event_tx.clone();
+            self.room = Some(euph::Room::new(
+                self.vault().clone(),
+                instance_config,
+                move |e| {
+                    let _ = tx.send(UiEvent::Euph(e));
+                },
+            ));
+        }
+    }
+
+    pub fn disconnect(&mut self) {
+        self.room = None;
+    }
+
+    pub fn room_state(&self) -> Option<&euph::State> {
+        if let Some(room) = &self.room {
+            Some(room.state())
+        } else {
+            None
+        }
+    }
+
+    pub fn room_state_joined(&self) -> Option<&Joined> {
+        self.room_state().and_then(|s| s.joined())
+    }
+
+    pub fn stopped(&self) -> bool {
+        self.room.as_ref().map(|r| r.stopped()).unwrap_or(true)
+    }
+
+    pub fn retain(&mut self) {
+        if let Some(room) = &self.room {
+            if room.stopped() {
+                self.room = None;
+            }
+        }
+    }
+
+    pub fn retrieve_mentioned(&mut self) -> bool {
+        let mentioned = self.mentioned;
+        self.mentioned = false;
+        mentioned
+    }
+
+    pub async fn unseen_msgs_count(&self) -> usize {
+        logging_unwrap!(self.vault().unseen_msgs_count().await)
+    }
+
+    async fn stabilize_pseudo_msg(&mut self) {
+        if let Some(id_rx) = &mut self.last_msg_sent {
+            match id_rx.try_recv() {
+                Ok(id) => {
+                    self.chat.send_successful(id);
+                    self.last_msg_sent = None;
+                }
+                Err(TryRecvError::Empty) => {} // Wait a bit longer
+                Err(TryRecvError::Closed) => {
+                    self.chat.send_failed();
+                    self.last_msg_sent = None;
+                }
+            }
+        }
+    }
+
+    fn stabilize_focus(&mut self) {
+        if self.room_state_joined().is_none() {
+            self.focus = Focus::Chat; // There is no nick list to focus on
+        }
+    }
+
+    fn stabilize_state(&mut self) {
+        let room_state = self.room.as_ref().map(|r| r.state());
+        match (&mut self.state, room_state) {
+            (
+                State::Auth(_),
+                Some(euph::State::Connected(
+                    _,
+                    conn::State::Joining(Joining {
+                        bounce: Some(_), ..
+                    }),
+                )),
+            ) => {} // Nothing to see here
+            (State::Auth(_), _) => self.state = State::Normal,
+
+            (State::Nick(_), Some(euph::State::Connected(_, conn::State::Joined(_)))) => {}
+            (State::Nick(_), _) => self.state = State::Normal,
+
+            (State::Account(account), state) => {
+                if !account.stabilize(state) {
+                    self.state = State::Normal
+                }
+            }
+
+            _ => {}
+        }
+    }
+
+    async fn stabilize(&mut self) {
+        self.stabilize_pseudo_msg().await;
+        self.stabilize_focus();
+        self.stabilize_state();
+    }
+
+    pub async fn widget(&mut self) -> BoxedAsync<'_, UiError> {
+        self.stabilize().await;
+
+        let room_state = self.room.as_ref().map(|room| room.state());
+        let status_widget = self.status_widget(room_state).await;
+        let chat = match room_state.and_then(|s| s.joined()) {
+            Some(joined) => Self::widget_with_nick_list(
+                &mut self.chat,
+                status_widget,
+                &mut self.nick_list,
+                joined,
+                self.focus,
+            ),
+            None => Self::widget_without_nick_list(&mut self.chat, status_widget),
+        };
+
+        let mut layers = vec![chat];
+
+        match &mut self.state {
+            State::Normal => {}
+            State::Auth(editor) => layers.push(auth::widget(editor).desync().boxed_async()),
+            State::Nick(editor) => layers.push(nick::widget(editor).desync().boxed_async()),
+            State::Account(account) => layers.push(account.widget().desync().boxed_async()),
+            State::Links(links) => layers.push(links.widget().desync().boxed_async()),
+            State::InspectMessage(message) => {
+                layers.push(inspect::message_widget(message).desync().boxed_async())
+            }
+            State::InspectSession(session) => {
+                layers.push(inspect::session_widget(session).desync().boxed_async())
+            }
+        }
+
+        for popup in &self.popups {
+            layers.push(popup.widget().desync().boxed_async());
+        }
+
+        Layer::new(layers).boxed_async()
+    }
+
+    fn widget_without_nick_list(
+        chat: &mut EuphChatState,
+        status_widget: impl Widget<UiError> + Send + Sync + 'static,
+    ) -> BoxedAsync<'_, UiError> {
+        let chat_widget = chat.widget(String::new(), true);
+
+        Join2::vertical(
+            status_widget.desync().segment().with_fixed(true),
+            chat_widget.segment(),
+        )
+        .boxed_async()
+    }
+
+    fn widget_with_nick_list<'a>(
+        chat: &'a mut EuphChatState,
+        status_widget: impl Widget<UiError> + Send + Sync + 'static,
+        nick_list: &'a mut ListState<SessionId>,
+        joined: &Joined,
+        focus: Focus,
+    ) -> BoxedAsync<'a, UiError> {
+        let nick_list_widget = nick_list::widget(
+            nick_list,
+            joined,
+            focus == Focus::NickList,
+            chat.nick_emoji(),
+        )
+        .padding()
+        .with_right(1)
+        .border()
+        .desync();
+
+        let chat_widget = chat.widget(joined.session.name.clone(), focus == Focus::Chat);
+
+        Join2::horizontal(
+            Join2::vertical(
+                status_widget.desync().segment().with_fixed(true),
+                chat_widget.segment(),
+            )
+            .segment(),
+            nick_list_widget.segment().with_fixed(true),
+        )
+        .boxed_async()
+    }
+
+    async fn status_widget(&self, state: Option<&euph::State>) -> impl Widget<UiError> + use<> {
+        let room_style = Style::new().bold().blue();
+        let mut info = Styled::new(format!("{} ", self.domain()), Style::new().grey())
+            .then(format!("&{}", self.name()), room_style);
+
+        info = match state {
+            None | Some(euph::State::Stopped) => info.then_plain(", archive"),
+            Some(euph::State::Disconnected) => info.then_plain(", waiting..."),
+            Some(euph::State::Connecting) => info.then_plain(", connecting..."),
+            Some(euph::State::Connected(_, conn::State::Joining(j))) if j.bounce.is_some() => {
+                info.then_plain(", auth required")
+            }
+            Some(euph::State::Connected(_, conn::State::Joining(_))) => {
+                info.then_plain(", joining...")
+            }
+            Some(euph::State::Connected(_, conn::State::Joined(j))) => {
+                let nick = &j.session.name;
+                if nick.is_empty() {
+                    info.then_plain(", present without nick")
+                } else {
+                    info.then_plain(", present as ")
+                        .and_then(euph::style_nick(nick, Style::new()))
+                }
+            }
+        };
+
+        let unseen = self.unseen_msgs_count().await;
+        if unseen > 0 {
+            info = info
+                .then_plain(" (")
+                .then(format!("{unseen}"), Style::new().bold().green())
+                .then_plain(")");
+        }
+
+        let title = if unseen > 0 {
+            format!("&{} ({unseen})", self.name())
+        } else {
+            format!("&{}", self.name())
+        };
+
+        Text::new(info)
+            .padding()
+            .with_horizontal(1)
+            .border()
+            .title(title)
+    }
+
+    async fn handle_chat_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> bool {
+        let can_compose = self.room_state_joined().is_some();
+
+        let reaction = self.chat.handle_input_event(event, keys, can_compose).await;
+        let reaction = logging_unwrap!(reaction);
+
+        match reaction {
+            Reaction::NotHandled => {}
+            Reaction::Handled => return true,
+            Reaction::Composed { parent, content } => {
+                if let Some(room) = &self.room {
+                    match room.send(parent, content) {
+                        Ok(id_rx) => self.last_msg_sent = Some(id_rx),
+                        Err(_) => self.chat.send_failed(),
+                    }
+                    return true;
+                }
+            }
+        }
+
+        false
+    }
+
+    async fn handle_room_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> bool {
+        match self.room_state() {
+            // Authenticating
+            Some(euph::State::Connected(
+                _,
+                conn::State::Joining(Joining {
+                    bounce: Some(_), ..
+                }),
+            )) => {
+                if event.matches(&keys.room.action.authenticate) {
+                    self.state = State::Auth(auth::new());
+                    return true;
+                }
+            }
+
+            // Joined
+            Some(euph::State::Connected(_, conn::State::Joined(joined))) => {
+                if event.matches(&keys.room.action.nick) {
+                    self.state = State::Nick(nick::new(joined.clone()));
+                    return true;
+                }
+                if event.matches(&keys.room.action.more_messages) {
+                    if let Some(room) = &self.room {
+                        let _ = room.log();
+                    }
+                    return true;
+                }
+                if event.matches(&keys.room.action.account) {
+                    self.state = State::Account(AccountUiState::new());
+                    return true;
+                }
+            }
+
+            // Otherwise
+            _ => {}
+        }
+
+        false
+    }
+
+    async fn handle_chat_focus_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+    ) -> bool {
+        // We need to handle chat input first, otherwise the other
+        // key bindings will shadow characters in the editor.
+        if self.handle_chat_input_event(event, keys).await {
+            return true;
+        }
+
+        if self.handle_room_input_event(event, keys).await {
+            return true;
+        }
+
+        if event.matches(&keys.tree.action.inspect) {
+            if let Some(id) = self.chat.cursor() {
+                if let Some(msg) = logging_unwrap!(self.vault().full_msg(*id).await) {
+                    self.state = State::InspectMessage(msg);
+                }
+            }
+            return true;
+        }
+
+        if event.matches(&keys.tree.action.links) {
+            if let Some(id) = self.chat.cursor() {
+                if let Some(msg) = logging_unwrap!(self.vault().msg(*id).await) {
+                    self.state = State::Links(LinksState::new(self.config, &msg.content));
+                }
+            }
+            return true;
+        }
+
+        false
+    }
+
+    fn handle_nick_list_focus_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+    ) -> bool {
+        if util::handle_list_input_event(&mut self.nick_list, event, keys) {
+            return true;
+        }
+
+        if event.matches(&keys.tree.action.inspect) {
+            if let Some(joined) = self.room_state_joined() {
+                if let Some(id) = self.nick_list.selected() {
+                    if *id == joined.session.session_id {
+                        self.state =
+                            State::InspectSession(SessionInfo::Full(joined.session.clone()));
+                    } else if let Some(session) = joined.listing.get(id) {
+                        self.state = State::InspectSession(session.clone());
+                    }
+                }
+            }
+            return true;
+        }
+
+        false
+    }
+
+    async fn handle_normal_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> bool {
+        match self.focus {
+            Focus::Chat => {
+                if self.handle_chat_focus_input_event(event, keys).await {
+                    return true;
+                }
+
+                if self.room_state_joined().is_some() && event.matches(&keys.general.focus) {
+                    self.focus = Focus::NickList;
+                    return true;
+                }
+            }
+            Focus::NickList => {
+                if event.matches(&keys.general.abort) || event.matches(&keys.general.focus) {
+                    self.focus = Focus::Chat;
+                    return true;
+                }
+
+                if self.handle_nick_list_focus_input_event(event, keys) {
+                    return true;
+                }
+            }
+        }
+
+        false
+    }
+
+    pub async fn handle_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+    ) -> RoomResult {
+        if !self.popups.is_empty() {
+            if event.matches(&keys.general.abort) {
+                self.popups.pop_back();
+                return RoomResult::Handled;
+            }
+            // Prevent event from reaching anything below the popup
+            return RoomResult::NotHandled;
+        }
+
+        let result = match &mut self.state {
+            State::Normal => return self.handle_normal_input_event(event, keys).await.into(),
+            State::Auth(editor) => auth::handle_input_event(event, keys, &self.room, editor),
+            State::Nick(editor) => nick::handle_input_event(event, keys, &self.room, editor),
+            State::Account(account) => account.handle_input_event(event, keys, &self.room),
+            State::Links(links) => links.handle_input_event(event, keys),
+            State::InspectMessage(_) | State::InspectSession(_) => {
+                inspect::handle_input_event(event, keys)
+            }
+        };
+
+        match result {
+            PopupResult::NotHandled => RoomResult::NotHandled,
+            PopupResult::Handled => RoomResult::Handled,
+            PopupResult::Close => {
+                self.state = State::Normal;
+                RoomResult::Handled
+            }
+            PopupResult::SwitchToRoom { name } => RoomResult::SwitchToRoom {
+                room: RoomIdentifier {
+                    domain: self.vault().room().domain.clone(),
+                    name,
+                },
+            },
+            PopupResult::ErrorOpeningLink { link, error } => {
+                self.popups.push_front(RoomPopup::Error {
+                    description: format!("Failed to open link: {link}"),
+                    reason: format!("{error}"),
+                });
+                RoomResult::Handled
+            }
+        }
+    }
+
+    pub async fn handle_event(&mut self, event: Event) -> bool {
+        let Some(room) = &self.room else { return false };
+
+        if event.config().name != room.instance().config().name {
+            // If we allowed names other than the current one, old instances
+            // that haven't yet shut down properly could mess up our state.
+            return false;
+        }
+
+        if let Event::Packet(
+            _,
+            ParsedPacket {
+                content: Ok(Data::SendEvent(send)),
+                ..
+            },
+            ConnSnapshot {
+                state: conn::State::Joined(joined),
+                ..
+            },
+        ) = &event
+        {
+            let normalized_name = euphoxide::nick::normalize(&joined.session.name);
+            let content = &*send.0.content;
+            for (rtype, rspan) in euph::find_spans(content) {
+                if rtype != SpanType::Mention {
+                    continue;
+                }
+                let Some(mention) = content[rspan].strip_prefix('@') else {
+                    continue;
+                };
+                let normalized_mention = euphoxide::nick::normalize(mention);
+                if normalized_name == normalized_mention {
+                    self.mentioned = true;
+                    break;
+                }
+            }
+        }
+
+        // We handle the packet internally first because the room event handling
+        // will consume it while we only need a reference.
+        let handled = if let Event::Packet(_, packet, _) = &event {
+            match &packet.content {
+                Ok(data) => self.handle_euph_data(data),
+                Err(reason) => self.handle_euph_error(packet.r#type, reason),
+            }
+        } else {
+            // The room state changes, which always means a redraw.
+            true
+        };
+
+        self.room
+            .as_mut()
+            // See check at the beginning of the function.
+            .expect("no room even though we checked earlier")
+            .handle_event(event)
+            .await;
+
+        handled
+    }
+
+    fn handle_euph_data(&mut self, data: &Data) -> bool {
+        // These packets don't result in any noticeable change in the UI.
+        #[allow(clippy::match_like_matches_macro)]
+        let handled = match data {
+            Data::PingEvent(_) | Data::PingReply(_) => {
+                // Pings are displayed nowhere in the room UI.
+                false
+            }
+            Data::DisconnectEvent(_) => {
+                // Followed by the server closing the connection, meaning that
+                // we'll get an `EuphRoomEvent::Disconnected` soon after this.
+                false
+            }
+            _ => true,
+        };
+
+        // Because the euphoria API is very carefully designed with emphasis on
+        // consistency, some failures are not normal errors but instead
+        // error-free replies that encode their own error.
+        let error = match data {
+            Data::AuthReply(reply) if !reply.success => {
+                Some(("authenticate", reply.reason.clone()))
+            }
+            Data::LoginReply(reply) if !reply.success => Some(("login", reply.reason.clone())),
+            _ => None,
+        };
+        if let Some((action, reason)) = error {
+            let description = format!("Failed to {action}.");
+            let reason = reason.unwrap_or_else(|| "no idea, the server wouldn't say".to_string());
+            self.popups.push_front(RoomPopup::Error {
+                description,
+                reason,
+            });
+        }
+
+        handled
+    }
+
+    fn handle_euph_error(&mut self, r#type: PacketType, reason: &str) -> bool {
+        let action = match r#type {
+            PacketType::AuthReply => "authenticate",
+            PacketType::NickReply => "set nick",
+            PacketType::PmInitiateReply => "initiate pm",
+            PacketType::SendReply => "send message",
+            PacketType::ChangeEmailReply => "change account email",
+            PacketType::ChangeNameReply => "change account name",
+            PacketType::ChangePasswordReply => "change account password",
+            PacketType::LoginReply => "log in",
+            PacketType::LogoutReply => "log out",
+            PacketType::RegisterAccountReply => "register account",
+            PacketType::ResendVerificationEmailReply => "resend verification email",
+            PacketType::ResetPasswordReply => "reset account password",
+            PacketType::BanReply => "ban",
+            PacketType::EditMessageReply => "edit message",
+            PacketType::GrantAccessReply => "grant room access",
+            PacketType::GrantManagerReply => "grant manager permissions",
+            PacketType::RevokeAccessReply => "revoke room access",
+            PacketType::RevokeManagerReply => "revoke manager permissions",
+            PacketType::UnbanReply => "unban",
+            _ => return false,
+        };
+        let description = format!("Failed to {action}.");
+        self.popups.push_front(RoomPopup::Error {
+            description,
+            reason: reason.to_string(),
+        });
+        true
+    }
+}
+
+pub enum RoomResult {
+    NotHandled,
+    Handled,
+    SwitchToRoom { room: RoomIdentifier },
+}
+
+impl From<bool> for RoomResult {
+    fn from(value: bool) -> Self {
+        match value {
+            true => Self::Handled,
+            false => Self::NotHandled,
+        }
+    }
+}

cove/src/ui/key_bindings.rs

@@ -0,0 +1,126 @@
+//! A scrollable popup showing the current key bindings.
+
+use std::convert::Infallible;
+
+use cove_config::{Config, Keys};
+use cove_input::{InputEvent, KeyBinding, KeyBindingInfo, KeyGroupInfo};
+use crossterm::style::Stylize;
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{Either2, Join2, Padding, Text},
+};
+
+use super::{
+    UiError, util,
+    widgets::{ListBuilder, ListState, Popup},
+};
+
+type Line = Either2<Text, Join2<Padding<Text>, Text>>;
+type Builder = ListBuilder<'static, Infallible, Line>;
+
+pub fn format_binding(binding: &KeyBinding) -> Styled {
+    let style = Style::new().cyan();
+    let mut keys = Styled::default();
+
+    for key in binding.keys() {
+        if !keys.text().is_empty() {
+            keys = keys.then_plain(", ");
+        }
+        keys = keys.then(key.to_string(), style);
+    }
+
+    if keys.text().is_empty() {
+        keys = keys.then("unbound", style);
+    }
+
+    keys
+}
+
+fn render_empty(builder: &mut Builder) {
+    builder.add_unsel(Text::new("").first2());
+}
+
+fn render_title(builder: &mut Builder, title: &str) {
+    let style = Style::new().bold().magenta();
+    builder.add_unsel(Text::new(Styled::new(title, style)).first2());
+}
+
+fn render_binding_info(builder: &mut Builder, binding_info: KeyBindingInfo<'_>) {
+    builder.add_unsel(
+        Join2::horizontal(
+            Text::new(binding_info.description)
+                .with_wrap(false)
+                .padding()
+                .with_right(2)
+                .with_stretch(true)
+                .segment(),
+            Text::new(format_binding(binding_info.binding))
+                .with_wrap(false)
+                .segment()
+                .with_fixed(true),
+        )
+        .second2(),
+    )
+}
+
+fn render_group_info(builder: &mut Builder, group_info: KeyGroupInfo<'_>) {
+    render_title(builder, group_info.description);
+    for binding_info in group_info.bindings {
+        render_binding_info(builder, binding_info);
+    }
+}
+
+pub fn widget<'a>(
+    list: &'a mut ListState<Infallible>,
+    config: &Config,
+) -> impl Widget<UiError> + use<'a> {
+    let mut list_builder = ListBuilder::new();
+
+    for group_info in config.keys.groups() {
+        if !list_builder.is_empty() {
+            render_empty(&mut list_builder);
+        }
+        render_group_info(&mut list_builder, group_info);
+    }
+
+    let scroll_info_style = Style::new().grey().italic();
+    let scroll_info = Styled::new("(Scroll with ", scroll_info_style)
+        .and_then(format_binding(&config.keys.cursor.down))
+        .then(" and ", scroll_info_style)
+        .and_then(format_binding(&config.keys.cursor.up))
+        .then(")", scroll_info_style);
+
+    let inner = Join2::vertical(
+        list_builder.build(list).segment(),
+        Text::new(scroll_info)
+            .float()
+            .with_center_h()
+            .segment()
+            .with_growing(false),
+    );
+
+    Popup::new(inner, "Key bindings")
+}
+
+pub fn handle_input_event(
+    list: &mut ListState<Infallible>,
+    event: &mut InputEvent<'_>,
+    keys: &Keys,
+) -> bool {
+    // To make scrolling with the mouse wheel work as expected
+    if event.matches(&keys.cursor.up) {
+        list.scroll_up(1);
+        return true;
+    }
+    if event.matches(&keys.cursor.down) {
+        list.scroll_down(1);
+        return true;
+    }
+
+    // List movement must come later, or it shadows the cursor movement keys
+    if util::handle_list_input_event(list, event, keys) {
+        return true;
+    }
+
+    false
+}

cove/src/ui/rooms.rs

@@ -0,0 +1,658 @@
+use std::{
+    collections::{HashMap, HashSet, hash_map::Entry},
+    iter,
+    sync::{Arc, Mutex},
+    time::Duration,
+};
+
+use cove_config::{Config, Keys, RoomsSortOrder};
+use cove_input::InputEvent;
+use crossterm::style::Stylize;
+use euphoxide::{
+    api::SessionType,
+    bot::instance::{Event, ServerConfig},
+    conn::{self, Joined},
+};
+use jiff::tz::TimeZone;
+use tokio::sync::mpsc;
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{BellState, BoxedAsync, Empty, Join2, Text},
+};
+
+use crate::{
+    euph,
+    macros::logging_unwrap,
+    vault::{EuphVault, RoomIdentifier, Vault},
+    version::{NAME, VERSION},
+};
+
+use super::{
+    UiError, UiEvent,
+    euph::room::{EuphRoom, RoomResult},
+    key_bindings, util,
+    widgets::{ListBuilder, ListState},
+};
+
+use self::{
+    connect::{ConnectResult, ConnectState},
+    delete::{DeleteResult, DeleteState},
+};
+
+mod connect;
+mod delete;
+
+enum State {
+    ShowList,
+    ShowRoom(RoomIdentifier),
+    Connect(ConnectState),
+    Delete(DeleteState),
+}
+
+#[derive(Clone, Copy)]
+enum Order {
+    Alphabet,
+    Importance,
+}
+
+impl Order {
+    fn from_rooms_sort_order(order: RoomsSortOrder) -> Self {
+        match order {
+            RoomsSortOrder::Alphabet => Self::Alphabet,
+            RoomsSortOrder::Importance => Self::Importance,
+        }
+    }
+}
+
+struct EuphServer {
+    config: ServerConfig,
+    next_instance_id: usize,
+}
+
+impl EuphServer {
+    async fn new(vault: &EuphVault, domain: String) -> Self {
+        let cookies = logging_unwrap!(vault.cookies(domain.clone()).await);
+        let config = ServerConfig::default()
+            .domain(domain)
+            .cookies(Arc::new(Mutex::new(cookies)))
+            .timeout(Duration::from_secs(10));
+
+        Self {
+            config,
+            next_instance_id: 0,
+        }
+    }
+}
+
+pub struct Rooms {
+    config: &'static Config,
+    tz: TimeZone,
+
+    vault: Vault,
+    ui_event_tx: mpsc::UnboundedSender<UiEvent>,
+
+    state: State,
+
+    list: ListState<RoomIdentifier>,
+    order: Order,
+    bell: BellState,
+
+    euph_servers: HashMap<String, EuphServer>,
+    euph_rooms: HashMap<RoomIdentifier, EuphRoom>,
+}
+
+impl Rooms {
+    pub async fn new(
+        config: &'static Config,
+        tz: TimeZone,
+        vault: Vault,
+        ui_event_tx: mpsc::UnboundedSender<UiEvent>,
+    ) -> Self {
+        let mut result = Self {
+            config,
+            tz,
+            vault,
+            ui_event_tx,
+            state: State::ShowList,
+            list: ListState::new(),
+            order: Order::from_rooms_sort_order(config.rooms_sort_order),
+            bell: BellState::new(),
+            euph_servers: HashMap::new(),
+            euph_rooms: HashMap::new(),
+        };
+
+        if !config.offline {
+            for (domain, server) in &config.euph.servers {
+                for (name, room) in &server.rooms {
+                    if room.autojoin {
+                        let id = RoomIdentifier::new(domain.clone(), name.clone());
+                        result.connect_to_room(id).await;
+                    }
+                }
+            }
+        }
+
+        result
+    }
+
+    async fn get_or_insert_server<'a>(
+        vault: &Vault,
+        euph_servers: &'a mut HashMap<String, EuphServer>,
+        domain: String,
+    ) -> &'a mut EuphServer {
+        match euph_servers.entry(domain.clone()) {
+            Entry::Occupied(entry) => entry.into_mut(),
+            Entry::Vacant(entry) => {
+                let server = EuphServer::new(&vault.euph(), domain).await;
+                entry.insert(server)
+            }
+        }
+    }
+
+    async fn get_or_insert_room(&mut self, room: RoomIdentifier) -> &mut EuphRoom {
+        let server =
+            Self::get_or_insert_server(&self.vault, &mut self.euph_servers, room.domain.clone())
+                .await;
+
+        self.euph_rooms.entry(room.clone()).or_insert_with(|| {
+            EuphRoom::new(
+                self.config,
+                server.config.clone(),
+                self.config.euph_room(&room.domain, &room.name),
+                self.vault.euph().room(room),
+                self.tz.clone(),
+                self.ui_event_tx.clone(),
+            )
+        })
+    }
+
+    async fn connect_to_room(&mut self, room: RoomIdentifier) {
+        let server =
+            Self::get_or_insert_server(&self.vault, &mut self.euph_servers, room.domain.clone())
+                .await;
+
+        let room = self.euph_rooms.entry(room.clone()).or_insert_with(|| {
+            EuphRoom::new(
+                self.config,
+                server.config.clone(),
+                self.config.euph_room(&room.domain, &room.name),
+                self.vault.euph().room(room),
+                self.tz.clone(),
+                self.ui_event_tx.clone(),
+            )
+        });
+
+        room.connect(&mut server.next_instance_id);
+    }
+
+    async fn connect_to_all_rooms(&mut self) {
+        for (id, room) in &mut self.euph_rooms {
+            let server =
+                Self::get_or_insert_server(&self.vault, &mut self.euph_servers, id.domain.clone())
+                    .await;
+
+            room.connect(&mut server.next_instance_id);
+        }
+    }
+
+    fn disconnect_from_room(&mut self, room: &RoomIdentifier) {
+        if let Some(room) = self.euph_rooms.get_mut(room) {
+            room.disconnect();
+        }
+    }
+
+    fn disconnect_from_all_rooms(&mut self) {
+        for room in self.euph_rooms.values_mut() {
+            room.disconnect();
+        }
+    }
+
+    /// Remove rooms that are not running any more and can't be found in the db
+    /// or config. Insert rooms that are in the db or config but not yet in in
+    /// the hash map.
+    ///
+    /// These kinds of rooms are either
+    /// - failed connection attempts, or
+    /// - rooms that were deleted from the db.
+    async fn stabilize_rooms(&mut self) {
+        // Collect all rooms from the db and config file
+        let rooms_from_db = logging_unwrap!(self.vault.euph().rooms().await);
+        let rooms_from_config = self
+            .config
+            .euph
+            .servers
+            .iter()
+            .flat_map(|(domain, server)| {
+                server
+                    .rooms
+                    .keys()
+                    .map(|name| RoomIdentifier::new(domain.clone(), name.clone()))
+            });
+        let mut rooms_set = rooms_from_db
+            .into_iter()
+            .chain(rooms_from_config)
+            .collect::<HashSet<_>>();
+
+        // Prevent room that is currently being shown from being removed. This
+        // could otherwise happen after connecting to a room that doesn't exist.
+        if let State::ShowRoom(name) = &self.state {
+            rooms_set.insert(name.clone());
+        }
+
+        // Now `rooms_set` contains all rooms that must exist. Other rooms may
+        // also exist, for example rooms that are connecting for the first time.
+
+        self.euph_rooms
+            .retain(|n, r| !r.stopped() || rooms_set.contains(n));
+
+        for room in rooms_set {
+            let room = self.get_or_insert_room(room).await;
+            room.retain();
+            self.bell.ring |= room.retrieve_mentioned();
+        }
+    }
+
+    pub async fn widget(&mut self) -> BoxedAsync<'_, UiError> {
+        match &self.state {
+            State::ShowRoom(_) => {}
+            _ => self.stabilize_rooms().await,
+        }
+
+        let widget = match &mut self.state {
+            State::ShowList => Self::rooms_widget(
+                &self.vault,
+                self.config,
+                &mut self.list,
+                self.order,
+                &self.euph_rooms,
+            )
+            .await
+            .desync()
+            .boxed_async(),
+
+            State::ShowRoom(id) => {
+                self.euph_rooms
+                    .get_mut(id)
+                    .expect("room exists after stabilization")
+                    .widget()
+                    .await
+            }
+
+            State::Connect(connect) => Self::rooms_widget(
+                &self.vault,
+                self.config,
+                &mut self.list,
+                self.order,
+                &self.euph_rooms,
+            )
+            .await
+            .below(connect.widget())
+            .desync()
+            .boxed_async(),
+
+            State::Delete(delete) => Self::rooms_widget(
+                &self.vault,
+                self.config,
+                &mut self.list,
+                self.order,
+                &self.euph_rooms,
+            )
+            .await
+            .below(delete.widget())
+            .desync()
+            .boxed_async(),
+        };
+
+        if self.config.bell_on_mention {
+            widget.above(self.bell.widget().desync()).boxed_async()
+        } else {
+            widget
+        }
+    }
+
+    fn format_pbln(joined: &Joined) -> String {
+        let mut p = 0_usize;
+        let mut b = 0_usize;
+        let mut l = 0_usize;
+        let mut n = 0_usize;
+
+        let sessions = joined
+            .listing
+            .values()
+            .map(|s| (s.id(), s.name()))
+            .chain(iter::once((
+                &joined.session.id,
+                &joined.session.name as &str,
+            )));
+        for (user_id, name) in sessions {
+            match user_id.session_type() {
+                Some(SessionType::Bot) if name.is_empty() => n += 1,
+                Some(SessionType::Bot) => b += 1,
+                _ if name.is_empty() => l += 1,
+                _ => p += 1,
+            }
+        }
+
+        // There must always be either one p, b, l or n since we're including
+        // ourselves.
+        let mut result = vec![];
+        if p > 0 {
+            result.push(format!("{p}p"));
+        }
+        if b > 0 {
+            result.push(format!("{b}b"));
+        }
+        if l > 0 {
+            result.push(format!("{l}l"));
+        }
+        if n > 0 {
+            result.push(format!("{n}n"));
+        }
+        result.join(" ")
+    }
+
+    fn format_room_state(state: Option<&euph::State>) -> Option<String> {
+        match state {
+            None | Some(euph::State::Stopped) => None,
+            Some(euph::State::Disconnected) => Some("waiting".to_string()),
+            Some(euph::State::Connecting) => Some("connecting".to_string()),
+            Some(euph::State::Connected(_, connected)) => match connected {
+                conn::State::Joining(joining) if joining.bounce.is_some() => {
+                    Some("auth required".to_string())
+                }
+                conn::State::Joining(_) => Some("joining".to_string()),
+                conn::State::Joined(joined) => Some(Self::format_pbln(joined)),
+            },
+        }
+    }
+
+    fn format_unseen_msgs(unseen: usize) -> Option<String> {
+        if unseen == 0 {
+            None
+        } else {
+            Some(format!("{unseen}"))
+        }
+    }
+
+    fn format_room_info(state: Option<&euph::State>, unseen: usize) -> Styled {
+        let unseen_style = Style::new().bold().green();
+
+        let state = Self::format_room_state(state);
+        let unseen = Self::format_unseen_msgs(unseen);
+
+        match (state, unseen) {
+            (None, None) => Styled::default(),
+            (None, Some(u)) => Styled::new_plain(" (")
+                .then(u, unseen_style)
+                .then_plain(")"),
+            (Some(s), None) => Styled::new_plain(" (").then_plain(s).then_plain(")"),
+            (Some(s), Some(u)) => Styled::new_plain(" (")
+                .then_plain(s)
+                .then_plain(", ")
+                .then(u, unseen_style)
+                .then_plain(")"),
+        }
+    }
+
+    fn sort_rooms(rooms: &mut [(&RoomIdentifier, Option<&euph::State>, usize)], order: Order) {
+        match order {
+            Order::Alphabet => rooms.sort_unstable_by_key(|(id, _, _)| *id),
+            Order::Importance => rooms
+                .sort_unstable_by_key(|(id, state, unseen)| (state.is_none(), *unseen == 0, *id)),
+        }
+    }
+
+    async fn render_rows(
+        list_builder: &mut ListBuilder<'_, RoomIdentifier, Text>,
+        order: Order,
+        euph_rooms: &HashMap<RoomIdentifier, EuphRoom>,
+    ) {
+        let mut rooms = vec![];
+        for (id, room) in euph_rooms {
+            let state = room.room_state();
+            let unseen = room.unseen_msgs_count().await;
+            rooms.push((id, state, unseen));
+        }
+        Self::sort_rooms(&mut rooms, order);
+        for (id, state, unseen) in rooms {
+            let id = id.clone();
+            let info = Self::format_room_info(state, unseen);
+            list_builder.add_sel(id.clone(), move |selected| {
+                let domain_style = if selected {
+                    Style::new().black().on_white()
+                } else {
+                    Style::new().grey()
+                };
+
+                let room_style = if selected {
+                    Style::new().bold().black().on_white()
+                } else {
+                    Style::new().bold().blue()
+                };
+
+                let text = Styled::new(format!("{} ", id.domain), domain_style)
+                    .then(format!("&{}", id.name), room_style)
+                    .and_then(info);
+
+                Text::new(text)
+            });
+        }
+    }
+
+    async fn rooms_widget<'a>(
+        vault: &Vault,
+        config: &Config,
+        list: &'a mut ListState<RoomIdentifier>,
+        order: Order,
+        euph_rooms: &HashMap<RoomIdentifier, EuphRoom>,
+    ) -> impl Widget<UiError> + use<'a> {
+        let version_info = Styled::new_plain("Welcome to ")
+            .then(format!("{NAME} {VERSION}"), Style::new().yellow().bold())
+            .then_plain("!");
+        let help_info = Styled::new("Press ", Style::new().grey())
+            .and_then(key_bindings::format_binding(&config.keys.general.help))
+            .then(" for key bindings.", Style::new().grey());
+        let info = Join2::vertical(
+            Text::new(version_info).float().with_center_h().segment(),
+            Text::new(help_info).segment(),
+        )
+        .padding()
+        .with_horizontal(1)
+        .border();
+
+        let mut heading = Styled::new("Rooms", Style::new().bold());
+        let mut title = "Rooms".to_string();
+
+        let total_rooms = euph_rooms.len();
+        let connected_rooms = euph_rooms
+            .iter()
+            .filter(|r| r.1.room_state().is_some())
+            .count();
+        let total_unseen = logging_unwrap!(vault.euph().total_unseen_msgs_count().await);
+        if total_unseen > 0 {
+            heading = heading
+                .then_plain(format!(" ({connected_rooms}/{total_rooms}, "))
+                .then(format!("{total_unseen}"), Style::new().bold().green())
+                .then_plain(")");
+            title.push_str(&format!(" ({total_unseen})"));
+        } else {
+            heading = heading.then_plain(format!(" ({connected_rooms}/{total_rooms})"))
+        }
+
+        let mut list_builder = ListBuilder::new();
+        Self::render_rows(&mut list_builder, order, euph_rooms).await;
+
+        Join2::horizontal(
+            Join2::vertical(
+                Text::new(heading).segment().with_fixed(true),
+                list_builder.build(list).segment(),
+            )
+            .segment(),
+            Join2::vertical(info.segment().with_growing(false), Empty::new().segment())
+                .segment()
+                .with_growing(false),
+        )
+        .title(title)
+    }
+
+    async fn handle_showlist_input_event(
+        &mut self,
+        event: &mut InputEvent<'_>,
+        keys: &Keys,
+    ) -> bool {
+        // Open room
+        if event.matches(&keys.general.confirm) {
+            if let Some(name) = self.list.selected() {
+                self.state = State::ShowRoom(name.clone());
+            }
+            return true;
+        }
+
+        // Move cursor and scroll
+        if util::handle_list_input_event(&mut self.list, event, keys) {
+            return true;
+        }
+
+        // Room actions
+        if event.matches(&keys.rooms.action.connect) {
+            if let Some(name) = self.list.selected() {
+                self.connect_to_room(name.clone()).await;
+            }
+            return true;
+        }
+        if event.matches(&keys.rooms.action.connect_all) {
+            self.connect_to_all_rooms().await;
+            return true;
+        }
+        if event.matches(&keys.rooms.action.disconnect) {
+            if let Some(room) = self.list.selected() {
+                self.disconnect_from_room(&room.clone());
+            }
+            return true;
+        }
+        if event.matches(&keys.rooms.action.disconnect_all) {
+            self.disconnect_from_all_rooms();
+            return true;
+        }
+        if event.matches(&keys.rooms.action.connect_autojoin) {
+            for (domain, server) in &self.config.euph.servers {
+                for (name, room) in &server.rooms {
+                    if !room.autojoin {
+                        continue;
+                    }
+                    let id = RoomIdentifier::new(domain.clone(), name.clone());
+                    self.connect_to_room(id).await;
+                }
+            }
+            return true;
+        }
+        if event.matches(&keys.rooms.action.disconnect_non_autojoin) {
+            for (id, room) in &mut self.euph_rooms {
+                let autojoin = self.config.euph_room(&id.domain, &id.name).autojoin;
+                if !autojoin {
+                    room.disconnect();
+                }
+            }
+            return true;
+        }
+        if event.matches(&keys.rooms.action.new) {
+            self.state = State::Connect(ConnectState::new());
+            return true;
+        }
+        if event.matches(&keys.rooms.action.delete) {
+            if let Some(room) = self.list.selected() {
+                self.state = State::Delete(DeleteState::new(room.clone()));
+            }
+            return true;
+        }
+        if event.matches(&keys.rooms.action.change_sort_order) {
+            self.order = match self.order {
+                Order::Alphabet => Order::Importance,
+                Order::Importance => Order::Alphabet,
+            };
+            return true;
+        }
+
+        false
+    }
+
+    pub async fn handle_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> bool {
+        self.stabilize_rooms().await;
+
+        match &mut self.state {
+            State::ShowList => {
+                if self.handle_showlist_input_event(event, keys).await {
+                    return true;
+                }
+            }
+            State::ShowRoom(name) => {
+                if let Some(room) = self.euph_rooms.get_mut(name) {
+                    match room.handle_input_event(event, keys).await {
+                        RoomResult::NotHandled => {}
+                        RoomResult::Handled => return true,
+                        RoomResult::SwitchToRoom { room } => {
+                            self.list.move_cursor_to_id(&room);
+                            self.connect_to_room(room.clone()).await;
+                            self.state = State::ShowRoom(room);
+                            return true;
+                        }
+                    }
+                    if event.matches(&keys.general.abort) {
+                        self.state = State::ShowList;
+                        return true;
+                    }
+                }
+            }
+            State::Connect(connect) => match connect.handle_input_event(event, keys) {
+                ConnectResult::Close => {
+                    self.state = State::ShowList;
+                    return true;
+                }
+                ConnectResult::Connect(room) => {
+                    self.list.move_cursor_to_id(&room);
+                    self.connect_to_room(room.clone()).await;
+                    self.state = State::ShowRoom(room);
+                    return true;
+                }
+                ConnectResult::Handled => {
+                    return true;
+                }
+                ConnectResult::Unhandled => {}
+            },
+            State::Delete(delete) => match delete.handle_input_event(event, keys) {
+                DeleteResult::Close => {
+                    self.state = State::ShowList;
+                    return true;
+                }
+                DeleteResult::Delete(room) => {
+                    self.euph_rooms.remove(&room);
+                    logging_unwrap!(self.vault.euph().room(room).delete().await);
+                    self.state = State::ShowList;
+                    return true;
+                }
+                DeleteResult::Handled => {
+                    return true;
+                }
+                DeleteResult::Unhandled => {}
+            },
+        }
+
+        false
+    }
+
+    pub async fn handle_euph_event(&mut self, event: Event) -> bool {
+        let config = event.config();
+        let room_id = RoomIdentifier::new(config.server.domain.clone(), config.room.clone());
+        let Some(room) = self.euph_rooms.get_mut(&room_id) else {
+            return false;
+        };
+
+        let handled = room.handle_event(event).await;
+
+        let room_visible = match &self.state {
+            State::ShowRoom(id) => *id == room_id,
+            _ => true,
+        };
+        handled && room_visible
+    }
+}

cove/src/ui/rooms/connect.rs

@@ -0,0 +1,123 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use crossterm::style::Stylize;
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{EditorState, Empty, Join2, Join3, Text},
+};
+
+use crate::{
+    ui::{UiError, util, widgets::Popup},
+    vault::RoomIdentifier,
+};
+
+#[derive(Clone, Copy, PartialEq, Eq)]
+enum Focus {
+    Name,
+    Domain,
+}
+
+impl Focus {
+    fn advance(self) -> Self {
+        match self {
+            Self::Name => Self::Domain,
+            Self::Domain => Self::Name,
+        }
+    }
+}
+
+pub struct ConnectState {
+    focus: Focus,
+    name: EditorState,
+    domain: EditorState,
+}
+
+pub enum ConnectResult {
+    Close,
+    Connect(RoomIdentifier),
+    Handled,
+    Unhandled,
+}
+
+impl ConnectState {
+    pub fn new() -> Self {
+        Self {
+            focus: Focus::Name,
+            name: EditorState::new(),
+            domain: EditorState::with_initial_text("euphoria.leet.nu".to_string()),
+        }
+    }
+
+    pub fn handle_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> ConnectResult {
+        if event.matches(&keys.general.abort) {
+            return ConnectResult::Close;
+        }
+
+        if event.matches(&keys.general.focus) {
+            self.focus = self.focus.advance();
+            return ConnectResult::Handled;
+        }
+
+        if event.matches(&keys.general.confirm) {
+            let id = RoomIdentifier {
+                domain: self.domain.text().to_string(),
+                name: self.name.text().to_string(),
+            };
+            if !id.domain.is_empty() && !id.name.is_empty() {
+                return ConnectResult::Connect(id);
+            }
+        }
+
+        let handled = match self.focus {
+            Focus::Name => {
+                util::handle_editor_input_event(&mut self.name, event, keys, util::is_room_char)
+            }
+            Focus::Domain => {
+                util::handle_editor_input_event(&mut self.domain, event, keys, |c| c != '\n')
+            }
+        };
+
+        if handled {
+            return ConnectResult::Handled;
+        }
+
+        ConnectResult::Unhandled
+    }
+
+    pub fn widget(&mut self) -> impl Widget<UiError> {
+        let room_style = Style::new().bold().blue();
+        let domain_style = Style::new().grey();
+
+        let name = Join2::horizontal(
+            Text::new(Styled::new_plain("Room:   ").then("&", room_style))
+                .with_wrap(false)
+                .segment()
+                .with_fixed(true),
+            self.name
+                .widget()
+                .with_highlight(|s| Styled::new(s, room_style))
+                .with_focus(self.focus == Focus::Name)
+                .segment(),
+        );
+
+        let domain = Join3::horizontal(
+            Text::new("Domain:")
+                .with_wrap(false)
+                .segment()
+                .with_fixed(true),
+            Empty::new().with_width(1).segment().with_fixed(true),
+            self.domain
+                .widget()
+                .with_highlight(|s| Styled::new(s, domain_style))
+                .with_focus(self.focus == Focus::Domain)
+                .segment(),
+        );
+
+        let inner = Join2::vertical(
+            name.segment().with_fixed(true),
+            domain.segment().with_fixed(true),
+        );
+
+        Popup::new(inner, "Connect to")
+    }
+}

cove/src/ui/rooms/delete.rs

@@ -0,0 +1,90 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use crossterm::style::Stylize;
+use toss::{
+    Style, Styled, Widget, WidgetExt,
+    widgets::{EditorState, Empty, Join2, Text},
+};
+
+use crate::{
+    ui::{UiError, util, widgets::Popup},
+    vault::RoomIdentifier,
+};
+
+pub struct DeleteState {
+    id: RoomIdentifier,
+    name: EditorState,
+}
+
+pub enum DeleteResult {
+    Close,
+    Delete(RoomIdentifier),
+    Handled,
+    Unhandled,
+}
+
+impl DeleteState {
+    pub fn new(id: RoomIdentifier) -> Self {
+        Self {
+            id,
+            name: EditorState::new(),
+        }
+    }
+
+    pub fn handle_input_event(&mut self, event: &mut InputEvent<'_>, keys: &Keys) -> DeleteResult {
+        if event.matches(&keys.general.abort) {
+            return DeleteResult::Close;
+        }
+
+        if event.matches(&keys.general.confirm) && self.name.text() == self.id.name {
+            return DeleteResult::Delete(self.id.clone());
+        }
+
+        if util::handle_editor_input_event(&mut self.name, event, keys, util::is_room_char) {
+            return DeleteResult::Handled;
+        }
+
+        DeleteResult::Unhandled
+    }
+
+    pub fn widget(&mut self) -> impl Widget<UiError> {
+        let warn_style = Style::new().bold().red();
+        let room_style = Style::new().bold().blue();
+        let text = Styled::new_plain("Are you sure you want to delete ")
+            .then("&", room_style)
+            .then(&self.id.name, room_style)
+            .then_plain(" on the ")
+            .then(&self.id.domain, Style::new().grey())
+            .then_plain(" server?\n\n")
+            .then_plain("This will delete the entire room history from your vault. ")
+            .then_plain("To shrink your vault afterwards, run ")
+            .then("cove gc", Style::new().italic().grey())
+            .then_plain(".\n\n")
+            .then_plain("To confirm the deletion, ")
+            .then_plain("enter the full name of the room and press enter:");
+
+        let inner = Join2::vertical(
+            // The Join prevents the text from filling up the entire available
+            // space if the editor is wider than the text.
+            Join2::horizontal(
+                Text::new(text)
+                    .resize()
+                    .with_max_width(54)
+                    .segment()
+                    .with_growing(false),
+                Empty::new().segment(),
+            )
+            .segment(),
+            Join2::horizontal(
+                Text::new(("&", room_style)).segment().with_fixed(true),
+                self.name
+                    .widget()
+                    .with_highlight(|s| Styled::new(s, room_style))
+                    .segment(),
+            )
+            .segment(),
+        );
+
+        Popup::new(inner, "Delete room").with_border_style(warn_style)
+    }
+}

cove/src/ui/util.rs

@@ -0,0 +1,196 @@
+use cove_config::Keys;
+use cove_input::InputEvent;
+use crossterm::event::{KeyCode, KeyModifiers};
+use toss::widgets::EditorState;
+
+use super::widgets::ListState;
+
+/// Test if a character is allowed to be typed in a room name.
+pub fn is_room_char(c: char) -> bool {
+    c.is_ascii_alphanumeric() || c == '_'
+}
+
+//////////
+// List //
+//////////
+
+pub fn handle_list_input_event<Id: Clone>(
+    list: &mut ListState<Id>,
+    event: &InputEvent<'_>,
+    keys: &Keys,
+) -> bool {
+    // Cursor movement
+    if event.matches(&keys.cursor.up) {
+        list.move_cursor_up();
+        return true;
+    }
+    if event.matches(&keys.cursor.down) {
+        list.move_cursor_down();
+        return true;
+    }
+    if event.matches(&keys.cursor.to_top) {
+        list.move_cursor_to_top();
+        return true;
+    }
+    if event.matches(&keys.cursor.to_bottom) {
+        list.move_cursor_to_bottom();
+        return true;
+    }
+
+    // Scrolling
+    if event.matches(&keys.scroll.up_line) {
+        list.scroll_up(1);
+        return true;
+    }
+    if event.matches(&keys.scroll.down_line) {
+        list.scroll_down(1);
+        return true;
+    }
+    if event.matches(&keys.scroll.up_half) {
+        list.scroll_up_half();
+        return true;
+    }
+    if event.matches(&keys.scroll.down_half) {
+        list.scroll_down_half();
+        return true;
+    }
+    if event.matches(&keys.scroll.up_full) {
+        list.scroll_up_full();
+        return true;
+    }
+    if event.matches(&keys.scroll.down_full) {
+        list.scroll_down_full();
+        return true;
+    }
+    if event.matches(&keys.scroll.center_cursor) {
+        list.center_cursor();
+        return true;
+    }
+
+    false
+}
+
+////////////
+// Editor //
+////////////
+
+fn edit_externally(
+    editor: &mut EditorState,
+    event: &mut InputEvent<'_>,
+    char_filter: impl Fn(char) -> bool,
+) {
+    let Ok(text) = event.prompt(editor.text()) else {
+        // Something went wrong during editing, let's abort the edit.
+        return;
+    };
+
+    if text.trim().is_empty() {
+        // The user likely wanted to abort the edit and has deleted the
+        // entire text (bar whitespace left over by some editors).
+        return;
+    }
+
+    let text = text
+        .strip_suffix('\n')
+        .unwrap_or(&text)
+        .chars()
+        .filter(|c| char_filter(*c))
+        .collect::<String>();
+
+    editor.set_text(event.widthdb(), text);
+}
+
+fn char_modifier(modifiers: KeyModifiers) -> bool {
+    modifiers == KeyModifiers::NONE || modifiers == KeyModifiers::SHIFT
+}
+
+pub fn handle_editor_input_event(
+    editor: &mut EditorState,
+    event: &mut InputEvent<'_>,
+    keys: &Keys,
+    char_filter: impl Fn(char) -> bool,
+) -> bool {
+    // Cursor movement
+    if event.matches(&keys.editor.cursor.left) {
+        editor.move_cursor_left(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.right) {
+        editor.move_cursor_right(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.left_word) {
+        editor.move_cursor_left_a_word(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.right_word) {
+        editor.move_cursor_right_a_word(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.start) {
+        editor.move_cursor_to_start_of_line(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.end) {
+        editor.move_cursor_to_end_of_line(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.up) {
+        editor.move_cursor_up(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.cursor.down) {
+        editor.move_cursor_down(event.widthdb());
+        return true;
+    }
+
+    // Editing
+    if event.matches(&keys.editor.action.backspace) {
+        editor.backspace(event.widthdb());
+        return true;
+    }
+    if event.matches(&keys.editor.action.delete) {
+        editor.delete();
+        return true;
+    }
+    if event.matches(&keys.editor.action.clear) {
+        editor.clear();
+        return true;
+    }
+    if event.matches(&keys.editor.action.external) {
+        edit_externally(editor, event, char_filter);
+        return true;
+    }
+
+    // Inserting individual characters
+    if let Some(key_event) = event.key_event() {
+        match key_event.code {
+            KeyCode::Enter if char_filter('\n') => {
+                editor.insert_char(event.widthdb(), '\n');
+                return true;
+            }
+            KeyCode::Char(c) if char_modifier(key_event.modifiers) && char_filter(c) => {
+                editor.insert_char(event.widthdb(), c);
+                return true;
+            }
+            _ => {}
+        }
+    }
+
+    // Pasting text
+    if let Some(text) = event.paste_event() {
+        // It seems that when pasting, '\n' are converted into '\r' for some
+        // reason. I don't really know why, or at what point this happens. Vim
+        // converts any '\r' pasted via the terminal into '\n', so I decided to
+        // mirror that behaviour.
+        let text = text
+            .chars()
+            .map(|c| if c == '\r' { '\n' } else { c })
+            .filter(|c| char_filter(*c))
+            .collect::<String>();
+        editor.insert_str(event.widthdb(), &text);
+        return true;
+    }
+
+    false
+}

cove/src/ui/widgets.rs

@@ -0,0 +1,5 @@
+pub use self::list::*;
+pub use self::popup::*;
+
+mod list;
+mod popup;

cove/src/ui/widgets/list.rs

@@ -0,0 +1,361 @@
+use std::vec;
+
+use toss::{Frame, Pos, Size, Widget, WidthDb};
+
+#[derive(Debug, Clone)]
+struct Cursor<Id> {
+    /// Id of the element the cursor is pointing to.
+    ///
+    /// If the rows change (e.g. reorder) but there is still a row with this id,
+    /// the cursor is moved to this row.
+    id: Id,
+
+    /// Index of the row the cursor is pointing to.
+    ///
+    /// If the rows change and there is no longer a row with the cursor's id,
+    /// the cursor is moved up or down to the next selectable row. This way, it
+    /// stays close to its previous position.
+    idx: usize,
+}
+
+impl<Id> Cursor<Id> {
+    pub fn new(id: Id, idx: usize) -> Self {
+        Self { id, idx }
+    }
+}
+
+#[derive(Debug)]
+pub struct ListState<Id> {
+    /// Amount of lines that the list is scrolled, i.e. offset from the top.
+    offset: usize,
+
+    /// A cursor within the list.
+    ///
+    /// Set to `None` if the list contains no selectable rows.
+    cursor: Option<Cursor<Id>>,
+
+    /// Height of the list when it was last rendered.
+    last_height: u16,
+
+    /// Rows when the list was last rendered.
+    last_rows: Vec<Option<Id>>,
+}
+
+impl<Id> ListState<Id> {
+    pub fn new() -> Self {
+        Self {
+            offset: 0,
+            cursor: None,
+            last_height: 0,
+            last_rows: vec![],
+        }
+    }
+
+    pub fn selected(&self) -> Option<&Id> {
+        self.cursor.as_ref().map(|cursor| &cursor.id)
+    }
+}
+
+impl<Id: Clone> ListState<Id> {
+    fn first_selectable(&self) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .find_map(|(i, row)| row.as_ref().map(|id| Cursor::new(id.clone(), i)))
+    }
+
+    fn last_selectable(&self) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .rev()
+            .find_map(|(i, row)| row.as_ref().map(|id| Cursor::new(id.clone(), i)))
+    }
+
+    fn selectable_at_or_before_index(&self, i: usize) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .take(i + 1)
+            .rev()
+            .find_map(|(i, row)| row.as_ref().map(|id| Cursor::new(id.clone(), i)))
+    }
+
+    fn selectable_at_or_after_index(&self, i: usize) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .skip(i)
+            .find_map(|(i, row)| row.as_ref().map(|id| Cursor::new(id.clone(), i)))
+    }
+
+    fn selectable_before_index(&self, i: usize) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .take(i)
+            .rev()
+            .find_map(|(i, row)| row.as_ref().map(|id| Cursor::new(id.clone(), i)))
+    }
+
+    fn selectable_after_index(&self, i: usize) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .skip(i + 1)
+            .find_map(|(i, row)| row.as_ref().map(|id| Cursor::new(id.clone(), i)))
+    }
+
+    fn move_cursor_to_make_it_visible(&mut self) {
+        if let Some(cursor) = &self.cursor {
+            let first_visible_line_idx = self.offset;
+            let last_visible_line_idx = self
+                .offset
+                .saturating_add(self.last_height.into())
+                .saturating_sub(1);
+
+            let new_cursor = if cursor.idx < first_visible_line_idx {
+                self.selectable_at_or_after_index(first_visible_line_idx)
+            } else if cursor.idx > last_visible_line_idx {
+                self.selectable_at_or_before_index(last_visible_line_idx)
+            } else {
+                return;
+            };
+
+            if let Some(new_cursor) = new_cursor {
+                self.cursor = Some(new_cursor);
+            }
+        }
+    }
+
+    fn scroll_so_cursor_is_visible(&mut self) {
+        if self.last_height == 0 {
+            // Cursor can't be visible because nothing is visible
+            return;
+        }
+
+        if let Some(cursor) = &self.cursor {
+            // As long as height > 0, min <= max is true
+            let min = (cursor.idx + 1).saturating_sub(self.last_height.into());
+            let max = cursor.idx; // Rows have a height of 1
+            self.offset = self.offset.clamp(min, max);
+        }
+    }
+
+    fn clamp_scrolling(&mut self) {
+        let min = 0;
+        let max = self.last_rows.len().saturating_sub(self.last_height.into());
+        self.offset = self.offset.clamp(min, max);
+    }
+
+    fn scroll_to(&mut self, new_offset: usize) {
+        self.offset = new_offset;
+        self.clamp_scrolling();
+        self.move_cursor_to_make_it_visible();
+    }
+
+    fn move_cursor_to(&mut self, new_cursor: Cursor<Id>) {
+        self.cursor = Some(new_cursor);
+        self.scroll_so_cursor_is_visible();
+        self.clamp_scrolling();
+    }
+
+    /// Scroll the list up by an amount of lines.
+    pub fn scroll_up(&mut self, lines: usize) {
+        self.scroll_to(self.offset.saturating_sub(lines));
+    }
+
+    /// Scroll the list down by an amount of lines.
+    pub fn scroll_down(&mut self, lines: usize) {
+        self.scroll_to(self.offset.saturating_add(lines));
+    }
+
+    pub fn scroll_up_half(&mut self) {
+        self.scroll_up((self.last_height / 2).into());
+    }
+
+    pub fn scroll_down_half(&mut self) {
+        self.scroll_down((self.last_height / 2).into());
+    }
+
+    pub fn scroll_up_full(&mut self) {
+        self.scroll_up(self.last_height.saturating_sub(1).into());
+    }
+
+    pub fn scroll_down_full(&mut self) {
+        self.scroll_down(self.last_height.saturating_sub(1).into());
+    }
+
+    /// Scroll so that the cursor is in the center of the widget, or at least as
+    /// close as possible.
+    pub fn center_cursor(&mut self) {
+        if let Some(cursor) = &self.cursor {
+            let height: usize = self.last_height.into();
+            self.scroll_to(cursor.idx.saturating_sub(height / 2));
+        }
+    }
+
+    /// Move the cursor up to the next selectable row.
+    pub fn move_cursor_up(&mut self) {
+        if let Some(cursor) = &self.cursor {
+            if let Some(new_cursor) = self.selectable_before_index(cursor.idx) {
+                self.move_cursor_to(new_cursor);
+            }
+        }
+    }
+
+    /// Move the cursor down to the next selectable row.
+    pub fn move_cursor_down(&mut self) {
+        if let Some(cursor) = &self.cursor {
+            if let Some(new_cursor) = self.selectable_after_index(cursor.idx) {
+                self.move_cursor_to(new_cursor);
+            }
+        }
+    }
+
+    /// Move the cursor to the first selectable row.
+    pub fn move_cursor_to_top(&mut self) {
+        if let Some(new_cursor) = self.first_selectable() {
+            self.move_cursor_to(new_cursor);
+        }
+    }
+
+    /// Move the cursor to the last selectable row.
+    pub fn move_cursor_to_bottom(&mut self) {
+        if let Some(new_cursor) = self.last_selectable() {
+            self.move_cursor_to(new_cursor);
+        }
+    }
+}
+
+impl<Id: Clone + Eq> ListState<Id> {
+    fn selectable_of_id(&self, id: &Id) -> Option<Cursor<Id>> {
+        self.last_rows
+            .iter()
+            .enumerate()
+            .find_map(|(i, row)| match row {
+                Some(rid) if rid == id => Some(Cursor::new(rid.clone(), i)),
+                _ => None,
+            })
+    }
+
+    pub fn move_cursor_to_id(&mut self, id: &Id) {
+        if let Some(new_cursor) = self.selectable_of_id(id) {
+            self.move_cursor_to(new_cursor);
+        }
+    }
+
+    fn fix_cursor(&mut self) {
+        let new_cursor = if let Some(cursor) = &self.cursor {
+            self.selectable_of_id(&cursor.id)
+                .or_else(|| self.selectable_at_or_before_index(cursor.idx))
+                .or_else(|| self.selectable_at_or_after_index(cursor.idx))
+        } else {
+            self.first_selectable()
+        };
+
+        if let Some(new_cursor) = new_cursor {
+            self.move_cursor_to(new_cursor);
+        } else {
+            self.cursor = None;
+        }
+    }
+}
+
+struct UnrenderedRow<'a, Id, W> {
+    id: Option<Id>,
+    widget: Box<dyn FnOnce(bool) -> W + 'a>,
+}
+
+pub struct ListBuilder<'a, Id, W> {
+    rows: Vec<UnrenderedRow<'a, Id, W>>,
+}
+
+impl<'a, Id, W> ListBuilder<'a, Id, W> {
+    pub fn new() -> Self {
+        Self { rows: vec![] }
+    }
+
+    pub fn is_empty(&self) -> bool {
+        self.rows.is_empty()
+    }
+
+    pub fn add_unsel(&mut self, widget: W)
+    where
+        W: 'a,
+    {
+        self.rows.push(UnrenderedRow {
+            id: None,
+            widget: Box::new(|_| widget),
+        });
+    }
+
+    pub fn add_sel(&mut self, id: Id, widget: impl FnOnce(bool) -> W + 'a) {
+        self.rows.push(UnrenderedRow {
+            id: Some(id),
+            widget: Box::new(widget),
+        });
+    }
+
+    pub fn build(self, state: &mut ListState<Id>) -> List<'_, Id, W>
+    where
+        Id: Clone + Eq,
+    {
+        state.last_rows = self.rows.iter().map(|row| row.id.clone()).collect();
+        state.fix_cursor();
+
+        let selected = state.selected();
+        let rows = self
+            .rows
+            .into_iter()
+            .map(|row| (row.widget)(row.id.as_ref() == selected))
+            .collect();
+        List { state, rows }
+    }
+}
+
+pub struct List<'a, Id, W> {
+    state: &'a mut ListState<Id>,
+    rows: Vec<W>,
+}
+
+impl<Id, E, W> Widget<E> for List<'_, Id, W>
+where
+    Id: Clone + Eq,
+    W: Widget<E>,
+{
+    fn size(
+        &self,
+        widthdb: &mut WidthDb,
+        max_width: Option<u16>,
+        _max_height: Option<u16>,
+    ) -> Result<Size, E> {
+        let mut width = 0;
+        for row in &self.rows {
+            let size = row.size(widthdb, max_width, Some(1))?;
+            width = width.max(size.width);
+        }
+        let height = self.rows.len().try_into().unwrap_or(u16::MAX);
+        Ok(Size::new(width, height))
+    }
+
+    fn draw(self, frame: &mut Frame) -> Result<(), E> {
+        let size = frame.size();
+
+        self.state.last_height = size.height;
+
+        for (y, row) in self
+            .rows
+            .into_iter()
+            .skip(self.state.offset)
+            .take(size.height.into())
+            .enumerate()
+        {
+            frame.push(Pos::new(0, y as i32), Size::new(size.width, 1));
+            row.draw(frame)?;
+            frame.pop();
+        }
+
+        Ok(())
+    }
+}

cove/src/ui/widgets/popup.rs

@@ -0,0 +1,54 @@
+use toss::{
+    Frame, Size, Style, Styled, Widget, WidgetExt, WidthDb,
+    widgets::{Background, Border, Desync, Float, Layer2, Padding, Text},
+};
+
+type Body<I> = Background<Border<Padding<I>>>;
+type Title = Float<Padding<Background<Padding<Text>>>>;
+
+pub struct Popup<I>(Float<Layer2<Body<I>, Desync<Title>>>);
+
+impl<I> Popup<I> {
+    pub fn new<S: Into<Styled>>(inner: I, title: S) -> Self {
+        let title = Text::new(title)
+            .padding()
+            .with_horizontal(1)
+            // The background displaces the border without affecting the style
+            .background()
+            .with_style(Style::new())
+            .padding()
+            .with_horizontal(2)
+            .float()
+            .with_top()
+            .with_left()
+            .desync();
+
+        let body = inner.padding().with_horizontal(1).border().background();
+
+        Self(title.above(body).float().with_center())
+    }
+
+    pub fn with_border_style(mut self, style: Style) -> Self {
+        let border = &mut self.0.inner.first.inner;
+        border.style = style;
+        self
+    }
+}
+
+impl<E, I> Widget<E> for Popup<I>
+where
+    I: Widget<E>,
+{
+    fn size(
+        &self,
+        widthdb: &mut WidthDb,
+        max_width: Option<u16>,
+        max_height: Option<u16>,
+    ) -> Result<Size, E> {
+        self.0.size(widthdb, max_width, max_height)
+    }
+
+    fn draw(self, frame: &mut Frame) -> Result<(), E> {
+        self.0.draw(frame)
+    }
+}

cove/src/util.rs

@@ -0,0 +1,70 @@
+use std::{convert::Infallible, env};
+
+use jiff::tz::TimeZone;
+
+pub trait InfallibleExt {
+    type Inner;
+
+    fn infallible(self) -> Self::Inner;
+}
+
+impl<T> InfallibleExt for Result<T, Infallible> {
+    type Inner = T;
+
+    fn infallible(self) -> T {
+        self.expect("infallible")
+    }
+}
+
+/// Load a [`TimeZone`] specified by the `TZ` environment varible, or by the
+/// provided string if the environment variable does not exist.
+///
+/// If a string is provided, it is interpreted in the same format that the `TZ`
+/// environment variable uses.
+///
+/// If no `TZ` environment variable could be found and no string is provided,
+/// the system local time (or UTC on Windows) is used.
+pub fn load_time_zone(tz_string: Option<&str>) -> Result<TimeZone, jiff::Error> {
+    let env_string = env::var("TZ").ok();
+    let tz_string = env_string.as_ref().map(|s| s as &str).or(tz_string);
+
+    let Some(tz_string) = tz_string else {
+        return Ok(TimeZone::system());
+    };
+
+    if tz_string == "localtime" {
+        return Ok(TimeZone::system());
+    }
+
+    if let Some(tz_string) = tz_string.strip_prefix(':') {
+        return TimeZone::get(tz_string);
+    }
+
+    // The time zone is either a manually specified string or a file in the tz
+    // database. We'll try to parse it as a manually specified string first
+    // because that doesn't require a fs lookup.
+    if let Ok(tz) = TimeZone::posix(tz_string) {
+        return Ok(tz);
+    }
+
+    TimeZone::get(tz_string)
+}
+
+pub fn caesar(text: &str, by: i8) -> String {
+    let by = by.rem_euclid(26) as u8;
+    text.chars()
+        .map(|c| {
+            if c.is_ascii_lowercase() {
+                let c = c as u8 - b'a';
+                let c = (c + by) % 26;
+                (c + b'a') as char
+            } else if c.is_ascii_uppercase() {
+                let c = c as u8 - b'A';
+                let c = (c + by) % 26;
+                (c + b'A') as char
+            } else {
+                c
+            }
+        })
+        .collect()
+}

cove/src/vault.rs

@@ -1,16 +1,14 @@
+use std::{fs, path::Path};
+
+use rusqlite::Connection;
+use vault::{Action, tokio::TokioVault};
+
+pub use self::euph::{EuphRoomVault, EuphVault, RoomIdentifier};
+
 mod euph;
 mod migrate;
 mod prepare;
 
-use std::fs;
-use std::path::Path;
-
-use rusqlite::Connection;
-use vault::tokio::TokioVault;
-use vault::Action;
-
-pub use self::euph::{EuphRoomVault, EuphVault};
-
 #[derive(Debug, Clone)]
 pub struct Vault {
     tokio_vault: TokioVault,
@@ -20,9 +18,10 @@ pub struct Vault {
 struct GcAction;
 
 impl Action for GcAction {
-    type Result = ();
+    type Output = ();
+    type Error = rusqlite::Error;
 
-    fn run(self, conn: &mut Connection) -> rusqlite::Result<Self::Result> {
+    fn run(self, conn: &mut Connection) -> Result<Self::Output, Self::Error> {
         conn.execute_batch("ANALYZE; VACUUM;")
     }
 }
@@ -36,7 +35,7 @@ impl Vault {
         self.tokio_vault.stop().await;
     }
 
-    pub async fn gc(&self) -> vault::tokio::Result<()> {
+    pub async fn gc(&self) -> Result<(), vault::tokio::Error<rusqlite::Error>> {
         self.tokio_vault.execute(GcAction).await
     }
 
@@ -49,8 +48,6 @@ fn launch_from_connection(conn: Connection, ephemeral: bool) -> rusqlite::Result
     conn.pragma_update(None, "foreign_keys", true)?;
     conn.pragma_update(None, "trusted_schema", false)?;
 
-    eprintln!("Opening vault");
-
     let tokio_vault = TokioVault::launch_and_prepare(conn, &migrate::MIGRATIONS, prepare::prepare)?;
     Ok(Vault {
         tokio_vault,

cove/src/vault/migrate.rs

@@ -0,0 +1,224 @@
+use rusqlite::Transaction;
+use vault::Migration;
+
+pub const MIGRATIONS: [Migration; 3] = [m1, m2, m3];
+
+fn eprint_status(nr: usize, total: usize) {
+    eprintln!("Migrating vault from {} to {} (out of {total})", nr, nr + 1);
+}
+
+fn m1(tx: &mut Transaction<'_>, nr: usize, total: usize) -> rusqlite::Result<()> {
+    eprint_status(nr, total);
+    tx.execute_batch(
+        "
+        CREATE TABLE euph_rooms (
+            room         TEXT NOT NULL PRIMARY KEY,
+            first_joined INT  NOT NULL,
+            last_joined  INT  NOT NULL
+        ) STRICT;
+
+        CREATE TABLE euph_msgs (
+            -- Message
+            room              TEXT NOT NULL,
+            id                INT  NOT NULL,
+            parent            INT,
+            previous_edit_id  INT,
+            time              INT  NOT NULL,
+            content           TEXT NOT NULL,
+            encryption_key_id TEXT,
+            edited            INT,
+            deleted           INT,
+            truncated         INT  NOT NULL,
+
+            -- SessionView
+            user_id             TEXT NOT NULL,
+            name                TEXT,
+            server_id           TEXT NOT NULL,
+            server_era          TEXT NOT NULL,
+            session_id          TEXT NOT NULL,
+            is_staff            INT  NOT NULL,
+            is_manager          INT  NOT NULL,
+            client_address      TEXT,
+            real_client_address TEXT,
+
+            PRIMARY KEY (room, id),
+            FOREIGN KEY (room) REFERENCES euph_rooms (room)
+                ON DELETE CASCADE
+        ) STRICT;
+
+        CREATE TABLE euph_spans (
+            room  TEXT NOT NULL,
+            start INT,
+            end   INT,
+
+            UNIQUE (room, start, end),
+            FOREIGN KEY (room) REFERENCES euph_rooms (room)
+                ON DELETE CASCADE,
+            CHECK (start IS NULL OR end IS NOT NULL)
+        ) STRICT;
+
+        CREATE TABLE euph_cookies (
+            cookie TEXT NOT NULL
+        ) STRICT;
+
+        CREATE INDEX euph_idx_msgs_room_id_parent
+        ON euph_msgs (room, id, parent);
+
+        CREATE INDEX euph_idx_msgs_room_parent_id
+        ON euph_msgs (room, parent, id);
+        ",
+    )
+}
+
+fn m2(tx: &mut Transaction<'_>, nr: usize, total: usize) -> rusqlite::Result<()> {
+    eprint_status(nr, total);
+    tx.execute_batch(
+        "
+        ALTER TABLE euph_msgs
+        ADD COLUMN seen INTEGER NOT NULL DEFAULT TRUE;
+
+        CREATE INDEX euph_idx_msgs_room_id_seen
+        ON euph_msgs (room, id, seen);
+        ",
+    )
+}
+
+fn m3(tx: &mut Transaction<'_>, nr: usize, total: usize) -> rusqlite::Result<()> {
+    eprint_status(nr, total);
+    println!("  This migration might take quite a while.");
+    println!("  Aborting it will not corrupt your vault.");
+
+    // Rooms should be identified not just via their name but also their domain.
+    // The domain should be required but there should be no default value.
+    //
+    // To accomplish this, we need to recreate and repopulate all euph related
+    // tables because SQLite's ALTER TABLE is not powerful enough.
+
+    eprintln!("  Preparing tables...");
+    tx.execute_batch(
+        "
+        DROP INDEX euph_idx_msgs_room_id_parent;
+        DROP INDEX euph_idx_msgs_room_parent_id;
+        DROP INDEX euph_idx_msgs_room_id_seen;
+
+        ALTER TABLE euph_rooms RENAME TO old_euph_rooms;
+        ALTER TABLE euph_msgs RENAME TO old_euph_msgs;
+        ALTER TABLE euph_spans RENAME TO old_euph_spans;
+        ALTER TABLE euph_cookies RENAME TO old_euph_cookies;
+
+        CREATE TABLE euph_rooms (
+            domain       TEXT NOT NULL,
+            room         TEXT NOT NULL,
+            first_joined INT  NOT NULL,
+            last_joined  INT  NOT NULL,
+
+            PRIMARY KEY (domain, room)
+        ) STRICT;
+
+        CREATE TABLE euph_msgs (
+            domain TEXT NOT NULL,
+            room   TEXT NOT NULL,
+            seen   INT  NOT NULL,
+
+            -- Message
+            id                INT  NOT NULL,
+            parent            INT,
+            previous_edit_id  INT,
+            time              INT  NOT NULL,
+            content           TEXT NOT NULL,
+            encryption_key_id TEXT,
+            edited            INT,
+            deleted           INT,
+            truncated         INT  NOT NULL,
+
+            -- SessionView
+            user_id             TEXT NOT NULL,
+            name                TEXT,
+            server_id           TEXT NOT NULL,
+            server_era          TEXT NOT NULL,
+            session_id          TEXT NOT NULL,
+            is_staff            INT  NOT NULL,
+            is_manager          INT  NOT NULL,
+            client_address      TEXT,
+            real_client_address TEXT,
+
+            PRIMARY KEY (domain, room, id),
+            FOREIGN KEY (domain, room) REFERENCES euph_rooms (domain, room)
+                ON DELETE CASCADE
+        ) STRICT;
+
+        CREATE TABLE euph_spans (
+            domain TEXT NOT NULL,
+            room   TEXT NOT NULL,
+            start  INT,
+            end    INT,
+
+            UNIQUE (domain, room, start, end),
+            FOREIGN KEY (domain, room) REFERENCES euph_rooms (domain, room)
+                ON DELETE CASCADE,
+            CHECK (start IS NULL OR end IS NOT NULL)
+        ) STRICT;
+
+        CREATE TABLE euph_cookies (
+            domain TEXT NOT NULL,
+            cookie TEXT NOT NULL
+        ) STRICT;
+        ",
+    )?;
+
+    eprintln!("  Migrating data...");
+    tx.execute_batch(
+        "
+        INSERT INTO euph_rooms (domain, room, first_joined, last_joined)
+        SELECT 'euphoria.io', room, first_joined, last_joined
+        FROM old_euph_rooms;
+
+        INSERT INTO euph_msgs (
+            domain, room, seen,
+            id, parent, previous_edit_id, time, content, encryption_key_id, edited, deleted, truncated,
+            user_id, name, server_id, server_era, session_id, is_staff, is_manager, client_address, real_client_address
+        )
+        SELECT
+            'euphoria.io', room, seen,
+            id, parent, previous_edit_id, time, content, encryption_key_id, edited, deleted, truncated,
+            user_id, name, server_id, server_era, session_id, is_staff, is_manager, client_address, real_client_address
+        FROM old_euph_msgs;
+
+        INSERT INTO euph_spans (domain, room, start, end)
+        SELECT 'euphoria.io', room, start, end
+        FROM old_euph_spans;
+
+        INSERT INTO euph_cookies (domain, cookie)
+        SELECT 'euphoria.io', cookie
+        FROM old_euph_cookies;
+        ",
+    )?;
+
+    eprintln!("  Recreating indexes...");
+    tx.execute_batch(
+        "
+        CREATE INDEX euph_idx_msgs_domain_room_id_parent
+        ON euph_msgs (domain, room, id, parent);
+
+        CREATE INDEX euph_idx_msgs_domain_room_parent_id
+        ON euph_msgs (domain, room, parent, id);
+
+        CREATE INDEX euph_idx_msgs_domain_room_id_seen
+        ON euph_msgs (domain, room, id, seen);
+        ",
+    )?;
+
+    eprintln!("  Cleaning up loose ends...");
+    tx.execute_batch(
+        "
+        DROP TABLE old_euph_rooms;
+        DROP TABLE old_euph_msgs;
+        DROP TABLE old_euph_spans;
+        DROP TABLE old_euph_cookies;
+
+        ANALYZE;
+        ",
+    )?;
+
+    Ok(())
+}

cove/src/vault/prepare.rs

@@ -1,28 +1,32 @@
 use rusqlite::Connection;
 
 pub fn prepare(conn: &mut Connection) -> rusqlite::Result<()> {
+    eprintln!("Preparing vault");
+
     // Cache ids of tree roots.
     conn.execute_batch(
         "
         CREATE TEMPORARY TABLE euph_trees (
+            domain TEXT NOT NULL,
             room TEXT NOT NULL,
             id INT NOT NULL,
 
-            PRIMARY KEY (room, id)
+            PRIMARY KEY (domain, room, id)
         ) STRICT;
 
-        INSERT INTO euph_trees (room, id)
-        SELECT room, id
+        INSERT INTO euph_trees (domain, room, id)
+        SELECT domain, room, id
         FROM euph_msgs
         WHERE parent IS NULL
         UNION
-        SELECT room, parent
+        SELECT domain, room, parent
         FROM euph_msgs
         WHERE parent IS NOT NULL
         AND NOT EXISTS(
             SELECT *
             FROM euph_msgs AS parents
-            WHERE parents.room = euph_msgs.room
+            WHERE parents.domain = euph_msgs.domain
+            AND parents.room = euph_msgs.room
             AND parents.id = euph_msgs.parent
         );
 
@@ -30,15 +34,16 @@ pub fn prepare(conn: &mut Connection) -> rusqlite::Result<()> {
         AFTER DELETE ON main.euph_rooms
         BEGIN
             DELETE FROM euph_trees
-            WHERE room = old.room;
+            WHERE domain = old.domain
+            AND room = old.room;
         END;
 
         CREATE TEMPORARY TRIGGER et_insert_msg_without_parent
         AFTER INSERT ON main.euph_msgs
         WHEN new.parent IS NULL
         BEGIN
-            INSERT OR IGNORE INTO euph_trees (room, id)
-            VALUES (new.room, new.id);
+            INSERT OR IGNORE INTO euph_trees (domain, room, id)
+            VALUES (new.domain, new.room, new.id);
         END;
 
         CREATE TEMPORARY TRIGGER et_insert_msg_with_parent
@@ -46,16 +51,18 @@ pub fn prepare(conn: &mut Connection) -> rusqlite::Result<()> {
         WHEN new.parent IS NOT NULL
         BEGIN
             DELETE FROM euph_trees
-            WHERE room = new.room
+            WHERE domain = new.domain
+            AND room = new.room
             AND id = new.id;
 
-            INSERT OR IGNORE INTO euph_trees (room, id)
+            INSERT OR IGNORE INTO euph_trees (domain, room, id)
             SELECT *
-            FROM (VALUES (new.room, new.parent))
+            FROM (VALUES (new.domain, new.room, new.parent))
             WHERE NOT EXISTS(
                 SELECT *
                 FROM euph_msgs
-                WHERE room = new.room
+                WHERE domain = new.domain
+                AND room = new.room
                 AND id = new.parent
                 AND parent IS NOT NULL
             );
@@ -67,35 +74,37 @@ pub fn prepare(conn: &mut Connection) -> rusqlite::Result<()> {
     conn.execute_batch(
         "
         CREATE TEMPORARY TABLE euph_unseen_counts (
+            domain TEXT    NOT NULL,
             room   TEXT    NOT NULL,
             amount INTEGER NOT NULL,
 
-            PRIMARY KEY (room)
+            PRIMARY KEY (domain, room)
         ) STRICT;
 
         -- There must be an entry for every existing room.
-        INSERT INTO euph_unseen_counts (room, amount)
-        SELECT room, 0
+        INSERT INTO euph_unseen_counts (domain, room, amount)
+        SELECT domain, room, 0
         FROM euph_rooms;
 
-        INSERT OR REPLACE INTO euph_unseen_counts (room, amount)
-        SELECT room, COUNT(*)
+        INSERT OR REPLACE INTO euph_unseen_counts (domain, room, amount)
+        SELECT domain, room, COUNT(*)
         FROM euph_msgs
         WHERE NOT seen
-        GROUP BY room;
+        GROUP BY domain, room;
 
         CREATE TEMPORARY TRIGGER euc_insert_room
         AFTER INSERT ON main.euph_rooms
         BEGIN
-            INSERT INTO euph_unseen_counts (room, amount)
-            VALUES (new.room, 0);
+            INSERT INTO euph_unseen_counts (domain, room, amount)
+            VALUES (new.domain, new.room, 0);
         END;
 
         CREATE TEMPORARY TRIGGER euc_delete_room
         AFTER DELETE ON main.euph_rooms
         BEGIN
             DELETE FROM euph_unseen_counts
-            WHERE room = old.room;
+            WHERE domain = old.domain
+            AND room = old.room;
         END;
 
         CREATE TEMPORARY TRIGGER euc_insert_msg
@@ -104,7 +113,8 @@ pub fn prepare(conn: &mut Connection) -> rusqlite::Result<()> {
         BEGIN
             UPDATE euph_unseen_counts
             SET amount = amount + 1
-            WHERE room = new.room;
+            WHERE domain = new.domain
+            AND room = new.room;
         END;
 
         CREATE TEMPORARY TRIGGER euc_update_msg
@@ -113,7 +123,8 @@ pub fn prepare(conn: &mut Connection) -> rusqlite::Result<()> {
         BEGIN
             UPDATE euph_unseen_counts
             SET amount = CASE WHEN new.seen THEN amount - 1 ELSE amount + 1 END
-            WHERE room = new.room;
+            WHERE domain = new.domain
+            AND room = new.room;
         END;
         ",
     )?;

cove/src/version.rs

@@ -0,0 +1,2 @@
+pub const NAME: &str = env!("CARGO_PKG_NAME");
+pub const VERSION: &str = env!("CARGO_PKG_VERSION");

flake.lock

@@ -1,63 +0,0 @@
-{
-  "nodes": {
-    "flake-utils": {
-      "locked": {
-        "lastModified": 1678901627,
-        "narHash": "sha256-U02riOqrKKzwjsxc/400XnElV+UtPUQWpANPlyazjH0=",
-        "owner": "numtide",
-        "repo": "flake-utils",
-        "rev": "93a2b84fc4b70d9e089d029deacc3583435c2ed6",
-        "type": "github"
-      },
-      "original": {
-        "owner": "numtide",
-        "repo": "flake-utils",
-        "type": "github"
-      }
-    },
-    "naersk": {
-      "inputs": {
-        "nixpkgs": [
-          "nixpkgs"
-        ]
-      },
-      "locked": {
-        "lastModified": 1679567394,
-        "narHash": "sha256-ZvLuzPeARDLiQUt6zSZFGOs+HZmE+3g4QURc8mkBsfM=",
-        "owner": "nix-community",
-        "repo": "naersk",
-        "rev": "88cd22380154a2c36799fe8098888f0f59861a15",
-        "type": "github"
-      },
-      "original": {
-        "owner": "nix-community",
-        "repo": "naersk",
-        "type": "github"
-      }
-    },
-    "nixpkgs": {
-      "locked": {
-        "lastModified": 1680643271,
-        "narHash": "sha256-m76rYcvqs+NzTyETfxh1o/9gKdBuJ/Hl+PI/kp73mDw=",
-        "owner": "NixOS",
-        "repo": "nixpkgs",
-        "rev": "246567a3ad88e3119c2001e2fe78be233474cde0",
-        "type": "github"
-      },
-      "original": {
-        "owner": "NixOS",
-        "repo": "nixpkgs",
-        "type": "github"
-      }
-    },
-    "root": {
-      "inputs": {
-        "flake-utils": "flake-utils",
-        "naersk": "naersk",
-        "nixpkgs": "nixpkgs"
-      }
-    }
-  },
-  "root": "root",
-  "version": 7
-}

flake.nix

@@ -1,21 +0,0 @@
-{
-  description = "TUI client for euphoria.io, a threaded real-time chat platform";
-
-  inputs = {
-    nixpkgs.url = "github:NixOS/nixpkgs";
-    flake-utils.url = "github:numtide/flake-utils";
-
-    naersk.url = "github:nix-community/naersk";
-    naersk.inputs.nixpkgs.follows = "nixpkgs";
-  };
-
-  outputs = { self, nixpkgs, flake-utils, naersk }: flake-utils.lib.eachDefaultSystem (system:
-    let
-      pkgs = import nixpkgs { inherit system; };
-      naersk' = pkgs.callPackage naersk { };
-    in
-    rec {
-      packages.default = naersk'.buildPackage { src = ./.; };
-    }
-  );
-}

src/config.rs

@@ -1,61 +0,0 @@
-use std::collections::HashMap;
-use std::fs;
-use std::path::{Path, PathBuf};
-
-use serde::Deserialize;
-
-use crate::macros::ok_or_return;
-
-#[derive(Debug, Clone, Copy, Default, Deserialize)]
-#[serde(rename_all = "snake_case")]
-pub enum RoomsSortOrder {
-    #[default]
-    Alphabet,
-    Importance,
-}
-
-#[derive(Debug, Clone, Default, Deserialize)]
-pub struct EuphRoom {
-    // TODO Mark favourite rooms via printable ascii characters
-    #[serde(default)]
-    pub autojoin: bool,
-    pub username: Option<String>,
-    #[serde(default)]
-    pub force_username: bool,
-    pub password: Option<String>,
-}
-
-#[derive(Debug, Default, Deserialize)]
-pub struct Euph {
-    pub rooms: HashMap<String, EuphRoom>,
-}
-
-#[derive(Debug, Default, Deserialize)]
-pub struct Config {
-    pub data_dir: Option<PathBuf>,
-    #[serde(default)]
-    pub ephemeral: bool,
-    #[serde(default)]
-    pub offline: bool,
-    #[serde(default)]
-    pub rooms_sort_order: RoomsSortOrder,
-    // TODO Invoke external notification command?
-    pub euph: Euph,
-}
-
-impl Config {
-    pub fn load(path: &Path) -> Self {
-        let content = ok_or_return!(fs::read_to_string(path), Self::default());
-        match toml::from_str(&content) {
-            Ok(config) => config,
-            Err(err) => {
-                eprintln!("Error loading config file: {err}");
-                Self::default()
-            }
-        }
-    }
-
-    pub fn euph_room(&self, name: &str) -> EuphRoom {
-        self.euph.rooms.get(name).cloned().unwrap_or_default()
-    }
-}

src/euph/small_message.rs

@@ -1,292 +0,0 @@
-use std::mem;
-
-use crossterm::style::{ContentStyle, Stylize};
-use euphoxide::api::{MessageId, Snowflake, Time};
-use time::OffsetDateTime;
-use toss::styled::Styled;
-
-use crate::store::Msg;
-use crate::ui::ChatMsg;
-
-use super::util;
-
-fn nick_char(ch: char) -> bool {
-    // Closely following the heim mention regex:
-    // https://github.com/euphoria-io/heim/blob/978c921063e6b06012fc8d16d9fbf1b3a0be1191/client/lib/stores/chat.js#L14-L15
-    // `>` has been experimentally confirmed to delimit mentions as well.
-    match ch {
-        ',' | '.' | '!' | '?' | ';' | '&' | '<' | '>' | '\'' | '"' => false,
-        _ => !ch.is_whitespace(),
-    }
-}
-
-fn room_char(ch: char) -> bool {
-    // Basically just \w, see also
-    // https://github.com/euphoria-io/heim/blob/978c921063e6b06012fc8d16d9fbf1b3a0be1191/client/lib/ui/MessageText.js#L66
-    ch.is_ascii_alphanumeric() || ch == '_'
-}
-
-enum Span {
-    Nothing,
-    Mention,
-    Room,
-    Emoji,
-}
-
-struct Highlighter<'a> {
-    content: &'a str,
-    base_style: ContentStyle,
-    exact: bool,
-
-    span: Span,
-    span_start: usize,
-    room_or_mention_possible: bool,
-
-    result: Styled,
-}
-
-impl<'a> Highlighter<'a> {
-    /// Does *not* guarantee `self.span_start == idx` after running!
-    fn close_mention(&mut self, idx: usize) {
-        let span_length = idx.saturating_sub(self.span_start);
-        if span_length <= 1 {
-            // We can repurpose the current span
-            self.span = Span::Nothing;
-            return;
-        }
-
-        let text = &self.content[self.span_start..idx]; // Includes @
-        self.result = mem::take(&mut self.result).and_then(if self.exact {
-            util::style_nick_exact(text, self.base_style)
-        } else {
-            util::style_nick(text, self.base_style)
-        });
-
-        self.span = Span::Nothing;
-        self.span_start = idx;
-    }
-
-    /// Does *not* guarantee `self.span_start == idx` after running!
-    fn close_room(&mut self, idx: usize) {
-        let span_length = idx.saturating_sub(self.span_start);
-        if span_length <= 1 {
-            // We can repurpose the current span
-            self.span = Span::Nothing;
-            return;
-        }
-
-        self.result = mem::take(&mut self.result).then(
-            &self.content[self.span_start..idx],
-            self.base_style.blue().bold(),
-        );
-
-        self.span = Span::Nothing;
-        self.span_start = idx;
-    }
-
-    // Warning: `idx` is the index of the closing colon.
-    fn close_emoji(&mut self, idx: usize) {
-        let name = &self.content[self.span_start + 1..idx];
-        if let Some(replace) = util::EMOJI.get(name) {
-            match replace {
-                Some(replace) if !self.exact => {
-                    self.result = mem::take(&mut self.result).then(replace, self.base_style);
-                }
-                _ => {
-                    let text = &self.content[self.span_start..=idx];
-                    let style = self.base_style.magenta();
-                    self.result = mem::take(&mut self.result).then(text, style);
-                }
-            }
-
-            self.span = Span::Nothing;
-            self.span_start = idx + 1;
-        } else {
-            self.close_plain(idx);
-            self.span = Span::Emoji;
-        }
-    }
-
-    /// Guarantees `self.span_start == idx` after running.
-    fn close_plain(&mut self, idx: usize) {
-        if self.span_start == idx {
-            // Span has length 0
-            return;
-        }
-
-        self.result =
-            mem::take(&mut self.result).then(&self.content[self.span_start..idx], self.base_style);
-
-        self.span = Span::Nothing;
-        self.span_start = idx;
-    }
-
-    fn close_span_before_current_char(&mut self, idx: usize, char: char) {
-        match self.span {
-            Span::Mention if !nick_char(char) => self.close_mention(idx),
-            Span::Room if !room_char(char) => self.close_room(idx),
-            Span::Emoji if char == '&' || char == '@' => {
-                self.span = Span::Nothing;
-            }
-            _ => {}
-        }
-    }
-
-    fn update_span_with_current_char(&mut self, idx: usize, char: char) {
-        match self.span {
-            Span::Nothing if char == '@' && self.room_or_mention_possible => {
-                self.close_plain(idx);
-                self.span = Span::Mention;
-            }
-            Span::Nothing if char == '&' && self.room_or_mention_possible => {
-                self.close_plain(idx);
-                self.span = Span::Room;
-            }
-            Span::Nothing if char == ':' => {
-                self.close_plain(idx);
-                self.span = Span::Emoji;
-            }
-            Span::Emoji if char == ':' => self.close_emoji(idx),
-            _ => {}
-        }
-    }
-
-    fn close_final_span(&mut self) {
-        let idx = self.content.len();
-        if self.span_start >= idx {
-            return; // Span has no contents
-        }
-
-        match self.span {
-            Span::Mention => self.close_mention(idx),
-            Span::Room => self.close_room(idx),
-            _ => {}
-        }
-
-        self.close_plain(idx);
-    }
-
-    fn step(&mut self, idx: usize, char: char) {
-        if self.span_start < idx {
-            self.close_span_before_current_char(idx, char);
-        }
-
-        self.update_span_with_current_char(idx, char);
-
-        // More permissive than the heim web client
-        self.room_or_mention_possible = !char.is_alphanumeric();
-    }
-
-    fn highlight(content: &'a str, base_style: ContentStyle, exact: bool) -> Styled {
-        let mut this = Self {
-            content: if exact { content } else { content.trim() },
-            base_style,
-            exact,
-            span: Span::Nothing,
-            span_start: 0,
-            room_or_mention_possible: true,
-            result: Styled::default(),
-        };
-
-        for (idx, char) in (if exact { content } else { content.trim() }).char_indices() {
-            this.step(idx, char);
-        }
-
-        this.close_final_span();
-
-        this.result
-    }
-}
-
-fn highlight_content(content: &str, base_style: ContentStyle, exact: bool) -> Styled {
-    Highlighter::highlight(content, base_style, exact)
-}
-
-#[derive(Debug, Clone)]
-pub struct SmallMessage {
-    pub id: MessageId,
-    pub parent: Option<MessageId>,
-    pub time: Time,
-    pub nick: String,
-    pub content: String,
-    pub seen: bool,
-}
-
-fn as_me(content: &str) -> Option<&str> {
-    content.strip_prefix("/me")
-}
-
-fn style_me() -> ContentStyle {
-    ContentStyle::default().grey().italic()
-}
-
-fn styled_nick(nick: &str) -> Styled {
-    Styled::new_plain("[")
-        .and_then(util::style_nick(nick, ContentStyle::default()))
-        .then_plain("]")
-}
-
-fn styled_nick_me(nick: &str) -> Styled {
-    let style = style_me();
-    Styled::new("*", style).and_then(util::style_nick(nick, style))
-}
-
-fn styled_content(content: &str) -> Styled {
-    highlight_content(content.trim(), ContentStyle::default(), false)
-}
-
-fn styled_content_me(content: &str) -> Styled {
-    let style = style_me();
-    highlight_content(content.trim(), style, false).then("*", style)
-}
-
-fn styled_editor_content(content: &str) -> Styled {
-    let style = if as_me(content).is_some() {
-        style_me()
-    } else {
-        ContentStyle::default()
-    };
-    highlight_content(content, style, true)
-}
-
-impl Msg for SmallMessage {
-    type Id = MessageId;
-
-    fn id(&self) -> Self::Id {
-        self.id
-    }
-
-    fn parent(&self) -> Option<Self::Id> {
-        self.parent
-    }
-
-    fn seen(&self) -> bool {
-        self.seen
-    }
-
-    fn last_possible_id() -> Self::Id {
-        MessageId(Snowflake::MAX)
-    }
-}
-
-impl ChatMsg for SmallMessage {
-    fn time(&self) -> OffsetDateTime {
-        self.time.0
-    }
-
-    fn styled(&self) -> (Styled, Styled) {
-        Self::pseudo(&self.nick, &self.content)
-    }
-
-    fn edit(nick: &str, content: &str) -> (Styled, Styled) {
-        (styled_nick(nick), styled_editor_content(content))
-    }
-
-    fn pseudo(nick: &str, content: &str) -> (Styled, Styled) {
-        if let Some(content) = as_me(content) {
-            (styled_nick_me(nick), styled_content_me(content))
-        } else {
-            (styled_nick(nick), styled_content(content))
-        }
-    }
-}

src/macros.rs

@@ -1,45 +0,0 @@
-macro_rules! some_or_return {
-    ($e:expr) => {
-        match $e {
-            Some(result) => result,
-            None => return,
-        }
-    };
-    ($e:expr, $ret:expr) => {
-        match $e {
-            Some(result) => result,
-            None => return $ret,
-        }
-    };
-}
-pub(crate) use some_or_return;
-
-macro_rules! ok_or_return {
-    ($e:expr) => {
-        match $e {
-            Ok(result) => result,
-            Err(_) => return,
-        }
-    };
-    ($e:expr, $ret:expr) => {
-        match $e {
-            Ok(result) => result,
-            Err(_) => return $ret,
-        }
-    };
-}
-pub(crate) use ok_or_return;
-
-// TODO Get rid of this macro as much as possible
-macro_rules! logging_unwrap {
-    ($e:expr) => {
-        match $e {
-            Ok(value) => value,
-            Err(err) => {
-                log::error!("{err}");
-                panic!("{err}");
-            }
-        }
-    };
-}
-pub(crate) use logging_unwrap;

src/main.rs

@@ -1,191 +0,0 @@
-#![forbid(unsafe_code)]
-// Rustc lint groups
-#![warn(future_incompatible)]
-#![warn(rust_2018_idioms)]
-#![warn(unused)]
-// Rustc lints
-#![warn(noop_method_call)]
-#![warn(single_use_lifetimes)]
-// Clippy lints
-#![warn(clippy::use_self)]
-
-// TODO Enable warn(unreachable_pub)?
-// TODO Remove unnecessary Debug impls and compare compile times
-// TODO Time zones other than UTC
-// TODO Fix password room auth
-
-mod config;
-mod euph;
-mod export;
-mod logger;
-mod macros;
-mod store;
-mod ui;
-mod vault;
-
-use std::path::PathBuf;
-
-use clap::Parser;
-use cookie::CookieJar;
-use directories::{BaseDirs, ProjectDirs};
-use log::info;
-use tokio::sync::mpsc;
-use toss::terminal::Terminal;
-
-use crate::config::Config;
-use crate::logger::Logger;
-use crate::ui::Ui;
-use crate::vault::Vault;
-
-#[derive(Debug, clap::Parser)]
-enum Command {
-    /// Run the client interactively (default).
-    Run,
-    /// Export room logs as plain text files.
-    Export(export::Args),
-    /// Compact and clean up vault.
-    Gc,
-    /// Clear euphoria session cookies.
-    ClearCookies,
-}
-
-impl Default for Command {
-    fn default() -> Self {
-        Self::Run
-    }
-}
-
-#[derive(Debug, clap::Parser)]
-#[command(version)]
-struct Args {
-    /// Show more detailed log messages.
-    #[arg(long, short)]
-    verbose: bool,
-
-    /// Path to the config file.
-    ///
-    /// Relative paths are interpreted relative to the current directory.
-    #[arg(long, short)]
-    config: Option<PathBuf>,
-
-    /// Path to a directory for cove to store its data in.
-    ///
-    /// Relative paths are interpreted relative to the current directory.
-    #[arg(long, short)]
-    data_dir: Option<PathBuf>,
-
-    /// If set, cove won't store data permanently.
-    #[arg(long, short)]
-    ephemeral: bool,
-
-    /// If set, cove will ignore the autojoin config option.
-    #[arg(long, short)]
-    offline: bool,
-
-    /// Measure the width of characters as displayed by the terminal emulator
-    /// instead of guessing the width.
-    #[arg(long, short)]
-    measure_widths: bool,
-
-    #[command(subcommand)]
-    command: Option<Command>,
-}
-
-fn set_data_dir(config: &mut Config, args_data_dir: Option<PathBuf>) {
-    if let Some(data_dir) = args_data_dir {
-        // The data dir specified via args_data_dir is relative to the current
-        // directory and needs no resolving.
-        config.data_dir = Some(data_dir);
-    } else if let Some(data_dir) = &config.data_dir {
-        // Resolve the data dir specified in the config file relative to the
-        // user's home directory, if possible.
-        if let Some(base_dirs) = BaseDirs::new() {
-            config.data_dir = Some(base_dirs.home_dir().join(data_dir));
-        }
-    }
-}
-
-fn set_ephemeral(config: &mut Config, args_ephemeral: bool) {
-    if args_ephemeral {
-        config.ephemeral = true;
-    }
-}
-
-fn set_offline(config: &mut Config, args_offline: bool) {
-    if args_offline {
-        config.offline = true;
-    }
-}
-
-#[tokio::main]
-async fn main() -> anyhow::Result<()> {
-    let args = Args::parse();
-    let (logger, logger_guard, logger_rx) = Logger::init(args.verbose);
-    let dirs = ProjectDirs::from("de", "plugh", "cove").expect("unable to determine directories");
-
-    let config_path = args
-        .config
-        .unwrap_or_else(|| dirs.config_dir().join("config.toml"));
-    eprintln!("Config file: {}", config_path.to_string_lossy());
-    let mut config = Config::load(&config_path);
-    set_data_dir(&mut config, args.data_dir);
-    set_ephemeral(&mut config, args.ephemeral);
-    set_offline(&mut config, args.offline);
-    let config = Box::leak(Box::new(config));
-
-    let vault = if config.ephemeral {
-        vault::launch_in_memory()?
-    } else {
-        let data_dir = config
-            .data_dir
-            .clone()
-            .unwrap_or_else(|| dirs.data_dir().to_path_buf());
-        eprintln!("Data dir:    {}", data_dir.to_string_lossy());
-        vault::launch(&data_dir.join("vault.db"))?
-    };
-
-    match args.command.unwrap_or_default() {
-        Command::Run => run(logger, logger_rx, config, &vault, args.measure_widths).await?,
-        Command::Export(args) => export::export(&vault.euph(), args).await?,
-        Command::Gc => {
-            eprintln!("Cleaning up and compacting vault");
-            eprintln!("This may take a while...");
-            vault.gc().await?;
-        }
-        Command::ClearCookies => {
-            eprintln!("Clearing cookies");
-            vault.euph().set_cookies(CookieJar::new()).await?;
-        }
-    }
-
-    vault.close().await;
-
-    // Print all logged errors. This should always happen, even if cove panics,
-    // because the errors may be key in diagnosing what happened. Because of
-    // this, it is not implemented via a normal function call.
-    drop(logger_guard);
-
-    eprintln!("Goodbye!");
-    Ok(())
-}
-
-async fn run(
-    logger: Logger,
-    logger_rx: mpsc::UnboundedReceiver<()>,
-    config: &'static Config,
-    vault: &Vault,
-    measure_widths: bool,
-) -> anyhow::Result<()> {
-    info!(
-        "Welcome to {} {}",
-        env!("CARGO_PKG_NAME"),
-        env!("CARGO_PKG_VERSION")
-    );
-
-    let mut terminal = Terminal::new()?;
-    terminal.set_measuring(measure_widths);
-    Ui::run(config, &mut terminal, vault.clone(), logger, logger_rx).await?;
-    drop(terminal); // So other things can print again
-
-    Ok(())
-}

src/ui/chat.rs

@@ -1,160 +0,0 @@
-// TODO Implement thread view
-// TODO Implement flat (chronological?) view
-// TODO Implement message search?
-
-mod blocks;
-mod tree;
-
-use std::sync::Arc;
-use std::{fmt, io};
-
-use async_trait::async_trait;
-use parking_lot::FairMutex;
-use time::OffsetDateTime;
-use toss::frame::{Frame, Size};
-use toss::styled::Styled;
-use toss::terminal::Terminal;
-
-use crate::store::{Msg, MsgStore};
-
-use self::tree::{TreeView, TreeViewState};
-
-use super::input::{InputEvent, KeyBindingsList};
-use super::widgets::Widget;
-
-///////////
-// Trait //
-///////////
-
-pub trait ChatMsg {
-    fn time(&self) -> OffsetDateTime;
-    fn styled(&self) -> (Styled, Styled);
-    fn edit(nick: &str, content: &str) -> (Styled, Styled);
-    fn pseudo(nick: &str, content: &str) -> (Styled, Styled);
-}
-
-///////////
-// State //
-///////////
-
-pub enum Mode {
-    Tree,
-    // Thread,
-    // Flat,
-}
-
-pub struct ChatState<M: Msg, S: MsgStore<M>> {
-    store: S,
-    mode: Mode,
-    tree: TreeViewState<M, S>,
-    // thread: ThreadView,
-    // flat: FlatView,
-}
-
-impl<M: Msg, S: MsgStore<M> + Clone> ChatState<M, S> {
-    pub fn new(store: S) -> Self {
-        Self {
-            mode: Mode::Tree,
-            tree: TreeViewState::new(store.clone()),
-            store,
-        }
-    }
-}
-
-impl<M: Msg, S: MsgStore<M>> ChatState<M, S> {
-    pub fn store(&self) -> &S {
-        &self.store
-    }
-
-    pub fn widget(&self, nick: String, focused: bool) -> Chat<M, S> {
-        match self.mode {
-            Mode::Tree => Chat::Tree(self.tree.widget(nick, focused)),
-        }
-    }
-}
-
-pub enum Reaction<M: Msg> {
-    NotHandled,
-    Handled,
-    Composed {
-        parent: Option<M::Id>,
-        content: String,
-    },
-    ComposeError(io::Error),
-}
-
-impl<M: Msg> Reaction<M> {
-    pub fn handled(&self) -> bool {
-        !matches!(self, Self::NotHandled)
-    }
-}
-
-impl<M: Msg, S: MsgStore<M>> ChatState<M, S> {
-    pub async fn list_key_bindings(&self, bindings: &mut KeyBindingsList, can_compose: bool) {
-        match self.mode {
-            Mode::Tree => self.tree.list_key_bindings(bindings, can_compose).await,
-        }
-    }
-
-    pub async fn handle_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-        can_compose: bool,
-    ) -> Result<Reaction<M>, S::Error> {
-        match self.mode {
-            Mode::Tree => {
-                self.tree
-                    .handle_input_event(terminal, crossterm_lock, event, can_compose)
-                    .await
-            }
-        }
-    }
-
-    pub async fn cursor(&self) -> Option<M::Id> {
-        match self.mode {
-            Mode::Tree => self.tree.cursor().await,
-        }
-    }
-
-    /// A [`Reaction::Composed`] message was sent, either successfully or
-    /// unsuccessfully.
-    ///
-    /// If successful, include the message's id as an argument. If unsuccessful,
-    /// instead pass a `None`.
-    pub async fn sent(&mut self, id: Option<M::Id>) {
-        match self.mode {
-            Mode::Tree => self.tree.sent(id).await,
-        }
-    }
-}
-
-////////////
-// Widget //
-////////////
-
-pub enum Chat<M: Msg, S: MsgStore<M>> {
-    Tree(TreeView<M, S>),
-}
-
-#[async_trait]
-impl<M, S> Widget for Chat<M, S>
-where
-    M: Msg + ChatMsg,
-    M::Id: Send + Sync,
-    S: MsgStore<M> + Send + Sync,
-    S::Error: fmt::Display,
-{
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size {
-        match self {
-            Self::Tree(tree) => tree.size(frame, max_width, max_height),
-        }
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        match *self {
-            Self::Tree(tree) => Box::new(tree).render(frame).await,
-        }
-    }
-}

src/ui/chat/blocks.rs

@@ -1,170 +0,0 @@
-use std::collections::{vec_deque, VecDeque};
-use std::ops::Range;
-
-use toss::frame::Frame;
-
-use crate::macros::some_or_return;
-use crate::ui::widgets::BoxedWidget;
-
-pub struct Block<I> {
-    pub id: I,
-    pub top_line: i32,
-    pub height: i32,
-    /// The lines of the block that should be made visible if the block is
-    /// focused on. By default, the focus encompasses the entire block.
-    ///
-    /// If not all of these lines can be made visible, the top of the range
-    /// should be preferred over the bottom.
-    pub focus: Range<i32>,
-    pub widget: BoxedWidget,
-}
-
-impl<I> Block<I> {
-    pub fn new<W: Into<BoxedWidget>>(frame: &mut Frame, id: I, widget: W) -> Self {
-        // Interestingly, rust-analyzer fails to deduce the type of `widget`
-        // here but rustc knows it's a `BoxedWidget`.
-        let widget = widget.into();
-        let size = widget.size(frame, Some(frame.size().width), None);
-        let height = size.height.into();
-        Self {
-            id,
-            top_line: 0,
-            height,
-            focus: 0..height,
-            widget,
-        }
-    }
-
-    pub fn focus(mut self, focus: Range<i32>) -> Self {
-        self.focus = focus;
-        self
-    }
-}
-
-pub struct Blocks<I> {
-    pub blocks: VecDeque<Block<I>>,
-    /// The top line of the first block. Useful for prepending blocks,
-    /// especially to empty [`Blocks`]s.
-    pub top_line: i32,
-    /// The bottom line of the last block. Useful for appending blocks,
-    /// especially to empty [`Blocks`]s.
-    pub bottom_line: i32,
-}
-
-impl<I> Blocks<I> {
-    pub fn new() -> Self {
-        Self::new_below(0)
-    }
-
-    /// Create a new [`Blocks`] such that the first prepended line will be on
-    /// `line`.
-    pub fn new_below(line: i32) -> Self {
-        Self {
-            blocks: VecDeque::new(),
-            top_line: line + 1,
-            bottom_line: line,
-        }
-    }
-
-    pub fn iter(&self) -> vec_deque::Iter<'_, Block<I>> {
-        self.blocks.iter()
-    }
-
-    pub fn offset(&mut self, delta: i32) {
-        self.top_line += delta;
-        self.bottom_line += delta;
-        for block in &mut self.blocks {
-            block.top_line += delta;
-        }
-    }
-
-    pub fn push_front(&mut self, mut block: Block<I>) {
-        self.top_line -= block.height;
-        block.top_line = self.top_line;
-        self.blocks.push_front(block);
-    }
-
-    pub fn push_back(&mut self, mut block: Block<I>) {
-        block.top_line = self.bottom_line + 1;
-        self.bottom_line += block.height;
-        self.blocks.push_back(block);
-    }
-
-    pub fn prepend(&mut self, mut layout: Self) {
-        while let Some(block) = layout.blocks.pop_back() {
-            self.push_front(block);
-        }
-    }
-
-    pub fn append(&mut self, mut layout: Self) {
-        while let Some(block) = layout.blocks.pop_front() {
-            self.push_back(block);
-        }
-    }
-
-    pub fn set_top_line(&mut self, line: i32) {
-        self.top_line = line;
-
-        if let Some(first_block) = self.blocks.front_mut() {
-            first_block.top_line = self.top_line;
-        }
-
-        for i in 1..self.blocks.len() {
-            self.blocks[i].top_line = self.blocks[i - 1].top_line + self.blocks[i - 1].height;
-        }
-
-        self.bottom_line = self
-            .blocks
-            .back()
-            .map(|b| b.top_line + b.height - 1)
-            .unwrap_or(self.top_line - 1);
-    }
-
-    pub fn set_bottom_line(&mut self, line: i32) {
-        self.bottom_line = line;
-
-        if let Some(last_block) = self.blocks.back_mut() {
-            last_block.top_line = self.bottom_line + 1 - last_block.height;
-        }
-
-        for i in (1..self.blocks.len()).rev() {
-            self.blocks[i - 1].top_line = self.blocks[i].top_line - self.blocks[i - 1].height;
-        }
-
-        self.top_line = self
-            .blocks
-            .front()
-            .map(|b| b.top_line)
-            .unwrap_or(self.bottom_line + 1)
-    }
-}
-
-impl<I: Eq> Blocks<I> {
-    pub fn find(&self, id: &I) -> Option<&Block<I>> {
-        self.blocks.iter().find(|b| b.id == *id)
-    }
-
-    pub fn recalculate_offsets(&mut self, id: &I, top_line: i32) {
-        let idx = some_or_return!(self
-            .blocks
-            .iter()
-            .enumerate()
-            .find(|(_, b)| b.id == *id)
-            .map(|(i, _)| i));
-
-        self.blocks[idx].top_line = top_line;
-
-        // Propagate changes to top
-        for i in (0..idx).rev() {
-            self.blocks[i].top_line = self.blocks[i + 1].top_line - self.blocks[i].height;
-        }
-        self.top_line = self.blocks.front().expect("blocks nonempty").top_line;
-
-        // Propagate changes to bottom
-        for i in (idx + 1)..self.blocks.len() {
-            self.blocks[i].top_line = self.blocks[i - 1].top_line + self.blocks[i - 1].height;
-        }
-        let bottom = self.blocks.back().expect("blocks nonempty");
-        self.bottom_line = bottom.top_line + bottom.height - 1;
-    }
-}

src/ui/chat/tree.rs

@@ -1,454 +0,0 @@
-// TODO Focusing on sub-trees
-
-mod cursor;
-mod layout;
-mod tree_blocks;
-mod widgets;
-
-use std::collections::HashSet;
-use std::fmt;
-use std::sync::Arc;
-
-use async_trait::async_trait;
-use parking_lot::FairMutex;
-use tokio::sync::Mutex;
-use toss::frame::{Frame, Pos, Size};
-use toss::terminal::Terminal;
-
-use crate::macros::logging_unwrap;
-use crate::store::{Msg, MsgStore};
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::util;
-use crate::ui::widgets::editor::EditorState;
-use crate::ui::widgets::Widget;
-
-use self::cursor::Cursor;
-
-use super::{ChatMsg, Reaction};
-
-///////////
-// State //
-///////////
-
-enum Correction {
-    MakeCursorVisible,
-    MoveCursorToVisibleArea,
-    CenterCursor,
-}
-
-struct InnerTreeViewState<M: Msg, S: MsgStore<M>> {
-    store: S,
-
-    last_cursor: Cursor<M::Id>,
-    last_cursor_line: i32,
-    last_visible_msgs: Vec<M::Id>,
-
-    cursor: Cursor<M::Id>,
-    editor: EditorState,
-
-    /// Scroll the view on the next render. Positive values scroll up and
-    /// negative values scroll down.
-    scroll: i32,
-    correction: Option<Correction>,
-
-    folded: HashSet<M::Id>,
-}
-
-impl<M: Msg, S: MsgStore<M>> InnerTreeViewState<M, S> {
-    fn new(store: S) -> Self {
-        Self {
-            store,
-            last_cursor: Cursor::Bottom,
-            last_cursor_line: 0,
-            last_visible_msgs: vec![],
-            cursor: Cursor::Bottom,
-            editor: EditorState::new(),
-            scroll: 0,
-            correction: None,
-            folded: HashSet::new(),
-        }
-    }
-
-    pub fn list_movement_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("j/k, ↓/↑", "move cursor up/down");
-        bindings.binding("J/K, ctrl+↓/↑", "move cursor to prev/next sibling");
-        bindings.binding("p/P", "move cursor to parent/root");
-        bindings.binding("h/l, ←/→", "move cursor chronologically");
-        bindings.binding("H/L, ctrl+←/→", "move cursor to prev/next unseen message");
-        bindings.binding("g, home", "move cursor to top");
-        bindings.binding("G, end", "move cursor to bottom");
-        bindings.binding("ctrl+y/e", "scroll up/down a line");
-        bindings.binding("ctrl+u/d", "scroll up/down half a screen");
-        bindings.binding("ctrl+b/f, page up/down", "scroll up/down one screen");
-        bindings.binding("z", "center cursor on screen");
-        // TODO Bindings inspired by vim's ()/[]/{} bindings?
-    }
-
-    async fn handle_movement_input_event(
-        &mut self,
-        frame: &mut Frame,
-        event: &InputEvent,
-    ) -> Result<bool, S::Error> {
-        let chat_height = frame.size().height - 3;
-
-        match event {
-            key!('k') | key!(Up) => self.move_cursor_up().await?,
-            key!('j') | key!(Down) => self.move_cursor_down().await?,
-            key!('K') | key!(Ctrl + Up) => self.move_cursor_up_sibling().await?,
-            key!('J') | key!(Ctrl + Down) => self.move_cursor_down_sibling().await?,
-            key!('p') => self.move_cursor_to_parent().await?,
-            key!('P') => self.move_cursor_to_root().await?,
-            key!('h') | key!(Left) => self.move_cursor_older().await?,
-            key!('l') | key!(Right) => self.move_cursor_newer().await?,
-            key!('H') | key!(Ctrl + Left) => self.move_cursor_older_unseen().await?,
-            key!('L') | key!(Ctrl + Right) => self.move_cursor_newer_unseen().await?,
-            key!('g') | key!(Home) => self.move_cursor_to_top().await?,
-            key!('G') | key!(End) => self.move_cursor_to_bottom().await,
-            key!(Ctrl + 'y') => self.scroll_up(1),
-            key!(Ctrl + 'e') => self.scroll_down(1),
-            key!(Ctrl + 'u') => self.scroll_up((chat_height / 2).into()),
-            key!(Ctrl + 'd') => self.scroll_down((chat_height / 2).into()),
-            key!(Ctrl + 'b') | key!(PageUp) => self.scroll_up(chat_height.saturating_sub(1).into()),
-            key!(Ctrl + 'f') | key!(PageDown) => {
-                self.scroll_down(chat_height.saturating_sub(1).into())
-            }
-            key!('z') => self.center_cursor(),
-            _ => return Ok(false),
-        }
-
-        Ok(true)
-    }
-
-    pub fn list_action_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("space", "fold current message's subtree");
-        bindings.binding("s", "toggle current message's seen status");
-        bindings.binding("S", "mark all visible messages as seen");
-        bindings.binding("ctrl+s", "mark all older messages as seen");
-    }
-
-    async fn handle_action_input_event(
-        &mut self,
-        event: &InputEvent,
-        id: Option<&M::Id>,
-    ) -> Result<bool, S::Error> {
-        match event {
-            key!(' ') => {
-                if let Some(id) = id {
-                    if !self.folded.remove(id) {
-                        self.folded.insert(id.clone());
-                    }
-                    return Ok(true);
-                }
-            }
-            key!('s') => {
-                if let Some(id) = id {
-                    if let Some(msg) = self.store.tree(id).await?.msg(id) {
-                        self.store.set_seen(id, !msg.seen()).await?;
-                    }
-                    return Ok(true);
-                }
-            }
-            key!('S') => {
-                for id in &self.last_visible_msgs {
-                    self.store.set_seen(id, true).await?;
-                }
-                return Ok(true);
-            }
-            key!(Ctrl + 's') => {
-                if let Some(id) = id {
-                    self.store.set_older_seen(id, true).await?;
-                } else {
-                    self.store
-                        .set_older_seen(&M::last_possible_id(), true)
-                        .await?;
-                }
-                return Ok(true);
-            }
-            _ => {}
-        }
-        Ok(false)
-    }
-
-    pub fn list_edit_initiating_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("r", "reply to message (inline if possible, else directly)");
-        bindings.binding("R", "reply to message (opposite of R)");
-        bindings.binding("t", "start a new thread");
-    }
-
-    async fn handle_edit_initiating_input_event(
-        &mut self,
-        event: &InputEvent,
-        id: Option<M::Id>,
-    ) -> Result<bool, S::Error> {
-        match event {
-            key!('r') => {
-                if let Some(parent) = self.parent_for_normal_reply().await? {
-                    self.cursor = Cursor::editor(id, parent);
-                    self.correction = Some(Correction::MakeCursorVisible);
-                }
-            }
-            key!('R') => {
-                if let Some(parent) = self.parent_for_alternate_reply().await? {
-                    self.cursor = Cursor::editor(id, parent);
-                    self.correction = Some(Correction::MakeCursorVisible);
-                }
-            }
-            key!('t') | key!('T') => {
-                self.cursor = Cursor::editor(id, None);
-                self.correction = Some(Correction::MakeCursorVisible);
-            }
-            _ => return Ok(false),
-        }
-
-        Ok(true)
-    }
-
-    pub fn list_normal_key_bindings(&self, bindings: &mut KeyBindingsList, can_compose: bool) {
-        self.list_movement_key_bindings(bindings);
-        bindings.empty();
-        self.list_action_key_bindings(bindings);
-        if can_compose {
-            bindings.empty();
-            self.list_edit_initiating_key_bindings(bindings);
-        }
-    }
-
-    async fn handle_normal_input_event(
-        &mut self,
-        frame: &mut Frame,
-        event: &InputEvent,
-        can_compose: bool,
-        id: Option<M::Id>,
-    ) -> Result<bool, S::Error> {
-        #[allow(clippy::if_same_then_else)]
-        Ok(if self.handle_movement_input_event(frame, event).await? {
-            true
-        } else if self.handle_action_input_event(event, id.as_ref()).await? {
-            true
-        } else if can_compose {
-            self.handle_edit_initiating_input_event(event, id).await?
-        } else {
-            false
-        })
-    }
-
-    fn list_editor_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("esc", "close editor");
-        bindings.binding("enter", "send message");
-        util::list_editor_key_bindings_allowing_external_editing(bindings, |_| true);
-    }
-
-    fn handle_editor_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-        coming_from: Option<M::Id>,
-        parent: Option<M::Id>,
-    ) -> Reaction<M> {
-        // TODO Tab-completion
-        match event {
-            key!(Esc) => {
-                self.cursor = coming_from.map(Cursor::Msg).unwrap_or(Cursor::Bottom);
-                self.correction = Some(Correction::MakeCursorVisible);
-                return Reaction::Handled;
-            }
-
-            key!(Enter) => {
-                let content = self.editor.text();
-                if !content.trim().is_empty() {
-                    self.cursor = Cursor::Pseudo {
-                        coming_from,
-                        parent: parent.clone(),
-                    };
-                    return Reaction::Composed { parent, content };
-                }
-            }
-
-            _ => {
-                let handled = util::handle_editor_input_event_allowing_external_editing(
-                    &self.editor,
-                    terminal,
-                    crossterm_lock,
-                    event,
-                    |_| true,
-                );
-                match handled {
-                    Ok(true) => {}
-                    Ok(false) => return Reaction::NotHandled,
-                    Err(e) => return Reaction::ComposeError(e),
-                }
-            }
-        }
-
-        self.correction = Some(Correction::MakeCursorVisible);
-        Reaction::Handled
-    }
-
-    pub fn list_key_bindings(&self, bindings: &mut KeyBindingsList, can_compose: bool) {
-        bindings.heading("Chat");
-        match &self.cursor {
-            Cursor::Bottom | Cursor::Msg(_) => {
-                self.list_normal_key_bindings(bindings, can_compose);
-            }
-            Cursor::Editor { .. } => self.list_editor_key_bindings(bindings),
-            Cursor::Pseudo { .. } => {
-                self.list_normal_key_bindings(bindings, false);
-            }
-        }
-    }
-
-    async fn handle_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-        can_compose: bool,
-    ) -> Result<Reaction<M>, S::Error> {
-        Ok(match &self.cursor {
-            Cursor::Bottom => {
-                if self
-                    .handle_normal_input_event(terminal.frame(), event, can_compose, None)
-                    .await?
-                {
-                    Reaction::Handled
-                } else {
-                    Reaction::NotHandled
-                }
-            }
-            Cursor::Msg(id) => {
-                let id = id.clone();
-                if self
-                    .handle_normal_input_event(terminal.frame(), event, can_compose, Some(id))
-                    .await?
-                {
-                    Reaction::Handled
-                } else {
-                    Reaction::NotHandled
-                }
-            }
-            Cursor::Editor {
-                coming_from,
-                parent,
-            } => self.handle_editor_input_event(
-                terminal,
-                crossterm_lock,
-                event,
-                coming_from.clone(),
-                parent.clone(),
-            ),
-            Cursor::Pseudo { .. } => {
-                if self
-                    .handle_movement_input_event(terminal.frame(), event)
-                    .await?
-                {
-                    Reaction::Handled
-                } else {
-                    Reaction::NotHandled
-                }
-            }
-        })
-    }
-
-    fn cursor(&self) -> Option<M::Id> {
-        match &self.cursor {
-            Cursor::Msg(id) => Some(id.clone()),
-            Cursor::Bottom | Cursor::Editor { .. } | Cursor::Pseudo { .. } => None,
-        }
-    }
-
-    fn sent(&mut self, id: Option<M::Id>) {
-        if let Cursor::Pseudo { coming_from, .. } = &self.cursor {
-            if let Some(id) = id {
-                self.last_cursor = Cursor::Msg(id.clone());
-                self.cursor = Cursor::Msg(id);
-                self.editor.clear();
-            } else {
-                self.cursor = match coming_from {
-                    Some(id) => Cursor::Msg(id.clone()),
-                    None => Cursor::Bottom,
-                };
-            };
-        }
-    }
-}
-
-pub struct TreeViewState<M: Msg, S: MsgStore<M>>(Arc<Mutex<InnerTreeViewState<M, S>>>);
-
-impl<M: Msg, S: MsgStore<M>> TreeViewState<M, S> {
-    pub fn new(store: S) -> Self {
-        Self(Arc::new(Mutex::new(InnerTreeViewState::new(store))))
-    }
-
-    pub fn widget(&self, nick: String, focused: bool) -> TreeView<M, S> {
-        TreeView {
-            inner: self.0.clone(),
-            nick,
-            focused,
-        }
-    }
-
-    pub async fn list_key_bindings(&self, bindings: &mut KeyBindingsList, can_compose: bool) {
-        self.0.lock().await.list_key_bindings(bindings, can_compose);
-    }
-
-    pub async fn handle_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-        can_compose: bool,
-    ) -> Result<Reaction<M>, S::Error> {
-        self.0
-            .lock()
-            .await
-            .handle_input_event(terminal, crossterm_lock, event, can_compose)
-            .await
-    }
-
-    pub async fn cursor(&self) -> Option<M::Id> {
-        self.0.lock().await.cursor()
-    }
-
-    pub async fn sent(&mut self, id: Option<M::Id>) {
-        self.0.lock().await.sent(id)
-    }
-}
-
-////////////
-// Widget //
-////////////
-
-pub struct TreeView<M: Msg, S: MsgStore<M>> {
-    inner: Arc<Mutex<InnerTreeViewState<M, S>>>,
-    nick: String,
-    focused: bool,
-}
-
-#[async_trait]
-impl<M, S> Widget for TreeView<M, S>
-where
-    M: Msg + ChatMsg,
-    M::Id: Send + Sync,
-    S: MsgStore<M> + Send + Sync,
-    S::Error: fmt::Display,
-{
-    fn size(&self, _frame: &mut Frame, _max_width: Option<u16>, _max_height: Option<u16>) -> Size {
-        Size::ZERO
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        let mut guard = self.inner.lock().await;
-        let blocks = logging_unwrap!(guard.relayout(self.nick, self.focused, frame).await);
-
-        let size = frame.size();
-        for block in blocks.into_blocks().blocks {
-            frame.push(
-                Pos::new(0, block.top_line),
-                Size::new(size.width, block.height as u16),
-            );
-            block.widget.render(frame).await;
-            frame.pop();
-        }
-    }
-}

src/ui/chat/tree/cursor.rs

@@ -1,498 +0,0 @@
-//! Moving the cursor around.
-
-use std::collections::HashSet;
-
-use crate::store::{Msg, MsgStore, Tree};
-
-use super::{Correction, InnerTreeViewState};
-
-#[derive(Debug, Clone, Copy)]
-pub enum Cursor<I> {
-    Bottom,
-    Msg(I),
-    Editor {
-        coming_from: Option<I>,
-        parent: Option<I>,
-    },
-    Pseudo {
-        coming_from: Option<I>,
-        parent: Option<I>,
-    },
-}
-
-impl<I> Cursor<I> {
-    pub fn editor(coming_from: Option<I>, parent: Option<I>) -> Self {
-        Self::Editor {
-            coming_from,
-            parent,
-        }
-    }
-}
-
-impl<I: Eq> Cursor<I> {
-    pub fn refers_to(&self, id: &I) -> bool {
-        if let Self::Msg(own_id) = self {
-            own_id == id
-        } else {
-            false
-        }
-    }
-
-    pub fn refers_to_last_child_of(&self, id: &I) -> bool {
-        if let Self::Editor {
-            parent: Some(parent),
-            ..
-        }
-        | Self::Pseudo {
-            parent: Some(parent),
-            ..
-        } = self
-        {
-            parent == id
-        } else {
-            false
-        }
-    }
-}
-
-impl<M: Msg, S: MsgStore<M>> InnerTreeViewState<M, S> {
-    fn find_parent(tree: &Tree<M>, id: &mut M::Id) -> bool {
-        if let Some(parent) = tree.parent(id) {
-            *id = parent;
-            true
-        } else {
-            false
-        }
-    }
-
-    fn find_first_child(folded: &HashSet<M::Id>, tree: &Tree<M>, id: &mut M::Id) -> bool {
-        if folded.contains(id) {
-            return false;
-        }
-
-        if let Some(child) = tree.children(id).and_then(|c| c.first()) {
-            *id = child.clone();
-            true
-        } else {
-            false
-        }
-    }
-
-    fn find_last_child(folded: &HashSet<M::Id>, tree: &Tree<M>, id: &mut M::Id) -> bool {
-        if folded.contains(id) {
-            return false;
-        }
-
-        if let Some(child) = tree.children(id).and_then(|c| c.last()) {
-            *id = child.clone();
-            true
-        } else {
-            false
-        }
-    }
-
-    /// Move to the previous sibling, or don't move if this is not possible.
-    ///
-    /// Always stays at the same level of indentation.
-    async fn find_prev_sibling(
-        store: &S,
-        tree: &mut Tree<M>,
-        id: &mut M::Id,
-    ) -> Result<bool, S::Error> {
-        let moved = if let Some(prev_sibling) = tree.prev_sibling(id) {
-            *id = prev_sibling;
-            true
-        } else if tree.parent(id).is_none() {
-            // We're at the root of our tree, so we need to move to the root of
-            // the previous tree.
-            if let Some(prev_root_id) = store.prev_root_id(tree.root()).await? {
-                *tree = store.tree(&prev_root_id).await?;
-                *id = prev_root_id;
-                true
-            } else {
-                false
-            }
-        } else {
-            false
-        };
-        Ok(moved)
-    }
-
-    /// Move to the next sibling, or don't move if this is not possible.
-    ///
-    /// Always stays at the same level of indentation.
-    async fn find_next_sibling(
-        store: &S,
-        tree: &mut Tree<M>,
-        id: &mut M::Id,
-    ) -> Result<bool, S::Error> {
-        let moved = if let Some(next_sibling) = tree.next_sibling(id) {
-            *id = next_sibling;
-            true
-        } else if tree.parent(id).is_none() {
-            // We're at the root of our tree, so we need to move to the root of
-            // the next tree.
-            if let Some(next_root_id) = store.next_root_id(tree.root()).await? {
-                *tree = store.tree(&next_root_id).await?;
-                *id = next_root_id;
-                true
-            } else {
-                false
-            }
-        } else {
-            false
-        };
-        Ok(moved)
-    }
-
-    /// Move to the previous message, or don't move if this is not possible.
-    async fn find_prev_msg(
-        store: &S,
-        folded: &HashSet<M::Id>,
-        tree: &mut Tree<M>,
-        id: &mut M::Id,
-    ) -> Result<bool, S::Error> {
-        // Move to previous sibling, then to its last child
-        // If not possible, move to parent
-        let moved = if Self::find_prev_sibling(store, tree, id).await? {
-            while Self::find_last_child(folded, tree, id) {}
-            true
-        } else {
-            Self::find_parent(tree, id)
-        };
-        Ok(moved)
-    }
-
-    /// Move to the next message, or don't move if this is not possible.
-    async fn find_next_msg(
-        store: &S,
-        folded: &HashSet<M::Id>,
-        tree: &mut Tree<M>,
-        id: &mut M::Id,
-    ) -> Result<bool, S::Error> {
-        if Self::find_first_child(folded, tree, id) {
-            return Ok(true);
-        }
-
-        if Self::find_next_sibling(store, tree, id).await? {
-            return Ok(true);
-        }
-
-        // Temporary id to avoid modifying the original one if no parent-sibling
-        // can be found.
-        let mut tmp_id = id.clone();
-        while Self::find_parent(tree, &mut tmp_id) {
-            if Self::find_next_sibling(store, tree, &mut tmp_id).await? {
-                *id = tmp_id;
-                return Ok(true);
-            }
-        }
-
-        Ok(false)
-    }
-
-    pub async fn move_cursor_up(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Bottom | Cursor::Pseudo { parent: None, .. } => {
-                if let Some(last_root_id) = self.store.last_root_id().await? {
-                    let tree = self.store.tree(&last_root_id).await?;
-                    let mut id = last_root_id;
-                    while Self::find_last_child(&self.folded, &tree, &mut id) {}
-                    self.cursor = Cursor::Msg(id);
-                }
-            }
-            Cursor::Msg(msg) => {
-                let path = self.store.path(msg).await?;
-                let mut tree = self.store.tree(path.first()).await?;
-                Self::find_prev_msg(&self.store, &self.folded, &mut tree, msg).await?;
-            }
-            Cursor::Editor { .. } => {}
-            Cursor::Pseudo {
-                parent: Some(parent),
-                ..
-            } => {
-                let tree = self.store.tree(parent).await?;
-                let mut id = parent.clone();
-                while Self::find_last_child(&self.folded, &tree, &mut id) {}
-                self.cursor = Cursor::Msg(id);
-            }
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_down(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Msg(msg) => {
-                let path = self.store.path(msg).await?;
-                let mut tree = self.store.tree(path.first()).await?;
-                if !Self::find_next_msg(&self.store, &self.folded, &mut tree, msg).await? {
-                    self.cursor = Cursor::Bottom;
-                }
-            }
-            Cursor::Pseudo { parent: None, .. } => {
-                self.cursor = Cursor::Bottom;
-            }
-            Cursor::Pseudo {
-                parent: Some(parent),
-                ..
-            } => {
-                let mut tree = self.store.tree(parent).await?;
-                let mut id = parent.clone();
-                while Self::find_last_child(&self.folded, &tree, &mut id) {}
-                // Now we're at the previous message
-                if Self::find_next_msg(&self.store, &self.folded, &mut tree, &mut id).await? {
-                    self.cursor = Cursor::Msg(id);
-                } else {
-                    self.cursor = Cursor::Bottom;
-                }
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_up_sibling(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Bottom | Cursor::Pseudo { parent: None, .. } => {
-                if let Some(last_root_id) = self.store.last_root_id().await? {
-                    self.cursor = Cursor::Msg(last_root_id);
-                }
-            }
-            Cursor::Msg(msg) => {
-                let path = self.store.path(msg).await?;
-                let mut tree = self.store.tree(path.first()).await?;
-                Self::find_prev_sibling(&self.store, &mut tree, msg).await?;
-            }
-            Cursor::Editor { .. } => {}
-            Cursor::Pseudo {
-                parent: Some(parent),
-                ..
-            } => {
-                let path = self.store.path(parent).await?;
-                let tree = self.store.tree(path.first()).await?;
-                if let Some(children) = tree.children(parent) {
-                    if let Some(last_child) = children.last() {
-                        self.cursor = Cursor::Msg(last_child.clone());
-                    }
-                }
-            }
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_down_sibling(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Msg(msg) => {
-                let path = self.store.path(msg).await?;
-                let mut tree = self.store.tree(path.first()).await?;
-                if !Self::find_next_sibling(&self.store, &mut tree, msg).await?
-                    && tree.parent(msg).is_none()
-                {
-                    self.cursor = Cursor::Bottom;
-                }
-            }
-            Cursor::Pseudo { parent: None, .. } => {
-                self.cursor = Cursor::Bottom;
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_to_parent(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Pseudo {
-                parent: Some(parent),
-                ..
-            } => self.cursor = Cursor::Msg(parent.clone()),
-            Cursor::Msg(id) => {
-                // Could also be done via retrieving the path, but it doesn't
-                // really matter here
-                let tree = self.store.tree(id).await?;
-                Self::find_parent(&tree, id);
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_to_root(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Pseudo {
-                parent: Some(parent),
-                ..
-            } => {
-                let path = self.store.path(parent).await?;
-                self.cursor = Cursor::Msg(path.first().clone());
-            }
-            Cursor::Msg(msg) => {
-                let path = self.store.path(msg).await?;
-                *msg = path.first().clone();
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_older(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Msg(id) => {
-                if let Some(prev_id) = self.store.older_msg_id(id).await? {
-                    *id = prev_id;
-                }
-            }
-            Cursor::Bottom | Cursor::Pseudo { .. } => {
-                if let Some(id) = self.store.newest_msg_id().await? {
-                    self.cursor = Cursor::Msg(id);
-                }
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_newer(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Msg(id) => {
-                if let Some(prev_id) = self.store.newer_msg_id(id).await? {
-                    *id = prev_id;
-                } else {
-                    self.cursor = Cursor::Bottom;
-                }
-            }
-            Cursor::Pseudo { .. } => {
-                self.cursor = Cursor::Bottom;
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_older_unseen(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Msg(id) => {
-                if let Some(prev_id) = self.store.older_unseen_msg_id(id).await? {
-                    *id = prev_id;
-                }
-            }
-            Cursor::Bottom | Cursor::Pseudo { .. } => {
-                if let Some(id) = self.store.newest_unseen_msg_id().await? {
-                    self.cursor = Cursor::Msg(id);
-                }
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_newer_unseen(&mut self) -> Result<(), S::Error> {
-        match &mut self.cursor {
-            Cursor::Msg(id) => {
-                if let Some(prev_id) = self.store.newer_unseen_msg_id(id).await? {
-                    *id = prev_id;
-                } else {
-                    self.cursor = Cursor::Bottom;
-                }
-            }
-            Cursor::Pseudo { .. } => {
-                self.cursor = Cursor::Bottom;
-            }
-            _ => {}
-        }
-        self.correction = Some(Correction::MakeCursorVisible);
-        Ok(())
-    }
-
-    pub async fn move_cursor_to_top(&mut self) -> Result<(), S::Error> {
-        if let Some(first_root_id) = self.store.first_root_id().await? {
-            self.cursor = Cursor::Msg(first_root_id);
-            self.correction = Some(Correction::MakeCursorVisible);
-        }
-        Ok(())
-    }
-
-    pub async fn move_cursor_to_bottom(&mut self) {
-        self.cursor = Cursor::Bottom;
-        // Not really necessary; only here for consistency with other methods
-        self.correction = Some(Correction::MakeCursorVisible);
-    }
-
-    pub fn scroll_up(&mut self, amount: i32) {
-        self.scroll += amount;
-        self.correction = Some(Correction::MoveCursorToVisibleArea);
-    }
-
-    pub fn scroll_down(&mut self, amount: i32) {
-        self.scroll -= amount;
-        self.correction = Some(Correction::MoveCursorToVisibleArea);
-    }
-
-    pub fn center_cursor(&mut self) {
-        self.correction = Some(Correction::CenterCursor);
-    }
-
-    /// The outer `Option` shows whether a parent exists or not. The inner
-    /// `Option` shows if that parent has an id.
-    pub async fn parent_for_normal_reply(&self) -> Result<Option<Option<M::Id>>, S::Error> {
-        Ok(match &self.cursor {
-            Cursor::Bottom => Some(None),
-            Cursor::Msg(id) => {
-                let path = self.store.path(id).await?;
-                let tree = self.store.tree(path.first()).await?;
-
-                Some(Some(if tree.next_sibling(id).is_some() {
-                    // A reply to a message that has further siblings should be a
-                    // direct reply. An indirect reply might end up a lot further
-                    // down in the current conversation.
-                    id.clone()
-                } else if let Some(parent) = tree.parent(id) {
-                    // A reply to a message without younger siblings should be
-                    // an indirect reply so as not to create unnecessarily deep
-                    // threads. In the case that our message has children, this
-                    // might get a bit confusing. I'm not sure yet how well this
-                    // "smart" reply actually works in practice.
-                    parent
-                } else {
-                    // When replying to a top-level message, it makes sense to avoid
-                    // creating unnecessary new threads.
-                    id.clone()
-                }))
-            }
-            _ => None,
-        })
-    }
-
-    /// The outer `Option` shows whether a parent exists or not. The inner
-    /// `Option` shows if that parent has an id.
-    pub async fn parent_for_alternate_reply(&self) -> Result<Option<Option<M::Id>>, S::Error> {
-        Ok(match &self.cursor {
-            Cursor::Bottom => Some(None),
-            Cursor::Msg(id) => {
-                let path = self.store.path(id).await?;
-                let tree = self.store.tree(path.first()).await?;
-
-                Some(Some(if tree.next_sibling(id).is_none() {
-                    // The opposite of replying normally
-                    id.clone()
-                } else if let Some(parent) = tree.parent(id) {
-                    // The opposite of replying normally
-                    parent
-                } else {
-                    // The same as replying normally, still to avoid creating
-                    // unnecessary new threads
-                    id.clone()
-                }))
-            }
-            _ => None,
-        })
-    }
-}

src/ui/chat/tree/layout.rs

@@ -1,605 +0,0 @@
-use toss::frame::Frame;
-
-use crate::store::{Msg, MsgStore, Path, Tree};
-use crate::ui::chat::blocks::Block;
-use crate::ui::widgets::empty::Empty;
-use crate::ui::ChatMsg;
-
-use super::tree_blocks::{BlockId, Root, TreeBlocks};
-use super::{widgets, Correction, Cursor, InnerTreeViewState};
-
-const SCROLLOFF: i32 = 2;
-const MIN_CONTENT_HEIGHT: i32 = 10;
-
-fn scrolloff(height: i32) -> i32 {
-    let scrolloff = (height - MIN_CONTENT_HEIGHT).max(0) / 2;
-    scrolloff.min(SCROLLOFF)
-}
-
-struct Context {
-    nick: String,
-    focused: bool,
-}
-
-impl<M: Msg + ChatMsg, S: MsgStore<M>> InnerTreeViewState<M, S> {
-    async fn cursor_path(&self, cursor: &Cursor<M::Id>) -> Result<Path<M::Id>, S::Error> {
-        Ok(match cursor {
-            Cursor::Msg(id) => self.store.path(id).await?,
-            Cursor::Bottom
-            | Cursor::Editor { parent: None, .. }
-            | Cursor::Pseudo { parent: None, .. } => Path::new(vec![M::last_possible_id()]),
-            Cursor::Editor {
-                parent: Some(parent),
-                ..
-            }
-            | Cursor::Pseudo {
-                parent: Some(parent),
-                ..
-            } => {
-                let mut path = self.store.path(parent).await?;
-                path.push(M::last_possible_id());
-                path
-            }
-        })
-    }
-
-    fn make_path_visible(&mut self, path: &Path<M::Id>) {
-        for segment in path.parent_segments() {
-            self.folded.remove(segment);
-        }
-    }
-
-    fn cursor_line(&self, blocks: &TreeBlocks<M::Id>) -> i32 {
-        if let Cursor::Bottom = self.cursor {
-            // The value doesn't matter as it will always be ignored.
-            0
-        } else {
-            blocks
-                .blocks()
-                .find(&BlockId::from_cursor(&self.cursor))
-                .expect("no cursor found")
-                .top_line
-        }
-    }
-
-    fn contains_cursor(&self, blocks: &TreeBlocks<M::Id>) -> bool {
-        blocks
-            .blocks()
-            .find(&BlockId::from_cursor(&self.cursor))
-            .is_some()
-    }
-
-    fn editor_block(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        indent: usize,
-    ) -> Block<BlockId<M::Id>> {
-        let (widget, cursor_row) =
-            widgets::editor::<M>(frame.widthdb(), indent, &context.nick, &self.editor);
-        let cursor_row = cursor_row as i32;
-        Block::new(frame, BlockId::Cursor, widget).focus(cursor_row..cursor_row + 1)
-    }
-
-    fn pseudo_block(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        indent: usize,
-    ) -> Block<BlockId<M::Id>> {
-        let widget = widgets::pseudo::<M>(indent, &context.nick, &self.editor);
-        Block::new(frame, BlockId::Cursor, widget)
-    }
-
-    fn layout_subtree(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        tree: &Tree<M>,
-        indent: usize,
-        id: &M::Id,
-        blocks: &mut TreeBlocks<M::Id>,
-    ) {
-        // Ghost cursor in front, for positioning according to last cursor line
-        if self.last_cursor.refers_to(id) {
-            let block = Block::new(frame, BlockId::LastCursor, Empty::new());
-            blocks.blocks_mut().push_back(block);
-        }
-
-        // Last part of message body if message is folded
-        let folded = self.folded.contains(id);
-        let folded_info = if folded {
-            Some(tree.subtree_size(id)).filter(|s| *s > 0)
-        } else {
-            None
-        };
-
-        // Main message body
-        let highlighted = context.focused && self.cursor.refers_to(id);
-        let widget = if let Some(msg) = tree.msg(id) {
-            widgets::msg(highlighted, indent, msg, folded_info)
-        } else {
-            widgets::msg_placeholder(highlighted, indent, folded_info)
-        };
-        let block = Block::new(frame, BlockId::Msg(id.clone()), widget);
-        blocks.blocks_mut().push_back(block);
-
-        // Children, recursively
-        if !folded {
-            if let Some(children) = tree.children(id) {
-                for child in children {
-                    self.layout_subtree(context, frame, tree, indent + 1, child, blocks);
-                }
-            }
-        }
-
-        // Trailing ghost cursor, for positioning according to last cursor line
-        if self.last_cursor.refers_to_last_child_of(id) {
-            let block = Block::new(frame, BlockId::LastCursor, Empty::new());
-            blocks.blocks_mut().push_back(block);
-        }
-
-        // Trailing editor or pseudomessage
-        if self.cursor.refers_to_last_child_of(id) {
-            match self.cursor {
-                Cursor::Editor { .. } => {
-                    blocks
-                        .blocks_mut()
-                        .push_back(self.editor_block(context, frame, indent + 1))
-                }
-                Cursor::Pseudo { .. } => {
-                    blocks
-                        .blocks_mut()
-                        .push_back(self.pseudo_block(context, frame, indent + 1))
-                }
-                _ => {}
-            }
-        }
-    }
-
-    fn layout_tree(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        tree: Tree<M>,
-    ) -> TreeBlocks<M::Id> {
-        let root = Root::Tree(tree.root().clone());
-        let mut blocks = TreeBlocks::new(root.clone(), root);
-        self.layout_subtree(context, frame, &tree, 0, tree.root(), &mut blocks);
-        blocks
-    }
-
-    fn layout_bottom(&self, context: &Context, frame: &mut Frame) -> TreeBlocks<M::Id> {
-        let mut blocks = TreeBlocks::new(Root::Bottom, Root::Bottom);
-
-        // Ghost cursor, for positioning according to last cursor line
-        if let Cursor::Editor { parent: None, .. } | Cursor::Pseudo { parent: None, .. } =
-            self.last_cursor
-        {
-            let block = Block::new(frame, BlockId::LastCursor, Empty::new());
-            blocks.blocks_mut().push_back(block);
-        }
-
-        match self.cursor {
-            Cursor::Bottom => {
-                let block = Block::new(frame, BlockId::Cursor, Empty::new());
-                blocks.blocks_mut().push_back(block);
-            }
-            Cursor::Editor { parent: None, .. } => blocks
-                .blocks_mut()
-                .push_back(self.editor_block(context, frame, 0)),
-            Cursor::Pseudo { parent: None, .. } => blocks
-                .blocks_mut()
-                .push_back(self.pseudo_block(context, frame, 0)),
-            _ => {}
-        }
-
-        blocks
-    }
-
-    async fn expand_to_top(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        blocks: &mut TreeBlocks<M::Id>,
-    ) -> Result<(), S::Error> {
-        let top_line = 0;
-
-        while blocks.blocks().top_line > top_line {
-            let top_root = blocks.top_root();
-            let prev_root_id = match top_root {
-                Root::Bottom => self.store.last_root_id().await?,
-                Root::Tree(root_id) => self.store.prev_root_id(root_id).await?,
-            };
-            let prev_root_id = match prev_root_id {
-                Some(id) => id,
-                None => break,
-            };
-            let prev_tree = self.store.tree(&prev_root_id).await?;
-            blocks.prepend(self.layout_tree(context, frame, prev_tree));
-        }
-
-        Ok(())
-    }
-
-    async fn expand_to_bottom(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        blocks: &mut TreeBlocks<M::Id>,
-    ) -> Result<(), S::Error> {
-        let bottom_line = frame.size().height as i32 - 1;
-
-        while blocks.blocks().bottom_line < bottom_line {
-            let bottom_root = blocks.bottom_root();
-            let next_root_id = match bottom_root {
-                Root::Bottom => break,
-                Root::Tree(root_id) => self.store.next_root_id(root_id).await?,
-            };
-            if let Some(next_root_id) = next_root_id {
-                let next_tree = self.store.tree(&next_root_id).await?;
-                blocks.append(self.layout_tree(context, frame, next_tree));
-            } else {
-                blocks.append(self.layout_bottom(context, frame));
-            }
-        }
-
-        Ok(())
-    }
-
-    async fn fill_screen_and_clamp_scrolling(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        blocks: &mut TreeBlocks<M::Id>,
-    ) -> Result<(), S::Error> {
-        let top_line = 0;
-        let bottom_line = frame.size().height as i32 - 1;
-
-        self.expand_to_top(context, frame, blocks).await?;
-
-        if blocks.blocks().top_line > top_line {
-            blocks.blocks_mut().set_top_line(0);
-        }
-
-        self.expand_to_bottom(context, frame, blocks).await?;
-
-        if blocks.blocks().bottom_line < bottom_line {
-            blocks.blocks_mut().set_bottom_line(bottom_line);
-        }
-
-        self.expand_to_top(context, frame, blocks).await?;
-
-        Ok(())
-    }
-
-    async fn layout_last_cursor_seed(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        last_cursor_path: &Path<M::Id>,
-    ) -> Result<TreeBlocks<M::Id>, S::Error> {
-        Ok(match &self.last_cursor {
-            Cursor::Bottom => {
-                let mut blocks = self.layout_bottom(context, frame);
-
-                let bottom_line = frame.size().height as i32 - 1;
-                blocks.blocks_mut().set_bottom_line(bottom_line);
-
-                blocks
-            }
-            Cursor::Editor { parent: None, .. } | Cursor::Pseudo { parent: None, .. } => {
-                let mut blocks = self.layout_bottom(context, frame);
-
-                blocks
-                    .blocks_mut()
-                    .recalculate_offsets(&BlockId::LastCursor, self.last_cursor_line);
-
-                blocks
-            }
-            Cursor::Msg(_)
-            | Cursor::Editor {
-                parent: Some(_), ..
-            }
-            | Cursor::Pseudo {
-                parent: Some(_), ..
-            } => {
-                let root = last_cursor_path.first();
-                let tree = self.store.tree(root).await?;
-                let mut blocks = self.layout_tree(context, frame, tree);
-
-                blocks
-                    .blocks_mut()
-                    .recalculate_offsets(&BlockId::LastCursor, self.last_cursor_line);
-
-                blocks
-            }
-        })
-    }
-
-    async fn layout_cursor_seed(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        last_cursor_path: &Path<M::Id>,
-        cursor_path: &Path<M::Id>,
-    ) -> Result<TreeBlocks<M::Id>, S::Error> {
-        let bottom_line = frame.size().height as i32 - 1;
-
-        Ok(match &self.cursor {
-            Cursor::Bottom
-            | Cursor::Editor { parent: None, .. }
-            | Cursor::Pseudo { parent: None, .. } => {
-                let mut blocks = self.layout_bottom(context, frame);
-
-                blocks.blocks_mut().set_bottom_line(bottom_line);
-
-                blocks
-            }
-            Cursor::Msg(_)
-            | Cursor::Editor {
-                parent: Some(_), ..
-            }
-            | Cursor::Pseudo {
-                parent: Some(_), ..
-            } => {
-                let root = cursor_path.first();
-                let tree = self.store.tree(root).await?;
-                let mut blocks = self.layout_tree(context, frame, tree);
-
-                let cursor_above_last = cursor_path < last_cursor_path;
-                let cursor_line = if cursor_above_last { 0 } else { bottom_line };
-                blocks
-                    .blocks_mut()
-                    .recalculate_offsets(&BlockId::from_cursor(&self.cursor), cursor_line);
-
-                blocks
-            }
-        })
-    }
-
-    async fn layout_initial_seed(
-        &self,
-        context: &Context,
-        frame: &mut Frame,
-        last_cursor_path: &Path<M::Id>,
-        cursor_path: &Path<M::Id>,
-    ) -> Result<TreeBlocks<M::Id>, S::Error> {
-        if let Cursor::Bottom = self.cursor {
-            self.layout_cursor_seed(context, frame, last_cursor_path, cursor_path)
-                .await
-        } else {
-            self.layout_last_cursor_seed(context, frame, last_cursor_path)
-                .await
-        }
-    }
-
-    fn scroll_so_cursor_is_visible(&self, frame: &Frame, blocks: &mut TreeBlocks<M::Id>) {
-        if matches!(self.cursor, Cursor::Bottom) {
-            return; // Cursor is locked to bottom
-        }
-
-        let block = blocks
-            .blocks()
-            .find(&BlockId::from_cursor(&self.cursor))
-            .expect("no cursor found");
-
-        let height = frame.size().height as i32;
-        let scrolloff = scrolloff(height);
-
-        let min_line = -block.focus.start + scrolloff;
-        let max_line = height - block.focus.end - scrolloff;
-
-        // If the message is higher than the available space, the top of the
-        // message should always be visible. I'm not using top_line.clamp(...)
-        // because the order of the min and max matters.
-        let top_line = block.top_line;
-        #[allow(clippy::manual_clamp)]
-        let new_top_line = top_line.min(max_line).max(min_line);
-        if new_top_line != top_line {
-            blocks.blocks_mut().offset(new_top_line - top_line);
-        }
-    }
-
-    fn scroll_so_cursor_is_centered(&self, frame: &Frame, blocks: &mut TreeBlocks<M::Id>) {
-        if matches!(self.cursor, Cursor::Bottom) {
-            return; // Cursor is locked to bottom
-        }
-
-        let block = blocks
-            .blocks()
-            .find(&BlockId::from_cursor(&self.cursor))
-            .expect("no cursor found");
-
-        let height = frame.size().height as i32;
-        let scrolloff = scrolloff(height);
-
-        let min_line = -block.focus.start + scrolloff;
-        let max_line = height - block.focus.end - scrolloff;
-
-        // If the message is higher than the available space, the top of the
-        // message should always be visible. I'm not using top_line.clamp(...)
-        // because the order of the min and max matters.
-        let top_line = block.top_line;
-        let new_top_line = (height - block.height) / 2;
-        #[allow(clippy::manual_clamp)]
-        let new_top_line = new_top_line.min(max_line).max(min_line);
-        if new_top_line != top_line {
-            blocks.blocks_mut().offset(new_top_line - top_line);
-        }
-    }
-
-    /// Try to obtain a [`Cursor::Msg`] pointing to the block.
-    fn msg_id(block: &Block<BlockId<M::Id>>) -> Option<M::Id> {
-        match &block.id {
-            BlockId::Msg(id) => Some(id.clone()),
-            _ => None,
-        }
-    }
-
-    fn visible(block: &Block<BlockId<M::Id>>, first_line: i32, last_line: i32) -> bool {
-        (first_line + 1 - block.height..=last_line).contains(&block.top_line)
-    }
-
-    fn move_cursor_so_it_is_visible(
-        &mut self,
-        frame: &Frame,
-        blocks: &TreeBlocks<M::Id>,
-    ) -> Option<M::Id> {
-        if !matches!(self.cursor, Cursor::Bottom | Cursor::Msg(_)) {
-            // In all other cases, there is no need to make the cursor visible
-            // since scrolling behaves differently enough.
-            return None;
-        }
-
-        let height = frame.size().height as i32;
-        let scrolloff = scrolloff(height);
-
-        let first_line = scrolloff;
-        let last_line = height - 1 - scrolloff;
-
-        let new_cursor = if matches!(self.cursor, Cursor::Bottom) {
-            blocks
-                .blocks()
-                .iter()
-                .rev()
-                .filter(|b| Self::visible(b, first_line, last_line))
-                .find_map(Self::msg_id)
-        } else {
-            let block = blocks
-                .blocks()
-                .find(&BlockId::from_cursor(&self.cursor))
-                .expect("no cursor found");
-
-            if Self::visible(block, first_line, last_line) {
-                return None;
-            } else if block.top_line < first_line {
-                blocks
-                    .blocks()
-                    .iter()
-                    .filter(|b| Self::visible(b, first_line, last_line))
-                    .find_map(Self::msg_id)
-            } else {
-                blocks
-                    .blocks()
-                    .iter()
-                    .rev()
-                    .filter(|b| Self::visible(b, first_line, last_line))
-                    .find_map(Self::msg_id)
-            }
-        };
-
-        if let Some(id) = new_cursor {
-            self.cursor = Cursor::Msg(id.clone());
-            Some(id)
-        } else {
-            None
-        }
-    }
-
-    fn visible_msgs(frame: &Frame, blocks: &TreeBlocks<M::Id>) -> Vec<M::Id> {
-        let height: i32 = frame.size().height.into();
-        let first_line = 0;
-        let last_line = first_line + height - 1;
-
-        let mut result = vec![];
-        for block in blocks.blocks().iter() {
-            if Self::visible(block, first_line, last_line) {
-                if let BlockId::Msg(id) = &block.id {
-                    result.push(id.clone());
-                }
-            }
-        }
-
-        result
-    }
-
-    pub async fn relayout(
-        &mut self,
-        nick: String,
-        focused: bool,
-        frame: &mut Frame,
-    ) -> Result<TreeBlocks<M::Id>, S::Error> {
-        // The basic idea is this:
-        //
-        // First, layout a full screen of blocks around self.last_cursor, using
-        // self.last_cursor_line for offset positioning. At this point, any
-        // outstanding scrolling is performed as well.
-        //
-        // Then, check if self.cursor is somewhere in these blocks. If it is, we
-        // now know the position of our own cursor. If it is not, it has jumped
-        // too far away from self.last_cursor and we'll need to render a new
-        // full screen of blocks around self.cursor before proceeding, using the
-        // cursor paths to determine the position of self.cursor on the screen.
-        //
-        // Now that we have a more-or-less accurate screen position of
-        // self.cursor, we can perform the actual cursor logic, i.e. make the
-        // cursor visible or move it so it is visible.
-        //
-        // This entire process is complicated by the different kinds of cursors.
-
-        let context = Context { nick, focused };
-
-        let last_cursor_path = self.cursor_path(&self.last_cursor).await?;
-        let cursor_path = self.cursor_path(&self.cursor).await?;
-        self.make_path_visible(&cursor_path);
-
-        let mut blocks = self
-            .layout_initial_seed(&context, frame, &last_cursor_path, &cursor_path)
-            .await?;
-        blocks.blocks_mut().offset(self.scroll);
-        self.fill_screen_and_clamp_scrolling(&context, frame, &mut blocks)
-            .await?;
-
-        if !self.contains_cursor(&blocks) {
-            blocks = self
-                .layout_cursor_seed(&context, frame, &last_cursor_path, &cursor_path)
-                .await?;
-            self.fill_screen_and_clamp_scrolling(&context, frame, &mut blocks)
-                .await?;
-        }
-
-        match self.correction {
-            Some(Correction::MakeCursorVisible) => {
-                self.scroll_so_cursor_is_visible(frame, &mut blocks);
-                self.fill_screen_and_clamp_scrolling(&context, frame, &mut blocks)
-                    .await?;
-            }
-            Some(Correction::MoveCursorToVisibleArea) => {
-                let new_cursor_msg_id = self.move_cursor_so_it_is_visible(frame, &blocks);
-                if let Some(cursor_msg_id) = new_cursor_msg_id {
-                    // Moving the cursor invalidates our current blocks, so we sadly
-                    // have to either perform an expensive operation or redraw the
-                    // entire thing. I'm choosing the latter for now.
-
-                    self.last_cursor = self.cursor.clone();
-                    self.last_cursor_line = self.cursor_line(&blocks);
-                    self.last_visible_msgs = Self::visible_msgs(frame, &blocks);
-                    self.scroll = 0;
-                    self.correction = None;
-
-                    let last_cursor_path = self.store.path(&cursor_msg_id).await?;
-                    blocks = self
-                        .layout_last_cursor_seed(&context, frame, &last_cursor_path)
-                        .await?;
-                    self.fill_screen_and_clamp_scrolling(&context, frame, &mut blocks)
-                        .await?;
-                }
-            }
-            Some(Correction::CenterCursor) => {
-                self.scroll_so_cursor_is_centered(frame, &mut blocks);
-                self.fill_screen_and_clamp_scrolling(&context, frame, &mut blocks)
-                    .await?;
-            }
-            None => {}
-        }
-
-        self.last_cursor = self.cursor.clone();
-        self.last_cursor_line = self.cursor_line(&blocks);
-        self.last_visible_msgs = Self::visible_msgs(frame, &blocks);
-        self.scroll = 0;
-        self.correction = None;
-
-        Ok(blocks)
-    }
-}

src/ui/chat/tree/tree_blocks.rs

@@ -1,71 +0,0 @@
-use crate::ui::chat::blocks::Blocks;
-
-use super::Cursor;
-
-#[derive(Debug, Clone, Copy, PartialEq, Eq)]
-pub enum BlockId<I> {
-    Msg(I),
-    Cursor,
-    LastCursor,
-}
-
-impl<I: Clone> BlockId<I> {
-    pub fn from_cursor(cursor: &Cursor<I>) -> Self {
-        match cursor {
-            Cursor::Msg(id) => Self::Msg(id.clone()),
-            _ => Self::Cursor,
-        }
-    }
-}
-
-#[derive(Debug, Clone, Copy)]
-pub enum Root<I> {
-    Bottom,
-    Tree(I),
-}
-
-pub struct TreeBlocks<I> {
-    blocks: Blocks<BlockId<I>>,
-    top_root: Root<I>,
-    bottom_root: Root<I>,
-}
-
-impl<I> TreeBlocks<I> {
-    pub fn new(top_root: Root<I>, bottom_root: Root<I>) -> Self {
-        Self {
-            blocks: Blocks::new(),
-            top_root,
-            bottom_root,
-        }
-    }
-
-    pub fn blocks(&self) -> &Blocks<BlockId<I>> {
-        &self.blocks
-    }
-
-    pub fn blocks_mut(&mut self) -> &mut Blocks<BlockId<I>> {
-        &mut self.blocks
-    }
-
-    pub fn into_blocks(self) -> Blocks<BlockId<I>> {
-        self.blocks
-    }
-
-    pub fn top_root(&self) -> &Root<I> {
-        &self.top_root
-    }
-
-    pub fn bottom_root(&self) -> &Root<I> {
-        &self.bottom_root
-    }
-
-    pub fn prepend(&mut self, other: Self) {
-        self.blocks.prepend(other.blocks);
-        self.top_root = other.top_root;
-    }
-
-    pub fn append(&mut self, other: Self) {
-        self.blocks.append(other.blocks);
-        self.bottom_root = other.bottom_root;
-    }
-}

src/ui/chat/tree/widgets.rs

@@ -1,160 +0,0 @@
-mod indent;
-mod seen;
-mod time;
-
-use crossterm::style::{ContentStyle, Stylize};
-use toss::styled::Styled;
-use toss::widthdb::WidthDb;
-
-use super::super::ChatMsg;
-use crate::store::Msg;
-use crate::ui::widgets::editor::EditorState;
-use crate::ui::widgets::join::{HJoin, Segment};
-use crate::ui::widgets::layer::Layer;
-use crate::ui::widgets::padding::Padding;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-use self::indent::Indent;
-
-pub const PLACEHOLDER: &str = "[...]";
-
-pub fn style_placeholder() -> ContentStyle {
-    ContentStyle::default().dark_grey()
-}
-
-fn style_time(highlighted: bool) -> ContentStyle {
-    if highlighted {
-        ContentStyle::default().black().on_white()
-    } else {
-        ContentStyle::default().grey()
-    }
-}
-
-fn style_indent(highlighted: bool) -> ContentStyle {
-    if highlighted {
-        ContentStyle::default().black().on_white()
-    } else {
-        ContentStyle::default().dark_grey()
-    }
-}
-
-fn style_info() -> ContentStyle {
-    ContentStyle::default().italic().dark_grey()
-}
-
-fn style_editor_highlight() -> ContentStyle {
-    ContentStyle::default().black().on_cyan()
-}
-
-fn style_pseudo_highlight() -> ContentStyle {
-    ContentStyle::default().black().on_yellow()
-}
-
-pub fn msg<M: Msg + ChatMsg>(
-    highlighted: bool,
-    indent: usize,
-    msg: &M,
-    folded_info: Option<usize>,
-) -> BoxedWidget {
-    let (nick, mut content) = msg.styled();
-
-    if let Some(amount) = folded_info {
-        content = content
-            .then_plain("\n")
-            .then(format!("[{amount} more]"), style_info());
-    }
-
-    HJoin::new(vec![
-        Segment::new(seen::widget(msg.seen())),
-        Segment::new(
-            Padding::new(time::widget(Some(msg.time()), style_time(highlighted)))
-                .stretch(true)
-                .right(1),
-        ),
-        Segment::new(Indent::new(indent, style_indent(highlighted))),
-        Segment::new(Layer::new(vec![
-            Indent::new(1, style_indent(false)).into(),
-            Padding::new(Text::new(nick)).right(1).into(),
-        ])),
-        // TODO Minimum content width
-        // TODO Minimizing and maximizing messages
-        Segment::new(Text::new(content).wrap(true)).priority(1),
-    ])
-    .into()
-}
-
-pub fn msg_placeholder(
-    highlighted: bool,
-    indent: usize,
-    folded_info: Option<usize>,
-) -> BoxedWidget {
-    let mut content = Styled::new(PLACEHOLDER, style_placeholder());
-
-    if let Some(amount) = folded_info {
-        content = content
-            .then_plain("\n")
-            .then(format!("[{amount} more]"), style_info());
-    }
-
-    HJoin::new(vec![
-        Segment::new(seen::widget(true)),
-        Segment::new(
-            Padding::new(time::widget(None, style_time(highlighted)))
-                .stretch(true)
-                .right(1),
-        ),
-        Segment::new(Indent::new(indent, style_indent(highlighted))),
-        Segment::new(Text::new(content)),
-    ])
-    .into()
-}
-
-pub fn editor<M: ChatMsg>(
-    widthdb: &mut WidthDb,
-    indent: usize,
-    nick: &str,
-    editor: &EditorState,
-) -> (BoxedWidget, usize) {
-    let (nick, content) = M::edit(nick, &editor.text());
-    let editor = editor.widget().highlight(|_| content);
-    let cursor_row = editor.cursor_row(widthdb);
-
-    let widget = HJoin::new(vec![
-        Segment::new(seen::widget(true)),
-        Segment::new(
-            Padding::new(time::widget(None, style_editor_highlight()))
-                .stretch(true)
-                .right(1),
-        ),
-        Segment::new(Indent::new(indent, style_editor_highlight())),
-        Segment::new(Layer::new(vec![
-            Indent::new(1, style_indent(false)).into(),
-            Padding::new(Text::new(nick)).right(1).into(),
-        ])),
-        Segment::new(editor).priority(1).expanding(true),
-    ])
-    .into();
-
-    (widget, cursor_row)
-}
-
-pub fn pseudo<M: ChatMsg>(indent: usize, nick: &str, editor: &EditorState) -> BoxedWidget {
-    let (nick, content) = M::edit(nick, &editor.text());
-
-    HJoin::new(vec![
-        Segment::new(seen::widget(true)),
-        Segment::new(
-            Padding::new(time::widget(None, style_pseudo_highlight()))
-                .stretch(true)
-                .right(1),
-        ),
-        Segment::new(Indent::new(indent, style_pseudo_highlight())),
-        Segment::new(Layer::new(vec![
-            Indent::new(1, style_indent(false)).into(),
-            Padding::new(Text::new(nick)).right(1).into(),
-        ])),
-        Segment::new(Text::new(content).wrap(true)).priority(1),
-    ])
-    .into()
-}

src/ui/chat/tree/widgets/indent.rs

@@ -1,37 +0,0 @@
-use async_trait::async_trait;
-use crossterm::style::ContentStyle;
-use toss::frame::{Frame, Pos, Size};
-
-use crate::ui::widgets::Widget;
-
-pub const INDENT: &str = "│ ";
-pub const INDENT_WIDTH: usize = 2;
-
-pub struct Indent {
-    level: usize,
-    style: ContentStyle,
-}
-
-impl Indent {
-    pub fn new(level: usize, style: ContentStyle) -> Self {
-        Self { level, style }
-    }
-}
-
-#[async_trait]
-impl Widget for Indent {
-    fn size(&self, _frame: &mut Frame, _max_width: Option<u16>, _max_height: Option<u16>) -> Size {
-        Size::new((INDENT_WIDTH * self.level) as u16, 0)
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        let size = frame.size();
-
-        for y in 0..size.height {
-            frame.write(
-                Pos::new(0, y.into()),
-                (INDENT.repeat(self.level), self.style),
-            )
-        }
-    }
-}

src/ui/chat/tree/widgets/seen.rs

@@ -1,24 +0,0 @@
-use crossterm::style::{ContentStyle, Stylize};
-
-use crate::ui::widgets::background::Background;
-use crate::ui::widgets::empty::Empty;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-const UNSEEN: &str = "*";
-const WIDTH: u16 = 1;
-
-fn seen_style() -> ContentStyle {
-    ContentStyle::default().black().on_green()
-}
-
-pub fn widget(seen: bool) -> BoxedWidget {
-    if seen {
-        Empty::new().width(WIDTH).into()
-    } else {
-        let style = seen_style();
-        Background::new(Text::new((UNSEEN, style)))
-            .style(style)
-            .into()
-    }
-}

src/ui/chat/tree/widgets/time.rs

@@ -1,25 +0,0 @@
-use crossterm::style::ContentStyle;
-use time::format_description::FormatItem;
-use time::macros::format_description;
-use time::OffsetDateTime;
-
-use crate::ui::widgets::background::Background;
-use crate::ui::widgets::empty::Empty;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-const TIME_FORMAT: &[FormatItem<'_>] = format_description!("[year]-[month]-[day] [hour]:[minute]");
-const TIME_WIDTH: u16 = 16;
-
-pub fn widget(time: Option<OffsetDateTime>, style: ContentStyle) -> BoxedWidget {
-    if let Some(time) = time {
-        let text = time.format(TIME_FORMAT).expect("could not format time");
-        Background::new(Text::new((text, style)))
-            .style(style)
-            .into()
-    } else {
-        Background::new(Empty::new().width(TIME_WIDTH))
-            .style(style)
-            .into()
-    }
-}

src/ui/euph/account.rs

@@ -1,209 +0,0 @@
-use crossterm::style::{ContentStyle, Stylize};
-use euphoxide::api::PersonalAccountView;
-use euphoxide::conn;
-use toss::terminal::Terminal;
-
-use crate::euph::{self, Room};
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::util;
-use crate::ui::widgets::editor::EditorState;
-use crate::ui::widgets::empty::Empty;
-use crate::ui::widgets::join::{HJoin, Segment, VJoin};
-use crate::ui::widgets::popup::Popup;
-use crate::ui::widgets::resize::Resize;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-#[derive(Debug, Clone, Copy, PartialEq, Eq)]
-enum Focus {
-    Email,
-    Password,
-}
-
-pub struct LoggedOut {
-    focus: Focus,
-    email: EditorState,
-    password: EditorState,
-}
-
-impl LoggedOut {
-    fn new() -> Self {
-        Self {
-            focus: Focus::Email,
-            email: EditorState::new(),
-            password: EditorState::new(),
-        }
-    }
-
-    fn widget(&self) -> BoxedWidget {
-        let bold = ContentStyle::default().bold();
-        VJoin::new(vec![
-            Segment::new(Text::new(("Not logged in", bold.yellow()))),
-            Segment::new(Empty::new().height(1)),
-            Segment::new(HJoin::new(vec![
-                Segment::new(Text::new(("Email address:", bold))),
-                Segment::new(Empty::new().width(1)),
-                Segment::new(self.email.widget().focus(self.focus == Focus::Email)),
-            ])),
-            Segment::new(HJoin::new(vec![
-                Segment::new(Text::new(("Password:", bold))),
-                Segment::new(Empty::new().width(5 + 1)),
-                Segment::new(
-                    self.password
-                        .widget()
-                        .focus(self.focus == Focus::Password)
-                        .hidden(),
-                ),
-            ])),
-        ])
-        .into()
-    }
-}
-
-pub struct LoggedIn(PersonalAccountView);
-
-impl LoggedIn {
-    fn widget(&self) -> BoxedWidget {
-        let bold = ContentStyle::default().bold();
-        VJoin::new(vec![
-            Segment::new(Text::new(("Logged in", bold.green()))),
-            Segment::new(Empty::new().height(1)),
-            Segment::new(HJoin::new(vec![
-                Segment::new(Text::new(("Email address:", bold))),
-                Segment::new(Empty::new().width(1)),
-                Segment::new(Text::new((&self.0.email,))),
-            ])),
-        ])
-        .into()
-    }
-}
-
-pub enum AccountUiState {
-    LoggedOut(LoggedOut),
-    LoggedIn(LoggedIn),
-}
-
-pub enum EventResult {
-    NotHandled,
-    Handled,
-    ResetState,
-}
-
-impl AccountUiState {
-    pub fn new() -> Self {
-        Self::LoggedOut(LoggedOut::new())
-    }
-
-    /// Returns `false` if the account UI should not be displayed any longer.
-    pub fn stabilize(&mut self, state: Option<&euph::State>) -> bool {
-        if let Some(euph::State::Connected(_, conn::State::Joined(state))) = state {
-            match (&self, &state.account) {
-                (Self::LoggedOut(_), Some(view)) => *self = Self::LoggedIn(LoggedIn(view.clone())),
-                (Self::LoggedIn(_), None) => *self = Self::LoggedOut(LoggedOut::new()),
-                _ => {}
-            }
-            true
-        } else {
-            false
-        }
-    }
-
-    pub fn widget(&self) -> BoxedWidget {
-        let inner = match self {
-            Self::LoggedOut(logged_out) => logged_out.widget(),
-            Self::LoggedIn(logged_in) => logged_in.widget(),
-        };
-        Popup::new(Resize::new(inner).min_width(40))
-            .title("Account")
-            .build()
-    }
-
-    pub fn list_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("esc", "close account ui");
-
-        match self {
-            Self::LoggedOut(logged_out) => {
-                match logged_out.focus {
-                    Focus::Email => bindings.binding("enter", "focus on password"),
-                    Focus::Password => bindings.binding("enter", "log in"),
-                }
-                bindings.binding("tab", "switch focus");
-                util::list_editor_key_bindings(bindings, |c| c != '\n');
-            }
-            Self::LoggedIn(_) => bindings.binding("L", "log out"),
-        }
-    }
-
-    pub fn handle_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        event: &InputEvent,
-        room: &Option<Room>,
-    ) -> EventResult {
-        if let key!(Esc) = event {
-            return EventResult::ResetState;
-        }
-
-        match self {
-            Self::LoggedOut(logged_out) => {
-                if let key!(Tab) = event {
-                    logged_out.focus = match logged_out.focus {
-                        Focus::Email => Focus::Password,
-                        Focus::Password => Focus::Email,
-                    };
-                    return EventResult::Handled;
-                }
-
-                match logged_out.focus {
-                    Focus::Email => {
-                        if let key!(Enter) = event {
-                            logged_out.focus = Focus::Password;
-                            return EventResult::Handled;
-                        }
-
-                        if util::handle_editor_input_event(
-                            &logged_out.email,
-                            terminal,
-                            event,
-                            |c| c != '\n',
-                        ) {
-                            EventResult::Handled
-                        } else {
-                            EventResult::NotHandled
-                        }
-                    }
-                    Focus::Password => {
-                        if let key!(Enter) = event {
-                            if let Some(room) = room {
-                                let _ =
-                                    room.login(logged_out.email.text(), logged_out.password.text());
-                            }
-                            return EventResult::Handled;
-                        }
-
-                        if util::handle_editor_input_event(
-                            &logged_out.password,
-                            terminal,
-                            event,
-                            |c| c != '\n',
-                        ) {
-                            EventResult::Handled
-                        } else {
-                            EventResult::NotHandled
-                        }
-                    }
-                }
-            }
-            Self::LoggedIn(_) => {
-                if let key!('L') = event {
-                    if let Some(room) = room {
-                        let _ = room.logout();
-                    }
-                    EventResult::Handled
-                } else {
-                    EventResult::NotHandled
-                }
-            }
-        }
-    }
-}

src/ui/euph/auth.rs

@@ -1,54 +0,0 @@
-use toss::terminal::Terminal;
-
-use crate::euph::Room;
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::util;
-use crate::ui::widgets::editor::EditorState;
-use crate::ui::widgets::popup::Popup;
-use crate::ui::widgets::BoxedWidget;
-
-pub fn new() -> EditorState {
-    EditorState::new()
-}
-
-pub fn widget(editor: &EditorState) -> BoxedWidget {
-    Popup::new(editor.widget().hidden())
-        .title("Enter password")
-        .build()
-}
-
-pub fn list_key_bindings(bindings: &mut KeyBindingsList) {
-    bindings.binding("esc", "abort");
-    bindings.binding("enter", "authenticate");
-    util::list_editor_key_bindings(bindings, |_| true);
-}
-
-pub enum EventResult {
-    NotHandled,
-    Handled,
-    ResetState,
-}
-
-pub fn handle_input_event(
-    terminal: &mut Terminal,
-    event: &InputEvent,
-    room: &Option<Room>,
-    editor: &EditorState,
-) -> EventResult {
-    match event {
-        key!(Esc) => EventResult::ResetState,
-        key!(Enter) => {
-            if let Some(room) = &room {
-                let _ = room.auth(editor.text());
-            }
-            EventResult::ResetState
-        }
-        _ => {
-            if util::handle_editor_input_event(editor, terminal, event, |_| true) {
-                EventResult::Handled
-            } else {
-                EventResult::NotHandled
-            }
-        }
-    }
-}

src/ui/euph/links.rs

@@ -1,138 +0,0 @@
-use std::io;
-
-use crossterm::style::{ContentStyle, Stylize};
-use linkify::{LinkFinder, LinkKind};
-use toss::styled::Styled;
-
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::widgets::list::ListState;
-use crate::ui::widgets::popup::Popup;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-pub struct LinksState {
-    links: Vec<String>,
-    list: ListState<usize>,
-}
-
-pub enum EventResult {
-    NotHandled,
-    Handled,
-    Close,
-    ErrorOpeningLink { link: String, error: io::Error },
-}
-
-const NUMBER_KEYS: [char; 10] = ['1', '2', '3', '4', '5', '6', '7', '8', '9', '0'];
-
-impl LinksState {
-    pub fn new(content: &str) -> Self {
-        let links = LinkFinder::new()
-            .url_must_have_scheme(false)
-            .kinds(&[LinkKind::Url])
-            .links(content)
-            .map(|l| l.as_str().to_string())
-            .collect();
-
-        Self {
-            links,
-            list: ListState::new(),
-        }
-    }
-
-    pub fn widget(&self) -> BoxedWidget {
-        let style_selected = ContentStyle::default().black().on_white();
-
-        let mut list = self.list.widget().focus(true);
-        if self.links.is_empty() {
-            list.add_unsel(Text::new((
-                "No links found",
-                ContentStyle::default().grey().italic(),
-            )))
-        }
-        for (id, link) in self.links.iter().enumerate() {
-            let (line_normal, line_selected) = if let Some(number_key) = NUMBER_KEYS.get(id) {
-                (
-                    Styled::new(
-                        format!("[{number_key}]"),
-                        ContentStyle::default().dark_grey().bold(),
-                    )
-                    .then_plain(" ")
-                    .then_plain(link),
-                    Styled::new(format!("[{number_key}]"), style_selected.bold())
-                        .then(" ", style_selected)
-                        .then(link, style_selected),
-                )
-            } else {
-                (
-                    Styled::new_plain(format!("    {link}")),
-                    Styled::new(format!("    {link}"), style_selected),
-                )
-            };
-
-            list.add_sel(id, Text::new(line_normal), Text::new(line_selected));
-        }
-
-        Popup::new(list).title("Links").build()
-    }
-
-    fn open_link_by_id(&self, id: usize) -> EventResult {
-        if let Some(link) = self.links.get(id) {
-            // The `http://` or `https://` schema is necessary for open::that to
-            // successfully open the link in the browser.
-            let link = if link.starts_with("http://") || link.starts_with("https://") {
-                link.clone()
-            } else {
-                format!("https://{link}")
-            };
-
-            if let Err(error) = open::that(&link) {
-                return EventResult::ErrorOpeningLink { link, error };
-            }
-        }
-        EventResult::Handled
-    }
-
-    fn open_link(&self) -> EventResult {
-        if let Some(id) = self.list.cursor() {
-            self.open_link_by_id(id)
-        } else {
-            EventResult::Handled
-        }
-    }
-
-    pub fn list_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.binding("esc", "close links popup");
-        bindings.binding("j/k, ↓/↑", "move cursor up/down");
-        bindings.binding("g, home", "move cursor to top");
-        bindings.binding("G, end", "move cursor to bottom");
-        bindings.binding("ctrl+y/e", "scroll up/down");
-        bindings.empty();
-        bindings.binding("enter", "open selected link");
-        bindings.binding("1,2,...", "open link by position");
-    }
-
-    pub fn handle_input_event(&mut self, event: &InputEvent) -> EventResult {
-        match event {
-            key!(Esc) => return EventResult::Close,
-            key!('k') | key!(Up) => self.list.move_cursor_up(),
-            key!('j') | key!(Down) => self.list.move_cursor_down(),
-            key!('g') | key!(Home) => self.list.move_cursor_to_top(),
-            key!('G') | key!(End) => self.list.move_cursor_to_bottom(),
-            key!(Ctrl + 'y') => self.list.scroll_up(1),
-            key!(Ctrl + 'e') => self.list.scroll_down(1),
-            key!(Enter) => return self.open_link(),
-            key!('1') => return self.open_link_by_id(0),
-            key!('2') => return self.open_link_by_id(1),
-            key!('3') => return self.open_link_by_id(2),
-            key!('4') => return self.open_link_by_id(3),
-            key!('5') => return self.open_link_by_id(4),
-            key!('6') => return self.open_link_by_id(5),
-            key!('7') => return self.open_link_by_id(6),
-            key!('8') => return self.open_link_by_id(7),
-            key!('9') => return self.open_link_by_id(8),
-            key!('0') => return self.open_link_by_id(9),
-            _ => return EventResult::NotHandled,
-        }
-        EventResult::Handled
-    }
-}

src/ui/euph/nick.rs

@@ -1,65 +0,0 @@
-use crossterm::style::ContentStyle;
-use euphoxide::conn::Joined;
-use toss::terminal::Terminal;
-
-use crate::euph::{self, Room};
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::util;
-use crate::ui::widgets::editor::EditorState;
-use crate::ui::widgets::padding::Padding;
-use crate::ui::widgets::popup::Popup;
-use crate::ui::widgets::BoxedWidget;
-
-pub fn new(joined: Joined) -> EditorState {
-    EditorState::with_initial_text(joined.session.name)
-}
-
-pub fn widget(editor: &EditorState) -> BoxedWidget {
-    let editor = editor
-        .widget()
-        .highlight(|s| euph::style_nick_exact(s, ContentStyle::default()));
-    Popup::new(Padding::new(editor).left(1))
-        .title("Choose nick")
-        .inner_padding(false)
-        .build()
-}
-
-fn nick_char(c: char) -> bool {
-    c != '\n'
-}
-
-pub fn list_key_bindings(bindings: &mut KeyBindingsList) {
-    bindings.binding("esc", "abort");
-    bindings.binding("enter", "set nick");
-    util::list_editor_key_bindings(bindings, nick_char);
-}
-
-pub enum EventResult {
-    NotHandled,
-    Handled,
-    ResetState,
-}
-
-pub fn handle_input_event(
-    terminal: &mut Terminal,
-    event: &InputEvent,
-    room: &Option<Room>,
-    editor: &EditorState,
-) -> EventResult {
-    match event {
-        key!(Esc) => EventResult::ResetState,
-        key!(Enter) => {
-            if let Some(room) = &room {
-                let _ = room.nick(editor.text());
-            }
-            EventResult::ResetState
-        }
-        _ => {
-            if util::handle_editor_input_event(editor, terminal, event, nick_char) {
-                EventResult::Handled
-            } else {
-                EventResult::NotHandled
-            }
-        }
-    }
-}

src/ui/euph/nick_list.rs

@@ -1,160 +0,0 @@
-use std::borrow::Cow;
-use std::iter;
-
-use crossterm::style::{Color, ContentStyle, Stylize};
-use euphoxide::api::{NickEvent, SessionId, SessionType, SessionView, UserId};
-use euphoxide::conn::{Joined, SessionInfo};
-use toss::styled::Styled;
-
-use crate::euph;
-use crate::ui::widgets::background::Background;
-use crate::ui::widgets::empty::Empty;
-use crate::ui::widgets::list::{List, ListState};
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-pub fn widget(state: &ListState<SessionId>, joined: &Joined, focused: bool) -> BoxedWidget {
-    let mut list = state.widget().focus(focused);
-    render_rows(&mut list, joined);
-    list.into()
-}
-
-#[derive(Debug, PartialEq, Eq, PartialOrd, Ord)]
-struct HalfSession {
-    name: String,
-    id: UserId,
-    session_id: SessionId,
-    is_staff: bool,
-    is_manager: bool,
-}
-
-impl HalfSession {
-    fn from_session_view(sess: &SessionView) -> Self {
-        Self {
-            name: sess.name.clone(),
-            id: sess.id.clone(),
-            session_id: sess.session_id.clone(),
-            is_staff: sess.is_staff,
-            is_manager: sess.is_manager,
-        }
-    }
-
-    fn from_nick_event(nick: &NickEvent) -> Self {
-        Self {
-            name: nick.to.clone(),
-            id: nick.id.clone(),
-            session_id: nick.session_id.clone(),
-            is_staff: false,
-            is_manager: false,
-        }
-    }
-
-    fn from_session_info(info: &SessionInfo) -> Self {
-        match info {
-            SessionInfo::Full(sess) => Self::from_session_view(sess),
-            SessionInfo::Partial(nick) => Self::from_nick_event(nick),
-        }
-    }
-}
-
-fn render_rows(list: &mut List<SessionId>, joined: &Joined) {
-    let mut people = vec![];
-    let mut bots = vec![];
-    let mut lurkers = vec![];
-    let mut nurkers = vec![];
-
-    let sessions = joined
-        .listing
-        .values()
-        .map(HalfSession::from_session_info)
-        .chain(iter::once(HalfSession::from_session_view(&joined.session)));
-    for sess in sessions {
-        match sess.id.session_type() {
-            Some(SessionType::Bot) if sess.name.is_empty() => nurkers.push(sess),
-            Some(SessionType::Bot) => bots.push(sess),
-            _ if sess.name.is_empty() => lurkers.push(sess),
-            _ => people.push(sess),
-        }
-    }
-
-    people.sort_unstable();
-    bots.sort_unstable();
-    lurkers.sort_unstable();
-    nurkers.sort_unstable();
-
-    render_section(list, "People", &people, &joined.session);
-    render_section(list, "Bots", &bots, &joined.session);
-    render_section(list, "Lurkers", &lurkers, &joined.session);
-    render_section(list, "Nurkers", &nurkers, &joined.session);
-}
-
-fn render_section(
-    list: &mut List<SessionId>,
-    name: &str,
-    sessions: &[HalfSession],
-    own_session: &SessionView,
-) {
-    if sessions.is_empty() {
-        return;
-    }
-
-    let heading_style = ContentStyle::new().bold();
-
-    if !list.is_empty() {
-        list.add_unsel(Empty::new());
-    }
-
-    let row = Styled::new_plain(" ")
-        .then(name, heading_style)
-        .then_plain(format!(" ({})", sessions.len()));
-    list.add_unsel(Text::new(row));
-
-    for session in sessions {
-        render_row(list, session, own_session);
-    }
-}
-
-fn render_row(list: &mut List<SessionId>, session: &HalfSession, own_session: &SessionView) {
-    let (name, style, style_inv, perms_style_inv) = if session.name.is_empty() {
-        let name = "lurk";
-        let style = ContentStyle::default().grey();
-        let style_inv = ContentStyle::default().black().on_grey();
-        (Cow::Borrowed(name), style, style_inv, style_inv)
-    } else {
-        let name = &session.name as &str;
-        let (r, g, b) = euph::nick_color(name);
-        let color = Color::Rgb { r, g, b };
-        let style = ContentStyle::default().bold().with(color);
-        let style_inv = ContentStyle::default().bold().black().on(color);
-        let perms_style_inv = ContentStyle::default().black().on(color);
-        (euph::EMOJI.replace(name), style, style_inv, perms_style_inv)
-    };
-
-    let perms = if session.is_staff {
-        "!"
-    } else if session.is_manager {
-        "*"
-    } else if session.id.session_type() == Some(SessionType::Account) {
-        "~"
-    } else {
-        ""
-    };
-
-    let owner = if session.session_id == own_session.session_id {
-        ">"
-    } else {
-        " "
-    };
-
-    let normal = Styled::new_plain(owner)
-        .then(&name, style)
-        .then_plain(perms);
-    let selected = Styled::new_plain(owner)
-        .then(name, style_inv)
-        .then(perms, perms_style_inv);
-    list.add_sel(
-        session.session_id.clone(),
-        Text::new(normal),
-        Background::new(Text::new(selected)).style(style_inv),
-    );
-}

src/ui/euph/popup.rs

@@ -1,37 +0,0 @@
-use crossterm::style::{ContentStyle, Stylize};
-use toss::styled::Styled;
-
-use crate::ui::widgets::float::Float;
-use crate::ui::widgets::popup::Popup;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-
-pub enum RoomPopup {
-    Error { description: String, reason: String },
-}
-
-impl RoomPopup {
-    fn server_error_widget(description: &str, reason: &str) -> BoxedWidget {
-        let border_style = ContentStyle::default().red().bold();
-        let text = Styled::new_plain(description)
-            .then_plain("\n\n")
-            .then("Reason:", ContentStyle::default().bold())
-            .then_plain(" ")
-            .then_plain(reason);
-        Popup::new(Text::new(text))
-            .title(("Error", border_style))
-            .border(border_style)
-            .build()
-    }
-
-    pub fn widget(&self) -> BoxedWidget {
-        let widget = match self {
-            Self::Error {
-                description,
-                reason,
-            } => Self::server_error_widget(description, reason),
-        };
-
-        Float::new(widget).horizontal(0.5).vertical(0.5).into()
-    }
-}

src/ui/euph/room.rs

@@ -1,782 +0,0 @@
-use std::collections::VecDeque;
-use std::sync::Arc;
-
-use crossterm::style::{ContentStyle, Stylize};
-use euphoxide::api::{Data, Message, MessageId, PacketType, SessionId};
-use euphoxide::bot::instance::{Event, ServerConfig};
-use euphoxide::conn::{self, Joined, Joining, SessionInfo};
-use parking_lot::FairMutex;
-use tokio::sync::oneshot::error::TryRecvError;
-use tokio::sync::{mpsc, oneshot};
-use toss::styled::Styled;
-use toss::terminal::Terminal;
-
-use crate::config;
-use crate::euph;
-use crate::macros::logging_unwrap;
-use crate::ui::chat::{ChatState, Reaction};
-use crate::ui::input::{key, InputEvent, KeyBindingsList};
-use crate::ui::widgets::border::Border;
-use crate::ui::widgets::editor::EditorState;
-use crate::ui::widgets::join::{HJoin, Segment, VJoin};
-use crate::ui::widgets::layer::Layer;
-use crate::ui::widgets::list::ListState;
-use crate::ui::widgets::padding::Padding;
-use crate::ui::widgets::text::Text;
-use crate::ui::widgets::BoxedWidget;
-use crate::ui::{util, UiEvent};
-use crate::vault::EuphRoomVault;
-
-use super::account::{self, AccountUiState};
-use super::links::{self, LinksState};
-use super::popup::RoomPopup;
-use super::{auth, inspect, nick, nick_list};
-
-#[derive(Debug, PartialEq, Eq)]
-enum Focus {
-    Chat,
-    NickList,
-}
-
-#[allow(clippy::large_enum_variant)]
-enum State {
-    Normal,
-    Auth(EditorState),
-    Nick(EditorState),
-    Account(AccountUiState),
-    Links(LinksState),
-    InspectMessage(Message),
-    InspectSession(SessionInfo),
-}
-
-pub struct EuphRoom {
-    server_config: ServerConfig,
-    config: config::EuphRoom,
-    ui_event_tx: mpsc::UnboundedSender<UiEvent>,
-
-    room: Option<euph::Room>,
-
-    focus: Focus,
-    state: State,
-    popups: VecDeque<RoomPopup>,
-
-    chat: ChatState<euph::SmallMessage, EuphRoomVault>,
-    last_msg_sent: Option<oneshot::Receiver<MessageId>>,
-
-    nick_list: ListState<SessionId>,
-}
-
-impl EuphRoom {
-    pub fn new(
-        server_config: ServerConfig,
-        config: config::EuphRoom,
-        vault: EuphRoomVault,
-        ui_event_tx: mpsc::UnboundedSender<UiEvent>,
-    ) -> Self {
-        Self {
-            server_config,
-            config,
-            ui_event_tx,
-            room: None,
-            focus: Focus::Chat,
-            state: State::Normal,
-            popups: VecDeque::new(),
-            chat: ChatState::new(vault),
-            last_msg_sent: None,
-            nick_list: ListState::new(),
-        }
-    }
-
-    fn vault(&self) -> &EuphRoomVault {
-        self.chat.store()
-    }
-
-    fn name(&self) -> &str {
-        self.vault().room()
-    }
-
-    pub fn connect(&mut self, next_instance_id: &mut usize) {
-        if self.room.is_none() {
-            let room = self.vault().room();
-            let instance_config = self
-                .server_config
-                .clone()
-                .room(self.vault().room().to_string())
-                .name(format!("{room}-{}", next_instance_id))
-                .human(true)
-                .username(self.config.username.clone())
-                .force_username(self.config.force_username)
-                .password(self.config.password.clone());
-            *next_instance_id = next_instance_id.wrapping_add(1);
-
-            let tx = self.ui_event_tx.clone();
-            self.room = Some(euph::Room::new(
-                self.vault().clone(),
-                instance_config,
-                move |e| {
-                    let _ = tx.send(UiEvent::Euph(e));
-                },
-            ));
-        }
-    }
-
-    pub fn disconnect(&mut self) {
-        self.room = None;
-    }
-
-    pub fn room_state(&self) -> Option<&euph::State> {
-        if let Some(room) = &self.room {
-            Some(room.state())
-        } else {
-            None
-        }
-    }
-
-    // TODO fn room_state_joined(&self) -> Option<&Joined> {}
-
-    pub fn stopped(&self) -> bool {
-        self.room.as_ref().map(|r| r.stopped()).unwrap_or(true)
-    }
-
-    pub fn retain(&mut self) {
-        if let Some(room) = &self.room {
-            if room.stopped() {
-                self.room = None;
-            }
-        }
-    }
-
-    pub async fn unseen_msgs_count(&self) -> usize {
-        logging_unwrap!(self.vault().unseen_msgs_count().await)
-    }
-
-    async fn stabilize_pseudo_msg(&mut self) {
-        if let Some(id_rx) = &mut self.last_msg_sent {
-            match id_rx.try_recv() {
-                Ok(id) => {
-                    self.chat.sent(Some(id)).await;
-                    self.last_msg_sent = None;
-                }
-                Err(TryRecvError::Empty) => {} // Wait a bit longer
-                Err(TryRecvError::Closed) => {
-                    self.chat.sent(None).await;
-                    self.last_msg_sent = None;
-                }
-            }
-        }
-    }
-
-    fn stabilize_focus(&mut self) {
-        match self.room_state() {
-            Some(euph::State::Connected(_, conn::State::Joined(_))) => {}
-            _ => self.focus = Focus::Chat, // There is no nick list to focus on
-        }
-    }
-
-    fn stabilize_state(&mut self) {
-        let room_state = self.room.as_ref().map(|r| r.state());
-        match (&mut self.state, room_state) {
-            (
-                State::Auth(_),
-                Some(euph::State::Connected(
-                    _,
-                    conn::State::Joining(Joining {
-                        bounce: Some(_), ..
-                    }),
-                )),
-            ) => {} // Nothing to see here
-            (State::Auth(_), _) => self.state = State::Normal,
-
-            (State::Nick(_), Some(euph::State::Connected(_, conn::State::Joined(_)))) => {}
-            (State::Nick(_), _) => self.state = State::Normal,
-
-            (State::Account(account), state) => {
-                if !account.stabilize(state) {
-                    self.state = State::Normal
-                }
-            }
-
-            _ => {}
-        }
-    }
-
-    async fn stabilize(&mut self) {
-        self.stabilize_pseudo_msg().await;
-        self.stabilize_focus();
-        self.stabilize_state();
-    }
-
-    pub async fn widget(&mut self) -> BoxedWidget {
-        self.stabilize().await;
-
-        let room_state = self.room_state();
-        let chat = if let Some(euph::State::Connected(_, conn::State::Joined(joined))) = room_state
-        {
-            self.widget_with_nick_list(room_state, joined).await
-        } else {
-            self.widget_without_nick_list(room_state).await
-        };
-
-        let mut layers = vec![chat];
-
-        match &self.state {
-            State::Normal => {}
-            State::Auth(editor) => layers.push(auth::widget(editor)),
-            State::Nick(editor) => layers.push(nick::widget(editor)),
-            State::Account(account) => layers.push(account.widget()),
-            State::Links(links) => layers.push(links.widget()),
-            State::InspectMessage(message) => layers.push(inspect::message_widget(message)),
-            State::InspectSession(session) => layers.push(inspect::session_widget(session)),
-        }
-
-        for popup in &self.popups {
-            layers.push(popup.widget());
-        }
-
-        Layer::new(layers).into()
-    }
-
-    async fn widget_without_nick_list(&self, state: Option<&euph::State>) -> BoxedWidget {
-        VJoin::new(vec![
-            Segment::new(Border::new(
-                Padding::new(self.status_widget(state).await).horizontal(1),
-            )),
-            // TODO Use last known nick?
-            Segment::new(self.chat.widget(String::new(), true)).expanding(true),
-        ])
-        .into()
-    }
-
-    async fn widget_with_nick_list(
-        &self,
-        state: Option<&euph::State>,
-        joined: &Joined,
-    ) -> BoxedWidget {
-        HJoin::new(vec![
-            Segment::new(VJoin::new(vec![
-                Segment::new(Border::new(
-                    Padding::new(self.status_widget(state).await).horizontal(1),
-                )),
-                Segment::new(
-                    self.chat
-                        .widget(joined.session.name.clone(), self.focus == Focus::Chat),
-                )
-                .expanding(true),
-            ]))
-            .expanding(true),
-            Segment::new(Border::new(
-                Padding::new(nick_list::widget(
-                    &self.nick_list,
-                    joined,
-                    self.focus == Focus::NickList,
-                ))
-                .right(1),
-            )),
-        ])
-        .into()
-    }
-
-    async fn status_widget(&self, state: Option<&euph::State>) -> BoxedWidget {
-        let room_style = ContentStyle::default().bold().blue();
-        let mut info = Styled::new(format!("&{}", self.name()), room_style);
-
-        info = match state {
-            None | Some(euph::State::Stopped) => info.then_plain(", archive"),
-            Some(euph::State::Disconnected) => info.then_plain(", waiting..."),
-            Some(euph::State::Connecting) => info.then_plain(", connecting..."),
-            Some(euph::State::Connected(_, conn::State::Joining(j))) if j.bounce.is_some() => {
-                info.then_plain(", auth required")
-            }
-            Some(euph::State::Connected(_, conn::State::Joining(_))) => {
-                info.then_plain(", joining...")
-            }
-            Some(euph::State::Connected(_, conn::State::Joined(j))) => {
-                let nick = &j.session.name;
-                if nick.is_empty() {
-                    info.then_plain(", present without nick")
-                } else {
-                    info.then_plain(", present as ")
-                        .and_then(euph::style_nick(nick, ContentStyle::default()))
-                }
-            }
-        };
-
-        let unseen = self.unseen_msgs_count().await;
-        if unseen > 0 {
-            info = info
-                .then_plain(" (")
-                .then(format!("{unseen}"), ContentStyle::default().bold().green())
-                .then_plain(")");
-        }
-
-        Text::new(info).into()
-    }
-
-    async fn list_chat_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        let can_compose = matches!(
-            self.room_state(),
-            Some(euph::State::Connected(_, conn::State::Joined(_)))
-        );
-        self.chat.list_key_bindings(bindings, can_compose).await;
-    }
-
-    async fn handle_chat_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-    ) -> bool {
-        let can_compose = matches!(
-            self.room_state(),
-            Some(euph::State::Connected(_, conn::State::Joined(_)))
-        );
-
-        let reaction = self
-            .chat
-            .handle_input_event(terminal, crossterm_lock, event, can_compose)
-            .await;
-        let reaction = logging_unwrap!(reaction);
-
-        match reaction {
-            Reaction::NotHandled => {}
-            Reaction::Handled => return true,
-            Reaction::Composed { parent, content } => {
-                if let Some(room) = &self.room {
-                    match room.send(parent, content) {
-                        Ok(id_rx) => self.last_msg_sent = Some(id_rx),
-                        Err(_) => self.chat.sent(None).await,
-                    }
-                    return true;
-                }
-            }
-            Reaction::ComposeError(e) => {
-                self.popups.push_front(RoomPopup::Error {
-                    description: "Failed to use external editor".to_string(),
-                    reason: format!("{e}"),
-                });
-                return true;
-            }
-        }
-
-        false
-    }
-
-    fn list_room_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        match self.room_state() {
-            // Authenticating
-            Some(euph::State::Connected(
-                _,
-                conn::State::Joining(Joining {
-                    bounce: Some(_), ..
-                }),
-            )) => {
-                bindings.binding("a", "authenticate");
-            }
-
-            // Connected
-            Some(euph::State::Connected(_, conn::State::Joined(_))) => {
-                bindings.binding("n", "change nick");
-                bindings.binding("m", "download more messages");
-                bindings.binding("A", "show account ui");
-            }
-
-            // Otherwise
-            _ => {}
-        }
-
-        // Inspecting messages
-        bindings.binding("i", "inspect message");
-        bindings.binding("I", "show message links");
-        bindings.binding("ctrl+p", "open room's plugh.de/present page");
-    }
-
-    async fn handle_room_input_event(&mut self, event: &InputEvent) -> bool {
-        match self.room_state() {
-            // Authenticating
-            Some(euph::State::Connected(
-                _,
-                conn::State::Joining(Joining {
-                    bounce: Some(_), ..
-                }),
-            )) => {
-                if let key!('a') = event {
-                    self.state = State::Auth(auth::new());
-                    return true;
-                }
-            }
-
-            // Joined
-            Some(euph::State::Connected(_, conn::State::Joined(joined))) => match event {
-                key!('n') | key!('N') => {
-                    self.state = State::Nick(nick::new(joined.clone()));
-                    return true;
-                }
-                key!('m') => {
-                    if let Some(room) = &self.room {
-                        let _ = room.log();
-                    }
-                    return true;
-                }
-                key!('A') => {
-                    self.state = State::Account(AccountUiState::new());
-                    return true;
-                }
-                _ => {}
-            },
-
-            // Otherwise
-            _ => {}
-        }
-
-        // Always applicable
-        match event {
-            key!('i') => {
-                if let Some(id) = self.chat.cursor().await {
-                    if let Some(msg) = logging_unwrap!(self.vault().full_msg(id).await) {
-                        self.state = State::InspectMessage(msg);
-                    }
-                }
-                return true;
-            }
-            key!('I') => {
-                if let Some(id) = self.chat.cursor().await {
-                    if let Some(msg) = logging_unwrap!(self.vault().msg(id).await) {
-                        self.state = State::Links(LinksState::new(&msg.content));
-                    }
-                }
-                return true;
-            }
-            key!(Ctrl + 'p') => {
-                let link = format!("https://plugh.de/present/{}/", self.name());
-                if let Err(error) = open::that(&link) {
-                    self.popups.push_front(RoomPopup::Error {
-                        description: format!("Failed to open link: {link}"),
-                        reason: format!("{error}"),
-                    });
-                }
-                return true;
-            }
-            _ => {}
-        }
-
-        false
-    }
-
-    async fn list_chat_focus_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        self.list_room_key_bindings(bindings);
-        bindings.empty();
-        self.list_chat_key_bindings(bindings).await;
-    }
-
-    async fn handle_chat_focus_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-    ) -> bool {
-        // We need to handle chat input first, otherwise the other
-        // key bindings will shadow characters in the editor.
-        if self
-            .handle_chat_input_event(terminal, crossterm_lock, event)
-            .await
-        {
-            return true;
-        }
-
-        if self.handle_room_input_event(event).await {
-            return true;
-        }
-
-        false
-    }
-
-    fn list_nick_list_focus_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        util::list_list_key_bindings(bindings);
-
-        bindings.binding("i", "inspect session");
-    }
-
-    fn handle_nick_list_focus_input_event(&mut self, event: &InputEvent) -> bool {
-        if util::handle_list_input_event(&mut self.nick_list, event) {
-            return true;
-        }
-
-        if let key!('i') = event {
-            if let Some(euph::State::Connected(_, conn::State::Joined(joined))) = self.room_state()
-            {
-                if let Some(id) = self.nick_list.cursor() {
-                    if id == joined.session.session_id {
-                        self.state =
-                            State::InspectSession(SessionInfo::Full(joined.session.clone()));
-                    } else if let Some(session) = joined.listing.get(&id) {
-                        self.state = State::InspectSession(session.clone());
-                    }
-                }
-            }
-            return true;
-        }
-
-        false
-    }
-
-    pub async fn list_normal_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        // Handled in rooms list, not here
-        bindings.binding("esc", "leave room");
-
-        match self.focus {
-            Focus::Chat => {
-                if let Some(euph::State::Connected(_, conn::State::Joined(_))) = self.room_state() {
-                    bindings.binding("tab", "focus on nick list");
-                }
-
-                self.list_chat_focus_key_bindings(bindings).await;
-            }
-            Focus::NickList => {
-                bindings.binding("tab, esc", "focus on chat");
-                bindings.empty();
-                bindings.heading("Nick list");
-                self.list_nick_list_focus_key_bindings(bindings);
-            }
-        }
-    }
-
-    async fn handle_normal_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-    ) -> bool {
-        match self.focus {
-            Focus::Chat => {
-                // Needs to be handled first or the tab key may be shadowed
-                // during editing.
-                if self
-                    .handle_chat_focus_input_event(terminal, crossterm_lock, event)
-                    .await
-                {
-                    return true;
-                }
-
-                if let Some(euph::State::Connected(_, conn::State::Joined(_))) = self.room_state() {
-                    if let key!(Tab) = event {
-                        self.focus = Focus::NickList;
-                        return true;
-                    }
-                }
-            }
-            Focus::NickList => {
-                if let key!(Tab) | key!(Esc) = event {
-                    self.focus = Focus::Chat;
-                    return true;
-                }
-
-                if self.handle_nick_list_focus_input_event(event) {
-                    return true;
-                }
-            }
-        }
-
-        false
-    }
-
-    pub async fn list_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        bindings.heading("Room");
-
-        if !self.popups.is_empty() {
-            bindings.binding("esc", "close popup");
-            return;
-        }
-
-        match &self.state {
-            State::Normal => self.list_normal_key_bindings(bindings).await,
-            State::Auth(_) => auth::list_key_bindings(bindings),
-            State::Nick(_) => nick::list_key_bindings(bindings),
-            State::Account(account) => account.list_key_bindings(bindings),
-            State::Links(links) => links.list_key_bindings(bindings),
-            State::InspectMessage(_) | State::InspectSession(_) => {
-                inspect::list_key_bindings(bindings)
-            }
-        }
-    }
-
-    pub async fn handle_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-    ) -> bool {
-        if !self.popups.is_empty() {
-            if matches!(event, key!(Esc)) {
-                self.popups.pop_back();
-                return true;
-            }
-            return false;
-        }
-
-        // TODO Use a common EventResult
-
-        match &mut self.state {
-            State::Normal => {
-                self.handle_normal_input_event(terminal, crossterm_lock, event)
-                    .await
-            }
-            State::Auth(editor) => {
-                match auth::handle_input_event(terminal, event, &self.room, editor) {
-                    auth::EventResult::NotHandled => false,
-                    auth::EventResult::Handled => true,
-                    auth::EventResult::ResetState => {
-                        self.state = State::Normal;
-                        true
-                    }
-                }
-            }
-            State::Nick(editor) => {
-                match nick::handle_input_event(terminal, event, &self.room, editor) {
-                    nick::EventResult::NotHandled => false,
-                    nick::EventResult::Handled => true,
-                    nick::EventResult::ResetState => {
-                        self.state = State::Normal;
-                        true
-                    }
-                }
-            }
-            State::Account(account) => {
-                match account.handle_input_event(terminal, event, &self.room) {
-                    account::EventResult::NotHandled => false,
-                    account::EventResult::Handled => true,
-                    account::EventResult::ResetState => {
-                        self.state = State::Normal;
-                        true
-                    }
-                }
-            }
-            State::Links(links) => match links.handle_input_event(event) {
-                links::EventResult::NotHandled => false,
-                links::EventResult::Handled => true,
-                links::EventResult::Close => {
-                    self.state = State::Normal;
-                    true
-                }
-                links::EventResult::ErrorOpeningLink { link, error } => {
-                    self.popups.push_front(RoomPopup::Error {
-                        description: format!("Failed to open link: {link}"),
-                        reason: format!("{error}"),
-                    });
-                    true
-                }
-            },
-            State::InspectMessage(_) | State::InspectSession(_) => {
-                match inspect::handle_input_event(event) {
-                    inspect::EventResult::NotHandled => false,
-                    inspect::EventResult::Close => {
-                        self.state = State::Normal;
-                        true
-                    }
-                }
-            }
-        }
-    }
-
-    pub async fn handle_event(&mut self, event: Event) -> bool {
-        let room = match &self.room {
-            None => return false,
-            Some(room) => room,
-        };
-
-        if event.config().name != room.instance().config().name {
-            // If we allowed names other than the current one, old instances
-            // that haven't yet shut down properly could mess up our state.
-            return false;
-        }
-
-        // We handle the packet internally first because the room event handling
-        // will consume it while we only need a reference.
-        let handled = if let Event::Packet(_, packet, _) = &event {
-            match &packet.content {
-                Ok(data) => self.handle_euph_data(data),
-                Err(reason) => self.handle_euph_error(packet.r#type, reason),
-            }
-        } else {
-            // The room state changes, which always means a redraw.
-            true
-        };
-
-        self.room
-            .as_mut()
-            // See check at the beginning of the function.
-            .expect("no room even though we checked earlier")
-            .handle_event(event)
-            .await;
-
-        handled
-    }
-
-    fn handle_euph_data(&mut self, data: &Data) -> bool {
-        // These packets don't result in any noticeable change in the UI.
-        #[allow(clippy::match_like_matches_macro)]
-        let handled = match data {
-            Data::PingEvent(_) | Data::PingReply(_) => {
-                // Pings are displayed nowhere in the room UI.
-                false
-            }
-            Data::DisconnectEvent(_) => {
-                // Followed by the server closing the connection, meaning that
-                // we'll get an `EuphRoomEvent::Disconnected` soon after this.
-                false
-            }
-            _ => true,
-        };
-
-        // Because the euphoria API is very carefully designed with emphasis on
-        // consistency, some failures are not normal errors but instead
-        // error-free replies that encode their own error.
-        let error = match data {
-            Data::AuthReply(reply) if !reply.success => {
-                Some(("authenticate", reply.reason.clone()))
-            }
-            Data::LoginReply(reply) if !reply.success => Some(("login", reply.reason.clone())),
-            _ => None,
-        };
-        if let Some((action, reason)) = error {
-            let description = format!("Failed to {action}.");
-            let reason = reason.unwrap_or_else(|| "no idea, the server wouldn't say".to_string());
-            self.popups.push_front(RoomPopup::Error {
-                description,
-                reason,
-            });
-        }
-
-        handled
-    }
-
-    fn handle_euph_error(&mut self, r#type: PacketType, reason: &str) -> bool {
-        let action = match r#type {
-            PacketType::AuthReply => "authenticate",
-            PacketType::NickReply => "set nick",
-            PacketType::PmInitiateReply => "initiate pm",
-            PacketType::SendReply => "send message",
-            PacketType::ChangeEmailReply => "change account email",
-            PacketType::ChangeNameReply => "change account name",
-            PacketType::ChangePasswordReply => "change account password",
-            PacketType::LoginReply => "log in",
-            PacketType::LogoutReply => "log out",
-            PacketType::RegisterAccountReply => "register account",
-            PacketType::ResendVerificationEmailReply => "resend verification email",
-            PacketType::ResetPasswordReply => "reset account password",
-            PacketType::BanReply => "ban",
-            PacketType::EditMessageReply => "edit message",
-            PacketType::GrantAccessReply => "grant room access",
-            PacketType::GrantManagerReply => "grant manager permissions",
-            PacketType::RevokeAccessReply => "revoke room access",
-            PacketType::RevokeManagerReply => "revoke manager permissions",
-            PacketType::UnbanReply => "unban",
-            _ => return false,
-        };
-        let description = format!("Failed to {action}.");
-        self.popups.push_front(RoomPopup::Error {
-            description,
-            reason: reason.to_string(),
-        });
-        true
-    }
-}

src/ui/input.rs

@@ -1,149 +0,0 @@
-use std::convert::Infallible;
-
-use crossterm::event::{Event, KeyCode, KeyModifiers};
-use crossterm::style::{ContentStyle, Stylize};
-use toss::styled::Styled;
-
-use super::widgets::background::Background;
-use super::widgets::border::Border;
-use super::widgets::empty::Empty;
-use super::widgets::float::Float;
-use super::widgets::join::{HJoin, Segment};
-use super::widgets::layer::Layer;
-use super::widgets::list::{List, ListState};
-use super::widgets::padding::Padding;
-use super::widgets::resize::Resize;
-use super::widgets::text::Text;
-use super::widgets::BoxedWidget;
-
-#[derive(Debug, Clone)]
-pub enum InputEvent {
-    Key(KeyEvent),
-    Paste(String),
-}
-
-impl InputEvent {
-    pub fn from_event(event: Event) -> Option<Self> {
-        match event {
-            crossterm::event::Event::Key(key) => Some(Self::Key(key.into())),
-            crossterm::event::Event::Paste(text) => Some(Self::Paste(text)),
-            _ => None,
-        }
-    }
-}
-
-/// A key event data type that is a bit easier to pattern match on than
-/// [`crossterm::event::KeyEvent`].
-#[derive(Debug, Clone, Copy)]
-pub struct KeyEvent {
-    pub code: KeyCode,
-    pub shift: bool,
-    pub ctrl: bool,
-    pub alt: bool,
-}
-
-impl From<crossterm::event::KeyEvent> for KeyEvent {
-    fn from(event: crossterm::event::KeyEvent) -> Self {
-        Self {
-            code: event.code,
-            shift: event.modifiers.contains(KeyModifiers::SHIFT),
-            ctrl: event.modifiers.contains(KeyModifiers::CONTROL),
-            alt: event.modifiers.contains(KeyModifiers::ALT),
-        }
-    }
-}
-
-#[rustfmt::skip]
-#[allow(unused_macro_rules)]
-macro_rules! key {
-    // key!(Paste text)
-    ( Paste $text:ident ) => { crate::ui::input::InputEvent::Paste($text) };
-
-    // key!('a')
-    (        $key:literal ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::Char($key), shift: _, ctrl: false, alt: false, }) };
-    ( Ctrl + $key:literal ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::Char($key), shift: _, ctrl: true,  alt: false, }) };
-    (  Alt + $key:literal ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::Char($key), shift: _, ctrl: false, alt: true,  }) };
-
-    // key!(Char c)
-    (        Char $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::Char($key), shift: _, ctrl: false, alt: false, }) };
-    ( Ctrl + Char $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::Char($key), shift: _, ctrl: true,  alt: false, }) };
-    (  Alt + Char $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::Char($key), shift: _, ctrl: false, alt: true,  }) };
-
-    // key!(F n)
-    (         F $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::F($key), shift: false, ctrl: false, alt: false, }) };
-    ( Shift + F $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::F($key), shift: true,  ctrl: false, alt: false, }) };
-    (  Ctrl + F $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::F($key), shift: false, ctrl: true,  alt: false, }) };
-    (   Alt + F $key:pat ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::F($key), shift: false, ctrl: false, alt: true,  }) };
-
-    // key!(other)
-    (         $key:ident ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::$key, shift: false, ctrl: false, alt: false, }) };
-    ( Shift + $key:ident ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::$key, shift: true,  ctrl: false, alt: false, }) };
-    (  Ctrl + $key:ident ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::$key, shift: false, ctrl: true,  alt: false, }) };
-    (   Alt + $key:ident ) => { crate::ui::input::InputEvent::Key(crate::ui::input::KeyEvent { code: crossterm::event::KeyCode::$key, shift: false, ctrl: false, alt: true,  }) };
-}
-pub(crate) use key;
-
-/// Helper wrapper around a list widget for a more consistent key binding style.
-pub struct KeyBindingsList(List<Infallible>);
-
-impl KeyBindingsList {
-    /// Width of the left column of key bindings.
-    const BINDING_WIDTH: u16 = 20;
-
-    pub fn new(state: &ListState<Infallible>) -> Self {
-        Self(state.widget())
-    }
-
-    fn binding_style() -> ContentStyle {
-        ContentStyle::default().cyan()
-    }
-
-    pub fn widget(self) -> BoxedWidget {
-        let binding_style = Self::binding_style();
-        Float::new(Layer::new(vec![
-            Border::new(Background::new(Padding::new(self.0).horizontal(1))).into(),
-            Float::new(
-                Padding::new(Text::new(
-                    Styled::new("jk/↓↑", binding_style)
-                        .then_plain(" to scroll, ")
-                        .then("esc", binding_style)
-                        .then_plain(" to close"),
-                ))
-                .horizontal(1),
-            )
-            .horizontal(0.5)
-            .into(),
-        ]))
-        .horizontal(0.5)
-        .vertical(0.5)
-        .into()
-    }
-
-    pub fn empty(&mut self) {
-        self.0.add_unsel(Empty::new());
-    }
-
-    pub fn heading(&mut self, name: &str) {
-        self.0
-            .add_unsel(Text::new((name, ContentStyle::default().bold())));
-    }
-
-    pub fn binding(&mut self, binding: &str, description: &str) {
-        let widget = HJoin::new(vec![
-            Segment::new(
-                Resize::new(Padding::new(Text::new((binding, Self::binding_style()))).right(1))
-                    .min_width(Self::BINDING_WIDTH),
-            ),
-            Segment::new(Text::new(description)),
-        ]);
-        self.0.add_unsel(widget);
-    }
-
-    pub fn binding_ctd(&mut self, description: &str) {
-        let widget = HJoin::new(vec![
-            Segment::new(Resize::new(Empty::new()).min_width(Self::BINDING_WIDTH)),
-            Segment::new(Text::new(description)),
-        ]);
-        self.0.add_unsel(widget);
-    }
-}

src/ui/rooms.rs

@@ -1,590 +0,0 @@
-use std::collections::{HashMap, HashSet};
-use std::iter;
-use std::sync::{Arc, Mutex};
-
-use crossterm::style::{ContentStyle, Stylize};
-use euphoxide::api::SessionType;
-use euphoxide::bot::instance::{Event, ServerConfig};
-use euphoxide::conn::{self, Joined};
-use parking_lot::FairMutex;
-use tokio::sync::mpsc;
-use toss::styled::Styled;
-use toss::terminal::Terminal;
-
-use crate::config::{Config, RoomsSortOrder};
-use crate::euph;
-use crate::macros::logging_unwrap;
-use crate::vault::Vault;
-
-use super::euph::room::EuphRoom;
-use super::input::{key, InputEvent, KeyBindingsList};
-use super::widgets::editor::EditorState;
-use super::widgets::join::{HJoin, Segment, VJoin};
-use super::widgets::layer::Layer;
-use super::widgets::list::{List, ListState};
-use super::widgets::popup::Popup;
-use super::widgets::resize::Resize;
-use super::widgets::text::Text;
-use super::widgets::BoxedWidget;
-use super::{util, UiEvent};
-
-enum State {
-    ShowList,
-    ShowRoom(String),
-    Connect(EditorState),
-    Delete(String, EditorState),
-}
-
-enum Order {
-    Alphabet,
-    Importance,
-}
-
-impl Order {
-    fn from_rooms_sort_order(order: RoomsSortOrder) -> Self {
-        match order {
-            RoomsSortOrder::Alphabet => Self::Alphabet,
-            RoomsSortOrder::Importance => Self::Importance,
-        }
-    }
-}
-
-pub struct Rooms {
-    config: &'static Config,
-
-    vault: Vault,
-    ui_event_tx: mpsc::UnboundedSender<UiEvent>,
-
-    state: State,
-
-    list: ListState<String>,
-    order: Order,
-
-    euph_server_config: ServerConfig,
-    euph_next_instance_id: usize,
-    euph_rooms: HashMap<String, EuphRoom>,
-}
-
-impl Rooms {
-    pub async fn new(
-        config: &'static Config,
-        vault: Vault,
-        ui_event_tx: mpsc::UnboundedSender<UiEvent>,
-    ) -> Self {
-        let cookies = logging_unwrap!(vault.euph().cookies().await);
-        let euph_server_config = ServerConfig::default().cookies(Arc::new(Mutex::new(cookies)));
-
-        let mut result = Self {
-            config,
-            vault,
-            ui_event_tx,
-            state: State::ShowList,
-            list: ListState::new(),
-            order: Order::from_rooms_sort_order(config.rooms_sort_order),
-            euph_server_config,
-            euph_next_instance_id: 0,
-            euph_rooms: HashMap::new(),
-        };
-
-        if !config.offline {
-            for (name, config) in &config.euph.rooms {
-                if config.autojoin {
-                    result.connect_to_room(name.clone());
-                }
-            }
-        }
-
-        result
-    }
-
-    fn get_or_insert_room(&mut self, name: String) -> &mut EuphRoom {
-        self.euph_rooms.entry(name.clone()).or_insert_with(|| {
-            EuphRoom::new(
-                self.euph_server_config.clone(),
-                self.config.euph_room(&name),
-                self.vault.euph().room(name),
-                self.ui_event_tx.clone(),
-            )
-        })
-    }
-
-    fn connect_to_room(&mut self, name: String) {
-        let room = self.euph_rooms.entry(name.clone()).or_insert_with(|| {
-            EuphRoom::new(
-                self.euph_server_config.clone(),
-                self.config.euph_room(&name),
-                self.vault.euph().room(name),
-                self.ui_event_tx.clone(),
-            )
-        });
-        room.connect(&mut self.euph_next_instance_id);
-    }
-
-    fn connect_to_all_rooms(&mut self) {
-        for room in self.euph_rooms.values_mut() {
-            room.connect(&mut self.euph_next_instance_id);
-        }
-    }
-
-    fn disconnect_from_room(&mut self, name: &str) {
-        if let Some(room) = self.euph_rooms.get_mut(name) {
-            room.disconnect();
-        }
-    }
-
-    fn disconnect_from_all_rooms(&mut self) {
-        for room in self.euph_rooms.values_mut() {
-            room.disconnect();
-        }
-    }
-
-    /// Remove rooms that are not running any more and can't be found in the db
-    /// or config. Insert rooms that are in the db or config but not yet in in
-    /// the hash map.
-    ///
-    /// These kinds of rooms are either
-    /// - failed connection attempts, or
-    /// - rooms that were deleted from the db.
-    async fn stabilize_rooms(&mut self) {
-        // Collect all rooms from the db and config file
-        let rooms = logging_unwrap!(self.vault.euph().rooms().await);
-        let mut rooms_set = rooms
-            .into_iter()
-            .chain(self.config.euph.rooms.keys().cloned())
-            .collect::<HashSet<_>>();
-
-        // Prevent room that is currently being shown from being removed. This
-        // could otherwise happen after connecting to a room that doesn't exist.
-        if let State::ShowRoom(name) = &self.state {
-            rooms_set.insert(name.clone());
-        }
-
-        // Now `rooms_set` contains all rooms that must exist. Other rooms may
-        // also exist, for example rooms that are connecting for the first time.
-
-        self.euph_rooms
-            .retain(|n, r| !r.stopped() || rooms_set.contains(n));
-
-        for room in rooms_set {
-            self.get_or_insert_room(room).retain();
-        }
-    }
-
-    pub async fn widget(&mut self) -> BoxedWidget {
-        match &self.state {
-            State::ShowRoom(_) => {}
-            _ => self.stabilize_rooms().await,
-        }
-
-        match &self.state {
-            State::ShowList => self.rooms_widget().await,
-            State::ShowRoom(name) => {
-                self.euph_rooms
-                    .get_mut(name)
-                    .expect("room exists after stabilization")
-                    .widget()
-                    .await
-            }
-            State::Connect(editor) => Layer::new(vec![
-                self.rooms_widget().await,
-                Self::new_room_widget(editor),
-            ])
-            .into(),
-            State::Delete(name, editor) => Layer::new(vec![
-                self.rooms_widget().await,
-                Self::delete_room_widget(name, editor),
-            ])
-            .into(),
-        }
-    }
-
-    fn new_room_widget(editor: &EditorState) -> BoxedWidget {
-        let room_style = ContentStyle::default().bold().blue();
-        let editor = editor.widget().highlight(|s| Styled::new(s, room_style));
-        Popup::new(HJoin::new(vec![
-            Segment::new(Text::new(("&", room_style))),
-            Segment::new(editor).priority(0),
-        ]))
-        .title("Connect to")
-        .build()
-    }
-
-    fn delete_room_widget(name: &str, editor: &EditorState) -> BoxedWidget {
-        let warn_style = ContentStyle::default().bold().red();
-        let room_style = ContentStyle::default().bold().blue();
-        let editor = editor.widget().highlight(|s| Styled::new(s, room_style));
-        let text = Styled::new_plain("Are you sure you want to delete ")
-            .then("&", room_style)
-            .then(name, room_style)
-            .then_plain("?\n\n")
-            .then_plain("This will delete the entire room history from your vault. ")
-            .then_plain("To shrink your vault afterwards, run ")
-            .then("cove gc", ContentStyle::default().italic().grey())
-            .then_plain(".\n\n")
-            .then_plain("To confirm the deletion, ")
-            .then_plain("enter the full name of the room and press enter:");
-        Popup::new(VJoin::new(vec![
-            // The HJoin prevents the text from filling up the entire available
-            // space if the editor is wider than the text.
-            Segment::new(HJoin::new(vec![Segment::new(
-                Resize::new(Text::new(text).wrap(true)).max_width(54),
-            )])),
-            Segment::new(HJoin::new(vec![
-                Segment::new(Text::new(("&", room_style))),
-                Segment::new(editor).priority(0),
-            ])),
-        ]))
-        .title(("Delete room", warn_style))
-        .border(warn_style)
-        .build()
-    }
-
-    fn format_pbln(joined: &Joined) -> String {
-        let mut p = 0_usize;
-        let mut b = 0_usize;
-        let mut l = 0_usize;
-        let mut n = 0_usize;
-
-        let sessions = joined
-            .listing
-            .values()
-            .map(|s| (s.id(), s.name()))
-            .chain(iter::once((
-                &joined.session.id,
-                &joined.session.name as &str,
-            )));
-        for (user_id, name) in sessions {
-            match user_id.session_type() {
-                Some(SessionType::Bot) if name.is_empty() => n += 1,
-                Some(SessionType::Bot) => b += 1,
-                _ if name.is_empty() => l += 1,
-                _ => p += 1,
-            }
-        }
-
-        // There must always be either one p, b, l or n since we're including
-        // ourselves.
-        let mut result = vec![];
-        if p > 0 {
-            result.push(format!("{p}p"));
-        }
-        if b > 0 {
-            result.push(format!("{b}b"));
-        }
-        if l > 0 {
-            result.push(format!("{l}l"));
-        }
-        if n > 0 {
-            result.push(format!("{n}n"));
-        }
-        result.join(" ")
-    }
-
-    fn format_room_state(state: Option<&euph::State>) -> Option<String> {
-        match state {
-            None | Some(euph::State::Stopped) => None,
-            Some(euph::State::Disconnected) => Some("waiting".to_string()),
-            Some(euph::State::Connecting) => Some("connecting".to_string()),
-            Some(euph::State::Connected(_, connected)) => match connected {
-                conn::State::Joining(joining) if joining.bounce.is_some() => {
-                    Some("auth required".to_string())
-                }
-                conn::State::Joining(_) => Some("joining".to_string()),
-                conn::State::Joined(joined) => Some(Self::format_pbln(joined)),
-            },
-        }
-    }
-
-    fn format_unseen_msgs(unseen: usize) -> Option<String> {
-        if unseen == 0 {
-            None
-        } else {
-            Some(format!("{unseen}"))
-        }
-    }
-
-    fn format_room_info(state: Option<&euph::State>, unseen: usize) -> Styled {
-        let unseen_style = ContentStyle::default().bold().green();
-
-        let state = Self::format_room_state(state);
-        let unseen = Self::format_unseen_msgs(unseen);
-
-        match (state, unseen) {
-            (None, None) => Styled::default(),
-            (None, Some(u)) => Styled::new_plain(" (")
-                .then(u, unseen_style)
-                .then_plain(")"),
-            (Some(s), None) => Styled::new_plain(" (").then_plain(s).then_plain(")"),
-            (Some(s), Some(u)) => Styled::new_plain(" (")
-                .then_plain(s)
-                .then_plain(", ")
-                .then(u, unseen_style)
-                .then_plain(")"),
-        }
-    }
-
-    fn sort_rooms(&self, rooms: &mut [(&String, Option<&euph::State>, usize)]) {
-        match self.order {
-            Order::Alphabet => rooms.sort_unstable_by_key(|(name, _, _)| *name),
-            Order::Importance => rooms.sort_unstable_by_key(|(name, state, unseen)| {
-                (state.is_none(), *unseen == 0, *name)
-            }),
-        }
-    }
-
-    async fn render_rows(&self, list: &mut List<String>) {
-        if self.euph_rooms.is_empty() {
-            list.add_unsel(Text::new((
-                "Press F1 for key bindings",
-                ContentStyle::default().grey().italic(),
-            )))
-        }
-
-        let mut rooms = vec![];
-        for (name, room) in &self.euph_rooms {
-            let state = room.room_state();
-            let unseen = room.unseen_msgs_count().await;
-            rooms.push((name, state, unseen));
-        }
-        self.sort_rooms(&mut rooms);
-        for (name, state, unseen) in rooms {
-            let room_style = ContentStyle::default().bold().blue();
-            let room_sel_style = ContentStyle::default().bold().black().on_white();
-
-            let mut normal = Styled::new(format!("&{name}"), room_style);
-            let mut selected = Styled::new(format!("&{name}"), room_sel_style);
-
-            let info = Self::format_room_info(state, unseen);
-            normal = normal.and_then(info.clone());
-            selected = selected.and_then(info);
-
-            list.add_sel(name.clone(), Text::new(normal), Text::new(selected));
-        }
-    }
-
-    async fn rooms_widget(&self) -> BoxedWidget {
-        let heading_style = ContentStyle::default().bold();
-        let amount = self.euph_rooms.len();
-        let heading =
-            Text::new(Styled::new("Rooms", heading_style).then_plain(format!(" ({amount})")));
-
-        let mut list = self.list.widget().focus(true);
-        self.render_rows(&mut list).await;
-
-        VJoin::new(vec![Segment::new(heading), Segment::new(list).priority(0)]).into()
-    }
-
-    fn room_char(c: char) -> bool {
-        c.is_ascii_alphanumeric() || c == '_'
-    }
-
-    fn list_showlist_key_bindings(bindings: &mut KeyBindingsList) {
-        bindings.heading("Rooms");
-        util::list_list_key_bindings(bindings);
-        bindings.empty();
-        bindings.binding("enter", "enter selected room");
-        bindings.binding("c", "connect to selected room");
-        bindings.binding("C", "connect to all rooms");
-        bindings.binding("d", "disconnect from selected room");
-        bindings.binding("D", "disconnect from all rooms");
-        bindings.binding("a", "connect to all autojoin room");
-        bindings.binding("A", "disconnect from all non-autojoin rooms");
-        bindings.binding("n", "connect to new room");
-        bindings.binding("X", "delete room");
-        bindings.empty();
-        bindings.binding("s", "change sort order");
-    }
-
-    fn handle_showlist_input_event(&mut self, event: &InputEvent) -> bool {
-        if util::handle_list_input_event(&mut self.list, event) {
-            return true;
-        }
-
-        match event {
-            key!(Enter) => {
-                if let Some(name) = self.list.cursor() {
-                    self.state = State::ShowRoom(name);
-                }
-                return true;
-            }
-            key!('c') => {
-                if let Some(name) = self.list.cursor() {
-                    self.connect_to_room(name);
-                }
-                return true;
-            }
-            key!('C') => {
-                self.connect_to_all_rooms();
-                return true;
-            }
-            key!('d') => {
-                if let Some(name) = self.list.cursor() {
-                    self.disconnect_from_room(&name);
-                }
-                return true;
-            }
-            key!('D') => {
-                self.disconnect_from_all_rooms();
-                return true;
-            }
-            key!('a') => {
-                for (name, options) in &self.config.euph.rooms {
-                    if options.autojoin {
-                        self.connect_to_room(name.clone());
-                    }
-                }
-                return true;
-            }
-            key!('A') => {
-                for (name, room) in &mut self.euph_rooms {
-                    let autojoin = self
-                        .config
-                        .euph
-                        .rooms
-                        .get(name)
-                        .map(|r| r.autojoin)
-                        .unwrap_or(false);
-                    if !autojoin {
-                        room.disconnect();
-                    }
-                }
-                return true;
-            }
-            key!('n') => {
-                self.state = State::Connect(EditorState::new());
-                return true;
-            }
-            key!('X') => {
-                if let Some(name) = self.list.cursor() {
-                    self.state = State::Delete(name, EditorState::new());
-                }
-                return true;
-            }
-            key!('s') => {
-                self.order = match self.order {
-                    Order::Alphabet => Order::Importance,
-                    Order::Importance => Order::Alphabet,
-                };
-                return true;
-            }
-            _ => {}
-        }
-
-        false
-    }
-
-    pub async fn list_key_bindings(&self, bindings: &mut KeyBindingsList) {
-        match &self.state {
-            State::ShowList => Self::list_showlist_key_bindings(bindings),
-            State::ShowRoom(name) => {
-                // Key bindings for leaving the room are a part of the room's
-                // list_key_bindings function since they may be shadowed by the
-                // nick selector or message editor.
-                if let Some(room) = self.euph_rooms.get(name) {
-                    room.list_key_bindings(bindings).await;
-                } else {
-                    // There should always be a room here already but I don't
-                    // really want to panic in case it is not. If I show a
-                    // message like this, it'll hopefully be reported if
-                    // somebody ever encounters it.
-                    bindings.binding_ctd("oops, this text should never be visible")
-                }
-            }
-            State::Connect(_) => {
-                bindings.heading("Rooms");
-                bindings.binding("esc", "abort");
-                bindings.binding("enter", "connect to room");
-                util::list_editor_key_bindings(bindings, Self::room_char);
-            }
-            State::Delete(_, _) => {
-                bindings.heading("Rooms");
-                bindings.binding("esc", "abort");
-                bindings.binding("enter", "delete room");
-                util::list_editor_key_bindings(bindings, Self::room_char);
-            }
-        }
-    }
-
-    pub async fn handle_input_event(
-        &mut self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-        event: &InputEvent,
-    ) -> bool {
-        self.stabilize_rooms().await;
-
-        match &self.state {
-            State::ShowList => {
-                if self.handle_showlist_input_event(event) {
-                    return true;
-                }
-            }
-            State::ShowRoom(name) => {
-                if let Some(room) = self.euph_rooms.get_mut(name) {
-                    if room
-                        .handle_input_event(terminal, crossterm_lock, event)
-                        .await
-                    {
-                        return true;
-                    }
-
-                    if let key!(Esc) = event {
-                        self.state = State::ShowList;
-                        return true;
-                    }
-                }
-            }
-            State::Connect(ed) => match event {
-                key!(Esc) => {
-                    self.state = State::ShowList;
-                    return true;
-                }
-                key!(Enter) => {
-                    let name = ed.text();
-                    if !name.is_empty() {
-                        self.connect_to_room(name.clone());
-                        self.state = State::ShowRoom(name);
-                    }
-                    return true;
-                }
-                _ => {
-                    if util::handle_editor_input_event(ed, terminal, event, Self::room_char) {
-                        return true;
-                    }
-                }
-            },
-            State::Delete(name, editor) => match event {
-                key!(Esc) => {
-                    self.state = State::ShowList;
-                    return true;
-                }
-                key!(Enter) if editor.text() == *name => {
-                    self.euph_rooms.remove(name);
-                    logging_unwrap!(self.vault.euph().room(name.clone()).delete().await);
-                    self.state = State::ShowList;
-                    return true;
-                }
-                _ => {
-                    if util::handle_editor_input_event(editor, terminal, event, Self::room_char) {
-                        return true;
-                    }
-                }
-            },
-        }
-
-        false
-    }
-
-    pub async fn handle_euph_event(&mut self, event: Event) -> bool {
-        let room_name = event.config().room.clone();
-        let Some(room) = self.euph_rooms.get_mut(&room_name) else { return false; };
-
-        let handled = room.handle_event(event).await;
-
-        let room_visible = match &self.state {
-            State::ShowRoom(name) => *name == room_name,
-            _ => true,
-        };
-        handled && room_visible
-    }
-}

src/ui/util.rs

@@ -1,166 +0,0 @@
-use std::io;
-use std::sync::Arc;
-
-use parking_lot::FairMutex;
-use toss::terminal::Terminal;
-
-use super::input::{key, InputEvent, KeyBindingsList};
-use super::widgets::editor::EditorState;
-use super::widgets::list::ListState;
-
-pub fn prompt(
-    terminal: &mut Terminal,
-    crossterm_lock: &Arc<FairMutex<()>>,
-    initial_text: &str,
-) -> io::Result<String> {
-    let content = {
-        let _guard = crossterm_lock.lock();
-        terminal.suspend().expect("could not suspend");
-        let content = edit::edit(initial_text);
-        terminal.unsuspend().expect("could not unsuspend");
-        content
-    };
-
-    content
-}
-
-//////////
-// List //
-//////////
-
-pub fn list_list_key_bindings(bindings: &mut KeyBindingsList) {
-    bindings.binding("j/k, ↓/↑", "move cursor up/down");
-    bindings.binding("g, home", "move cursor to top");
-    bindings.binding("G, end", "move cursor to bottom");
-    bindings.binding("ctrl+y/e", "scroll up/down");
-}
-
-pub fn handle_list_input_event<Id: Clone>(list: &mut ListState<Id>, event: &InputEvent) -> bool {
-    match event {
-        key!('k') | key!(Up) => list.move_cursor_up(),
-        key!('j') | key!(Down) => list.move_cursor_down(),
-        key!('g') | key!(Home) => list.move_cursor_to_top(),
-        key!('G') | key!(End) => list.move_cursor_to_bottom(),
-        key!(Ctrl + 'y') => list.scroll_up(1),
-        key!(Ctrl + 'e') => list.scroll_down(1),
-        _ => return false,
-    }
-
-    true
-}
-
-////////////
-// Editor //
-////////////
-
-fn list_editor_editing_key_bindings(
-    bindings: &mut KeyBindingsList,
-    char_filter: impl Fn(char) -> bool,
-) {
-    if char_filter('\n') {
-        bindings.binding("enter+<any modifier>", "insert newline");
-    }
-
-    bindings.binding("ctrl+h, backspace", "delete before cursor");
-    bindings.binding("ctrl+d, delete", "delete after cursor");
-    bindings.binding("ctrl+l", "clear editor contents");
-}
-
-fn list_editor_cursor_movement_key_bindings(bindings: &mut KeyBindingsList) {
-    bindings.binding("ctrl+b, ←", "move cursor left");
-    bindings.binding("ctrl+f, →", "move cursor right");
-    bindings.binding("alt+b, ctrl+←", "move cursor left a word");
-    bindings.binding("alt+f, ctrl+→", "move cursor right a word");
-    bindings.binding("ctrl+a, home", "move cursor to start of line");
-    bindings.binding("ctrl+e, end", "move cursor to end of line");
-    bindings.binding("↑/↓", "move cursor up/down");
-}
-
-pub fn list_editor_key_bindings(
-    bindings: &mut KeyBindingsList,
-    char_filter: impl Fn(char) -> bool,
-) {
-    list_editor_editing_key_bindings(bindings, char_filter);
-    bindings.empty();
-    list_editor_cursor_movement_key_bindings(bindings);
-}
-
-pub fn handle_editor_input_event(
-    editor: &EditorState,
-    terminal: &mut Terminal,
-    event: &InputEvent,
-    char_filter: impl Fn(char) -> bool,
-) -> bool {
-    match event {
-        // Enter with *any* modifier pressed - if ctrl and shift don't
-        // work, maybe alt does
-        key!(Enter) => return false,
-        InputEvent::Key(crate::ui::input::KeyEvent {
-            code: crossterm::event::KeyCode::Enter,
-            ..
-        }) if char_filter('\n') => editor.insert_char(terminal.widthdb(), '\n'),
-
-        // Editing
-        key!(Char ch) if char_filter(*ch) => editor.insert_char(terminal.widthdb(), *ch),
-        key!(Paste str) => {
-            // It seems that when pasting, '\n' are converted into '\r' for some
-            // reason. I don't really know why, or at what point this happens.
-            // Vim converts any '\r' pasted via the terminal into '\n', so I
-            // decided to mirror that behaviour.
-            let str = str.replace('\r', "\n");
-            if str.chars().all(char_filter) {
-                editor.insert_str(terminal.widthdb(), &str);
-            } else {
-                return false;
-            }
-        }
-        key!(Ctrl + 'h') | key!(Backspace) => editor.backspace(terminal.widthdb()),
-        key!(Ctrl + 'd') | key!(Delete) => editor.delete(),
-        key!(Ctrl + 'l') => editor.clear(),
-        // TODO Key bindings to delete words
-
-        // Cursor movement
-        key!(Ctrl + 'b') | key!(Left) => editor.move_cursor_left(terminal.widthdb()),
-        key!(Ctrl + 'f') | key!(Right) => editor.move_cursor_right(terminal.widthdb()),
-        key!(Alt + 'b') | key!(Ctrl + Left) => editor.move_cursor_left_a_word(terminal.widthdb()),
-        key!(Alt + 'f') | key!(Ctrl + Right) => editor.move_cursor_right_a_word(terminal.widthdb()),
-        key!(Ctrl + 'a') | key!(Home) => editor.move_cursor_to_start_of_line(terminal.widthdb()),
-        key!(Ctrl + 'e') | key!(End) => editor.move_cursor_to_end_of_line(terminal.widthdb()),
-        key!(Up) => editor.move_cursor_up(terminal.widthdb()),
-        key!(Down) => editor.move_cursor_down(terminal.widthdb()),
-
-        _ => return false,
-    }
-
-    true
-}
-
-pub fn list_editor_key_bindings_allowing_external_editing(
-    bindings: &mut KeyBindingsList,
-    char_filter: impl Fn(char) -> bool,
-) {
-    list_editor_editing_key_bindings(bindings, char_filter);
-    bindings.binding("ctrl+x", "edit in external editor");
-    bindings.empty();
-    list_editor_cursor_movement_key_bindings(bindings);
-}
-
-pub fn handle_editor_input_event_allowing_external_editing(
-    editor: &EditorState,
-    terminal: &mut Terminal,
-    crossterm_lock: &Arc<FairMutex<()>>,
-    event: &InputEvent,
-    char_filter: impl Fn(char) -> bool,
-) -> io::Result<bool> {
-    if let key!(Ctrl + 'x') = event {
-        editor.edit_externally(terminal, crossterm_lock)?;
-        Ok(true)
-    } else {
-        Ok(handle_editor_input_event(
-            editor,
-            terminal,
-            event,
-            char_filter,
-        ))
-    }
-}

src/ui/widgets.rs

@@ -1,39 +0,0 @@
-// Since the widget module is effectively a library and will probably be moved
-// to toss later, warnings about unused functions are mostly inaccurate.
-// TODO Restrict this a bit more?
-#![allow(dead_code)]
-
-pub mod background;
-pub mod border;
-pub mod cursor;
-pub mod editor;
-pub mod empty;
-pub mod float;
-pub mod join;
-pub mod layer;
-pub mod list;
-pub mod padding;
-pub mod popup;
-pub mod resize;
-pub mod rules;
-pub mod text;
-
-use async_trait::async_trait;
-use toss::frame::{Frame, Size};
-
-// TODO Add Error type and return Result-s (at least in Widget::render)
-
-#[async_trait]
-pub trait Widget {
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size;
-
-    async fn render(self: Box<Self>, frame: &mut Frame);
-}
-
-pub type BoxedWidget = Box<dyn Widget + Send>;
-
-impl<W: 'static + Widget + Send> From<W> for BoxedWidget {
-    fn from(widget: W) -> Self {
-        Box::new(widget)
-    }
-}

src/ui/widgets/background.rs

@@ -1,42 +0,0 @@
-use async_trait::async_trait;
-use crossterm::style::ContentStyle;
-use toss::frame::{Frame, Pos, Size};
-
-use super::{BoxedWidget, Widget};
-
-pub struct Background {
-    inner: BoxedWidget,
-    style: ContentStyle,
-}
-
-impl Background {
-    pub fn new<W: Into<BoxedWidget>>(inner: W) -> Self {
-        Self {
-            inner: inner.into(),
-            style: ContentStyle::default(),
-        }
-    }
-
-    pub fn style(mut self, style: ContentStyle) -> Self {
-        self.style = style;
-        self
-    }
-}
-
-#[async_trait]
-impl Widget for Background {
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size {
-        self.inner.size(frame, max_width, max_height)
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        let size = frame.size();
-        for dy in 0..size.height {
-            for dx in 0..size.width {
-                frame.write(Pos::new(dx.into(), dy.into()), (" ", self.style));
-            }
-        }
-
-        self.inner.render(frame).await;
-    }
-}

src/ui/widgets/border.rs

@@ -1,61 +0,0 @@
-use async_trait::async_trait;
-use crossterm::style::ContentStyle;
-use toss::frame::{Frame, Pos, Size};
-
-use super::{BoxedWidget, Widget};
-
-pub struct Border {
-    inner: BoxedWidget,
-    style: ContentStyle,
-}
-
-impl Border {
-    pub fn new<W: Into<BoxedWidget>>(inner: W) -> Self {
-        Self {
-            inner: inner.into(),
-            style: ContentStyle::default(),
-        }
-    }
-
-    pub fn style(mut self, style: ContentStyle) -> Self {
-        self.style = style;
-        self
-    }
-}
-
-#[async_trait]
-impl Widget for Border {
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size {
-        let max_width = max_width.map(|w| w.saturating_sub(2));
-        let max_height = max_height.map(|h| h.saturating_sub(2));
-        let size = self.inner.size(frame, max_width, max_height);
-        size + Size::new(2, 2)
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        let mut size = frame.size();
-        size.width = size.width.max(2);
-        size.height = size.height.max(2);
-
-        let right = size.width as i32 - 1;
-        let bottom = size.height as i32 - 1;
-        frame.write(Pos::new(0, 0), ("┌", self.style));
-        frame.write(Pos::new(right, 0), ("┐", self.style));
-        frame.write(Pos::new(0, bottom), ("└", self.style));
-        frame.write(Pos::new(right, bottom), ("┘", self.style));
-
-        for y in 1..bottom {
-            frame.write(Pos::new(0, y), ("│", self.style));
-            frame.write(Pos::new(right, y), ("│", self.style));
-        }
-
-        for x in 1..right {
-            frame.write(Pos::new(x, 0), ("─", self.style));
-            frame.write(Pos::new(x, bottom), ("─", self.style));
-        }
-
-        frame.push(Pos::new(1, 1), size - Size::new(2, 2));
-        self.inner.render(frame).await;
-        frame.pop();
-    }
-}

src/ui/widgets/cursor.rs

@@ -1,39 +0,0 @@
-use async_trait::async_trait;
-use toss::frame::{Frame, Pos, Size};
-
-use super::{BoxedWidget, Widget};
-
-pub struct Cursor {
-    inner: BoxedWidget,
-    pos: Pos,
-}
-
-impl Cursor {
-    pub fn new<W: Into<BoxedWidget>>(inner: W) -> Self {
-        Self {
-            inner: inner.into(),
-            pos: Pos::ZERO,
-        }
-    }
-
-    pub fn at(mut self, pos: Pos) -> Self {
-        self.pos = pos;
-        self
-    }
-
-    pub fn at_xy(self, x: i32, y: i32) -> Self {
-        self.at(Pos::new(x, y))
-    }
-}
-
-#[async_trait]
-impl Widget for Cursor {
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size {
-        self.inner.size(frame, max_width, max_height)
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        self.inner.render(frame).await;
-        frame.set_cursor(Some(self.pos));
-    }
-}

src/ui/widgets/editor.rs

@@ -1,566 +0,0 @@
-use std::sync::Arc;
-use std::{io, iter};
-
-use async_trait::async_trait;
-use crossterm::style::{ContentStyle, Stylize};
-use parking_lot::{FairMutex, Mutex};
-use toss::frame::{Frame, Pos, Size};
-use toss::styled::Styled;
-use toss::terminal::Terminal;
-use toss::widthdb::WidthDb;
-use unicode_segmentation::UnicodeSegmentation;
-
-use crate::ui::util;
-
-use super::text::Text;
-use super::Widget;
-
-/// Like [`WidthDb::wrap`] but includes a final break index if the text ends
-/// with a newline.
-fn wrap(widthdb: &mut WidthDb, text: &str, width: usize) -> Vec<usize> {
-    let mut breaks = widthdb.wrap(text, width);
-    if text.ends_with('\n') {
-        breaks.push(text.len())
-    }
-    breaks
-}
-
-///////////
-// State //
-///////////
-
-struct InnerEditorState {
-    text: String,
-
-    /// Index of the cursor in the text.
-    ///
-    /// Must point to a valid grapheme boundary.
-    idx: usize,
-
-    /// Column of the cursor on the screen just after it was last moved
-    /// horizontally.
-    col: usize,
-
-    /// Width of the text when the editor was last rendered.
-    ///
-    /// Does not include additional column for cursor.
-    last_width: u16,
-}
-
-impl InnerEditorState {
-    fn new(text: String) -> Self {
-        Self {
-            idx: text.len(),
-            col: 0,
-            last_width: u16::MAX,
-            text,
-        }
-    }
-
-    ///////////////////////////////
-    // Grapheme helper functions //
-    ///////////////////////////////
-
-    fn grapheme_boundaries(&self) -> Vec<usize> {
-        self.text
-            .grapheme_indices(true)
-            .map(|(i, _)| i)
-            .chain(iter::once(self.text.len()))
-            .collect()
-    }
-
-    /// Ensure the cursor index lies on a grapheme boundary. If it doesn't, it
-    /// is moved to the next grapheme boundary.
-    ///
-    /// Can handle arbitrary cursor index.
-    fn move_cursor_to_grapheme_boundary(&mut self) {
-        for i in self.grapheme_boundaries() {
-            #[allow(clippy::comparison_chain)]
-            if i == self.idx {
-                // We're at a valid grapheme boundary already
-                return;
-            } else if i > self.idx {
-                // There was no valid grapheme boundary at our cursor index, so
-                // we'll take the next one we can get.
-                self.idx = i;
-                return;
-            }
-        }
-
-        // The cursor was out of bounds, so move it to the last valid index.
-        self.idx = self.text.len();
-    }
-
-    ///////////////////////////////
-    // Line/col helper functions //
-    ///////////////////////////////
-
-    /// Like [`Self::grapheme_boundaries`] but for lines.
-    ///
-    /// Note that the last line can have a length of 0 if the text ends with a
-    /// newline.
-    fn line_boundaries(&self) -> Vec<usize> {
-        let newlines = self
-            .text
-            .char_indices()
-            .filter(|(_, c)| *c == '\n')
-            .map(|(i, _)| i + 1); // utf-8 encodes '\n' as a single byte
-        iter::once(0)
-            .chain(newlines)
-            .chain(iter::once(self.text.len()))
-            .collect()
-    }
-
-    /// Find the cursor's current line.
-    ///
-    /// Returns `(line_nr, start_idx, end_idx)`.
-    fn cursor_line(&self, boundaries: &[usize]) -> (usize, usize, usize) {
-        let mut result = (0, 0, 0);
-        for (i, (start, end)) in boundaries.iter().zip(boundaries.iter().skip(1)).enumerate() {
-            if self.idx >= *start {
-                result = (i, *start, *end);
-            } else {
-                break;
-            }
-        }
-        result
-    }
-
-    fn cursor_col(&self, widthdb: &mut WidthDb, line_start: usize) -> usize {
-        widthdb.width(&self.text[line_start..self.idx])
-    }
-
-    fn line(&self, line: usize) -> (usize, usize) {
-        let boundaries = self.line_boundaries();
-        boundaries
-            .iter()
-            .copied()
-            .zip(boundaries.iter().copied().skip(1))
-            .nth(line)
-            .expect("line exists")
-    }
-
-    fn move_cursor_to_line_col(&mut self, widthdb: &mut WidthDb, line: usize, col: usize) {
-        let (start, end) = self.line(line);
-        let line = &self.text[start..end];
-
-        let mut width = 0;
-        for (gi, g) in line.grapheme_indices(true) {
-            self.idx = start + gi;
-            if col > width {
-                width += widthdb.grapheme_width(g, width) as usize;
-            } else {
-                return;
-            }
-        }
-
-        if !line.ends_with('\n') {
-            self.idx = end;
-        }
-    }
-
-    fn record_cursor_col(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.line_boundaries();
-        let (_, start, _) = self.cursor_line(&boundaries);
-        self.col = self.cursor_col(widthdb, start);
-    }
-
-    /////////////
-    // Editing //
-    /////////////
-
-    fn clear(&mut self) {
-        self.text = String::new();
-        self.idx = 0;
-        self.col = 0;
-    }
-
-    fn set_text(&mut self, widthdb: &mut WidthDb, text: String) {
-        self.text = text;
-        self.move_cursor_to_grapheme_boundary();
-        self.record_cursor_col(widthdb);
-    }
-
-    /// Insert a character at the current cursor position and move the cursor
-    /// accordingly.
-    fn insert_char(&mut self, widthdb: &mut WidthDb, ch: char) {
-        self.text.insert(self.idx, ch);
-        self.idx += ch.len_utf8();
-        self.record_cursor_col(widthdb);
-    }
-
-    /// Insert a string at the current cursor position and move the cursor
-    /// accordingly.
-    fn insert_str(&mut self, widthdb: &mut WidthDb, str: &str) {
-        self.text.insert_str(self.idx, str);
-        self.idx += str.len();
-        self.record_cursor_col(widthdb);
-    }
-
-    /// Delete the grapheme before the cursor position.
-    fn backspace(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.grapheme_boundaries();
-        for (start, end) in boundaries.iter().zip(boundaries.iter().skip(1)) {
-            if *end == self.idx {
-                self.text.replace_range(start..end, "");
-                self.idx = *start;
-                self.record_cursor_col(widthdb);
-                break;
-            }
-        }
-    }
-
-    /// Delete the grapheme after the cursor position.
-    fn delete(&mut self) {
-        let boundaries = self.grapheme_boundaries();
-        for (start, end) in boundaries.iter().zip(boundaries.iter().skip(1)) {
-            if *start == self.idx {
-                self.text.replace_range(start..end, "");
-                break;
-            }
-        }
-    }
-
-    /////////////////////
-    // Cursor movement //
-    /////////////////////
-
-    fn move_cursor_left(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.grapheme_boundaries();
-        for (start, end) in boundaries.iter().zip(boundaries.iter().skip(1)) {
-            if *end == self.idx {
-                self.idx = *start;
-                self.record_cursor_col(widthdb);
-                break;
-            }
-        }
-    }
-
-    fn move_cursor_right(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.grapheme_boundaries();
-        for (start, end) in boundaries.iter().zip(boundaries.iter().skip(1)) {
-            if *start == self.idx {
-                self.idx = *end;
-                self.record_cursor_col(widthdb);
-                break;
-            }
-        }
-    }
-
-    fn move_cursor_left_a_word(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.grapheme_boundaries();
-        let mut encountered_word = false;
-        for (start, end) in boundaries.iter().zip(boundaries.iter().skip(1)).rev() {
-            if *end == self.idx {
-                let g = &self.text[*start..*end];
-                let whitespace = g.chars().all(|c| c.is_whitespace());
-                if encountered_word && whitespace {
-                    break;
-                } else if !whitespace {
-                    encountered_word = true;
-                }
-                self.idx = *start;
-            }
-        }
-        self.record_cursor_col(widthdb);
-    }
-
-    fn move_cursor_right_a_word(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.grapheme_boundaries();
-        let mut encountered_word = false;
-        for (start, end) in boundaries.iter().zip(boundaries.iter().skip(1)) {
-            if *start == self.idx {
-                let g = &self.text[*start..*end];
-                let whitespace = g.chars().all(|c| c.is_whitespace());
-                if encountered_word && whitespace {
-                    break;
-                } else if !whitespace {
-                    encountered_word = true;
-                }
-                self.idx = *end;
-            }
-        }
-        self.record_cursor_col(widthdb);
-    }
-
-    fn move_cursor_to_start_of_line(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.line_boundaries();
-        let (line, _, _) = self.cursor_line(&boundaries);
-        self.move_cursor_to_line_col(widthdb, line, 0);
-        self.record_cursor_col(widthdb);
-    }
-
-    fn move_cursor_to_end_of_line(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.line_boundaries();
-        let (line, _, _) = self.cursor_line(&boundaries);
-        self.move_cursor_to_line_col(widthdb, line, usize::MAX);
-        self.record_cursor_col(widthdb);
-    }
-
-    fn move_cursor_up(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.line_boundaries();
-        let (line, _, _) = self.cursor_line(&boundaries);
-        if line > 0 {
-            self.move_cursor_to_line_col(widthdb, line - 1, self.col);
-        }
-    }
-
-    fn move_cursor_down(&mut self, widthdb: &mut WidthDb) {
-        let boundaries = self.line_boundaries();
-
-        // There's always at least one line, and always at least two line
-        // boundaries at 0 and self.text.len().
-        let amount_of_lines = boundaries.len() - 1;
-
-        let (line, _, _) = self.cursor_line(&boundaries);
-        if line + 1 < amount_of_lines {
-            self.move_cursor_to_line_col(widthdb, line + 1, self.col);
-        }
-    }
-}
-
-pub struct EditorState(Arc<Mutex<InnerEditorState>>);
-
-impl EditorState {
-    pub fn new() -> Self {
-        Self(Arc::new(Mutex::new(InnerEditorState::new(String::new()))))
-    }
-
-    pub fn with_initial_text(text: String) -> Self {
-        Self(Arc::new(Mutex::new(InnerEditorState::new(text))))
-    }
-
-    pub fn widget(&self) -> Editor {
-        let guard = self.0.lock();
-        let text = Styled::new_plain(guard.text.clone());
-        let idx = guard.idx;
-        Editor {
-            state: self.0.clone(),
-            text,
-            idx,
-            focus: true,
-            hidden: None,
-        }
-    }
-
-    pub fn text(&self) -> String {
-        self.0.lock().text.clone()
-    }
-
-    pub fn clear(&self) {
-        self.0.lock().clear();
-    }
-
-    pub fn set_text(&self, widthdb: &mut WidthDb, text: String) {
-        self.0.lock().set_text(widthdb, text);
-    }
-
-    pub fn insert_char(&self, widthdb: &mut WidthDb, ch: char) {
-        self.0.lock().insert_char(widthdb, ch);
-    }
-
-    pub fn insert_str(&self, widthdb: &mut WidthDb, str: &str) {
-        self.0.lock().insert_str(widthdb, str);
-    }
-
-    /// Delete the grapheme before the cursor position.
-    pub fn backspace(&self, widthdb: &mut WidthDb) {
-        self.0.lock().backspace(widthdb);
-    }
-
-    /// Delete the grapheme after the cursor position.
-    pub fn delete(&self) {
-        self.0.lock().delete();
-    }
-
-    pub fn move_cursor_left(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_left(widthdb);
-    }
-
-    pub fn move_cursor_right(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_right(widthdb);
-    }
-
-    pub fn move_cursor_left_a_word(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_left_a_word(widthdb);
-    }
-
-    pub fn move_cursor_right_a_word(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_right_a_word(widthdb);
-    }
-
-    pub fn move_cursor_to_start_of_line(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_to_start_of_line(widthdb);
-    }
-
-    pub fn move_cursor_to_end_of_line(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_to_end_of_line(widthdb);
-    }
-
-    pub fn move_cursor_up(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_up(widthdb);
-    }
-
-    pub fn move_cursor_down(&self, widthdb: &mut WidthDb) {
-        self.0.lock().move_cursor_down(widthdb);
-    }
-
-    pub fn edit_externally(
-        &self,
-        terminal: &mut Terminal,
-        crossterm_lock: &Arc<FairMutex<()>>,
-    ) -> io::Result<()> {
-        let mut guard = self.0.lock();
-        let text = util::prompt(terminal, crossterm_lock, &guard.text)?;
-
-        if text.trim().is_empty() {
-            // The user likely wanted to abort the edit and has deleted the
-            // entire text (bar whitespace left over by some editors).
-            return Ok(());
-        }
-
-        if let Some(text) = text.strip_suffix('\n') {
-            // Some editors like vim add a trailing newline that would look out
-            // of place in cove's editor. To intentionally add a trailing
-            // newline, simply add two in-editor.
-            guard.set_text(terminal.widthdb(), text.to_string());
-        } else {
-            guard.set_text(terminal.widthdb(), text);
-        }
-
-        Ok(())
-    }
-}
-
-////////////
-// Widget //
-////////////
-
-pub struct Editor {
-    state: Arc<Mutex<InnerEditorState>>,
-    text: Styled,
-    idx: usize,
-    focus: bool,
-    hidden: Option<Box<Text>>,
-}
-
-impl Editor {
-    pub fn highlight<F>(mut self, f: F) -> Self
-    where
-        F: FnOnce(&str) -> Styled,
-    {
-        let new_text = f(self.text.text());
-        assert_eq!(self.text.text(), new_text.text());
-        self.text = new_text;
-        self
-    }
-
-    pub fn focus(mut self, active: bool) -> Self {
-        self.focus = active;
-        self
-    }
-
-    pub fn hidden(self) -> Self {
-        self.hidden_with_placeholder(("<hidden>", ContentStyle::default().grey().italic()))
-    }
-
-    pub fn hidden_with_placeholder<S: Into<Styled>>(mut self, placeholder: S) -> Self {
-        self.hidden = Some(Box::new(Text::new(placeholder)));
-        self
-    }
-
-    fn wrapped_cursor(cursor_idx: usize, break_indices: &[usize]) -> (usize, usize) {
-        let mut row = 0;
-        let mut line_idx = cursor_idx;
-
-        for break_idx in break_indices {
-            if cursor_idx < *break_idx {
-                break;
-            } else {
-                row += 1;
-                line_idx = cursor_idx - break_idx;
-            }
-        }
-
-        (row, line_idx)
-    }
-
-    pub fn cursor_row(&self, widthdb: &mut WidthDb) -> usize {
-        let width = self.state.lock().last_width;
-        let text_width = (width - 1) as usize;
-        let indices = wrap(widthdb, self.text.text(), text_width);
-        let (row, _) = Self::wrapped_cursor(self.idx, &indices);
-        row
-    }
-}
-
-#[async_trait]
-impl Widget for Editor {
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size {
-        if let Some(placeholder) = &self.hidden {
-            let mut size = placeholder.size(frame, max_width, max_height);
-
-            // Cursor needs to fit regardless of focus
-            size.width = size.width.max(1);
-            size.height = size.height.max(1);
-
-            return size;
-        }
-
-        let widthdb = frame.widthdb();
-
-        let max_width = max_width.map(|w| w as usize).unwrap_or(usize::MAX).max(1);
-        let max_text_width = max_width - 1;
-        let indices = wrap(widthdb, self.text.text(), max_text_width);
-        let lines = self.text.clone().split_at_indices(&indices);
-
-        let min_width = lines
-            .iter()
-            .map(|l| widthdb.width(l.text().trim_end()))
-            .max()
-            .unwrap_or(0)
-            + 1;
-        let min_height = lines.len();
-        Size::new(min_width as u16, min_height as u16)
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        if let Some(placeholder) = self.hidden {
-            if !self.text.text().is_empty() {
-                placeholder.render(frame).await;
-            }
-            if self.focus {
-                frame.set_cursor(Some(Pos::ZERO));
-            }
-            return;
-        }
-
-        let size = frame.size();
-        let widthdb = frame.widthdb();
-
-        let width = size.width.max(1);
-        let text_width = (width - 1) as usize;
-        let indices = wrap(widthdb, self.text.text(), text_width);
-        let lines = self.text.split_at_indices(&indices);
-
-        // Determine cursor position now while we still have the lines.
-        let cursor_pos = if self.focus {
-            let (cursor_row, cursor_line_idx) = Self::wrapped_cursor(self.idx, &indices);
-            let cursor_col = widthdb.width(lines[cursor_row].text().split_at(cursor_line_idx).0);
-            let cursor_col = cursor_col.min(text_width);
-            Some(Pos::new(cursor_col as i32, cursor_row as i32))
-        } else {
-            None
-        };
-
-        for (i, line) in lines.into_iter().enumerate() {
-            frame.write(Pos::new(0, i as i32), line);
-        }
-
-        if let Some(pos) = cursor_pos {
-            frame.set_cursor(Some(pos));
-        }
-
-        self.state.lock().last_width = width;
-    }
-}

src/ui/widgets/empty.rs

@@ -1,39 +0,0 @@
-use async_trait::async_trait;
-use toss::frame::{Frame, Size};
-
-use super::Widget;
-
-#[derive(Debug, Default, Clone, Copy)]
-pub struct Empty {
-    size: Size,
-}
-
-impl Empty {
-    pub fn new() -> Self {
-        Self { size: Size::ZERO }
-    }
-
-    pub fn width(mut self, width: u16) -> Self {
-        self.size.width = width;
-        self
-    }
-
-    pub fn height(mut self, height: u16) -> Self {
-        self.size.height = height;
-        self
-    }
-
-    pub fn size(mut self, size: Size) -> Self {
-        self.size = size;
-        self
-    }
-}
-
-#[async_trait]
-impl Widget for Empty {
-    fn size(&self, _frame: &mut Frame, _max_width: Option<u16>, _max_height: Option<u16>) -> Size {
-        self.size
-    }
-
-    async fn render(self: Box<Self>, _frame: &mut Frame) {}
-}

src/ui/widgets/float.rs

@@ -1,65 +0,0 @@
-use async_trait::async_trait;
-use toss::frame::{Frame, Pos, Size};
-
-use super::{BoxedWidget, Widget};
-
-pub struct Float {
-    inner: BoxedWidget,
-    horizontal: Option<f32>,
-    vertical: Option<f32>,
-}
-
-impl Float {
-    pub fn new<W: Into<BoxedWidget>>(inner: W) -> Self {
-        Self {
-            inner: inner.into(),
-            horizontal: None,
-            vertical: None,
-        }
-    }
-
-    pub fn horizontal(mut self, position: f32) -> Self {
-        self.horizontal = Some(position);
-        self
-    }
-
-    pub fn vertical(mut self, position: f32) -> Self {
-        self.vertical = Some(position);
-        self
-    }
-}
-
-#[async_trait]
-impl Widget for Float {
-    fn size(&self, frame: &mut Frame, max_width: Option<u16>, max_height: Option<u16>) -> Size {
-        self.inner.size(frame, max_width, max_height)
-    }
-
-    async fn render(self: Box<Self>, frame: &mut Frame) {
-        let size = frame.size();
-
-        let mut inner_size = self.inner.size(frame, Some(size.width), Some(size.height));
-        inner_size.width = inner_size.width.min(size.width);
-        inner_size.height = inner_size.height.min(size.height);
-
-        let mut inner_pos = Pos::ZERO;
-
-        if let Some(horizontal) = self.horizontal {
-            let available = (size.width - inner_size.width) as f32;
-            // Biased towards the left if horizontal lands exactly on the
-            // boundary between two cells
-            inner_pos.x = (horizontal * available).floor().min(available) as i32;
-        }
-
-        if let Some(vertical) = self.vertical {
-            let available = (size.height - inner_size.height) as f32;
-            // Biased towards the top if vertical lands exactly on the boundary
-            // between two cells
-            inner_pos.y = (vertical * available).floor().min(available) as i32;
-        }
-
-        frame.push(inner_pos, inner_size);
-        self.inner.render(frame).await;
-        frame.pop();
-    }
-}